diff --git a/include/main.php b/include/main.php index 68ffb84..3ced801 100644 --- a/include/main.php +++ b/include/main.php @@ -43,4 +43,14 @@ switch($type){ \gp\tool\Plugins::Action('PageCreated'); +if (session_status() == PHP_SESSION_NONE) { + error_log("No active session detected. Attempting session_start()..."); + if (!session_start()) { + error_log("session_start() FAILED."); + die("Session could not be started."); + } else { + error_log("session_start() SUCCEEDED. Session ID: " . session_id()); + } + } + \gp\tool\Output::RunOut(); diff --git a/include/thirdparty/elFinder/js/elfinder.full.js b/include/thirdparty/elFinder/js/elfinder.full.js index 8479206..eac5205 100644 --- a/include/thirdparty/elFinder/js/elfinder.full.js +++ b/include/thirdparty/elFinder/js/elfinder.full.js @@ -20423,7 +20423,7 @@ $.fn.elfindersearchbutton = function(cmd) { typeSet.append($('')); }); } - opts.find('div.buttonset').buttonset(); + opts.find('div.buttonset').controlgroup(); $('#'+id('SearchFromAll')).next('label').attr('title', fm.i18n('searchTarget', fm.i18n('btnAll'))); if (sTypes) { $.each(sTypes, function(i, v) { diff --git a/include/thirdparty/elFinder/js/elfinder.min.js b/include/thirdparty/elFinder/js/elfinder.min.js index c66f915..d30c981 100644 --- a/include/thirdparty/elFinder/js/elfinder.min.js +++ b/include/thirdparty/elFinder/js/elfinder.min.js @@ -15,7 +15,7 @@ var t=n.root(this),i=n.file(this);i&&(i.sizeInfo||"directory"!==i.mime)?d.push(e errCopyTo:'Copying files to volume "$1" not allowed.',errMkOutLink:"Unable to create a link to outside the volume root.",errUpload:"Upload error.",errUploadFile:'Unable to upload "$1".',errUploadNoFiles:"No files found for upload.",errUploadTotalSize:"Data exceeds the maximum allowed size.",errUploadFileSize:"File exceeds maximum allowed size.",errUploadMime:"File type not allowed.",errUploadTransfer:'"$1" transfer error.',errUploadTemp:"Unable to make temporary file for upload.",errNotReplace:'Object "$1" already exists at this location and can not be replaced by object with another type.',errReplace:'Unable to replace "$1".',errSave:'Unable to save "$1".',errCopy:'Unable to copy "$1".',errMove:'Unable to move "$1".',errCopyInItself:'Unable to copy "$1" into itself.',errRm:'Unable to remove "$1".',errTrash:"Unable into trash.",errRmSrc:"Unable remove source file(s).",errExtract:'Unable to extract files from "$1".',errArchive:"Unable to create archive.",errArcType:"Unsupported archive type.",errNoArchive:"File is not archive or has unsupported archive type.",errCmdNoSupport:"Backend does not support this command.",errReplByChild:'The folder "$1" can\'t be replaced by an item it contains.',errArcSymlinks:"For security reason denied to unpack archives contains symlinks or files with not allowed names.",errArcMaxSize:"Archive files exceeds maximum allowed size.",errResize:'Unable to resize "$1".',errResizeDegree:"Invalid rotate degree.",errResizeRotate:"Unable to rotate image.",errResizeSize:"Invalid image size.",errResizeNoChange:"Image size not changed.",errUsupportType:"Unsupported file type.",errNotUTF8Content:'File "$1" is not in UTF-8 and cannot be edited.',errNetMount:'Unable to mount "$1".',errNetMountNoDriver:"Unsupported protocol.",errNetMountFailed:"Mount failed.",errNetMountHostReq:"Host required.",errSessionExpires:"Your session has expired due to inactivity.",errCreatingTempDir:'Unable to create temporary directory: "$1"',errFtpDownloadFile:'Unable to download file from FTP: "$1"',errFtpUploadFile:'Unable to upload file to FTP: "$1"',errFtpMkdir:'Unable to create remote directory on FTP: "$1"',errArchiveExec:'Error while archiving files: "$1"',errExtractExec:'Error while extracting files: "$1"',errNetUnMount:"Unable to unmount.",errConvUTF8:"Not convertible to UTF-8",errFolderUpload:"Try the modern browser, If you'd like to upload the folder.",errSearchTimeout:'Timed out while searching "$1". Search result is partial.',errReauthRequire:"Re-authorization is required.",errMaxTargets:"Max number of selectable items is $1.",errRestore:"Unable to restore from the trash. Can't identify the restore destination.",errEditorNotFound:"Editor not found to this file type.",errServerError:"Error occurred on the server side.",errEmpty:'Unable to empty folder "$1".',moreErrors:"There are $1 more errors.",errMaxMkdirs:"You can create up to $1 folders at one time.",cmdarchive:"Create archive",cmdback:"Back",cmdcopy:"Copy",cmdcut:"Cut",cmddownload:"Download",cmdduplicate:"Duplicate",cmdedit:"Edit file",cmdextract:"Extract files from archive",cmdforward:"Forward",cmdgetfile:"Select files",cmdhelp:"About this software",cmdhome:"Root",cmdinfo:"Get info",cmdmkdir:"New folder",cmdmkdirin:"Into New Folder",cmdmkfile:"New file",cmdopen:"Open",cmdpaste:"Paste",cmdquicklook:"Preview",cmdreload:"Reload",cmdrename:"Rename",cmdrm:"Delete",cmdtrash:"Into trash",cmdrestore:"Restore",cmdsearch:"Find files",cmdup:"Go to parent folder",cmdupload:"Upload files",cmdview:"View",cmdresize:"Resize & Rotate",cmdsort:"Sort",cmdnetmount:"Mount network volume",cmdnetunmount:"Unmount",cmdplaces:"To Places",cmdchmod:"Change mode",cmdopendir:"Open a folder",cmdcolwidth:"Reset column width",cmdfullscreen:"Full Screen",cmdmove:"Move",cmdempty:"Empty the folder",cmdundo:"Undo",cmdredo:"Redo",cmdpreference:"Preferences",cmdselectall:"Select all",cmdselectnone:"Select none",cmdselectinvert:"Invert selection",cmdopennew:"Open in new window",cmdhide:"Hide (Preference)",btnClose:"Close",btnSave:"Save",btnRm:"Remove",btnApply:"Apply",btnCancel:"Cancel",btnNo:"No",btnYes:"Yes",btnMount:"Mount",btnApprove:"Goto $1 & approve",btnUnmount:"Unmount",btnConv:"Convert",btnCwd:"Here",btnVolume:"Volume",btnAll:"All",btnMime:"MIME Type",btnFileName:"Filename",btnSaveClose:"Save & Close",btnBackup:"Backup",btnRename:"Rename",btnRenameAll:"Rename(All)",btnPrevious:"Prev ($1/$2)",btnNext:"Next ($1/$2)",btnSaveAs:"Save As",ntfopen:"Open folder",ntffile:"Open file",ntfreload:"Reload folder content",ntfmkdir:"Creating folder",ntfmkfile:"Creating files",ntfrm:"Delete items",ntfcopy:"Copy items",ntfmove:"Move items",ntfprepare:"Checking existing items",ntfrename:"Rename files",ntfupload:"Uploading files",ntfdownload:"Downloading files",ntfsave:"Save files",ntfarchive:"Creating archive",ntfextract:"Extracting files from archive",ntfsearch:"Searching files",ntfresize:"Resizing images",ntfsmth:"Doing something",ntfloadimg:"Loading image",ntfnetmount:"Mounting network volume",ntfnetunmount:"Unmounting network volume",ntfdim:"Acquiring image dimension",ntfreaddir:"Reading folder infomation",ntfurl:"Getting URL of link",ntfchmod:"Changing file mode",ntfpreupload:"Verifying upload file name",ntfzipdl:"Creating a file for download",ntfparents:"Getting path infomation",ntfchunkmerge:"Processing the uploaded file",ntftrash:"Doing throw in the trash",ntfrestore:"Doing restore from the trash",ntfchkdir:"Checking destination folder",ntfundo:"Undoing previous operation",ntfredo:"Redoing previous undone",ntfchkcontent:"Checking contents",volume_Trash:"Trash",dateUnknown:"unknown",Today:"Today",Yesterday:"Yesterday",msJan:"Jan",msFeb:"Feb",msMar:"Mar",msApr:"Apr",msMay:"May",msJun:"Jun",msJul:"Jul",msAug:"Aug",msSep:"Sep",msOct:"Oct",msNov:"Nov",msDec:"Dec",January:"January",February:"February",March:"March",April:"April",May:"May",June:"June",July:"July",August:"August",September:"September",October:"October",November:"November",December:"December",Sunday:"Sunday",Monday:"Monday",Tuesday:"Tuesday",Wednesday:"Wednesday",Thursday:"Thursday",Friday:"Friday",Saturday:"Saturday",Sun:"Sun",Mon:"Mon",Tue:"Tue",Wed:"Wed",Thu:"Thu",Fri:"Fri",Sat:"Sat",sortname:"by name",sortkind:"by kind",sortsize:"by size",sortdate:"by date",sortFoldersFirst:"Folders first",sortperm:"by permission",sortmode:"by mode",sortowner:"by owner",sortgroup:"by group",sortAlsoTreeview:"Also Treeview","untitled file.txt":"NewFile.txt","untitled folder":"NewFolder",Archive:"NewArchive","untitled file":"NewFile.$1",extentionfile:"$1: File",extentiontype:"$1: $2",confirmReq:"Confirmation required",confirmRm:"Are you sure you want to permanently remove items?
This cannot be undone!",confirmRepl:"Replace old file with new one? (If it contains folders, it will be merged. To backup and replace, select Backup.)",confirmRest:"Replace existing item with the item in trash?",confirmConvUTF8:"Not in UTF-8
Convert to UTF-8?
Contents become UTF-8 by saving after conversion.",confirmNonUTF8:"Character encoding of this file couldn't be detected. It need to temporarily convert to UTF-8 for editting.
Please select character encoding of this file.",confirmNotSave:"It has been modified.
Losing work if you do not save changes.",confirmTrash:"Are you sure you want to move items to trash bin?",confirmMove:'Are you sure you want to move items to "$1"?',apllyAll:"Apply to all",name:"Name",size:"Size",perms:"Permissions",modify:"Modified",kind:"Kind",read:"read",write:"write",noaccess:"no access",and:"and",unknown:"unknown",selectall:"Select all items",selectfiles:"Select item(s)",selectffile:"Select first item",selectlfile:"Select last item",viewlist:"List view",viewicons:"Icons view",viewSmall:"Small icons",viewMedium:"Medium icons",viewLarge:"Large icons",viewExtraLarge:"Extra large icons",places:"Places",calc:"Calculate",path:"Path",aliasfor:"Alias for",locked:"Locked",dim:"Dimensions",files:"Files",folders:"Folders",items:"Items",yes:"yes",no:"no",link:"Link",searcresult:"Search results",selected:"selected items",about:"About",shortcuts:"Shortcuts",help:"Help",webfm:"Web file manager",ver:"Version",protocolver:"protocol version",homepage:"Project home",docs:"Documentation",github:"Fork us on GitHub",twitter:"Follow us on Twitter",facebook:"Join us on Facebook",team:"Team",chiefdev:"chief developer",developer:"developer",contributor:"contributor",maintainer:"maintainer",translator:"translator",icons:"Icons",dontforget:"and don't forget to take your towel",shortcutsof:"Shortcuts disabled",dropFiles:"Drop files here",or:"or",selectForUpload:"Select files",moveFiles:"Move items",copyFiles:"Copy items",restoreFiles:"Restore items",rmFromPlaces:"Remove from places",aspectRatio:"Aspect ratio",scale:"Scale",width:"Width",height:"Height",resize:"Resize",crop:"Crop",rotate:"Rotate","rotate-cw":"Rotate 90 degrees CW","rotate-ccw":"Rotate 90 degrees CCW",degree:"°",netMountDialogTitle:"Mount network volume",protocol:"Protocol",host:"Host",port:"Port",user:"User",pass:"Password",confirmUnmount:"Are you sure to unmount $1?",dropFilesBrowser:"Drop or Paste files from browser",dropPasteFiles:"Drop files, Paste URLs or images(clipboard) here",encoding:"Encoding",locale:"Locale",searchTarget:"Target: $1",searchMime:"Search by input MIME Type",owner:"Owner",group:"Group",other:"Other",execute:"Execute",perm:"Permission",mode:"Mode",emptyFolder:"Folder is empty",emptyFolderDrop:"Folder is empty\\A Drop to add items",emptyFolderLTap:"Folder is empty\\A Long tap to add items",quality:"Quality",autoSync:"Auto sync",moveUp:"Move up",getLink:"Get URL link",selectedItems:"Selected items ($1)",folderId:"Folder ID",offlineAccess:"Allow offline access",reAuth:"To re-authenticate",nowLoading:"Now loading...",openMulti:"Open multiple files",openMultiConfirm:"You are trying to open the $1 files. Are you sure you want to open in browser?",emptySearch:"Search results is empty in search target.",editingFile:"It is editing a file.",hasSelected:"You have selected $1 items.",hasClipboard:"You have $1 items in the clipboard.",incSearchOnly:"Incremental search is only from the current view.",reinstate:"Reinstate",complete:"$1 complete",contextmenu:"Context menu",pageTurning:"Page turning",volumeRoots:"Volume roots",reset:"Reset",bgcolor:"Background color",colorPicker:"Color picker","8pxgrid":"8px Grid",enabled:"Enabled",disabled:"Disabled",emptyIncSearch:"Search results is empty in current view.\\A Press [Enter] to expand search target.",emptyLetSearch:"First letter search results is empty in current view.",textLabel:"Text label",minsLeft:"$1 mins left",openAsEncoding:"Reopen with selected encoding",saveAsEncoding:"Save with the selected encoding",selectFolder:"Select folder",firstLetterSearch:"First letter search",presets:"Presets",tooManyToTrash:"It's too many items so it can't into trash.",TextArea:"TextArea",folderToEmpty:'Empty the folder "$1".',filderIsEmpty:'There are no items in a folder "$1".',preference:"Preference",language:"Language",clearBrowserData:"Initialize the settings saved in this browser",toolbarPref:"Toolbar settings",charsLeft:"... $1 chars left.",linesLeft:"... $1 lines left.",sum:"Sum",roughFileSize:"Rough file size",autoFocusDialog:"Focus on the element of dialog with mouseover",select:"Select",selectAction:"Action when select file",useStoredEditor:"Open with the editor used last time",selectinvert:"Invert selection",renameMultiple:"Are you sure you want to rename $1 selected items like $2?
This cannot be undone!",batchRename:"Batch rename",plusNumber:"+ Number",asPrefix:"Add prefix",asSuffix:"Add suffix",changeExtention:"Change extention",columnPref:"Columns settings (List view)",reflectOnImmediate:"All changes will reflect immediately to the archive.",reflectOnUnmount:"Any changes will not reflect until un-mount this volume.",unmountChildren:"The following volume(s) mounted on this volume also unmounted. Are you sure to unmount it?",selectionInfo:"Selection Info",hashChecker:"Algorithms to show the file hash",infoItems:"Info Items (Selection Info Panel)",pressAgainToExit:"Press again to exit.",toolbar:"Toolbar",workspace:"Work Space",dialog:"Dialog",all:"All",iconSize:"Icon Size (Icons view)",editorMaximized:"Open the maximized editor window",editorConvNoApi:"Because conversion by API is not currently available, please convert on the website.",editorConvNeedUpload:"After conversion, you must be upload with the item URL or a downloaded file to save the converted file.",convertOn:"Convert on the site of $1",integrations:"Integrations",integrationWith:"This elFinder has the following external services integrated. Please check the terms of use, privacy policy, etc. before using it.",showHidden:"Show hidden items",hideHidden:"Hide hidden items",toggleHidden:"Show/Hide hidden items",makefileTypes:'File types to enable with "New file"',typeOfTextfile:"Type of the Text file",add:"Add",theme:"Theme","default":"Default",description:"Description",website:"Website",author:"Author",email:"Email",license:"License",exportToSave:"This item can't be saved. To avoid losing the edits you need to export to your PC.",dblclickToSelect:"Double click on the file to select it.",useFullscreen:"Use fullscreen mode",kindUnknown:"Unknown",kindRoot:"Volume Root",kindFolder:"Folder",kindSelects:"Selections",kindAlias:"Alias",kindAliasBroken:"Broken alias",kindApp:"Application",kindPostscript:"Postscript document",kindMsOffice:"Microsoft Office document",kindMsWord:"Microsoft Word document",kindMsExcel:"Microsoft Excel document",kindMsPP:"Microsoft Powerpoint presentation",kindOO:"Open Office document",kindAppFlash:"Flash application",kindPDF:"Portable Document Format (PDF)",kindTorrent:"Bittorrent file",kind7z:"7z archive",kindTAR:"TAR archive",kindGZIP:"GZIP archive",kindBZIP:"BZIP archive",kindXZ:"XZ archive",kindZIP:"ZIP archive",kindRAR:"RAR archive",kindJAR:"Java JAR file",kindTTF:"True Type font",kindOTF:"Open Type font",kindRPM:"RPM package",kindText:"Text document",kindTextPlain:"Plain text",kindPHP:"PHP source",kindCSS:"Cascading style sheet",kindHTML:"HTML document",kindJS:"Javascript source",kindRTF:"Rich Text Format",kindC:"C source",kindCHeader:"C header source",kindCPP:"C++ source",kindCPPHeader:"C++ header source",kindShell:"Unix shell script",kindPython:"Python source",kindJava:"Java source",kindRuby:"Ruby source",kindPerl:"Perl script",kindSQL:"SQL source",kindXML:"XML document",kindAWK:"AWK source",kindCSV:"Comma separated values",kindDOCBOOK:"Docbook XML document",kindMarkdown:"Markdown text",kindImage:"Image",kindBMP:"BMP image",kindJPEG:"JPEG image",kindGIF:"GIF Image",kindPNG:"PNG Image",kindTIFF:"TIFF image",kindTGA:"TGA image",kindPSD:"Adobe Photoshop image",kindXBITMAP:"X bitmap image",kindPXM:"Pixelmator image",kindAudio:"Audio media",kindAudioMPEG:"MPEG audio",kindAudioMPEG4:"MPEG-4 audio",kindAudioMIDI:"MIDI audio",kindAudioOGG:"Ogg Vorbis audio",kindAudioWAV:"WAV audio",AudioPlaylist:"MP3 playlist",kindVideo:"Video media",kindVideoDV:"DV movie",kindVideoMPEG:"MPEG movie",kindVideoMPEG4:"MPEG-4 movie",kindVideoAVI:"AVI movie",kindVideoMOV:"Quick Time movie",kindVideoWM:"Windows Media movie",kindVideoFlash:"Flash movie",kindVideoMKV:"Matroska movie",kindVideoOGG:"Ogg movie"}}),e.fn.elfinderbutton=function(t){return this.each(function(){var n,i,a="class",o=t.fm,r=o.res(a,"disabled"),s=o.res(a,"active"),l=o.res(a,"hover"),c="elfinder-button-menu-item",d="elfinder-button-menu-item-selected",p=e(''+t.title+""),u=t.className?t.className:t.name,h=e(this).addClass("ui-state-default elfinder-button").attr("title",t.title).append('',p).on("mouseenter mouseleave",function(e){!h.hasClass(r)&&h["mouseleave"==e.type?"removeClass":"addClass"](l)}).on("click",function(e){h.hasClass(r)||(n&&t.variants.length>=1?(n.is(":hidden")&&o.getUI().click(),e.stopPropagation(),n.css(m()).slideToggle({duration:100,done:function(e){o[n.is(":visible")?"toFront":"toHide"](n)}})):o.exec(t.name,g(),{_userAction:!0,_currentType:"toolbar",_currentNode:h}))}),f=function(){o.toHide(n)},m=function(){var e=o.getUI(),t=e.offset(),n=h.offset();return{top:n.top-t.top,left:n.left-t.left,maxHeight:e.height()-40}},g=function(){var e,t=o.selected();return t.length||(t=(e=o.cwd())?[o.cwd().hash]:void 0),t};p.hide(),t.button=h,Array.isArray(t.variants)&&(h.addClass("elfinder-menubutton"),n=e('
').hide().appendTo(o.getUI()).on("mouseenter mouseleave","."+c,function(){e(this).toggleClass(l)}).on("click","."+c,function(i){var a=e(this).data("value");i.preventDefault(),i.stopPropagation(),h.removeClass(l),o.toHide(n),"undefined"==typeof a&&(a={}),"object"==typeof a&&(a._userAction=!0),o.exec(t.name,g(),a)}).on("close",f),o.bind("disable select",f).getUI().on("click",f),t.change(function(){n.html(""),e.each(t.variants,function(i,a){n.append(e('
'+a[1]+"
").data("value",a[0]).addClass(a[0]==t.value?d:""))})})),t.change(function(){var e;i&&cancelAnimationFrame(i),i=requestAnimationFrame(function(){t.disabled()?h.removeClass(s+" "+l).addClass(r):(h.removeClass(r),h[t.active()?"addClass":"removeClass"](s)),t.syncTitleOnChange&&(e=t.className?t.className:t.name,u!==e&&(h.children(".elfinder-button-icon").removeClass("elfinder-button-icon-"+u).addClass("elfinder-button-icon-"+e),n&&n.removeClass("elfinder-button-"+u+"-menu").addClass("elfinder-button-"+e+"-menu"),u=e),p.html(t.title),h.attr("title",t.title))})}).change()})},e.fn.elfindercontextmenu=function(t){return this.each(function(){var n,i,a,o,r,s,l,c=(e(this),"elfinder-contextmenu-item"),d="elfinder-contextsubmenu-item",p="elfinder-contextmenu-extra-icon",u=t.res("class","hover"),h={distance:8,start:function(){f.data("drag",!0).data("touching")&&f.find("."+u).removeClass(u)},stop:function(){f.data("draged",!0).removeData("drag")}},f=e(this).addClass("touch-punch ui-helper-reset ui-front ui-widget ui-state-default ui-corner-all elfinder-contextmenu elfinder-contextmenu-"+t.direction).hide().on("touchstart",function(e){f.data("touching",!0).children().removeClass(u)}).on("touchend",function(e){f.removeData("touching")}).on("mouseenter mouseleave","."+c,function(t){e(this).toggleClass(u,!("mouseenter"!==t.type&&(f.data("draged")||!f.data("submenuKeep")))),f.data("draged")&&f.data("submenuKeep")&&f.find(".elfinder-contextmenu-sub:visible").parent().addClass(u)}).on("mouseenter mouseleave","."+p,function(t){e(this).parent().toggleClass(u,"mouseleave"===t.type)}).on("mouseenter mouseleave","."+c+",."+d,function(t){var n=function(t,n){e.each(n?r:a,function(e,i){if(t[0]===i)return(n?r:a)._cur=e,n?s=t:o=t,!1})};if(t.originalEvent){var i=e(this),l=function(){o&&!o.children("div.elfinder-contextmenu-sub:visible").length&&o.removeClass(u)};"mouseenter"===t.type?i.hasClass(d)?(s&&s.removeClass(u),o&&(r=o.find("div."+d)),n(i,!0)):(l(),n(i)):i.hasClass(d)?(s=null,r=null):(l(),function(e){setTimeout(function(){e===o&&(o=null)},250)}(o))}}).on("contextmenu",function(){return!1}).on("mouseup",function(){setTimeout(function(){f.removeData("draged")},100)}).draggable(h),m="ltr"===t.direction,g=m?"left":"right",v=Object.assign({},t.options.contextmenu),b='
{label}
',y=function(n,i,a,o){var r,s,l="",c="",d="";return o&&(o.className&&(l=" "+o.className),o.iconClass&&(d=o.iconClass,i=""),o.iconImg&&(r=o.iconImg.split(/ +/),s=r[1]&&r[2]?t.escape(r[1]+"px "+r[2]+"px"):"",c=" style=\"background:url('"+t.escape(r[0])+"') "+(s?s:"0 0")+" no-repeat;"+(s?"":"posbackground-size:contain;")+'"')),e(b.replace("{icon}",i?"elfinder-button-icon-"+i:d?d:"").replace("{label}",n).replace("{style}",c).replace("{className}",l)).on("click",function(e){e.stopPropagation(),e.preventDefault(),a()})},w=function(e){var t=e.split(/ +/),n=t[1]&&t[2]?t[1]+"px "+t[2]+"px":"";return{backgroundImage:'url("'+t[0]+'")',backgroundRepeat:"no-repeat",backgroundPosition:n?n:"",backgroundSize:n?"":"contain"}},x=function(){var n="touchstart.contextmenuAutoToggle";f.data("hideTm")&&clearTimeout(f.data("hideTm")),f.is(":visible")&&f.on("touchstart",function(e){e.originalEvent.touches.length>1||(f.stop(),t.toFront(f),f.data("hideTm")&&clearTimeout(f.data("hideTm")))}).data("hideTm",setTimeout(function(){f.is(":visible")&&(i.find(".elfinder-cwd-file").off(n),i.find(".elfinder-cwd-file.ui-selected").one(n,function(t){if(!(t.originalEvent.touches.length>1)){var a=e(t.target);return!f.first().length||a.is("input:checkbox")||a.hasClass("elfinder-cwd-select")?void i.find(".elfinder-cwd-file").off(n):(t.stopPropagation(),C(t.originalEvent.touches[0].pageX,t.originalEvent.touches[0].pageY),i.data("longtap",!0),void a.one("touchend",function(){setTimeout(function(){i.removeData("longtap")},80)}))}}).one("unselect."+t.namespace,function(){i.find(".elfinder-cwd-file").off(n)}),f.fadeOut({duration:300,fail:function(){f.css("opacity","1").show()},done:function(){t.toHide(f)}}))},4500))},k=function(n){var i=n.keyCode,l=e.ui.keyCode.ESCAPE,c=e.ui.keyCode.ENTER,p=e.ui.keyCode.LEFT,h=e.ui.keyCode.RIGHT,f=e.ui.keyCode.UP,m=e.ui.keyCode.DOWN,g="ltr"===t.direction?h:p,v=g===h?p:h;e.inArray(i,[l,c,p,h,f,m])!==-1&&(n.preventDefault(),n.stopPropagation(),n.stopImmediatePropagation(),i==l||i===v?o&&r&&s?(s.trigger("mouseleave").trigger("submenuclose"),o.addClass(u),r=null,s=null):i==l&&z():i==f||i==m?r?(s&&s.trigger("mouseleave"),i==m&&(!s||r.length<=++r._cur)?r._cur=0:i==f&&(!s||--r._cur<0)&&(r._cur=r.length-1),s=r.eq(r._cur).trigger("mouseenter")):(r=null,o&&o.trigger("mouseleave"),i==m&&(!o||a.length<=++a._cur)?a._cur=0:i==f&&(!o||--a._cur<0)&&(a._cur=a.length-1),o=a.eq(a._cur).addClass(u)):!o||i!=c&&i!==g||(o.hasClass("elfinder-contextmenu-group")?s?i==c&&s.click():(o.trigger("mouseenter"),r=o.find("div."+d),r._cur=0,s=r.first().addClass(u)):i==c&&o.click()))},C=function(i,a,c){var d,p=f.outerWidth(),u=f.outerHeight(),h=n.attr("style"),m=n.offset(),v=n.width(),b=n.height(),y=t.UA.Mobile?40:2,w=t.UA.Mobile?20:2,i=i-(m?m.left:0),a=a-(m?m.top:0),c=Object.assign(c||{},{top:Math.max(0,a+w+u1&&f.append('
'+t.i18n("selectedItems",""+b)+"
"),a=e(),e.each(v[i]||[],function(v,b){var x,k,C,T,A,j;if("|"===b)return void(s&&(l=!0));if(r[b]?(k=r[b],C=!0):k=b,x=t.getCommand(k),!x||g||t.searchStatus.state&&x.disableOnSearch||(x.__disabled=x._disabled,x._disabled=!(x.alwaysEnabled||!!t._commands[k]&&!(e.inArray(b,h)!==-1||C&&h[k])),e.each(x.linkedCmds,function(e,n){var i;(i=t.getCommand(n))&&(i.__disabled=i._disabled,i._disabled=!(i.alwaysEnabled||!!t._commands[n]&&!h[n]))})),x&&!x._disabled&&x.getstate(o)!=-1){if(x.variants){if(!x.variants.length)return;T=y(x.title,x.className?x.className:x.name,function(){},x.contextmenuOpts),A=e('
').hide().css("max-height",t.getUI().height()-30).appendTo(T.append('')),j=function(e){if(e){var i=n.attr("style");n.width(n.width()),A.css({top:"-1000px",left:"auto",right:"auto"});var a,o,r=T.offset(),s=r.left,l=r.top,c=T.outerWidth(),d=A.outerWidth(!0),p=A.outerHeight(!0),u=n.offset(),h=u.left+n.width(),g=u.top+n.height(),v=m,b=c;m?(o=s+c+d-h,o>10&&(s>d-5?(b-=5,v=!1):t.UA.Mobile||(b=c-o))):(o=d-s,o>0&&(s+c+d-150&&l0?30-p:5,f.find(".elfinder-contextmenu-sub:visible").hide(),A.css({top:a,left:v?b:"auto",right:v?"auto":b,overflowY:"auto"}).show(),n.attr("style",i)}else A.hide()},T.addClass("elfinder-contextmenu-group").on("mouseleave",".elfinder-contextmenu-sub",function(e){f.data("draged")||f.removeData("submenuKeep")}).on("submenuclose",".elfinder-contextmenu-sub",function(e){j(!1)}).on("click","."+d,function(n){var a,r;n.stopPropagation(),f.data("draged")||(r=e(this),x.keepContextmenu?(r.removeClass(u),T.addClass(u)):f.hide(),a=r.data("exec"),"undefined"==typeof a&&(a={}),"object"==typeof a&&(a._userAction=!0,a._currentType=i,a._currentNode=r),!x.keepContextmenu&&z(),t.exec(x.name,o,a))}).on("touchend",function(e){f.data("drag")||(j(!0),f.data("submenuKeep",!0))}).on("mouseenter mouseleave",function(t){f.data("touching")||(T.data("timer")&&(clearTimeout(T.data("timer")),T.removeData("timer")),e(t.target).closest(".elfinder-contextmenu-sub",f).length||("mouseleave"===t.type?f.data("submenuKeep")||T.data("timer",setTimeout(function(){T.removeData("timer"),j(!1)},250)):T.data("timer",setTimeout(function(){T.removeData("timer"),j(!0)},a.find("div.elfinder-contextmenu-sub:visible").length?250:0))))}),e.each(x.variants,function(t,n){var i,a="|"===n?'
':e('
'+n[1]+"
").data("exec",n[0]);"undefined"!=typeof n[2]&&(i=e("").addClass("elfinder-button-icon elfinder-contextmenu-icon"),/\//.test(n[2])?i.css(w(n[2])):i.addClass("elfinder-button-icon-"+n[2]),a.prepend(i).addClass(d+"-icon")),A.append(a)})}else T=y(x.title,x.className?x.className:x.name,function(){f.data("draged")||(!x.keepContextmenu&&z(),t.exec(x.name,o,{_userAction:!0,_currentType:i,_currentNode:T}))},x.contextmenuOpts),x.extra&&x.extra.node?(e('').append(x.extra.node).appendTo(T),e(x.extra.node).trigger("ready",{targets:o})):T.remove("."+p);x.extendsCmd&&T.children("span.elfinder-button-icon").addClass("elfinder-button-icon-"+x.extendsCmd),l&&f.append('
'),f.append(T),s=!0,l=!1}x&&"undefined"!=typeof x.__disabled&&(x._disabled=x.__disabled,delete x.__disabled,e.each(x.linkedCmds,function(e,n){var i;(i=t.getCommand(n))&&(i._disabled=i.__disabled,delete i.__disabled)}))}),a=f.children("div."+c)},A=function(t){j="raw",e.each(t,function(e,t){var n;"|"===t?f.append('
'):t.label&&"function"==typeof t.callback&&(n=y(t.label,t.icon,function(){f.data("draged")||(!t.remain&&z(),t.callback())},t.options||null),f.append(n))}),a=f.children("div."+c)},j=null,S=null;t.one("load",function(){n=t.getUI(),i=t.getUI("cwd"),t.bind("contextmenu",function(n){var a,o=n.data,r={};o.type&&"files"!==o.type&&i.trigger("unselectall"),z(),o.type&&o.targets?(t.trigger("contextmenucreate",o),T(o.type,o.targets),t.trigger("contextmenucreatedone",o)):o.raw&&A(o.raw),f.children().length&&(a=o.prevNode||null,a&&(f.data("prevNode",f.prev()),a.after(f)),o.fitHeight&&(r={maxHeight:Math.min(t.getUI().height(),e(window).height()),overflowY:"auto"},f.draggable("destroy").removeClass("ui-draggable")),C(o.x,o.y,r),o.opened&&"function"==typeof o.opened&&o.opened.call(f))}).one("destroy",function(){f.remove()}).bind("disable",z).bind("select",function(e){"files"===j&&(!e.data||e.data.selected.toString()!==S.toString())&&z()})}).shortcut({pattern:"mac"===t.OS?"ctrl+m":"contextmenu shift+f10",description:"contextmenu",callback:function(n){n.stopPropagation(),n.preventDefault(),e(document).one("contextmenu."+t.namespace,function(e){e.preventDefault(),e.stopPropagation()});var i,a,o,r,s=t.selected();s.length?(i="files",a=s,r=t.cwdHash2Elm(s[0])):(i="cwd",a=[t.cwd().hash],o=t.getUI("workzone").offset()),r&&r.length||(r=t.getUI("workzone")),o=r.offset(),o.top+=r.height()/2,o.left+=r.width()/2,t.trigger("contextmenu",{type:i,targets:a,x:o.left,y:o.top})}})})},e.fn.elfindercwd=function(t,n){return this.not(".elfinder-cwd").each(function(){var i,a,o,r,s,l,c,d=t.UA.Mobile,p="list"==t.viewType,u="select."+t.namespace,h="unselect."+t.namespace,f="disable."+t.namespace,m="enable."+t.namespace,g="class",v=t.res(g,"cwdfile"),b="."+v,y="ui-selected",w=t.res(g,"disabled"),x=t.res(g,"draggable"),k=t.res(g,"droppable"),C=t.res(g,"hover"),z=t.res(g,"active"),T=t.res(g,"adroppable"),A=v+"-tmp",j="elfinder-cwd-selectchk",S=t.options.loadTmbs>0?t.options.loadTmbs:5,O="",I={},M=[],F=[],E=void 0,D=[],U="",P=function(){for(var e="",t=0;t{'+D[t]+"}";return e},q=function(){return'
{marker}{name}
'+R+""+P()+""},R=e.map(n.showSelectCheckboxUA,function(e){return!(!t.UA[e]&&!e.match(/^all$/i))||null}).length?'
':"",H=!1,_=null,N={icon:'
{marker}
{name}
'+R+"
",row:""},L=t.res("tpl","perms"),W=t.res("tpl","lock"),B=t.res("tpl","symlink"),$={id:function(e){return t.cwdHash2Id(e.hash)},name:function(e){var n=t.escape(e.i18||e.name);return!p&&(n=n.replace(/([_.])/g,"​$1")),n},nametitle:function(e){return t.escape(e.i18||e.name)},permsclass:function(e){return t.perms2class(e)},perm:function(e){return t.formatPermissions(e)},dirclass:function(e){var i="directory"==e.mime?"directory":"";return e.isroot&&(i+=" isroot"),e.csscls&&(i+=" "+t.escape(e.csscls)),n.getClass&&(i+=" "+n.getClass(e)),i},style:function(e){return e.icon?t.getIconStyle(e):""},mime:function(e){var n=t.mime2class(e.mime);return e.icon&&(n+=" elfinder-cwd-bgurl"),n},size:function(e){return"directory"!==e.mime||e.size?t.formatSize(e.size):"-"},date:function(e){return t.formatDate(e)},kind:function(e){return t.mime2kind(e)},mode:function(e){return e.perm?t.formatFileMode(e.perm):""},modestr:function(e){return e.perm?t.formatFileMode(e.perm,"string"):""},modeoct:function(e){return e.perm?t.formatFileMode(e.perm,"octal"):""},modeboth:function(e){return e.perm?t.formatFileMode(e.perm,"both"):""},marker:function(e){return(e.alias||"symlink-broken"==e.mime?B:"")+(e.read&&e.write?"":L)+(e.locked?W:"")},tooltip:function(e){var n=t.formatDate(e)+(e.size>0?" ("+t.formatSize(e.size)+")":""),i="";return i=O&&e.path?t.escape(e.path.replace(/\/[^\/]*$/,"")):e.tooltip?t.escape(e.tooltip).replace(/\r/g," "):"",p&&(i+=(i?" ":"")+t.escape(e.i18||e.name)),i?i+" "+n:n}},V={},K=function(n,i){var o,r,s;if(n&&!V[n]&&("undefined"==typeof a&&(e("#elfinderAddBadgeStyle"+t.namespace).length&&e("#elfinderAddBadgeStyle"+t.namespace).remove(), a=e('').insertBefore(e("head").children(":first")).get(0).sheet||null),a)){if(n=n.toLowerCase(),s=n.split("/"),r=t.escape(t.mimeTypes[n]||(i.replace(/.bac?k$/i,"").match(/\.([^.]+)$/)||["",""])[1])){o=".elfinder-cwd-icon-"+s[0].replace(/(\.|\+)/g,"-"),"undefined"!=typeof s[1]&&(o+=".elfinder-cwd-icon-"+s[1].replace(/(\.|\+)/g,"-"));try{a.insertRule(o+':before{content:"'+r.toLowerCase()+'"}',0)}catch(l){}}V[n]=!0}},X=function(e){return e.mime&&"directory"!==e.mime&&!V[e.mime]&&K(e.mime,e.name),N[p?"row":"icon"].replace(/\{([a-z0-9_]+)\}/g,function(n,i){return $[i]?$[i](e,t):e[i]?e[i]:""})},J=e(),G=!1,Y=function(t,n){function i(e,t){return e[t+"All"]("[id]:not(."+w+"):not(.elfinder-cwd-parent):first")}var a,o,r,s,l,c=e.ui.keyCode,d=t==c.LEFT||t==c.UP,f=Ue.find("[id]."+y);if(f.length)if(a=f.filter(d?":first":":last"),r=i(a,d?"prev":"next"),r.length)if(p||t==c.LEFT||t==c.RIGHT)o=r;else if(s=a.position().top,l=a.position().left,o=a,d){do o=o.prev("[id]");while(o.length&&!(o.position().tops&&o.position().left>=l));o.hasClass(w)&&(o=i(o,"prev")),o.length||(r=Ue.find("[id]:not(."+w+"):last"),r.position().top>s&&(o=r))}else o=a;else o=J.length?d?J.prev():J:Ue.find("[id]:not(."+w+"):not(.elfinder-cwd-parent):"+(d?"last":"first"));o&&o.length&&!o.hasClass("elfinder-cwd-parent")&&(a&&n?o=a.add(a[d?"prevUntil":"nextUntil"]("#"+o.attr("id"))).add(o):f.trigger(h),o.trigger(u),re(o.filter(d?":first":":last")),oe())},Q={},Z=function(e){t.cwdHash2Elm(e).trigger(u)},ee=!1,te=function(){t.cwd().hash;R&&Re.find("input").prop("checked",!0),t.lazy(function(){var n;t.maxTargets&&(E||F).length>t.maxTargets?(ne({notrigger:!0}),n=e.map(E||F,function(e){return t.file(e)||null}),n=n.slice(0,t.maxTargets),Q={},e.each(n,function(e,n){Q[n.hash]=!0,t.cwdHash2Elm(n.hash).trigger(u)}),t.toast({mode:"warning",msg:t.i18n(["errMaxTargets",t.maxTargets])})):(Ue.find("[id]:not(."+y+"):not(.elfinder-cwd-parent)").trigger(u),Q=t.arrayFlip(E||F,!0)),oe(),R&&Re.data("pending",!1)},0,{repaint:!0})},ne=function(e){var t=e||{};R&&Re.find("input").prop("checked",!1),Object.keys(Q).length&&(G=!1,Q={},Ue.find("[id]."+y).trigger(h),R&&Ue.find("input:checkbox."+j).prop("checked",!1)),!t.notrigger&&oe(),R&&Re.data("pending",!1),Ue.removeClass("elfinder-cwd-allselected")},ie=function(){var n={};ee?ne():Object.keys(Q).length?(e.each(E||F,function(e,i){var a=t.cwdHash2Elm(i);Q[i]?a.length&&a.trigger(h):(n[i]=!0,a.length&&a.trigger(u))}),Q=n,oe()):te()},ae=void 0,oe=function(){var e=Object.keys(Q),n={selected:e,origin:"cwd"};ge&&(e.length>1||e[0]!==t.cwdId2Hash(ge.attr("id")))&&ge.hasClass(y)&&ge.trigger(h),ee=e.length&&e.length===(E||F).length&&(!t.maxTargets||e.length<=t.maxTargets),R&&(Re.find("input").prop("checked",ee),Ue[ee?"addClass":"removeClass"]("elfinder-cwd-allselected")),ee?n.selectall=!0:e.length||(n.unselectall=!0),t.trigger("select",n)},re=function(e,n){if(e.length){var i=e.position().top,a=e.outerHeight(!0),o=Pe.scrollTop(),r=Pe.get(0).clientHeight,s=we?we.outerHeight(!0):0;i+s+a>o+r?Pe.scrollTop(parseInt(i+s+a-r)):i"),l=function(n){var i,a,l,c=n||null,h=[],f=!1,m={},g="self"===t.option("tmbUrl"),v=!le.renderd;i=se.splice(0,be+(c||0)/(le.hpi||1)),le.renderd+=i.length,se.length||(qe.hide(),Pe.off(pe,ye)),a=[],h=e.map(i,function(e){return e.hash&&e.name?("directory"==e.mime&&(f=!0),(e.tmb&&(1!=e.tmb||e.size>0)||g&&0===e.mime.indexOf("image/"))&&(m[e.hash]=e.tmb||"self"),I[e.hash]&&a.push(e.hash),X(e)):null}),s.empty().append(h.join("")),f&&!d&&Te(s),l=[],Object.keys(Q).length&&s.find("[id]:not(."+y+"):not(.elfinder-cwd-parent)").each(function(){Q[t.cwdId2Hash(this.id)]&&l.push(e(this))}),o.append(r?s:s.children()),l.length&&(e.each(l,function(e,t){t.trigger(u)}),oe()),a.length&&t.trigger("lockfiles",{files:a}),!le.hpi&&Fe(o,i.length),p&&(Ue.find("thead").show(),ke({fitWidth:!_})),Object.keys(m).length&&Object.assign(le.attachTmbs,m),v&&(d||Ue.data("selectable")||Ue.selectable(he).data("selectable",!0)),!ue&&Pe.trigger(pe)};le.renderd||(le.rendering=!0,Pe.scrollTop(0),i=t.cwd().phash,l(),n.oldSchool&&(i&&!O?ve(i):ge=e()),p&&(_&&Ce(),ke({fitWidth:!0})),le.itemH=(p?o.find("tr:first"):o.find("[id]:first")).outerHeight(!0),t.trigger("cwdrender"),le.rendering=!1,me(!0)),!le.rendering&&se.length?(a=Pe.height()+Pe.scrollTop()+t.options.showThreshold+le.row-le.renderd*le.hpi)>0?(le.rendering=!0,t.lazy(function(){l(a),le.rendering=!1})):!t.enabled()&&_e():_e()}},we=null,xe=t.UA.CSS.positionSticky&&t.UA.CSS.widthMaxContent,ke=function(a){if(i=0,n.listView.fixedHeader){var o,r,s,l,c,d,p,u,h,f,m,g,v,b=function(){var e,n;n="ltr"===t.direction?"left":"right",e=("ltr"===t.direction?Pe.scrollLeft():s.outerWidth(!0)-Pe.width()-Pe.scrollLeft())*-1,r.css(n)!==e&&r.css(n,e)},y=a||{};if(c=Ue.find("tbody"),u=c.children("tr:first"),u.length&&u.is(":visible")){if(s=c.parent(),we?(l=e("#"+t.namespace+"-cwd-thead"),p=l.children("tr:first")):(v=!0,c.addClass("elfinder-cwd-fixheader"),l=Ue.find("thead").attr("id",t.namespace+"-cwd-thead"),p=l.children("tr:first"),d=p.outerHeight(!0),Ue.css("margin-top",d-parseInt(s.css("padding-top"))),xe?(we=e('
').addClass(Ue.attr("class")).append(e("
").append(l)),Ue.after(we),Pe.on("resize.fixheader",function(e){e.stopPropagation(),ke({fitWidth:!0})})):(r=e("
").addClass(Ue.attr("class")).append(e("
").append(l)),we=e("
").addClass(Pe.attr("class")+" elfinder-cwd-fixheader").removeClass("ui-droppable native-droppable").css(Pe.position()).css({height:d,width:Ue.outerWidth()}).append(r),"rtl"===t.direction&&we.css("left",Pe.data("width")-Pe.width()+"px"),b(),Pe.after(we).on("scroll.fixheader resize.fixheader",function(e){b(),"resize"===e.type&&(e.stopPropagation(),we.css(Pe.position()),Pe.data("width",Pe.css("overflow","hidden").width()),Pe.css("overflow","auto"),ke())}))),v||y.fitWidth||Math.abs(u.outerWidth()-p.outerWidth())>2){o=D.length+1;for(var w=0;w").on("load",function(){t.find(".elfinder-cwd-icon").addClass(n.className).css("background-image","url('"+n.url+"')")}).attr("src",n.url)},o=function(e,n){var o,r,s=t.cwdHash2Elm(e);s.length&&("1"!=n?(o=t.file(e),o.tmb!==n&&(o.tmb=n),r=t.tmb(o),i?s.find(".elfinder-cwd-icon").addClass(r.className).css("background-image","url('"+r.url+"')"):a(s,r),delete le.attachTmbs[e]):i?je([e]):le.tmbLoading[e]||le.getTmbs.push(e))};e.isPlainObject(n)&&Object.keys(n).length&&(Object.assign(le.attachTmbs,n),e.each(n,o),i||!le.getTmbs.length||Object.keys(le.tmbLoading).length||je())},je=function(n){var i=[],a=!1;return t.oldAPI?void t.request({data:{cmd:"tmb",current:t.cwd().hash},preventFail:!0}).done(function(e){e.images&&Object.keys(e.images).length&&Ae(e.images),e.tmb&&je()}):(n?(a=!0,i=n.splice(0,S)):i=le.getTmbs.splice(0,S),void(i.length&&(a||fe[i[0]]||fe[i[i.length-1]])&&(e.each(i,function(e,t){le.tmbLoading[t]=!0}),t.request({data:{cmd:"tmb",targets:i},preventFail:!0}).done(function(t){var o,r=[];t.images&&((o=Object.keys(t.images).length)?(o");if(h>be)De(),Q=t.arrayFlip(e.map(n,function(e){return e.hash}),!0),oe();else{for(h&&Le.removeClass("elfinder-cwd-wrapper-empty"),c="self"===t.option("tmbUrl");h--;)a=n[h],o=a.hash,t.cwdHash2Elm(o).length||((r=m(a))&&!r.length&&(r=null),!r&&(l=g(a))>=0?se.splice(l,0,a):(b.empty().append(X(a)),"directory"===a.mime&&!d&&Te(b),s=v?b:b.children(),r?r.before(s):u.append(s),++le.renderd),t.cwdHash2Elm(o).length&&(a.tmb&&(1!=a.tmb||a.size>0)||c&&0===a.mime.indexOf("image/"))&&(f[o]=a.tmb||"self"));p&&(Ce(),ke({fitWidth:!_})),Fe(u),Object.keys(f).length&&(Object.assign(le.attachTmbs,f),se.length<1&&je())}},Oe=function(n){var i,a,o,r,s=n.length,l=t.searchStatus.state>1,c=t.getCommand(t.currentReqCmd)||{};if(!t.cwd().hash&&!c.noChangeDirOnRemovedCwd)return e.each(M.reverse(),function(e,n){if(t.file(n))return r=!0,t.one(t.currentReqCmd+"done",function(){!t.cwd().hash&&t.exec("open",n)}),!1}),void(!r&&!t.cwd().hash&&t.exec("open",t.roots[Object.keys(t.roots)[0]]));for(;s--;){if(i=n[s],(a=t.cwdHash2Elm(i)).length)try{a.remove(),--le.renderd}catch(d){t.debug("error",d)}else(o=ce(i))!==-1&&se.splice(o,1);Q[i]&&delete Q[i],l&&(o=e.inArray(i,F))!==-1&&F.splice(o,1)}l&&t.trigger("cwdhasheschange",F),p&&(Ce(),ke({fitWidth:!_}))},Ie=function(){for(var e="",n="",i=0;i'+e+"";return n},Me=function(e){var t,n;e.height||(t=p?Ue.find("tbody"):Ue,n=t.find(p?"tr:first":"[id]:first"),e.height=n.outerHeight(!0),p||(e.width=n.outerWidth(!0)))},Fe=function(e,n){var i,a=e||(p?Ue.find("tbody"):Ue),o=Ve[t.viewType],r=1;se.length>0&&(le.hpi?p||(r=Math.floor(a.width()/o.width)):(Me(o),p?le.row=le.hpi=o.height:(r=Math.floor(a.width()/o.width),le.row=o.height,le.hpi=le.row/r)),i=Math.ceil((se.length+(n||0))/r),p&&we&&++i,qe.css({top:le.row*i+"px"}).show())},Ee={contextmenu:function(e){return e.preventDefault(),void 0!==Ue.data("longtap")?void e.stopPropagation():void t.trigger("contextmenu",{type:"cwd",targets:[t.cwd().hash],x:e.pageX,y:e.pageY})},touchstart:function(e){e.originalEvent.touches.length>1||(Ue.data("longtap")!==!1&&(Pe.data("touching",{x:e.originalEvent.touches[0].pageX,y:e.originalEvent.touches[0].pageY}),Ue.data("tmlongtap",setTimeout(function(){Ue.data("longtap",!0),t.trigger("contextmenu",{type:"cwd",targets:[t.cwd().hash],x:Pe.data("touching").x,y:Pe.data("touching").y})},500))),Ue.data("longtap",null))},touchend:function(e){"touchmove"===e.type?(!Pe.data("touching")||Math.abs(Pe.data("touching").x-e.originalEvent.touches[0].pageX)+Math.abs(Pe.data("touching").y-e.originalEvent.touches[0].pageY)>4)&&Pe.data("touching",null):setTimeout(function(){Ue.removeData("longtap")},80),clearTimeout(Ue.data("tmlongtap"))},click:function(e){Ue.data("longtap")&&(e.preventDefault(),e.stopPropagation())}},De=function(){t.lazy(function(){var n;Le.append(Re).removeClass("elfinder-cwd-wrapper-empty elfinder-search-result elfinder-incsearch-result elfinder-letsearch-result"),(t.searchStatus.state>1||t.searchStatus.ininc)&&Le.addClass("elfinder-search-result"+(t.searchStatus.ininc?" elfinder-"+("/"===O.substr(0,1)?"let":"inc")+"search-result":"")),le.attachThumbJob&&le.attachThumbJob._abort(),Ue.data("selectable")&&Ue.selectable("disable").selectable("destroy").removeData("selectable"),t.trigger("cwdinit"),J=e();try{Ue.empty()}catch(i){Ue.html("")}we&&(Pe.off("scroll.fixheader resize.fixheader"),we.remove(),we=null),Ue.removeClass("elfinder-cwd-view-icons elfinder-cwd-view-list").addClass("elfinder-cwd-view-"+(p?"list":"icons")).attr("style","").css("height","auto"),qe.hide(),Pe[p?"addClass":"removeClass"]("elfinder-cwd-wrapper-list")._padding=parseInt(Pe.css("padding-top"))+parseInt(Pe.css("padding-bottom")),t.UA.iOS&&Pe.removeClass("overflow-scrolling-touch").addClass("overflow-scrolling-touch"),p&&(Ue.html("
"),n=e(''+t.getColumnName("name")+""+Ie()+""),Ue.find("thead").hide().append(n).find("td:first").append(Re),e.fn.sortable&&n.addClass("touch-punch touch-punch-keep-default").sortable({axis:"x",distance:8,items:"> .sortable-item",start:function(t,n){e(n.item[0]).data("dragging",!0),n.placeholder.width(n.helper.removeClass("ui-state-hover").width()).removeClass("ui-state-active").addClass("ui-state-hover").css("visibility","visible")},update:function(n,i){var a,o,r=e(i.item[0]).attr("class").split(" ")[0].replace("elfinder-cwd-view-th-","");D=e.map(e(this).children(),function(t){var n=e(t).attr("class").split(" ")[0].replace("elfinder-cwd-view-th-","");return o||(r===n?o=!0:a=n),"name"===n?null:n}),N.row=q(),t.storage("cwdCols",D),a=".elfinder-col-"+a+":first",r=".elfinder-col-"+r+":first",t.lazy(function(){Ue.find("tbody tr").each(function(){var t=e(this);t.children(a).after(t.children(r))})})},stop:function(t,n){setTimeout(function(){e(n.item[0]).removeData("dragging")},100)}}),n.find("td").addClass("touch-punch").resizable({handles:"ltr"===t.direction?"e":"w",start:function(t,n){var i=Ue.find("td.elfinder-col-"+n.element.attr("class").split(" ")[0].replace("elfinder-cwd-view-th-","")+":first");n.element.data("dragging",!0).data("resizeTarget",i).data("targetWidth",i.width()),H=!0,"fixed"!==Ue.find("table").css("table-layout")&&(Ue.find("tbody tr:first td").each(function(){e(this).width(e(this).width())}),Ue.find("table").css("table-layout","fixed"))},resize:function(e,t){t.element.data("resizeTarget").width(t.element.data("targetWidth")-(t.originalSize.width-t.size.width))},stop:function(n,i){H=!1,ke({fitWidth:!0}),_={},Ue.find("tbody tr:first td").each(function(){var t=e(this).attr("class").split(" ")[0].replace("elfinder-col-","");_[t]=e(this).width()}),t.storage("cwdColWidth",_),setTimeout(function(){i.element.removeData("dragging")},100)}}).find(".ui-resizable-handle").addClass("ui-icon ui-icon-grip-dotted-vertical")),se=e.map(E||F,function(e){return t.file(e)||null}),se=t.sortFiles(se),E?E=e.map(se,function(e){return e.hash}):F=e.map(se,function(e){return e.hash}),le={renderd:0,attachTmbs:{},getTmbs:[],tmbLoading:{},lazyOpts:{tm:0}},Le[se.length<1?"addClass":"removeClass"]("elfinder-cwd-wrapper-empty"),Pe.off(pe,ye).on(pe,ye).trigger(pe),t.cwd().write?(Pe[t.isCommandEnabled("upload")?"addClass":"removeClass"]("native-droppable"),Pe.droppable(t.isCommandEnabled("paste")?"enable":"disable")):Pe.removeClass("native-droppable").droppable("disable").removeClass("ui-state-disabled")})},Ue=e(this).addClass("ui-helper-clearfix elfinder-cwd").attr("unselectable","on").on("click."+t.namespace,b,function(n){var i,a,o,r,s,l=this.id?e(this):e(this).parents("[id]:first"),c=e(n.target);if(R&&(c.is("input:checkbox."+j)||c.hasClass("elfinder-cwd-select")))return n.stopPropagation(),n.preventDefault(),l.trigger(l.hasClass(y)?h:u),oe(),void requestAnimationFrame(function(){c.prop("checked",l.hasClass(y))});if(Ue.data("longtap")||c.hasClass("elfinder-cwd-nonselect"))return void n.stopPropagation();if(U||(U=l.attr("id"),setTimeout(function(){U=""},500)),n.shiftKey&&(i=l.prevAll(ae||"."+y+":first"),a=l.nextAll(ae||"."+y+":first"),o=i.length,r=a.length),n.shiftKey&&(o||r))s=o?l.prevUntil("#"+i.attr("id")):l.nextUntil("#"+a.attr("id")),s=s.add(l),o||(s=e(s.get().reverse())),s.trigger(u);else if(n.ctrlKey||n.metaKey)l.trigger(l.hasClass(y)?h:u);else{if(Pe.data("touching")&&l.hasClass(y))return Pe.data("touching",null),void t.dblclick({file:t.cwdId2Hash(this.id)});ne({notrigger:!0}),l.trigger(u)}oe()}).on("dblclick."+t.namespace,b,function(n){if(U){var i=t.cwdId2Hash(U);n.stopPropagation(),this.id!==U&&(e(this).trigger(h),e("#"+U).trigger(u),oe()),t.dblclick({file:i})}}).on("touchstart."+t.namespace,b,function(n){if(!(n.originalEvent.touches.length>1)){var i,a=this.id?e(this):e(this).parents("[id]:first"),o=e(n.target),r=n.target.nodeName;if("INPUT"===r&&"text"===n.target.type||"TEXTAREA"===r||o.hasClass("elfinder-cwd-nonselect"))return void n.stopPropagation();if(a.find("input:text,textarea").length)return n.stopPropagation(),void n.preventDefault();Pe.data("touching",{x:n.originalEvent.touches[0].pageX,y:n.originalEvent.touches[0].pageY}),R&&(o.is("input:checkbox."+j)||o.hasClass("elfinder-cwd-select"))||(i=a.prevAll("."+y+":first").length+a.nextAll("."+y+":first").length,Ue.data("longtap",null),(Object.keys(Q).length||p&&"TD"!==n.target.nodeName||!p&&this!==n.target)&&(Ue.data("longtap",!1),a.addClass(C),a.data("tmlongtap",setTimeout(function(){Ue.data("longtap",!0),a.trigger(u),oe(),t.trigger("contextmenu",{type:"files",targets:t.selected(),x:n.originalEvent.touches[0].pageX,y:n.originalEvent.touches[0].pageY})},500))))}}).on("touchmove."+t.namespace+" touchend."+t.namespace,b,function(n){var i,a=e(n.target);if(!R||!a.is("input:checkbox."+j)&&!a.hasClass("elfinder-cwd-select")){if("INPUT"==n.target.nodeName||"TEXTAREA"==n.target.nodeName)return void n.stopPropagation();i=this.id?e(this):e(this).parents("[id]:first"),clearTimeout(i.data("tmlongtap")),"touchmove"===n.type?(Pe.data("touching",null),i.removeClass(C)):(Pe.data("touching")&&!Ue.data("longtap")&&i.hasClass(y)&&(n.preventDefault(),Pe.data("touching",null),t.dblclick({file:t.cwdId2Hash(this.id)})),setTimeout(function(){Ue.removeData("longtap")},80))}}).on("mouseenter."+t.namespace,b,function(i){if(!ue){var a=e(this),o=null;if(!(d||a.data("dragRegisted")||a.hasClass(A)||a.hasClass(x)||a.hasClass(w))){if(a.data("dragRegisted",!0),!t.isCommandEnabled("copy",t.searchStatus.state>1||a.hasClass("isroot")?t.cwdId2Hash(a.attr("id")):void 0)&&!t.isCommandEnabled("cut",t.searchStatus.state>1||a.hasClass("isroot")?t.cwdId2Hash(a.attr("id")):void 0))return;a.on("mousedown",function(i){var o=n.metakeyDragout&&!t.UA.IE&&(i.shiftKey||i.altKey),r=!1;o&&Ue.data("selectable")&&(Ue.selectable("disable").selectable("destroy").removeData("selectable"),requestAnimationFrame(function(){Ue.selectable(he).selectable("option",{disabled:!1}).selectable("refresh").data("selectable",!0)})),a.removeClass("ui-state-disabled"),o?a.draggable("option","disabled",!0).attr("draggable","true"):(a.hasClass(y)||(r=p?e(i.target).closest("span,tr").is("tr"):e(i.target).hasClass("elfinder-cwd-file")),r?a.draggable("option","disabled",!0).removeClass("ui-state-disabled"):a.draggable("option","disabled",!1).removeAttr("draggable").draggable("option","cursorAt",{left:50-parseInt(e(i.currentTarget).css("margin-left")),top:47}))}).on("dragstart",function(n){var i=n.dataTransfer||n.originalEvent.dataTransfer||null;if(o=null,i&&!t.UA.IE){var a,r=this.id?e(this):e(this).parents("[id]:first"),s=e(""),l="",c=null,d=null,p=[],h=function(n){var i,a=n.mime,o=t.tmb(n);return i='
',o&&(i=e(i).addClass(o.className).css("background-image","url('"+o.url+"')").get(0).outerHTML),i},f=[];if(r.trigger(u),oe(),e.each(Q,function(n){var i=t.file(n),a=i.url;if(i&&"directory"!==i.mime){if(a){if("1"==a)return f.push(n),!0}else a=t.url(i.hash);a&&(a=t.convAbsUrl(a),p.push(n),e("").attr("href",a).text(a).appendTo(s),l+=a+"\n",c||(c=i.mime+":"+i.name+":"+a),d||(d=a+"\n"+i.name))}}),f.length)return e.each(f,function(e,n){var i=t.file(n);i.url="",t.request({data:{cmd:"url",target:n},notify:{type:"url",cnt:1},preventDefault:!0}).always(function(e){i.url=e.url?e.url:"1"})}),!1;if(!l)return!1;i.setDragImage&&(o=e('
').append(h(t.file(p[0]))).appendTo(e(document.body)),(a=p.length)>1&&o.append(h(t.file(p[a-1]))+''+a+""),i.setDragImage(o.get(0),50,47)),i.effectAllowed="copyLink",i.setData("DownloadURL",c),i.setData("text/x-moz-url",d),i.setData("text/uri-list",l),i.setData("text/plain",l),i.setData("text/html",s.html()),i.setData("elfinderfrom",window.location.href+t.cwd().hash),i.setData("elfinderfrom:"+i.getData("elfinderfrom"),"")}}).on("dragend",function(e){ne({notrigger:!0}),o&&o.remove()}).draggable(t.draggable)}}}).on(u,b,function(n){var i=e(this),a=t.cwdId2Hash(i.attr("id"));G||i.hasClass(w)||(ae="#"+this.id,i.addClass(y).children().addClass(C).find("input:checkbox."+j).prop("checked",!0),Q[a]||(Q[a]=!0),J=Ue.find("[id]."+y+":last").next())}).on(h,b,function(n){var i=e(this),a=t.cwdId2Hash(i.attr("id"));G||(i.removeClass(y).children().removeClass(C).find("input:checkbox."+j).prop("checked",!1),Ue.hasClass("elfinder-cwd-allselected")&&(R&&Re.children("input").prop("checked",!1),Ue.removeClass("elfinder-cwd-allselected")),Q[a]&&delete Q[a])}).on(f,b,function(){var t=e(this).removeClass(C+" "+y).addClass(w),n=t.children(),i=p?t:n.find("div.elfinder-cwd-file-wrapper,div.elfinder-cwd-filename");n.removeClass(C+" "+y),t.hasClass(k)&&t.droppable("disable"),i.hasClass(x)&&i.draggable("disable")}).on(m,b,function(){var t=e(this).removeClass(w),n=p?t:t.children("div.elfinder-cwd-file-wrapper,div.elfinder-cwd-filename");t.hasClass(k)&&t.droppable("enable"),n.hasClass(x)&&n.draggable("enable")}).on("scrolltoview",b,function(t,n){re(e(this),!n||"undefined"==typeof n.blink||n.blink)}).on("mouseenter."+t.namespace+" mouseleave."+t.namespace,b,function(n){var i="mouseenter"===n.type;i&&(ue||t.UA.Mobile)||(t.trigger("hover",{hash:t.cwdId2Hash(e(this).attr("id")),type:n.type}),e(this).toggleClass(C,"mouseenter"==n.type))}).on("mouseenter."+t.namespace+" mouseleave."+t.namespace,".elfinder-cwd-file-wrapper,.elfinder-cwd-filename",function(t){var n="mouseenter"===t.type;n&&ue||e(this).closest(b).children(".elfinder-cwd-file-wrapper,.elfinder-cwd-filename").toggleClass(z,"mouseenter"==t.type)}).on("contextmenu."+t.namespace,function(n){var i=e(n.target).closest(b);if(i.get(0)!==n.target||Q[t.cwdId2Hash(i.get(0).id)])return i.find("input:text,textarea").length?void n.stopPropagation():void(i.length&&("TD"!=n.target.nodeName||Q[t.cwdId2Hash(i.get(0).id)])&&(n.stopPropagation(),n.preventDefault(),i.hasClass(w)||Pe.data("touching")||(i.hasClass(y)||(ne({notrigger:!0}),i.trigger(u),oe()),t.trigger("contextmenu",{type:"files",targets:t.selected(),x:n.pageX,y:n.pageY}))))}).on("click."+t.namespace,function(e){e.target!==this||Ue.data("longtap")||!e.shiftKey&&!e.ctrlKey&&!e.metaKey&&ne()}).on("create."+t.namespace,function(n,i){var a=p?Ue.find("tbody"):Ue,o=a.find(".elfinder-cwd-parent"),r=i.move||!1,s=e(X(i)).addClass(A),l=t.selected();l.length?r&&t.trigger("lockfiles",{files:l}):ne(),o.length?o.after(s):a.prepend(s),Ce(),Pe.scrollTop(0).scrollLeft(0)}).on("unselectall",ne).on("selectfile",function(e,n){t.cwdHash2Elm(n).trigger(u),oe()}).on("colwidth",function(){p&&(Ue.find("table").css("table-layout","").find("td").css("width",""),ke({fitWidth:!0}),t.storage("cwdColWidth",_=null))}).on("iconpref",function(e,t){Ue.removeClass(function(e,t){return(t.match(/\belfinder-cwd-size\S+/g)||[]).join(" ")}),s=t?parseInt(t.size)||0:0,p||(s>0&&Ue.addClass("elfinder-cwd-size"+s),le.renderd&&requestAnimationFrame(function(){Ve.icons={},le.hpi=null,Fe(Ue,le.renderd),me()}))}).on("onwheel"in document?"wheel":"mousewheel",function(e){var i,a,o;!p&&(e.ctrlKey&&!e.metaKey||!e.ctrlKey&&e.metaKey)&&(e.stopPropagation(),e.preventDefault(),i=Ue.data("wheelTm"),"undefined"!=typeof i?(clearTimeout(i),Ue.data("wheelTm",setTimeout(function(){Ue.removeData("wheelTm")},200))):(Ue.data("wheelTm",!1),a=s||0,o=e.originalEvent.deltaY?e.originalEvent.deltaY:-e.originalEvent.wheelDelta,o>0?s>0&&(a=s-1):s').droppable(Object.assign({},ze,{autoDisable:!1})).on("contextmenu."+t.namespace,Ee.contextmenu).on("touchstart."+t.namespace,Ee.touchstart).on("touchmove."+t.namespace+" touchend."+t.namespace,Ee.touchend).on("click."+t.namespace,Ee.click).on("scroll."+t.namespace,function(){ue||(Ue.data("selectable")&&Ue.selectable("disable"),Pe.trigger(de)),ue=!0,le.scrtm&&cancelAnimationFrame(le.scrtm),le.scrtm&&Math.abs((le.scrolltop||0)-(le.scrolltop=this.scrollTop||e(this).scrollTop()))<5&&(le.scrtm=0,Pe.trigger(pe)),le.scrtm=requestAnimationFrame(function(){le.scrtm=0,Pe.trigger(pe)})}).on(pe,function(){ue=!1,me()}),qe=e("
 
").css({position:"absolute",width:"1px",height:"1px"}).hide(),Re=R?e('
').attr("title",t.i18n("selectall")).on("click",function(t){return t.stopPropagation(),t.preventDefault(),!e(this).data("pending")&&(Re.data("pending",!0),void(Ue.hasClass("elfinder-cwd-allselected")?(Re.find("input").prop("checked",!1),requestAnimationFrame(function(){ne()})):te()))}):e(),He=null,_e=function(t){var n=function(){if("undefined"!=typeof le.renderd){var t=0;Pe.siblings("div.elfinder-panel:visible").each(function(){t+=e(this).outerHeight(!0)}),Pe.height(Le.height()-t-Pe._padding)}};t&&n(),He&&cancelAnimationFrame(He),He=requestAnimationFrame(function(){!t&&n();var e,i;Ue.css("height","auto"),e=Pe[0].clientHeight-parseInt(Pe.css("padding-top"))-parseInt(Pe.css("padding-bottom"))-parseInt(Ue.css("margin-top")),i=Ue.outerHeight(!0),i').insertAfter(Ue),Be=e('
'),$e=function(){var e,n,i;o&&clearTimeout(o),l&&t.volumeExpires[l]&&(n=t.volumeExpires[l]-+new Date/1e3,i=n%60+.1,e=Math.floor(n/60),Be.html(t.i18n(["minsLeft",e])).show(),e&&(o=setTimeout($e,1e3*i)))},Ve={icons:{},list:{}};t.UA.ltIE10||We.append(e('
').html(t.i18n("volume_Trash"))).append(Be),$=Object.assign($,n.replacement||{});try{_=t.storage("cwdColWidth")?t.storage("cwdColWidth"):null}catch(Ke){_=null}t.bind("columnpref",function(i){var a=i.data||{};(D=t.storage("cwdCols"))?(D=e.grep(D,function(e){return n.listView.columns.indexOf(e)!==-1}),n.listView.columns.length>D.length&&e.each(n.listView.columns,function(e,t){D.indexOf(t)===-1&&D.push(t)})):D=n.listView.columns;var o=t.storage("columnhides")||null;o&&Object.keys(o).length&&(D=e.grep(D,function(e){return!o[e]})),N.row=q(),p&&a.repaint&&De()}).trigger("columnpref"),d&&e("body").on("touchstart touchmove touchend",function(e){}), R&&Ue.addClass("elfinder-has-checkbox"),e(window).on("scroll."+t.namespace,function(){c&&cancelAnimationFrame(c),c=requestAnimationFrame(function(){Pe.trigger(pe)})}),e(document).on("keydown."+t.namespace,function(n){n.keyCode==e.ui.keyCode.ESCAPE&&(t.getUI().find(".ui-widget:visible").length||ne())}),t.one("init",function(){var i,a,o,s,l=document.createElement("style"),c=0;document.head&&(document.head.appendChild(l),i=l.sheet,i.insertRule('.elfinder-cwd-wrapper-empty .elfinder-cwd:not(.elfinder-table-header-sticky):after{ content:"'+t.i18n("emptyFolder")+'" }',c++),i.insertRule('.elfinder-cwd-wrapper-empty .native-droppable .elfinder-cwd:not(.elfinder-table-header-sticky):after{ content:"'+t.i18n("emptyFolder"+(d?"LTap":"Drop"))+'" }',c++),i.insertRule('.elfinder-cwd-wrapper-empty .ui-droppable-disabled .elfinder-cwd:not(.elfinder-table-header-sticky):after{ content:"'+t.i18n("emptyFolder")+'" }',c++),i.insertRule('.elfinder-cwd-wrapper-empty.elfinder-search-result .elfinder-cwd:not(.elfinder-table-header-sticky):after{ content:"'+t.i18n("emptySearch")+'" }',c++),i.insertRule('.elfinder-cwd-wrapper-empty.elfinder-search-result.elfinder-incsearch-result .elfinder-cwd:not(.elfinder-table-header-sticky):after{ content:"'+t.i18n("emptyIncSearch")+'" }',c++),i.insertRule('.elfinder-cwd-wrapper-empty.elfinder-search-result.elfinder-letsearch-result .elfinder-cwd:not(.elfinder-table-header-sticky):after{ content:"'+t.i18n("emptyLetSearch")+'" }',c++)),(s=t.storage("iconsize")||n.iconsView.size||0)&&(s=Math.min(s,n.iconsView.sizeMax),Ue.trigger("iconpref",{size:s})),d||(t.one("open",function(){i&&t.zIndex&&i.insertRule(".ui-selectable-helper{z-index:"+t.zIndex+";}",c++)}),o=e('
'),a=t.getUI(),a.on("resize",function(e,t){var n;e.preventDefault(),e.stopPropagation(),t&&t.fullscreen&&(n=a.offset(),"on"===t.fullscreen?(o.css({top:n.top*-1,left:n.left*-1}).appendTo(a),he.appendTo=o):(o.detach(),he.appendTo="body"),Ue.data("selectable")&&Ue.selectable("option",{appendTo:he.appendTo}))})),r=t.getUI("tree").length}).bind("enable",function(){_e()}).bind("request.open",function(){le.getTmbs=[]}).one("open",function(){t.maxTargets&&(S=Math.min(t.maxTargets,S))}).bind("open add remove searchend",function(){var n=t.cwd().hash,i=this.type;if(("open"===i||"searchend"===i||t.searchStatus.state<2)&&(F=e.map(t.files(n),function(e){return e.hash}),t.trigger("cwdhasheschange",F)),"open"===i){var a=function(){var n=!1;return e.each(M,function(e,i){if(t.trashes[i])return n=!0,!1}),n},o=n&&(!t.file(n)||r)?r?function(){var n=e.Deferred();return t.one("treesync",function(e){e.data.always(function(){n.resolve()})}),n}():t.request({data:{cmd:"parents",target:t.cwd().hash},preventFail:!0}):null,s=t.cwd();s.volumeid!==l&&(Be.empty().hide(),l&&Pe.removeClass("elfinder-cwd-wrapper-"+l),l=s.volumeid,$e(),Pe.addClass("elfinder-cwd-wrapper-"+l)),e.when(o).done(function(){M=t.parents(s.hash),Pe[a()?"addClass":"removeClass"]("elfinder-cwd-wrapper-trash")}),E=void 0,ne({notrigger:!0}),De()}}).bind("search",function(n){F=e.map(n.data.files,function(e){return e.hash}),t.trigger("cwdhasheschange",F),E=void 0,t.searchStatus.ininc=!1,De(),t.autoSync("stop")}).bind("searchend",function(e){(O||E)&&(O="",E?t.trigger("incsearchend",e.data):e.data&&e.data.noupdate||De()),t.autoSync()}).bind("searchstart",function(e){ne(),O=e.data.query}).bind("incsearchstart",function(n){var i=n.data.query||"",a=n.data.type||"SearchName",o=t.options.commandsOptions.search.searchTypes||{};(o[a]&&o[a].incsearch||"SearchName"===a)&&(Q={},t.lazy(function(){var n,r,s="";if(O=i,i){if("/"===i.substr(0,1)&&(i=i.substr(1),s="^"),n=new RegExp(s+i.replace(/([\\*\;\.\?\[\]\{\}\(\)\^\$\-\|])/g,"\\$1"),"i"),"SearchName"===a)E=e.grep(F,function(e){var i=t.file(e);return!(!i||!(i.name.match(n)||i.i18&&i.i18.match(n)))});else if(r=o[a].incsearch,"string"==typeof r)E=e.grep(F,function(e){var i=t.file(e);return!!(i&&i[r]&&(i[r]+"").match(n))});else if("function"==typeof r)try{E=e.grep(r({val:i,regex:n},F,t),function(e){return!!t.file(e)})}catch(l){E=[]}t.trigger("incsearch",{hashes:E,query:i}).searchStatus.ininc=!0,De(),t.autoSync("stop")}else t.trigger("incsearchend")}))}).bind("incsearchend",function(e){O="",t.searchStatus.ininc=!1,E=void 0,e.data&&e.data.noupdate||De(),t.autoSync()}).bind("sortchange",function(){var e=Pe.scrollLeft(),n=Ue.hasClass("elfinder-cwd-allselected");De(),t.one("cwdrender",function(){Pe.scrollLeft(e),n&&(Q=t.arrayFlip(E||F,!0)),(n||Object.keys(Q).length)&&oe()})}).bind("viewchange",function(){var e="list"!=t.viewType,n=Ue.hasClass("elfinder-cwd-allselected");e!=p&&(p=e,t.viewType=p?"list":"icons",s&&t.one("cwdinit",function(){Ue.trigger("iconpref",{size:s})}),De(),_e(),n&&(Ue.addClass("elfinder-cwd-allselected"),Re.find("input").prop("checked",!0)),Object.keys(Q).length&&oe())}).bind("wzresize",function(){var e,n=p?Ue.find("tbody"):Ue;_e(!0),le.hpi&&Fe(n,n.find("[id]").length),e=Ue.offset(),Le.data("rectangle",Object.assign({width:Le.width(),height:Le.height(),cwdEdge:"ltr"===t.direction?e.left:e.left+Ue.width()},Le.offset())),le.itemH=(p?n.find("tr:first"):n.find("[id]:first")).outerHeight(!0)}).bind("changeclipboard",function(t){I={},t.data&&t.data.clipboard&&t.data.clipboard.length&&e.each(t.data.clipboard,function(e,t){t.cut&&(I[t.hash]=!0)})}).bind("resMixinMake",function(){Ce()}).bind("tmbreload",function(t){var n={},i=t.data&&t.data.files?t.data.files:null;e.each(i,function(e,t){t.tmb&&"1"!=t.tmb&&(n[t.hash]=t.tmb)}),Object.keys(n).length&&Ae(n,!0)}).add(function(n){var i=O?new RegExp(O.replace(/([\\*\;\.\?\[\]\{\}\(\)\^\$\-\|])/g,"\\$1"),"i"):null,a=t.searchStatus.mime,o=t.searchStatus.state>1,r=o&&t.searchStatus.target?t.searchStatus.target:t.cwd().hash,s=t.path(r),l=function(n){var l,c;return l=n.phash===r,!l&&o&&(c=n.path||t.path(n.hash),l=s&&0===c.indexOf(s),!l&&t.searchStatus.mixed&&(l=!!e.grep(t.searchStatus.mixed,function(e){return 0===n.hash.indexOf(e)}).length)),l&&o&&(l=a?0===n.mime.indexOf(a):!!(n.name.match(i)||n.i18&&n.i18.match(i))),l},c=e.grep(n.data.added||[],function(e){return!!l(e)});Se(c),2===t.searchStatus.state&&(e.each(c,function(t,n){e.inArray(n.hash,F)===-1&&F.push(n.hash)}),t.trigger("cwdhasheschange",F)),p&&_e(),Pe.trigger(pe)}).change(function(n){var i,a=t.cwd().hash,o=t.selected();O?e.each(n.data.changed||[],function(n,a){t.cwdHash2Elm(a.hash).length&&(Oe([a.hash]),Se([a],"change"),e.inArray(a.hash,o)!==-1&&Z(a.hash),i=!0)}):e.each(e.grep(n.data.changed||[],function(e){return e.phash==a}),function(n,a){t.cwdHash2Elm(a.hash).length&&(Oe([a.hash]),Se([a],"change"),e.inArray(a.hash,o)!==-1&&Z(a.hash),i=!0)}),i&&(t.trigger("cwdhasheschange",F),p&&_e(),Pe.trigger(pe)),oe()}).remove(function(e){var t=p?Ue.find("tbody"):Ue;Oe(e.data.removed||[]),oe(),se.length<1&&t.children(b+(n.oldSchool?":not(.elfinder-cwd-parent)":"")).length<1?(Le.addClass("elfinder-cwd-wrapper-empty"),R&&Re.find("input").prop("checked",!1),qe.hide(),Pe.off(pe,ye),_e()):(Fe(t),Pe.trigger(pe))}).dragstart(function(t){var n=e(t.data.target),i=t.data.originalEvent;n.hasClass(v)&&(n.hasClass(y)||(!(i.ctrlKey||i.metaKey||i.shiftKey)&&ne({notrigger:!0}),n.trigger(u),oe())),Ue.removeClass(w).data("selectable")&&Ue.selectable("disable"),G=!0}).dragstop(function(){Ue.data("selectable")&&Ue.selectable("enable"),G=!1}).bind("lockfiles unlockfiles selectfiles unselectfiles",function(n){var i,a,o,r={lockfiles:f,unlockfiles:m,selectfiles:u,unselectfiles:h},s=r[n.type],l=n.data.files||[],c=l.length,d=n.data.helper||e();if(c>0&&(i=t.parents(l[0])),s!==u&&s!==h||(o=s===u,e.each(l,function(e,t){var n=Ue.hasClass("elfinder-cwd-allselected");Q[t]?(n&&(R&&Re.children("input").prop("checked",!1),Ue.removeClass("elfinder-cwd-allselected"),n=!1),!o&&delete Q[t]):o&&(Q[t]=!0)})),!d.data("locked")){for(;c--;)try{t.cwdHash2Elm(l[c]).trigger(s)}catch(n){}!n.data.inselect&&oe()}Pe.data("dropover")&&i.indexOf(Pe.data("dropover"))!==-1&&(a="lockfiles"!==n.type,d.toggleClass("elfinder-drag-helper-plus",a),Pe.toggleClass(T,a))}).bind("mkdir mkfile duplicate upload rename archive extract paste multiupload",function(n){if("upload"!=n.type||!n.data._multiupload){var i=t.cwd().hash;ne({notrigger:!0}),e.each((n.data.added||[]).concat(n.data.changed||[]),function(e,t){t&&t.phash==i&&Z(t.hash)}),oe()}}).shortcut({pattern:"ctrl+a",description:"selectall",callback:te}).shortcut({pattern:"ctrl+shift+i",description:"selectinvert",callback:ie}).shortcut({pattern:"left right up down shift+left shift+right shift+up shift+down",description:"selectfiles",type:"keydown",callback:function(e){Y(e.keyCode,e.shiftKey)}}).shortcut({pattern:"home",description:"selectffile",callback:function(e){ne({notrigger:!0}),re(Ue.find("[id]:first").trigger(u)),oe()}}).shortcut({pattern:"end",description:"selectlfile",callback:function(e){ne({notrigger:!0}),re(Ue.find("[id]:last").trigger(u)),oe()}}).shortcut({pattern:"page_up",description:"pageTurning",callback:function(e){le.itemH&&Pe.scrollTop(Math.round(Pe.scrollTop()-Math.floor((Pe.height()+(p?le.itemH*-1:16))/le.itemH)*le.itemH))}}).shortcut({pattern:"page_down",description:"pageTurning",callback:function(e){le.itemH&&Pe.scrollTop(Math.round(Pe.scrollTop()+Math.floor((Pe.height()+(p?le.itemH*-1:16))/le.itemH)*le.itemH))}})}),this},e.fn.elfinderdialog=function(t,n){var i,a,o,r,s=window.navigator.platform.indexOf("Win")!=-1,l={},c={enabled:!1,width:!1,height:!1,defaultSize:null},d=function(t){var i,a;c.enabled&&(a=n.options.dialogContained?o:e(window),i={maxWidth:c.width?a.width()-l.width:null,maxHeight:c.height?a.height()-l.height:null},Object.assign(r,i),t.css(i).trigger("resize"),t.data("hasResizable")&&(t.resizable("option","maxWidth")'+t.title+""),z=e('
'),T=e('
').append(z),A=0,j=0,S=e(),O=e('
').hide(),I=function(){t.optimizeNumber&&P.find("input[type=number]").each(function(){e(this).attr("inputmode","numeric"),e(this).attr("pattern","[0-9]*")})},M=function(){S=P.find("."+y),S.length&&(S.attr("tabindex","-1"),S.filter("."+w).length||z.children("."+y+":"+(s?"first":"last")).addClass(w))},F=function(t){var n=S.filter(":visible:enabled"),i=t?null:n.filter("."+w+":first");return i&&i.length||(i=n.first()),t&&e.each(n,function(e,a){if(a===t&&n[e+1])return i=n.eq(e+1),!1}),i},E=function(t){var n=S.filter(":visible:enabled"),i=n.last();return e.each(n,function(e,a){if(a===t&&n[e-1])return i=n.eq(e-1),!1}),i},D=function(){e.each(t.headerBtnOrder.split(":").reverse(),function(e,t){U[t]&&U[t]()}),s&&C.children(".elfinder-titlebar-button").addClass("elfinder-titlebar-button-right")},U={close:function(){C.prepend(e('').on("mousedown touchstart",function(e){e.preventDefault(),e.stopPropagation(),f.elfinderdialog("close")}))},maximize:function(){t.allowMaximize&&(P.on("resize",function(e,t){var n,i;if(e.preventDefault(),e.stopPropagation(),t&&t.maximize){if(i=C.find(".elfinder-titlebar-full"),n="on"===t.maximize,i.children("span.ui-icon").toggleClass("ui-icon-plusthick",!n).toggleClass("ui-icon-arrowreturnthick-1-s",n),n){try{P.hasClass("ui-draggable")&&P.draggable("disable"),P.hasClass("ui-resizable")&&P.resizable("disable")}catch(e){}f.css("width","100%").css("height",P.height()-P.children(".ui-dialog-titlebar").outerHeight(!0)-T.outerHeight(!0))}else{f.attr("style",i.data("style")),i.removeData("style"),q();try{P.hasClass("ui-draggable")&&P.draggable("enable"),P.hasClass("ui-resizable")&&P.resizable("enable")}catch(e){}}P.trigger("resize",{init:!0})}}),C.prepend(e('').on("mousedown touchstart",function(i){var a=e(this);i.preventDefault(),i.stopPropagation(),P.hasClass("elfinder-maximized")||"undefined"!=typeof a.data("style")||(f.height(f.height()),a.data("style",f.attr("style")||"")),n.toggleMaximize(P),"function"==typeof t.maximize&&t.maximize.call(f[0])})))},minimize:function(){var i,a,o;t.allowMinimize&&(i=e('').on("mousedown touchstart",function(i){var r=e(this),s=n.getUI("bottomtray"),l={width:70,height:24},c=e("
").css(l).addClass(P.get(0).className+" elfinder-dialog-minimized"),d=function(){a.remove(),P.removeData("minimized").show(),f.elfinderdialog("close")},p={};i.preventDefault(),i.stopPropagation(),P.data("minimized")?(P.removeData("minimized").before(a.css(Object.assign({position:"absolute"},a.offset()))),n.toFront(a),a.animate(Object.assign({width:P.width(),height:P.height()},o),function(){P.show(),n.toFront(P),a.remove(),q(),u(),P.trigger("resize",{init:!0}),"function"==typeof t.minimize&&t.minimize.call(f[0])})):(o=P.data("minimized",{dialog:function(){return a},show:function(){a.show()},hide:function(){a.hide()},close:d,title:function(e){a.children(".ui-dialog-titlebar").children(".elfinder-dialog-title").text(e)}}).position(),a=P.clone().on("mousedown",function(){r.trigger("mousedown")}).removeClass("ui-draggable ui-resizable elfinder-frontmost"),s.append(c),Object.assign(p,c.offset(),l),c.remove(),a.height(P.height()).children(".ui-dialog-content:first").empty(),n.toHide(P.before(a)),a.children(".ui-dialog-content:first,.ui-dialog-buttonpane,.ui-resizable-handle").remove(),a.find(".elfinder-titlebar-minimize,.elfinder-titlebar-full").remove(),a.find(".ui-dialog-titlebar-close").on("mousedown",function(e){e.stopPropagation(),e.preventDefault(),d()}),a.animate(p,function(){a.attr("style","").css({maxWidth:P.width()}).addClass("elfinder-dialog-minimized").appendTo(s),u(),"function"==typeof t.minimize&&t.minimize.call(f[0])}))}),C.on("dblclick",function(t){e(this).children(".elfinder-titlebar-minimize").trigger("mousedown")}).prepend(i),P.on("togleminimize",function(){i.trigger("mousedown")}))}},P=e('
').hide().append(f).appendTo(o).draggable({containment:n.options.dialogContained?o:null,handle:".ui-dialog-titlebar",start:function(){O.show()},drag:function(e,t){var i=t.offset.top,a=t.offset.left;i<0&&(t.position.top=t.position.top-i),a<0&&(t.position.left=t.position.left-a),n.options.dialogContained&&(t.position.top<0&&(t.position.top=0),t.position.left<0&&(t.position.left=0))},stop:function(e,n){O.hide(),P.css({height:t.height}),f.data("draged",!0)}}).css({width:t.width,height:t.height,minWidth:t.minWidth,minHeight:t.minHeight,maxWidth:t.maxWidth,maxHeight:t.maxHeight}).on("touchstart touchmove touchend click dblclick mouseup mouseenter mouseleave mouseout mouseover mousemove",function(e){!h[e.type]&&e.stopPropagation()}).on("mousedown",function(t){!h[t.type]&&t.stopPropagation(),requestAnimationFrame(function(){P.is(":visible")&&!P.hasClass("elfinder-frontmost")&&(a=e(":focus"),a.length||(a=void 0),P.trigger("totop"))})}).on("open",function(){P.data("margin-y",f.outerHeight(!0)-f.height()),c.enabled&&(t.height&&"auto"!==t.height&&P.trigger("resize",{init:!0}),c.defaultSize||(c.defaultSize={width:f.width(),height:f.height()}),d(P),P.trigger("resize").trigger("posinit"),o.on("resize."+n.namespace,P,p)),P.hasClass(v)||o.children("."+g+":visible:not(."+v+")").each(function(){var t=e(this),n=parseInt(t.css("top")),i=parseInt(t.css("left")),a=parseInt(P.css("top")),o=parseInt(P.css("left")),r=Math.abs(n-a)<10,s=Math.abs(i-o)<10;t[0]!=P[0]&&(r||s)&&P.css({top:r?n+10:a,left:s?i+10:o})}),P.data("modal")&&(P.addClass(x),n.getUI("overlay").elfinderoverlay("show")),P.trigger("totop"),t.openMaximized&&n.toggleMaximize(P),n.trigger("dialogopen",{dialog:P}),"function"==typeof t.open&&e.proxy(t.open,f[0])(),t.closeOnEscape&&e(document).on("keydown."+k,function(t){t.keyCode==e.ui.keyCode.ESCAPE&&P.hasClass("elfinder-frontmost")&&f.elfinderdialog("close")}),P.hasClass(n.res("class","editing"))&&u()}).on("close",function(i){var a,r;t.beforeclose&&"function"==typeof t.beforeclose?(r=t.beforeclose(),r&&r.promise||(r=r?e.Deferred().resolve():e.Deferred().reject())):r=e.Deferred().resolve(),r.done(function(){c.enabled&&o.off("resize."+n.namespace,p),t.closeOnEscape&&e(document).off("keyup."+k),t.allowMaximize&&n.toggleMaximize(P,!1),n.toHide(P),P.data("modal")&&n.getUI("overlay").elfinderoverlay("hide"),"function"==typeof t.close&&e.proxy(t.close,f[0])(),t.destroyOnClose&&P.parent().length&&P.hide().remove(),a=o.children("."+g+":visible"),P.hasClass(n.res("class","editing"))&&u()})}).on("totop frontmost",function(){var e=n.storage("autoFocusDialog");P.data("focusOnMouseOver",e?e>0:n.options.uiOptions.dialog.focusOnMouseOver),P.data("minimized")&&C.children(".elfinder-titlebar-minimize").trigger("mousedown"),!P.data("modal")&&n.getUI("overlay").is(":visible")?n.getUI("overlay").before(P):n.toFront(P),o.children("."+g+":not(."+x+")").removeClass(m),P.addClass(m),!n.UA.Mobile&&(a||F()).trigger("focus"),a=void 0}).on("posinit",function(){var i,a,s,l,c,d,p,u=t.position;if(!P.hasClass("elfinder-maximized")){if(!u&&!P.data("resizing")){if(p=o.hasClass("elfinder-fullscreen")||n.options.enableAlways,P.css(p?{maxWidth:"100%",maxHeight:"100%",overflow:"auto"}:r),n.UA.Mobile&&!p&&P.data("rotated")===n.UA.Rotated)return;P.data("rotated",n.UA.Rotated),c=e(window),i=o.offset(),l={width:P.outerWidth(!0),height:P.outerHeight(!0)},l.right=i.left+l.width,l.bottom=i.top+l.height,d={scrLeft:c.scrollLeft(),scrTop:c.scrollTop(),width:c.width(),height:c.height()},d.right=d.scrLeft+d.width,d.bottom=d.scrTop+d.height,n.options.dialogContained||p?(a=0,s=0):(a=i.top*-1+d.scrTop,s=i.left*-1+d.scrLeft),u={top:l.height>=d.height?a:Math.max(a,parseInt((o.height()-l.height)/2-42)),left:l.width>=d.width?s:Math.max(s,parseInt((o.width()-l.width)/2))},l.right+u.left>d.right&&(u.left=Math.max(s,d.right-l.right)),l.bottom+u.top>d.bottom&&(u.top=Math.max(a,d.bottom-l.bottom))}t.absolute&&(u.position="absolute"),u&&P.css(u)}}).on("resize",function(n,i){var a,o,r,s,l=0,d=i&&i.init;i&&(i.minimize||i.maxmize)||P.data("minimized")||(n.stopPropagation(),n.preventDefault(),P.children(".ui-widget-header,.ui-dialog-buttonpane").each(function(){l+=e(this).outerHeight(!0)}),s="auto"===t.height,s&&f.css({"max-height":"",height:"auto"}),d||!c.enabled||n.originalEvent||P.hasClass("elfinder-maximized")?a=P.height()-l-P.data("margin-y"):(a=P.height(),o=P.css("min-height")||a,r=P.css("max-height")||a,o=o.match(/%/)?Math.floor(parseInt(o)/100*P.parent().height()):parseInt(o),r=r.match(/%/)?Math.floor(parseInt(r)/100*P.parent().height()):parseInt(r),a=Math.min(s?P.height():c.defaultSize.height,Math.max(r,o)-l-P.data("margin-y"))),f.css(s?"max-height":"height",a),d||(q(),o=f.height(),o=a'+t+"").on("click",e.proxy(n,f[0]));n._cssClass&&i.addClass(n._cssClass),s?z.append(i):z.prepend(i)}),z.children().length&&(P.append(T),P.show(),T.find("button").each(function(t,n){A+=e(n).outerWidth(!0)}),P.hide(),A+=20,P.width()1&&(e=c.outerHeight(!0)),d.height(u.height()-e-i)}).trigger("wzresize")};t.cssloaded?e():t.one("cssloaded",e)}).one("opendone",function(){o&&o.trigger("resize"),d.css("overflow","auto")}).bind("themechange",m),t.UA.Touch&&(s=t.storage("autoHide")||{},"undefined"==typeof s.navbar&&(s.navbar=n.autoHideUA&&n.autoHideUA.length>0&&e.grep(n.autoHideUA,function(e){return!!t.UA[e]}).length,t.storage("autoHide",s)),s.navbar&&t.one("init",function(){d.children().length&&t.uiAutoHide.push(function(){d.stop(!0,!0).trigger("navhide",{duration:"slow",init:!0})})}),t.bind("load",function(){d.children().length&&(r=e('
').hide().appendTo(u),"none"!==r.css("pointer-events")&&(r.remove(),r=null))}),d.on("navshow navhide",function(e,n){var i="navshow"===e.type?"show":"hide",a=n&&n.duration?n.duration:"fast",o=n&&n.handleW?n.handleW:Math.max(50,t.getUI().width()/10);d.stop(!0,!0)[i]({duration:a,step:function(){t.trigger("wzresize")},complete:function(){r&&("show"===i?r.stop(!0,!0).hide():(r.width(o?o:""),t.resources.blink(r,"slowonce"))),t.trigger("navbar"+i),n.init&&t.trigger("uiautohide"),f()}}),s.navbar="show"!==i,t.storage("autoHide",Object.assign(t.storage("autoHide"),{navbar:s.navbar}))}).on("touchstart",function(n){e(this)["scroll"+("ltr"===t.direction?"Right":"Left")]()>5&&(n.originalEvent._preventSwipeX=!0)})),t.UA.Mobile||(o=d.resizable({handles:h?"e":"w",minWidth:n.minWidth||150,maxWidth:n.maxWidth||500,resize:function(){t.trigger("wzresize")},stop:function(e,n){t.storage("navbarWidth",n.size.width),f()}}).on("resize scroll",function(n){var i=e(this),a=i.data("posinit");n.preventDefault(),n.stopPropagation(),h||"resize"!==n.type||d.css("left",0),a&&cancelAnimationFrame(a),i.data("posinit",requestAnimationFrame(function(){var e=t.UA.Opera&&d.scrollLeft()?20:2;o.css("top",0).css({top:parseInt(d.scrollTop())+"px",left:h?"auto":parseInt(d.scrollRight()-e)*-1,right:h?parseInt(d.scrollLeft()-e)*-1:"auto"}),"resize"===n.type&&t.getUI("cwd").trigger("resize")}))}).children(".ui-resizable-handle").addClass("ui-front")),(l=t.storage("navbarWidth"))?d.width(l):t.UA.Mobile&&t.one(t.cssloaded?"init":"cssloaded",function(){var n=function(){l=d.parent().width()/2,d.data("defWidth")>l?d.width(l):d.width(d.data("defWidth")),d.data("width",d.width()),t.trigger("wzresize")};d.data("defWidth",d.width()),e(window).on("resize."+t.namespace,n),n()})}),this},e.fn.elfindernavdock=function(t,n){return this.not(".elfinder-navdock").each(function(){var i,a,o=e(this).hide().addClass("ui-state-default elfinder-navdock touch-punch"),r=o.parent(),s=(r.children(".elfinder-workzone").append(o),function(n,i){var a,r=i||o.height(),s=n-r,l=Object.keys(c).length,d=l?s/l:0;s&&(a=o.css("overflow"),o.css("overflow","hidden"),o.height(n),e.each(c,function(e,n){n.height(n.height()+d).trigger("resize."+t.namespace)}),t.trigger("wzresize"),o.css("overflow",a))}),l=e('
').appendTo(o),c={},d=(parseInt(n.initMaxHeight)||50)/100,p=(parseInt(n.maxHeight)||90)/100;o.data("addNode",function(e,n){var r,u,h,f=t.getUI("workzone").height(),m=f*d;return n=Object.assign({first:!1,sizeSync:!0,init:!1},n),e.attr("id")||e.attr("id",t.namespace+"-navdock-"+ +new Date),n.sizeSync&&(c[e.attr("id")]=e),r=o.height(),u=r+e.outerHeight(!0),n.first?l.after(e):o.append(e),a=!0,o.resizable("enable").height(u).show(),t.trigger("wzresize"),n.init&&(h=t.storage("navdockHeight"),u=h?h:u>m?m:u,i=u),s(Math.min(u,f*p)),o}).data("removeNode",function(n,i){var r=e("#"+n);return delete c[n],o.height(o.height()-e("#"+n).outerHeight(!0)),i?"detach"===i?r=r.detach():i.append(r):r.remove(),o.children().length<=1&&(a=!1,o.resizable("disable").height(0).hide()),t.trigger("wzresize"),r}),n.disabled||t.one("init",function(){var e;t.getUI("navbar").children().not(".ui-resizable-handle").length&&(o.data("dockEnabled",!0),o.resizable({maxHeight:t.getUI("workzone").height()*p,handles:{n:l},start:function(n,i){e=o.css("overflow"),o.css("overflow","hidden"),t.trigger("navdockresizestart",{event:n,ui:i},!0)},resize:function(e,n){o.css("top",""),t.trigger("wzresize",{inNavdockResize:!0})},stop:function(n,a){t.trigger("navdockresizestop",{event:n,ui:a},!0),o.css("top",""),i=a.size.height,t.storage("navdockHeight",i),s(i,a.originalSize.height),o.css("overflow",e)}}),t.bind("wzresize",function(e){var n,a;o.is(":visible")&&(n=t.getUI("workzone").height()*p,e.data&&e.data.inNavdockResize||(a=o.height(),n1&&s(n):Math.abs(a-i)>1&&s(i)),o.resizable("option","maxHeight",n))}).bind("themechange",function(){var e=Math.round(o.height());requestAnimationFrame(function(){var t=Math.round(o.height()),n=e-t;0!==n&&s(o.height(),t-n)})})),t.bind("navbarshow navbarhide",function(e){o[a&&"navbarshow"===e.type?"show":"hide"]()})})}),this},e.fn.elfinderoverlay=function(t){var n,i,a,o,r=this.parent().elfinder("instance");return this.filter(":not(.elfinder-overlay)").each(function(){t=Object.assign({},t),e(this).addClass("ui-front ui-widget-overlay elfinder-overlay").hide().on("mousedown",function(e){e.preventDefault(),e.stopPropagation()}).data({cnt:0,show:"function"==typeof t.show?t.show:function(){},hide:"function"==typeof t.hide?t.hide:function(){}})}),"show"==t&&(n=this.eq(0),i=n.data("cnt")+1,a=n.data("show"),r.toFront(n),n.data("cnt",i),n.is(":hidden")&&(n.show(),a())),"hide"==t&&(n=this.eq(0),i=n.data("cnt")-1,o=n.data("hide"),n.data("cnt",i),i<=0&&(n.hide(), -o())),this},e.fn.elfinderpanel=function(t){return this.each(function(){var n=e(this).addClass("elfinder-panel ui-state-default ui-corner-all"),i="margin-"+("ltr"==t.direction?"left":"right");t.one("load",function(e){var a=t.getUI("navbar");n.css(i,parseInt(a.outerWidth(!0))),a.on("resize",function(e){e.preventDefault(),e.stopPropagation(),n.is(":visible")&&n.css(i,parseInt(a.outerWidth(!0)))})})})},e.fn.elfinderpath=function(t,n){return this.each(function(){var a,o,r="",s="",l=[],c="statusbar",d=t.res("class","hover"),p="path"+(i.prototype.uniqueid?i.prototype.uniqueid:"")+"-",u=e('
'),h=e(this).addClass("elfinder-path").html(" ").on("mousedown","span.elfinder-path-dir",function(n){var i=e(this).attr("id").substr(p.length);n.preventDefault(),i!=t.cwd().hash&&(e(this).addClass(d),r?t.exec("search",r,{target:i,mime:l.join(" ")}):t.trigger("select",{selected:[i]}).exec("open",i))}).prependTo(t.getUI("statusbar").show()),f=e('
').on("click",function(n){n.stopPropagation(),n.preventDefault();var i=e.map(t.roots,function(e){return t.file(e)}),a=[];e.each(i,function(e,n){n.phash||t.root(t.cwd().hash,!0)===n.hash||a.push({label:t.escape(n.i18||n.name),icon:"home",callback:function(){t.exec("open",n.hash)},options:{iconClass:n.csscls||"",iconImg:n.icon||""}})}),t.trigger("contextmenu",{raw:a,x:n.pageX,y:n.pageY})}).append('').appendTo(u),m=function(n){var i=[],a=[];return e.each(t.parents(n),function(e,o){var r=n===o?"elfinder-path-dir elfinder-path-cwd":"elfinder-path-dir",s=t.file(o),l=t.escape(s.i18||s.name);a.push(l),i.push(''+l+"")}),i.join(''+t.option("separator")+"")},g=function(){var n;h.children("span.elfinder-path-dir").attr("style",""),n="ltr"===t.direction?e("#"+p+t.cwd().hash).prevAll("span.elfinder-path-dir:first"):e(),h.scrollLeft(n.length?n.position().left:0)},v=function(){if(!t.UA.CSS.flex){var n,i,a=h.children("span.elfinder-path-dir"),o=a.length;if("workzone"===c||o<2)return void a.attr("style","");h.width(h.css("max-width")),a.css({maxWidth:100/o+"%",display:"inline-block"}),n=h.width()-9,h.children("span.elfinder-path-other").each(function(){n-=e(this).width()}),i=[],a.each(function(t){var a=e(this),o=a.width();n-=o,o0&&(n/=i.length,e.each(i,function(t,i){var o=e(a[i]);o.css("max-width",o.width()+n)})),a.last().attr("style","")):a.attr("style","")}};t.one("init",function(){a=t.getUI("tree").length,o=t.getUI("stat").length,!a&&n.toWorkzoneWithoutNavbar&&(u.append(h).insertBefore(t.getUI("workzone")),c="workzone",t.bind("open",g).one("opendone",function(){t.getUI().trigger("resize")}))}).bind("open searchend parents",function(){r="",s="",l=[],h.html(m(t.cwd().hash)),Object.keys(t.roots).length>1?(h.css("margin",""),f.show()):(h.css("margin",0),f.hide()),!o&&v()}).bind("searchstart",function(e){e.data&&(r=e.data.query||"",s=e.data.target||"",l=e.data.mimes||[])}).bind("search",function(e){var n="";n=s?m(s):t.i18n("btnAll"),h.html(''+t.i18n("searcresult")+": "+n),v()}).bind("navbarshow navbarhide",function(){var e=t.getUI("workzone");"navbarshow"===this.type?(t.unbind("open",g),h.prependTo(t.getUI("statusbar")),u.detach(),c="statusbar"):(u.append(h).insertBefore(e),c="workzone",g(),t.bind("open",g)),t.trigger("uiresize")}).bind("resize uistatchange",v)})},e.fn.elfinderplaces=function(t,n){return this.each(function(){var i={},a="class",o=t.res(a,"navdir"),r=t.res(a,"navcollapse"),s=t.res(a,"navexpand"),l=t.res(a,"hover"),c=t.res(a,"treeroot"),d=t.res(a,"adroppable"),p=t.res("tpl","placedir"),u=t.res("tpl","perms"),h=e(t.res("tpl","navspinner")),f=n.suffix?n.suffix:"",m="places"+f,g=null,v=function(e){return e.substr(6)},b=function(e){return"place-"+e},y=function(t){return e(document.getElementById(b(t)))},w=function(){var n=[],a={};n=e.map(F.children().find("[id]"),function(e){return v(e.id)}),n.length?e.each(n.reverse(),function(e,t){a[t]=i[t]}):a=null,t.storage(m,a)},x=function(){var a,o;m="places"+(n.suffix?n.suffix:""),i={},a=t.storage(m),"string"==typeof a?(a=e.grep(a.split(","),function(e){return!!e}),e.each(a,function(e,t){var n=t.split("#");i[n[0]]=n[1]?n[1]:n[0]})):e.isPlainObject(a)&&(i=a),t.trigger("placesload",{dirs:i,storageKey:m},!0),o=Object.keys(i),o.length&&(M.prepend(h),t.request({data:{cmd:"info",targets:o},preventDefault:!0}).done(function(n){var a={};n.files&&n.files.length&&t.cache(n.files),e.each(n.files,function(e,t){var n=t.hash;a[n]=t}),e.each(i,function(e,t){C(a[e]||Object.assign({notfound:!0},t))}),t.storage("placesState")>0&&M.trigger("click")}).always(function(){h.remove()}))},k=function(n,i){return e(p.replace(/\{id\}/,b(n?n.hash:i)).replace(/\{name\}/,t.escape(n?n.i18||n.name:i)).replace(/\{cssclass\}/,n?t.perms2class(n)+(n.notfound?" elfinder-na":"")+(n.csscls?" "+n.csscls:""):"").replace(/\{permissions\}/,!n||n.read&&n.write&&!n.notfound?"":u).replace(/\{title\}/,n?' title="'+t.escape(t.path(n.hash,!0)||n.i18||n.name)+'"':"").replace(/\{symlink\}/,"").replace(/\{style\}/,n&&n.icon?t.getIconStyle(n):""))},C=function(e){var n,a;return"directory"===e.mime&&(a=e.hash,t.files().hasOwnProperty(a)||t.trigger("tree",{tree:[e]}),n=k(e,a),i[a]=e,F.prepend(n),M.addClass(r),O.toggle(F.children().length>1),!0)},z=function(e){var t,n,a=null;return i[e]&&(delete i[e],t=y(e),t.length&&(a=t.text(),t.parent().remove(),n=F.children().length,O.toggle(n>1),n||(M.removeClass(r),E.removeClass(s),F.slideToggle(!1)))),a},T=function(e){var n=y(e),i=n.parent(),a=i.prev("div"),o="ui-state-hover",r=t.getUI("contextmenu");g&&clearTimeout(g),a.length&&(r.find(":first").data("placesHash",e),n.addClass(o),i.insertBefore(a),a=i.prev("div"),g=setTimeout(function(){n.removeClass(o),r.find(":first").data("placesHash")===e&&r.hide().empty()},1500)),a.length||(n.removeClass(o),r.hide().empty())},A=function(e,t){var n=e.hash,a=y(t||n),o=k(e,n);return a.length>0&&(a.parent().replaceWith(o),i[n]=e,!0)},j=function(){F.empty(),M.removeClass(r),E.removeClass(s),F.slideToggle(!1)},S=function(){e.each(i,function(n,i){var a=t.file(n)||i,r=k(a,n),s=null;return a||r.hide(),!(!F.children().length||(e.each(F.children(),function(){var t=e(this);if((a.i18||a.name).localeCompare(t.children("."+o).text())<0)return s=!r.insertBefore(t)}),null===s))||void(!y(n).length&&F.append(r))}),w()},O=e('').hide().on("click",function(e){e.stopPropagation(),F.empty(),S()}),I=k({hash:"root-"+t.namespace,name:t.i18n(n.name,"places"),read:!0,write:!0}),M=I.children("."+o).addClass(c).on("click",function(e){e.stopPropagation(),M.hasClass(r)&&(E.toggleClass(s),F.slideToggle(),t.storage("placesState",E.hasClass(s)?1:0))}).append(O),F=I.children("."+t.res(a,"navsubtree")),E=e(this).addClass(t.res(a,"tree")+" elfinder-places ui-corner-all").hide().append(I).appendTo(t.getUI("navbar")).on("mouseenter mouseleave","."+o,function(t){e(this).toggleClass("ui-state-hover","mouseenter"==t.type)}).on("click","."+o,function(n){var i=e(this);return i.data("longtap")?void n.stopPropagation():void(!i.hasClass("elfinder-na")&&t.exec("open",i.attr("id").substr(6)))}).on("contextmenu","."+o+":not(."+c+")",function(n){var i=e(this),a=i.attr("id").substr(6);n.preventDefault(),t.trigger("contextmenu",{raw:[{label:t.i18n("moveUp"),icon:"up",remain:!0,callback:function(){T(a),w()}},"|",{label:t.i18n("rmFromPlaces"),icon:"rm",callback:function(){z(a),w()}}],x:n.pageX,y:n.pageY}),i.addClass("ui-state-hover"),t.getUI("contextmenu").children().on("mouseenter",function(){i.addClass("ui-state-hover")}),t.bind("closecontextmenu",function(){i.removeClass("ui-state-hover")})}).droppable({tolerance:"pointer",accept:".elfinder-cwd-file-wrapper,.elfinder-tree-dir,.elfinder-cwd-file",hoverClass:t.res("class","adroppable"),classes:{"ui-droppable-hover":t.res("class","adroppable")},over:function(n,a){var o=a.helper,r=e.grep(o.data("files"),function(e){return"directory"===t.file(e).mime&&!i[e]});n.stopPropagation(),o.data("dropover",o.data("dropover")+1),t.insideWorkzone(n.pageX,n.pageY)&&(r.length>0?(o.addClass("elfinder-drag-helper-plus"),t.trigger("unlockfiles",{files:o.data("files"),helper:o})):e(this).removeClass(d))},out:function(t,n){var i=n.helper;t.stopPropagation(),i.removeClass("elfinder-drag-helper-move elfinder-drag-helper-plus").data("dropover",Math.max(i.data("dropover")-1,0)),e(this).removeData("dropover").removeClass(d)},drop:function(n,a){var o=a.helper,r=!0;e.each(o.data("files"),function(e,n){var a=t.file(n);a&&"directory"==a.mime&&!i[a.hash]?C(a):r=!1}),w(),r&&o.hide()}}).on("touchstart","."+o+":not(."+c+")",function(n){if(!(n.originalEvent.touches.length>1))var i=e(this).attr("id").substr(6),a=e(this).addClass(l).data("longtap",null).data("tmlongtap",setTimeout(function(){a.data("longtap",!0),t.trigger("contextmenu",{raw:[{label:t.i18n("rmFromPlaces"),icon:"rm",callback:function(){z(i),w()}}],x:n.originalEvent.touches[0].pageX,y:n.originalEvent.touches[0].pageY})},500))}).on("touchmove touchend","."+o+":not(."+c+")",function(t){clearTimeout(e(this).data("tmlongtap")),"touchmove"==t.type&&e(this).removeClass(l)});e.fn.sortable&&F.addClass("touch-punch").sortable({appendTo:t.getUI(),revert:!1,helper:function(n){var i=e(n.target).parent();return i.children().removeClass("ui-state-hover"),e('
').append(e('
').show().append(i.clone()))},stop:function(t,n){var i=e(n.item[0]),a=E.offset().top,o=E.offset().left,r=E.width(),s=E.height(),l=t.pageX,c=t.pageY;l>o&&la&&c').on("focus",function(){!h.hasClass("ui-state-active")&&s.getUI().click(),o=!0,v="",h.addClass("ui-state-active"),s.trigger("uiresize"),n&&n.css(f()).slideDown(function(){h.addClass("ui-state-active"),s.toFront(n)})}).on("blur",function(){o=!1,n?n.data("infocus")?n.data("infocus",!1):n.slideUp(function(){h.removeClass("ui-state-active"),s.trigger("uiresize"),s.toHide(n)}):h.removeClass("ui-state-active")}).appendTo(h).on("keypress",function(e){e.stopPropagation()}).on("keydown",function(t){t.stopPropagation(),t.keyCode===e.ui.keyCode.ENTER?m():t.keyCode===e.ui.keyCode.ESCAPE&&(t.preventDefault(),g())});l.enable&&(l.minlen=l.minlen||2,l.wait=l.wait||500,b.attr("title",s.i18n("incSearchOnly")).on("compositionstart",function(){b.data("composing",!0)}).on("compositionend",function(){b.removeData("composing"),b.trigger("input")}).on("input",function(){b.data("composing")||(b.data("inctm")&&clearTimeout(b.data("inctm")),b.data("inctm",setTimeout(function(){var e=b.val();(0===e.length||e.length>=l.minlen)&&(v!==e&&s.trigger("incsearchstart",{query:e,type:i?i.children("input:checked").val():"searchName"}),v=e,""===e&&s.searchStatus.state>1&&s.searchStatus.query&&b.val(s.searchStatus.query).trigger("select"))},l.wait)))}),s.UA.ltIE8&&b.on("keydown",function(e){229===e.keyCode&&(b.data("imetm")&&clearTimeout(b.data("imetm")),b.data("composing",!0),b.data("imetm",setTimeout(function(){b.removeData("composing")},100)))}).on("keyup",function(t){b.data("imetm")&&clearTimeout(b.data("imetm")),b.data("composing")?t.keyCode===e.ui.keyCode.ENTER&&b.trigger("compositionend"):b.trigger("input")})),e('').appendTo(h).on("mousedown",function(e){e.stopPropagation(),e.preventDefault(),h.hasClass("ui-state-active")?m():b.trigger("focus")}),e('').appendTo(h).on("mousedown",function(e){e.stopPropagation(),e.preventDefault(),""!==b.val()||h.hasClass("ui-state-active")?g():b.trigger("focus")}),s.bind("toolbarload",function(){var e=h.parent();if(e.length&&(p.prepend(h.show()),e.remove(),s.UA.ltIE7)){var t=h.children("ltr"==s.direction?".ui-icon-close":".ui-icon-search");t.css({right:"",left:parseInt(h.width())-t.outerWidth(!0)})}}),s.one("init",function(){s.getUI("cwd").on("touchstart click",function(){o&&b.trigger("blur")})}).one("open",function(){n=s.api<2.1?null:e('
').append(e('
').append(e('"),e('"),e('")),e('
').append(e('"))).hide().appendTo(s.getUI()),n&&(c&&(i=n.find(".elfinder-search-type"),e.each(t.options.searchTypes,function(t,n){i.append(e('"))})),n.find("div.buttonset").buttonset(),e("#"+d("SearchFromAll")).next("label").attr("title",s.i18n("searchTarget",s.i18n("btnAll"))),c&&e.each(c,function(t,n){n.title&&e("#"+d(t)).next("label").attr("title",s.i18n(n.title))}),n.on("mousedown","div.buttonset",function(e){e.stopPropagation(),n.data("infocus",!0)}).on("click","input",function(t){t.stopPropagation(),e.trim(b.val())?m():b.trigger("focus")}).on("close",function(){b.trigger("blur")}))}).bind("searchend",function(){b.val("")}).bind("open parents",function(){var t=[],n=s.file(s.root(s.cwd().hash));n&&(e.each(s.parents(s.cwd().hash),function(e,n){t.push(s.file(n).name)}),e("#"+d("SearchFromCwd")).next("label").attr("title",s.i18n("searchTarget",t.join(s.option("separator")))),e("#"+d("SearchFromVol")).next("label").attr("title",s.i18n("searchTarget",n.name)))}).bind("open",function(){v&&g()}).bind("cwdinit",function(){a=!1}).bind("cwdrender",function(){a=!0}).bind("keydownEsc",function(){v&&"/"===v.substr(0,1)&&(v="",b.val(""),s.trigger("searchend"))}).shortcut({pattern:"ctrl+f f3",description:t.title,callback:function(){b.trigger("select").trigger("focus")}}).shortcut({pattern:"a b c d e f g h i j k l m n o p q r s t u v w x y z dig0 dig1 dig2 dig3 dig4 dig5 dig6 dig7 dig8 dig9 num0 num1 num2 num3 num4 num5 num6 num7 num8 num9",description:s.i18n("firstLetterSearch"),callback:function(t){if(a){var n,i=t.originalEvent.keyCode,o=function(){var t=s.selected(),n=e.ui.keyCode[!t.length||s.cwdHash2Elm(t[0]).next("[id]").length?"RIGHT":"HOME"];e(document).trigger(e.Event("keydown",{keyCode:n,ctrlKey:!1,shiftKey:!1,altKey:!1,metaKey:!1}))};i>=96&&i<=105&&(i-=48),n="/"+String.fromCharCode(i),v!==n?(b.val(n),v=n,s.trigger("incsearchstart",{query:n}).one("cwdrender",o)):o()}}})})},e.fn.elfindersortbutton=function(t){return this.each(function(){var n,i=t.fm,a=t.name,o="class",r=i.res(o,"disabled"),s=i.res(o,"hover"),l="elfinder-button-menu-item",c=l+"-selected",d=c+"-asc",p=c+"-desc",u=e(''+t.title+""),h=e(this).addClass("ui-state-default elfinder-button elfinder-menubutton elfiner-button-"+a).attr("title",t.title).append('',u).on("mouseenter mouseleave",function(e){!h.hasClass(r)&&h.toggleClass(s,"mouseenter"===e.type)}).on("click",function(e){h.hasClass(r)||(e.stopPropagation(),m.is(":hidden")&&i.getUI().click(),m.css(v()).slideToggle({duration:100,done:function(e){i[m.is(":visible")?"toFront":"toHide"](m)}}))}),f=function(){i.toHide(m)},m=e('
').hide().appendTo(i.getUI()).on("mouseenter mouseleave","."+l,function(t){e(this).toggleClass(s,"mouseenter"===t.type)}).on("click",function(e){e.preventDefault(),e.stopPropagation()}).on("close",f),g=function(){m.children("[rel]").removeClass(c+" "+d+" "+p).filter('[rel="'+i.sortType+'"]').addClass(c+" "+("asc"==i.sortOrder?d:p)),m.children(".elfinder-sort-stick").toggleClass(c,i.sortStickFolders),m.children(".elfinder-sort-tree").toggleClass(c,i.sortAlsoTreeview)},v=function(){var e=i.getUI().offset(),t=h.offset();return{top:t.top-e.top,left:t.left-e.left}};u.hide(),e.each(i.sortRules,function(t,n){m.append(e('
'+i.i18n("sort"+t)+"
").data("type",t))}),m.children().on("click",function(n){t.exec([],e(this).removeClass(s).attr("rel"))}),e('
'+i.i18n("sortFoldersFirst")+"
").appendTo(m).on("click",function(){t.exec([],"stick")}),i.one("init",function(){i.ui.tree&&null!==i.options.sortAlsoTreeview&&e('
'+i.i18n("sortAlsoTreeview")+"
").appendTo(m).on("click",function(){t.exec([],"tree")})}).bind("disable select",f).bind("sortchange",g).getUI().on("click",f),m.children().length>1?t.change(function(){n&&cancelAnimationFrame(n),n=requestAnimationFrame(function(){h.toggleClass(r,t.disabled()),g()})}).change():h.addClass(r)})},e.fn.elfinderstat=function(t){return this.each(function(){var n=e(this).addClass("elfinder-stat-size"),i=e('
').on("click","a",function(n){var i=e(this).data("hash");n.preventDefault(),t.exec("opendir",[i])}),a=t.i18n("items"),o=t.i18n("selected"),r=t.i18n("size"),s=function(i){var o=0,r=0,s=t.cwd(),l=!0,c=!0;(s.sizeInfo||s.size)&&(r=s.size,l=!1),e.each(i,function(e,t){o++,l&&(r+=parseInt(t.size)||0,c!==!0||"directory"!==t.mime||t.sizeInfo||(c=!1))}),n.html(a+': '+o+', '+t.i18n(c?"sum":"size")+": "+t.formatSize(r)+"").attr("title",n.text()),t.trigger("uistatchange")},l=function(e){n.find("span.elfinder-stat-incsearch").html(e?e.hashes.length+" / ":""),n.attr("title",n.text()),t.trigger("uistatchange")},c=function(n){var a,s,l=0,c=0,d=[];1===n.length?(s=n[0],l=s.size,2===t.searchStatus.state&&(a=t.escape(s.path?s.path.replace(/\/[^\/]*$/,""):".."),d.push(''+a+"")),d.push(t.escape(s.i18||s.name)),i.html(d.join("/")+(l>0?", "+t.formatSize(l):""))):n.length?(e.each(n,function(e,t){c++,l+=parseInt(t.size)||0}),i.html(c?o+": "+c+", "+r+": "+t.formatSize(l):" ")):i.html(""),i.attr("title",i.text()),t.trigger("uistatchange")};t.getUI("statusbar").prepend(n).append(i).show(),t.UA.Mobile&&e.fn.tooltip&&t.getUI("statusbar").tooltip({classes:{"ui-tooltip":"elfinder-ui-tooltip ui-widget-shadow"},tooltipClass:"elfinder-ui-tooltip ui-widget-shadow",track:!0}),t.bind("cwdhasheschange",function(n){s(e.map(n.data,function(e){return t.file(e)}))}).change(function(i){var a=i.data.changed||[],o=t.cwd().hash;e.each(a,function(){if(this.hash===o)return this.size&&(n.children(".elfinder-stat-size").addClass("elfinder-stat-size-recursive").html(t.i18n("sum")+": "+t.formatSize(this.size)),n.attr("title",n.text())),!1})}).select(function(){c(t.selectedFiles())}).bind("open",function(){c([])}).bind("incsearch",function(e){l(e.data)}).bind("incsearchend",function(){l()})})},e.fn.elfindertoast=function(t,n){var i=Object.assign({mode:"success",msg:"",showMethod:"fadeIn",showDuration:300,showEasing:"swing",onShown:void 0,hideMethod:"fadeOut",hideDuration:1500,hideEasing:"swing",onHidden:void 0,timeOut:3e3,extNode:void 0,button:void 0,width:void 0},e.isPlainObject(n.options.uiOptions.toast.defaults)?n.options.uiOptions.toast.defaults:{});return this.each(function(){t=Object.assign({},i,t||{});var a,o=e(this),r=function(e){o.stop(),n.toFront(o),o[t.showMethod]({duration:t.showDuration,easing:t.showEasing,complete:function(){t.onShown&&t.onShown(),!e&&t.timeOut&&(a=setTimeout(s,t.timeOut))}})},s=function(){o[t.hideMethod]({duration:t.hideDuration,easing:t.hideEasing,complete:function(){t.onHidden&&t.onHidden(),o.remove()}})};o.on("click",function(e){e.stopPropagation(),e.preventDefault(),a&&clearTimeout(a),t.onHidden&&t.onHidden(),o.stop().remove()}).on("mouseenter mouseleave",function(e){t.timeOut&&(a&&clearTimeout(a),a=null,"mouseenter"===e.type?r(!0):a=setTimeout(s,t.timeOut))}).hide().addClass("toast-"+t.mode).append(e('
').html(t.msg.replace(/%([a-zA-Z0-9]+)%/g,function(e,t){return n.i18n(t)}))),t.extNode&&o.append(t.extNode),t.button&&o.append(e('').append(e('').text(n.i18n(t.button.text))).on("mouseenter mouseleave",function(t){e(this).toggleClass("ui-state-hover","mouseenter"==t.type)}).on("click",t.button.click||function(){})),t.width&&o.css("max-width",t.width),r()})},e.fn.elfindertoolbar=function(t,n){return this.not(".elfinder-toolbar").each(function(){var i,a,o,r,s,l,c,d,p,u=t._commands,h=e(this).addClass("ui-helper-clearfix ui-widget-header elfinder-toolbar"),f={displayTextLabel:!1,labelExcludeUA:["Mobile"],autoHideUA:["Mobile"],showPreferenceButton:"none"},m=function(t){return e.grep(t,function(t){return!e.isPlainObject(t)||(f=Object.assign(f,t),!1)})},g=function(n){var l,c;for(e.each(v,function(e,t){t.detach()}),h.empty(),i=b.length;i--;)if(b[i]){for(r=e('
'),a=b[i].length;a--;)l=b[i][a],n&&n[l]||!(o=u[l])||(s="elfinder"+o.options.ui,!v[l]&&e.fn[s]&&(v[l]=e("
")[s](o)),v[l]&&(v[l].children(".elfinder-button-text")[d?"show":"hide"](),r.prepend(v[l])));r.children().length&&h.prepend(r),r.children(":gt(0)").before('')}(c=u.preference)&&("always"===f.showPreferenceButton||!h.children().length&&"auto"===f.showPreferenceButton)&&(r=e('
'),l="preference",s="elfinder"+o.options.ui,v[l]=e("
")[s](c),v[l].children(".elfinder-button-text")[d?"show":"hide"](),r.prepend(v[l]),h.append(r)),!h.data("swipeClose")&&h.children().length?h.show():h.hide(),x=h[0].clientHeight,t.trigger("toolbarload").trigger("uiresize")},v={},b=m(n||[]),y=null,w="",x=0,k=[];f.showPreferenceButton=f.showPreferenceButton.toLowerCase(),"none"!==f.displayTextLabel&&(d=t.storage("toolbarTextLabel"),d=null===d?f.displayTextLabel&&(!f.labelExcludeUA||!f.labelExcludeUA.length||!e.grep(f.labelExcludeUA,function(e){return!!t.UA[e]}).length):1==d,k.push({label:t.i18n("textLabel"),icon:"text",callback:function(){d=!d,h.css("height","").find(".elfinder-button-text")[d?"show":"hide"](),t.trigger("uiresize").storage("toolbarTextLabel",d?"1":"0")}})),f.preferenceInContextmenu&&u.preference&&k.push({label:t.i18n("toolbarPref"),icon:"preference",callback:function(){t.exec("preference",void 0,{tab:"toolbar"})}}),k.length&&h.on("contextmenu",function(e){e.stopPropagation(),e.preventDefault(),t.trigger("contextmenu",{raw:k,x:e.pageX,y:e.pageY})}).on("touchstart",function(e){e.originalEvent.touches.length>1||(h.data("tmlongtap")&&clearTimeout(h.data("tmlongtap")),h.removeData("longtap").data("longtap",{x:e.originalEvent.touches[0].pageX,y:e.originalEvent.touches[0].pageY}).data("tmlongtap",setTimeout(function(){h.removeData("longtapTm").trigger({type:"contextmenu",pageX:h.data("longtap").x,pageY:h.data("longtap").y}).data("longtap",{longtap:!0})},500)))}).on("touchmove touchend",function(e){h.data("tmlongtap")&&(("touchend"===e.type||Math.abs(h.data("longtap").x-e.originalEvent.touches[0].pageX)+Math.abs(h.data("longtap").y-e.originalEvent.touches[0].pageY)>4)&&clearTimeout(h.data("tmlongtap")),h.removeData("longtapTm"))}).on("click",function(e){h.data("longtap")&&h.data("longtap").longtap&&(e.stopImmediatePropagation(),e.preventDefault())}).on("touchend click",".elfinder-button",function(e){h.data("longtap")&&h.data("longtap").longtap&&(e.stopImmediatePropagation(),e.preventDefault())}),h.prev().length&&h.parent().prepend(this),g(),t.bind("open sync select toolbarpref",function(){var n,i,a,o=Object.assign({},t.option("disabledFlip")),r=t.storage("toolbarhides");if(!r&&Array.isArray(f.defaultHides)&&(r={},e.each(f.defaultHides,function(){r[this]=!0}),t.storage("toolbarhides",r)),"select"===this.type){if(t.searchStatus.state<2)return;i=t.selected(),i.length&&(o=t.getDisabledCmds(i,!0))}e.each(r,function(e){o[e]||(o[e]=!0)}),Object.keys(t.commandMap).length&&e.each(t.commandMap,function(e,t){"hidden"===t&&(o[e]=!0)}),a=Object.keys(o),y&&y.toString()===a.sort().toString()||(g(a.length?o:null),n=!0),y=a.sort(),(n||w!==JSON.stringify(t.commandMap))&&(w=JSON.stringify(t.commandMap),n||e.each(e("div.elfinder-button"),function(){var t=e(this).data("origin");t&&e(this).after(t).detach()}),Object.keys(t.commandMap).length&&e.each(t.commandMap,function(n,i){var a,o=t._commands[i],r=o?"elfinder"+o.options.ui:null;r&&e.fn[r]&&(a=v[n],a&&(!v[i]&&e.fn[r]&&(v[i]=e("
")[r](o),v[i]&&(v[i].children(".elfinder-button-text")[d?"show":"hide"](),o.extendsCmd&&v[i].children("span.elfinder-button-icon").addClass("elfinder-button-icon-"+o.extendsCmd))),v[i]&&(a.after(v[i]),v[i].data("origin",a.detach()))))}))}).bind("resize",function(e){p&&cancelAnimationFrame(p),p=requestAnimationFrame(function(){var e=h[0].clientHeight;x!==e&&(x=e,t.trigger("uiresize"))})}),t.UA.Touch&&(c=t.storage("autoHide")||{},"undefined"==typeof c.toolbar&&(c.toolbar=f.autoHideUA&&f.autoHideUA.length>0&&e.grep(f.autoHideUA,function(e){return!!t.UA[e]}).length,t.storage("autoHide",c)),c.toolbar&&t.one("init",function(){t.uiAutoHide.push(function(){h.stop(!0,!0).trigger("toggle",{duration:500,init:!0})})}),t.bind("load",function(){l=e('
').hide().appendTo(t.getUI()),"none"!==l.css("pointer-events")&&(l.remove(),l=null)}),h.on("toggle",function(e,n){var i=t.getUI("workzone"),a=h.is(":hidden"),o=i.height(),r=h.height(),s=h.outerHeight(!0),d=s-r,p=Object.assign({step:function(e){i.height(o+(a?(e+d)*-1:r-e)),t.trigger("resize")},always:function(){requestAnimationFrame(function(){h.css("height",""),t.trigger("uiresize"),l&&(a?l.stop(!0,!0).hide():(l.height(n.handleH?n.handleH:""),t.resources.blink(l,"slowonce"))),a&&h.scrollTop("0px"),n.init&&t.trigger("uiautohide")})}},n);h.data("swipeClose",!a).stop(!0,!0).animate({height:"toggle"},p),c.toolbar=!a,t.storage("autoHide",Object.assign(t.storage("autoHide"),{toolbar:c.toolbar}))}).on("touchstart",function(e){h.scrollBottom()>5&&(e.originalEvent._preventSwipeY=!0)}))}),this},e.fn.elfindertree=function(t,n){var i=t.res("class","tree");return this.not("."+i).each(function(){var a,o,r,s,l="class",c=t.UA.Mobile,d=t.res(l,"treeroot"),p=n.openRootOnLoad,u=n.openCwdOnOpen,h=u||n.syncTree,f=t.res(l,"navsubtree"),m=t.res(l,"treedir"),g="span."+m,v=t.res(l,"navcollapse"),b=t.res(l,"navexpand"),y="elfinder-subtree-loaded",w="elfinder-subtree-chksubdir",x=t.res(l,"navarrow"),k=t.res(l,"active"),C=t.res(l,"adroppable"),z=t.res(l,"hover"),T=t.res(l,"disabled"),A=t.res(l,"draggable"),j=t.res(l,"droppable"),S="elfinder-navbar-wrapper-root",O="elfinder-navbar-wrapper-pastable",I="elfinder-navbar-wrapper-uploadable",M=function(e){var t=se.offset().left;return t<=e&&e<=t+se.width()},F={},E=[],D=function(n){var i=[];if(e.each(n,function(e,n){F[n]&&i.push(t.navId2Hash(n)),delete F[n]}),i.length)return t.request({data:{cmd:"subdirs",targets:i,preventDefault:!0}}).done(function(n){n&&n.subdirs&&e.each(n.subdirs,function(e,n){var i=t.navHash2Elm(e);i.removeClass(w),i[n?"addClass":"removeClass"](v)})})},U=null,P=function(){var n=Object.keys(F);n.length&&(U&&U._abort(),a&&clearTimeout(a),E=[],U=t.asyncJob(function(n){return t.isInWindow(e("#"+n))?n:null},n,{numPerOnce:200}).done(function(e){e.length&&(E=e,R())}))},q=0,R=function(){var e,i=n.subdirsMaxConn-q,o=t.maxTargets?Math.min(t.maxTargets,n.subdirsAtOnce):n.subdirsAtOnce;if(a&&cancelAnimationFrame(a),E.length)if(i>0)for(e=0;e'),h=e(this).addClass("elfinder-path").html(" ").on("mousedown","span.elfinder-path-dir",function(n){var i=e(this).attr("id").substr(p.length);n.preventDefault(),i!=t.cwd().hash&&(e(this).addClass(d),r?t.exec("search",r,{target:i,mime:l.join(" ")}):t.trigger("select",{selected:[i]}).exec("open",i))}).prependTo(t.getUI("statusbar").show()),f=e('
').on("click",function(n){n.stopPropagation(),n.preventDefault();var i=e.map(t.roots,function(e){return t.file(e)}),a=[];e.each(i,function(e,n){n.phash||t.root(t.cwd().hash,!0)===n.hash||a.push({label:t.escape(n.i18||n.name),icon:"home",callback:function(){t.exec("open",n.hash)},options:{iconClass:n.csscls||"",iconImg:n.icon||""}})}),t.trigger("contextmenu",{raw:a,x:n.pageX,y:n.pageY})}).append('').appendTo(u),m=function(n){var i=[],a=[];return e.each(t.parents(n),function(e,o){var r=n===o?"elfinder-path-dir elfinder-path-cwd":"elfinder-path-dir",s=t.file(o),l=t.escape(s.i18||s.name);a.push(l),i.push(''+l+"")}),i.join(''+t.option("separator")+"")},g=function(){var n;h.children("span.elfinder-path-dir").attr("style",""),n="ltr"===t.direction?e("#"+p+t.cwd().hash).prevAll("span.elfinder-path-dir:first"):e(),h.scrollLeft(n.length?n.position().left:0)},v=function(){if(!t.UA.CSS.flex){var n,i,a=h.children("span.elfinder-path-dir"),o=a.length;if("workzone"===c||o<2)return void a.attr("style","");h.width(h.css("max-width")),a.css({maxWidth:100/o+"%",display:"inline-block"}),n=h.width()-9,h.children("span.elfinder-path-other").each(function(){n-=e(this).width()}),i=[],a.each(function(t){var a=e(this),o=a.width();n-=o,o0&&(n/=i.length,e.each(i,function(t,i){var o=e(a[i]);o.css("max-width",o.width()+n)})),a.last().attr("style","")):a.attr("style","")}};t.one("init",function(){a=t.getUI("tree").length,o=t.getUI("stat").length,!a&&n.toWorkzoneWithoutNavbar&&(u.append(h).insertBefore(t.getUI("workzone")),c="workzone",t.bind("open",g).one("opendone",function(){t.getUI().trigger("resize")}))}).bind("open searchend parents",function(){r="",s="",l=[],h.html(m(t.cwd().hash)),Object.keys(t.roots).length>1?(h.css("margin",""),f.show()):(h.css("margin",0),f.hide()),!o&&v()}).bind("searchstart",function(e){e.data&&(r=e.data.query||"",s=e.data.target||"",l=e.data.mimes||[])}).bind("search",function(e){var n="";n=s?m(s):t.i18n("btnAll"),h.html(''+t.i18n("searcresult")+": "+n),v()}).bind("navbarshow navbarhide",function(){var e=t.getUI("workzone");"navbarshow"===this.type?(t.unbind("open",g),h.prependTo(t.getUI("statusbar")),u.detach(),c="statusbar"):(u.append(h).insertBefore(e),c="workzone",g(),t.bind("open",g)),t.trigger("uiresize")}).bind("resize uistatchange",v)})},e.fn.elfinderplaces=function(t,n){return this.each(function(){var i={},a="class",o=t.res(a,"navdir"),r=t.res(a,"navcollapse"),s=t.res(a,"navexpand"),l=t.res(a,"hover"),c=t.res(a,"treeroot"),d=t.res(a,"adroppable"),p=t.res("tpl","placedir"),u=t.res("tpl","perms"),h=e(t.res("tpl","navspinner")),f=n.suffix?n.suffix:"",m="places"+f,g=null,v=function(e){return e.substr(6)},b=function(e){return"place-"+e},y=function(t){return e(document.getElementById(b(t)))},w=function(){var n=[],a={};n=e.map(F.children().find("[id]"),function(e){return v(e.id)}),n.length?e.each(n.reverse(),function(e,t){a[t]=i[t]}):a=null,t.storage(m,a)},x=function(){var a,o;m="places"+(n.suffix?n.suffix:""),i={},a=t.storage(m),"string"==typeof a?(a=e.grep(a.split(","),function(e){return!!e}),e.each(a,function(e,t){var n=t.split("#");i[n[0]]=n[1]?n[1]:n[0]})):e.isPlainObject(a)&&(i=a),t.trigger("placesload",{dirs:i,storageKey:m},!0),o=Object.keys(i),o.length&&(M.prepend(h),t.request({data:{cmd:"info",targets:o},preventDefault:!0}).done(function(n){var a={};n.files&&n.files.length&&t.cache(n.files),e.each(n.files,function(e,t){var n=t.hash;a[n]=t}),e.each(i,function(e,t){C(a[e]||Object.assign({notfound:!0},t))}),t.storage("placesState")>0&&M.trigger("click")}).always(function(){h.remove()}))},k=function(n,i){return e(p.replace(/\{id\}/,b(n?n.hash:i)).replace(/\{name\}/,t.escape(n?n.i18||n.name:i)).replace(/\{cssclass\}/,n?t.perms2class(n)+(n.notfound?" elfinder-na":"")+(n.csscls?" "+n.csscls:""):"").replace(/\{permissions\}/,!n||n.read&&n.write&&!n.notfound?"":u).replace(/\{title\}/,n?' title="'+t.escape(t.path(n.hash,!0)||n.i18||n.name)+'"':"").replace(/\{symlink\}/,"").replace(/\{style\}/,n&&n.icon?t.getIconStyle(n):""))},C=function(e){var n,a;return"directory"===e.mime&&(a=e.hash,t.files().hasOwnProperty(a)||t.trigger("tree",{tree:[e]}),n=k(e,a),i[a]=e,F.prepend(n),M.addClass(r),O.toggle(F.children().length>1),!0)},z=function(e){var t,n,a=null;return i[e]&&(delete i[e],t=y(e),t.length&&(a=t.text(),t.parent().remove(),n=F.children().length,O.toggle(n>1),n||(M.removeClass(r),E.removeClass(s),F.slideToggle(!1)))),a},T=function(e){var n=y(e),i=n.parent(),a=i.prev("div"),o="ui-state-hover",r=t.getUI("contextmenu");g&&clearTimeout(g),a.length&&(r.find(":first").data("placesHash",e),n.addClass(o),i.insertBefore(a),a=i.prev("div"),g=setTimeout(function(){n.removeClass(o),r.find(":first").data("placesHash")===e&&r.hide().empty()},1500)),a.length||(n.removeClass(o),r.hide().empty())},A=function(e,t){var n=e.hash,a=y(t||n),o=k(e,n);return a.length>0&&(a.parent().replaceWith(o),i[n]=e,!0)},j=function(){F.empty(),M.removeClass(r),E.removeClass(s),F.slideToggle(!1)},S=function(){e.each(i,function(n,i){var a=t.file(n)||i,r=k(a,n),s=null;return a||r.hide(),!(!F.children().length||(e.each(F.children(),function(){var t=e(this);if((a.i18||a.name).localeCompare(t.children("."+o).text())<0)return s=!r.insertBefore(t)}),null===s))||void(!y(n).length&&F.append(r))}),w()},O=e('').hide().on("click",function(e){e.stopPropagation(),F.empty(),S()}),I=k({hash:"root-"+t.namespace,name:t.i18n(n.name,"places"),read:!0,write:!0}),M=I.children("."+o).addClass(c).on("click",function(e){e.stopPropagation(),M.hasClass(r)&&(E.toggleClass(s),F.slideToggle(),t.storage("placesState",E.hasClass(s)?1:0))}).append(O),F=I.children("."+t.res(a,"navsubtree")),E=e(this).addClass(t.res(a,"tree")+" elfinder-places ui-corner-all").hide().append(I).appendTo(t.getUI("navbar")).on("mouseenter mouseleave","."+o,function(t){e(this).toggleClass("ui-state-hover","mouseenter"==t.type)}).on("click","."+o,function(n){var i=e(this);return i.data("longtap")?void n.stopPropagation():void(!i.hasClass("elfinder-na")&&t.exec("open",i.attr("id").substr(6)))}).on("contextmenu","."+o+":not(."+c+")",function(n){var i=e(this),a=i.attr("id").substr(6);n.preventDefault(),t.trigger("contextmenu",{raw:[{label:t.i18n("moveUp"),icon:"up",remain:!0,callback:function(){T(a),w()}},"|",{label:t.i18n("rmFromPlaces"),icon:"rm",callback:function(){z(a),w()}}],x:n.pageX,y:n.pageY}),i.addClass("ui-state-hover"),t.getUI("contextmenu").children().on("mouseenter",function(){i.addClass("ui-state-hover")}),t.bind("closecontextmenu",function(){i.removeClass("ui-state-hover")})}).droppable({tolerance:"pointer",accept:".elfinder-cwd-file-wrapper,.elfinder-tree-dir,.elfinder-cwd-file",hoverClass:t.res("class","adroppable"),classes:{"ui-droppable-hover":t.res("class","adroppable")},over:function(n,a){var o=a.helper,r=e.grep(o.data("files"),function(e){return"directory"===t.file(e).mime&&!i[e]});n.stopPropagation(),o.data("dropover",o.data("dropover")+1),t.insideWorkzone(n.pageX,n.pageY)&&(r.length>0?(o.addClass("elfinder-drag-helper-plus"),t.trigger("unlockfiles",{files:o.data("files"),helper:o})):e(this).removeClass(d))},out:function(t,n){var i=n.helper;t.stopPropagation(),i.removeClass("elfinder-drag-helper-move elfinder-drag-helper-plus").data("dropover",Math.max(i.data("dropover")-1,0)),e(this).removeData("dropover").removeClass(d)},drop:function(n,a){var o=a.helper,r=!0;e.each(o.data("files"),function(e,n){var a=t.file(n);a&&"directory"==a.mime&&!i[a.hash]?C(a):r=!1}),w(),r&&o.hide()}}).on("touchstart","."+o+":not(."+c+")",function(n){if(!(n.originalEvent.touches.length>1))var i=e(this).attr("id").substr(6),a=e(this).addClass(l).data("longtap",null).data("tmlongtap",setTimeout(function(){a.data("longtap",!0),t.trigger("contextmenu",{raw:[{label:t.i18n("rmFromPlaces"),icon:"rm",callback:function(){z(i),w()}}],x:n.originalEvent.touches[0].pageX,y:n.originalEvent.touches[0].pageY})},500))}).on("touchmove touchend","."+o+":not(."+c+")",function(t){clearTimeout(e(this).data("tmlongtap")),"touchmove"==t.type&&e(this).removeClass(l)});e.fn.sortable&&F.addClass("touch-punch").sortable({appendTo:t.getUI(),revert:!1,helper:function(n){var i=e(n.target).parent();return i.children().removeClass("ui-state-hover"),e('
').append(e('
').show().append(i.clone()))},stop:function(t,n){var i=e(n.item[0]),a=E.offset().top,o=E.offset().left,r=E.width(),s=E.height(),l=t.pageX,c=t.pageY;l>o&&la&&c').on("focus",function(){!h.hasClass("ui-state-active")&&s.getUI().click(),o=!0,v="",h.addClass("ui-state-active"),s.trigger("uiresize"),n&&n.css(f()).slideDown(function(){h.addClass("ui-state-active"),s.toFront(n)})}).on("blur",function(){o=!1,n?n.data("infocus")?n.data("infocus",!1):n.slideUp(function(){h.removeClass("ui-state-active"),s.trigger("uiresize"),s.toHide(n)}):h.removeClass("ui-state-active")}).appendTo(h).on("keypress",function(e){e.stopPropagation()}).on("keydown",function(t){t.stopPropagation(),t.keyCode===e.ui.keyCode.ENTER?m():t.keyCode===e.ui.keyCode.ESCAPE&&(t.preventDefault(),g())});l.enable&&(l.minlen=l.minlen||2,l.wait=l.wait||500,b.attr("title",s.i18n("incSearchOnly")).on("compositionstart",function(){b.data("composing",!0)}).on("compositionend",function(){b.removeData("composing"),b.trigger("input")}).on("input",function(){b.data("composing")||(b.data("inctm")&&clearTimeout(b.data("inctm")),b.data("inctm",setTimeout(function(){var e=b.val();(0===e.length||e.length>=l.minlen)&&(v!==e&&s.trigger("incsearchstart",{query:e,type:i?i.children("input:checked").val():"searchName"}),v=e,""===e&&s.searchStatus.state>1&&s.searchStatus.query&&b.val(s.searchStatus.query).trigger("select"))},l.wait)))}),s.UA.ltIE8&&b.on("keydown",function(e){229===e.keyCode&&(b.data("imetm")&&clearTimeout(b.data("imetm")),b.data("composing",!0),b.data("imetm",setTimeout(function(){b.removeData("composing")},100)))}).on("keyup",function(t){b.data("imetm")&&clearTimeout(b.data("imetm")),b.data("composing")?t.keyCode===e.ui.keyCode.ENTER&&b.trigger("compositionend"):b.trigger("input")})),e('').appendTo(h).on("mousedown",function(e){e.stopPropagation(),e.preventDefault(),h.hasClass("ui-state-active")?m():b.trigger("focus")}),e('').appendTo(h).on("mousedown",function(e){e.stopPropagation(),e.preventDefault(),""!==b.val()||h.hasClass("ui-state-active")?g():b.trigger("focus")}),s.bind("toolbarload",function(){var e=h.parent();if(e.length&&(p.prepend(h.show()),e.remove(),s.UA.ltIE7)){var t=h.children("ltr"==s.direction?".ui-icon-close":".ui-icon-search");t.css({right:"",left:parseInt(h.width())-t.outerWidth(!0)})}}),s.one("init",function(){s.getUI("cwd").on("touchstart click",function(){o&&b.trigger("blur")})}).one("open",function(){n=s.api<2.1?null:e('
').append(e('
').append(e('"),e('"),e('")),e('
').append(e('"))).hide().appendTo(s.getUI()),n&&(c&&(i=n.find(".elfinder-search-type"),e.each(t.options.searchTypes,function(t,n){i.append(e('"))})),n.find("div.buttonset").controlgroup(),e("#"+d("SearchFromAll")).next("label").attr("title",s.i18n("searchTarget",s.i18n("btnAll"))),c&&e.each(c,function(t,n){n.title&&e("#"+d(t)).next("label").attr("title",s.i18n(n.title))}),n.on("mousedown","div.buttonset",function(e){e.stopPropagation(),n.data("infocus",!0)}).on("click","input",function(t){t.stopPropagation(),e.trim(b.val())?m():b.trigger("focus")}).on("close",function(){b.trigger("blur")}))}).bind("searchend",function(){b.val("")}).bind("open parents",function(){var t=[],n=s.file(s.root(s.cwd().hash));n&&(e.each(s.parents(s.cwd().hash),function(e,n){t.push(s.file(n).name)}),e("#"+d("SearchFromCwd")).next("label").attr("title",s.i18n("searchTarget",t.join(s.option("separator")))),e("#"+d("SearchFromVol")).next("label").attr("title",s.i18n("searchTarget",n.name)))}).bind("open",function(){v&&g()}).bind("cwdinit",function(){a=!1}).bind("cwdrender",function(){a=!0}).bind("keydownEsc",function(){v&&"/"===v.substr(0,1)&&(v="",b.val(""),s.trigger("searchend"))}).shortcut({pattern:"ctrl+f f3",description:t.title,callback:function(){b.trigger("select").trigger("focus")}}).shortcut({pattern:"a b c d e f g h i j k l m n o p q r s t u v w x y z dig0 dig1 dig2 dig3 dig4 dig5 dig6 dig7 dig8 dig9 num0 num1 num2 num3 num4 num5 num6 num7 num8 num9",description:s.i18n("firstLetterSearch"),callback:function(t){if(a){var n,i=t.originalEvent.keyCode,o=function(){var t=s.selected(),n=e.ui.keyCode[!t.length||s.cwdHash2Elm(t[0]).next("[id]").length?"RIGHT":"HOME"];e(document).trigger(e.Event("keydown",{keyCode:n,ctrlKey:!1,shiftKey:!1,altKey:!1,metaKey:!1}))};i>=96&&i<=105&&(i-=48),n="/"+String.fromCharCode(i),v!==n?(b.val(n),v=n,s.trigger("incsearchstart",{query:n}).one("cwdrender",o)):o()}}})})},e.fn.elfindersortbutton=function(t){return this.each(function(){var n,i=t.fm,a=t.name,o="class",r=i.res(o,"disabled"),s=i.res(o,"hover"),l="elfinder-button-menu-item",c=l+"-selected",d=c+"-asc",p=c+"-desc",u=e(''+t.title+""),h=e(this).addClass("ui-state-default elfinder-button elfinder-menubutton elfiner-button-"+a).attr("title",t.title).append('',u).on("mouseenter mouseleave",function(e){!h.hasClass(r)&&h.toggleClass(s,"mouseenter"===e.type)}).on("click",function(e){h.hasClass(r)||(e.stopPropagation(),m.is(":hidden")&&i.getUI().click(),m.css(v()).slideToggle({duration:100,done:function(e){i[m.is(":visible")?"toFront":"toHide"](m)}}))}),f=function(){i.toHide(m)},m=e('
').hide().appendTo(i.getUI()).on("mouseenter mouseleave","."+l,function(t){e(this).toggleClass(s,"mouseenter"===t.type)}).on("click",function(e){e.preventDefault(),e.stopPropagation()}).on("close",f),g=function(){m.children("[rel]").removeClass(c+" "+d+" "+p).filter('[rel="'+i.sortType+'"]').addClass(c+" "+("asc"==i.sortOrder?d:p)),m.children(".elfinder-sort-stick").toggleClass(c,i.sortStickFolders),m.children(".elfinder-sort-tree").toggleClass(c,i.sortAlsoTreeview)},v=function(){var e=i.getUI().offset(),t=h.offset();return{top:t.top-e.top,left:t.left-e.left}};u.hide(),e.each(i.sortRules,function(t,n){m.append(e('
'+i.i18n("sort"+t)+"
").data("type",t))}),m.children().on("click",function(n){t.exec([],e(this).removeClass(s).attr("rel"))}),e('
'+i.i18n("sortFoldersFirst")+"
").appendTo(m).on("click",function(){t.exec([],"stick")}),i.one("init",function(){i.ui.tree&&null!==i.options.sortAlsoTreeview&&e('
'+i.i18n("sortAlsoTreeview")+"
").appendTo(m).on("click",function(){t.exec([],"tree")})}).bind("disable select",f).bind("sortchange",g).getUI().on("click",f),m.children().length>1?t.change(function(){n&&cancelAnimationFrame(n),n=requestAnimationFrame(function(){h.toggleClass(r,t.disabled()),g()})}).change():h.addClass(r)})},e.fn.elfinderstat=function(t){return this.each(function(){var n=e(this).addClass("elfinder-stat-size"),i=e('
').on("click","a",function(n){var i=e(this).data("hash");n.preventDefault(),t.exec("opendir",[i])}),a=t.i18n("items"),o=t.i18n("selected"),r=t.i18n("size"),s=function(i){var o=0,r=0,s=t.cwd(),l=!0,c=!0;(s.sizeInfo||s.size)&&(r=s.size,l=!1),e.each(i,function(e,t){o++,l&&(r+=parseInt(t.size)||0,c!==!0||"directory"!==t.mime||t.sizeInfo||(c=!1))}),n.html(a+': '+o+', '+t.i18n(c?"sum":"size")+": "+t.formatSize(r)+"").attr("title",n.text()),t.trigger("uistatchange")},l=function(e){n.find("span.elfinder-stat-incsearch").html(e?e.hashes.length+" / ":""),n.attr("title",n.text()),t.trigger("uistatchange")},c=function(n){var a,s,l=0,c=0,d=[];1===n.length?(s=n[0],l=s.size,2===t.searchStatus.state&&(a=t.escape(s.path?s.path.replace(/\/[^\/]*$/,""):".."),d.push(''+a+"")),d.push(t.escape(s.i18||s.name)),i.html(d.join("/")+(l>0?", "+t.formatSize(l):""))):n.length?(e.each(n,function(e,t){c++,l+=parseInt(t.size)||0}),i.html(c?o+": "+c+", "+r+": "+t.formatSize(l):" ")):i.html(""),i.attr("title",i.text()),t.trigger("uistatchange")};t.getUI("statusbar").prepend(n).append(i).show(),t.UA.Mobile&&e.fn.tooltip&&t.getUI("statusbar").tooltip({classes:{"ui-tooltip":"elfinder-ui-tooltip ui-widget-shadow"},tooltipClass:"elfinder-ui-tooltip ui-widget-shadow",track:!0}),t.bind("cwdhasheschange",function(n){s(e.map(n.data,function(e){return t.file(e)}))}).change(function(i){var a=i.data.changed||[],o=t.cwd().hash;e.each(a,function(){if(this.hash===o)return this.size&&(n.children(".elfinder-stat-size").addClass("elfinder-stat-size-recursive").html(t.i18n("sum")+": "+t.formatSize(this.size)),n.attr("title",n.text())),!1})}).select(function(){c(t.selectedFiles())}).bind("open",function(){c([])}).bind("incsearch",function(e){l(e.data)}).bind("incsearchend",function(){l()})})},e.fn.elfindertoast=function(t,n){var i=Object.assign({mode:"success",msg:"",showMethod:"fadeIn",showDuration:300,showEasing:"swing",onShown:void 0,hideMethod:"fadeOut",hideDuration:1500,hideEasing:"swing",onHidden:void 0,timeOut:3e3,extNode:void 0,button:void 0,width:void 0},e.isPlainObject(n.options.uiOptions.toast.defaults)?n.options.uiOptions.toast.defaults:{});return this.each(function(){t=Object.assign({},i,t||{});var a,o=e(this),r=function(e){o.stop(),n.toFront(o),o[t.showMethod]({duration:t.showDuration,easing:t.showEasing,complete:function(){t.onShown&&t.onShown(),!e&&t.timeOut&&(a=setTimeout(s,t.timeOut))}})},s=function(){o[t.hideMethod]({duration:t.hideDuration,easing:t.hideEasing,complete:function(){t.onHidden&&t.onHidden(),o.remove()}})};o.on("click",function(e){e.stopPropagation(),e.preventDefault(),a&&clearTimeout(a),t.onHidden&&t.onHidden(),o.stop().remove()}).on("mouseenter mouseleave",function(e){t.timeOut&&(a&&clearTimeout(a),a=null,"mouseenter"===e.type?r(!0):a=setTimeout(s,t.timeOut))}).hide().addClass("toast-"+t.mode).append(e('
').html(t.msg.replace(/%([a-zA-Z0-9]+)%/g,function(e,t){return n.i18n(t)}))),t.extNode&&o.append(t.extNode),t.button&&o.append(e('').append(e('').text(n.i18n(t.button.text))).on("mouseenter mouseleave",function(t){e(this).toggleClass("ui-state-hover","mouseenter"==t.type)}).on("click",t.button.click||function(){})),t.width&&o.css("max-width",t.width),r()})},e.fn.elfindertoolbar=function(t,n){return this.not(".elfinder-toolbar").each(function(){var i,a,o,r,s,l,c,d,p,u=t._commands,h=e(this).addClass("ui-helper-clearfix ui-widget-header elfinder-toolbar"),f={displayTextLabel:!1,labelExcludeUA:["Mobile"],autoHideUA:["Mobile"],showPreferenceButton:"none"},m=function(t){return e.grep(t,function(t){return!e.isPlainObject(t)||(f=Object.assign(f,t),!1)})},g=function(n){var l,c;for(e.each(v,function(e,t){t.detach()}),h.empty(),i=b.length;i--;)if(b[i]){for(r=e('
'),a=b[i].length;a--;)l=b[i][a],n&&n[l]||!(o=u[l])||(s="elfinder"+o.options.ui,!v[l]&&e.fn[s]&&(v[l]=e("
")[s](o)),v[l]&&(v[l].children(".elfinder-button-text")[d?"show":"hide"](),r.prepend(v[l])));r.children().length&&h.prepend(r),r.children(":gt(0)").before('')}(c=u.preference)&&("always"===f.showPreferenceButton||!h.children().length&&"auto"===f.showPreferenceButton)&&(r=e('
'),l="preference",s="elfinder"+o.options.ui,v[l]=e("
")[s](c),v[l].children(".elfinder-button-text")[d?"show":"hide"](),r.prepend(v[l]),h.append(r)),!h.data("swipeClose")&&h.children().length?h.show():h.hide(),x=h[0].clientHeight,t.trigger("toolbarload").trigger("uiresize")},v={},b=m(n||[]),y=null,w="",x=0,k=[];f.showPreferenceButton=f.showPreferenceButton.toLowerCase(),"none"!==f.displayTextLabel&&(d=t.storage("toolbarTextLabel"),d=null===d?f.displayTextLabel&&(!f.labelExcludeUA||!f.labelExcludeUA.length||!e.grep(f.labelExcludeUA,function(e){return!!t.UA[e]}).length):1==d,k.push({label:t.i18n("textLabel"),icon:"text",callback:function(){d=!d,h.css("height","").find(".elfinder-button-text")[d?"show":"hide"](),t.trigger("uiresize").storage("toolbarTextLabel",d?"1":"0")}})),f.preferenceInContextmenu&&u.preference&&k.push({label:t.i18n("toolbarPref"),icon:"preference",callback:function(){t.exec("preference",void 0,{tab:"toolbar"})}}),k.length&&h.on("contextmenu",function(e){e.stopPropagation(),e.preventDefault(),t.trigger("contextmenu",{raw:k,x:e.pageX,y:e.pageY})}).on("touchstart",function(e){e.originalEvent.touches.length>1||(h.data("tmlongtap")&&clearTimeout(h.data("tmlongtap")),h.removeData("longtap").data("longtap",{x:e.originalEvent.touches[0].pageX,y:e.originalEvent.touches[0].pageY}).data("tmlongtap",setTimeout(function(){h.removeData("longtapTm").trigger({type:"contextmenu",pageX:h.data("longtap").x,pageY:h.data("longtap").y}).data("longtap",{longtap:!0})},500)))}).on("touchmove touchend",function(e){h.data("tmlongtap")&&(("touchend"===e.type||Math.abs(h.data("longtap").x-e.originalEvent.touches[0].pageX)+Math.abs(h.data("longtap").y-e.originalEvent.touches[0].pageY)>4)&&clearTimeout(h.data("tmlongtap")),h.removeData("longtapTm"))}).on("click",function(e){h.data("longtap")&&h.data("longtap").longtap&&(e.stopImmediatePropagation(),e.preventDefault())}).on("touchend click",".elfinder-button",function(e){h.data("longtap")&&h.data("longtap").longtap&&(e.stopImmediatePropagation(),e.preventDefault())}),h.prev().length&&h.parent().prepend(this),g(),t.bind("open sync select toolbarpref",function(){var n,i,a,o=Object.assign({},t.option("disabledFlip")),r=t.storage("toolbarhides");if(!r&&Array.isArray(f.defaultHides)&&(r={},e.each(f.defaultHides,function(){r[this]=!0}),t.storage("toolbarhides",r)),"select"===this.type){if(t.searchStatus.state<2)return;i=t.selected(),i.length&&(o=t.getDisabledCmds(i,!0))}e.each(r,function(e){o[e]||(o[e]=!0)}),Object.keys(t.commandMap).length&&e.each(t.commandMap,function(e,t){"hidden"===t&&(o[e]=!0)}),a=Object.keys(o),y&&y.toString()===a.sort().toString()||(g(a.length?o:null),n=!0),y=a.sort(),(n||w!==JSON.stringify(t.commandMap))&&(w=JSON.stringify(t.commandMap),n||e.each(e("div.elfinder-button"),function(){var t=e(this).data("origin");t&&e(this).after(t).detach()}),Object.keys(t.commandMap).length&&e.each(t.commandMap,function(n,i){var a,o=t._commands[i],r=o?"elfinder"+o.options.ui:null;r&&e.fn[r]&&(a=v[n],a&&(!v[i]&&e.fn[r]&&(v[i]=e("
")[r](o),v[i]&&(v[i].children(".elfinder-button-text")[d?"show":"hide"](),o.extendsCmd&&v[i].children("span.elfinder-button-icon").addClass("elfinder-button-icon-"+o.extendsCmd))),v[i]&&(a.after(v[i]),v[i].data("origin",a.detach()))))}))}).bind("resize",function(e){p&&cancelAnimationFrame(p),p=requestAnimationFrame(function(){var e=h[0].clientHeight;x!==e&&(x=e,t.trigger("uiresize"))})}),t.UA.Touch&&(c=t.storage("autoHide")||{},"undefined"==typeof c.toolbar&&(c.toolbar=f.autoHideUA&&f.autoHideUA.length>0&&e.grep(f.autoHideUA,function(e){return!!t.UA[e]}).length,t.storage("autoHide",c)),c.toolbar&&t.one("init",function(){t.uiAutoHide.push(function(){h.stop(!0,!0).trigger("toggle",{duration:500,init:!0})})}),t.bind("load",function(){l=e('
').hide().appendTo(t.getUI()),"none"!==l.css("pointer-events")&&(l.remove(),l=null)}),h.on("toggle",function(e,n){var i=t.getUI("workzone"),a=h.is(":hidden"),o=i.height(),r=h.height(),s=h.outerHeight(!0),d=s-r,p=Object.assign({step:function(e){i.height(o+(a?(e+d)*-1:r-e)),t.trigger("resize")},always:function(){requestAnimationFrame(function(){h.css("height",""),t.trigger("uiresize"),l&&(a?l.stop(!0,!0).hide():(l.height(n.handleH?n.handleH:""),t.resources.blink(l,"slowonce"))),a&&h.scrollTop("0px"),n.init&&t.trigger("uiautohide")})}},n);h.data("swipeClose",!a).stop(!0,!0).animate({height:"toggle"},p),c.toolbar=!a,t.storage("autoHide",Object.assign(t.storage("autoHide"),{toolbar:c.toolbar}))}).on("touchstart",function(e){h.scrollBottom()>5&&(e.originalEvent._preventSwipeY=!0)}))}),this},e.fn.elfindertree=function(t,n){var i=t.res("class","tree");return this.not("."+i).each(function(){var a,o,r,s,l="class",c=t.UA.Mobile,d=t.res(l,"treeroot"),p=n.openRootOnLoad,u=n.openCwdOnOpen,h=u||n.syncTree,f=t.res(l,"navsubtree"),m=t.res(l,"treedir"),g="span."+m,v=t.res(l,"navcollapse"),b=t.res(l,"navexpand"),y="elfinder-subtree-loaded",w="elfinder-subtree-chksubdir",x=t.res(l,"navarrow"),k=t.res(l,"active"),C=t.res(l,"adroppable"),z=t.res(l,"hover"),T=t.res(l,"disabled"),A=t.res(l,"draggable"),j=t.res(l,"droppable"),S="elfinder-navbar-wrapper-root",O="elfinder-navbar-wrapper-pastable",I="elfinder-navbar-wrapper-uploadable",M=function(e){var t=se.offset().left;return t<=e&&e<=t+se.width()},F={},E=[],D=function(n){var i=[];if(e.each(n,function(e,n){F[n]&&i.push(t.navId2Hash(n)),delete F[n]}),i.length)return t.request({data:{cmd:"subdirs",targets:i,preventDefault:!0}}).done(function(n){n&&n.subdirs&&e.each(n.subdirs,function(e,n){var i=t.navHash2Elm(e);i.removeClass(w),i[n?"addClass":"removeClass"](v)})})},U=null,P=function(){var n=Object.keys(F);n.length&&(U&&U._abort(),a&&clearTimeout(a),E=[],U=t.asyncJob(function(n){return t.isInWindow(e("#"+n))?n:null},n,{numPerOnce:200}).done(function(e){e.length&&(E=e,R())}))},q=0,R=function(){var e,i=n.subdirsMaxConn-q,o=t.maxTargets?Math.min(t.maxTargets,n.subdirsAtOnce):n.subdirsAtOnce;if(a&&cancelAnimationFrame(a),E.length)if(i>0)for(e=0;ed&&(i.on("update."+t.namespace,h),void 0===n&&(u=0,p(),n=f(v.hash),void 0===n&&(n=0)),y=a.slice(n,n+d),$[m]=i,w=n?Math.max(-1,n-d):-1,x=n+d>=a.length?0:n+d,r=Math.ceil(a.length/d),s=Math.ceil(n/d)),e.each(y||a,function(e,t){z.push(K(t)),t.node&&(T[t.hash]=t.node)}),k=w>-1?e('').text(t.i18n("btnPrevious",s,r)).button({icons:{primary:"ui-icon-caret-1-n"}}).on("click",function(e){e.preventDefault(),e.stopPropagation(),g(w,"up")}):e(),C=x?e('').text(t.i18n("btnNext",s+2,r)).button({icons:{primary:"ui-icon-caret-1-s"}}).on("click",function(e){e.preventDefault(),e.stopPropagation(),g(x,"down")}):e(),b(),i.empty()[y?"addClass":"removeClass"]("elfinder-navbar-hasmore").append(k,z.join(""),C),e.each(T,function(e,n){t.navHash2Elm(e).parent().replaceWith(n)}),o&&Z(t.navHash2Id(y["up"===o?y.length-1:0].hash)),!c&&t.lazy(function(){ie(null,i)})},b=function(){e.each(i.children(".elfinder-navbar-wrapper"),function(n,i){var o,r,l=e(i),c=l.children("[id]:first");c.hasClass(y)&&(o=t.navId2Hash(c.attr("id")),o&&void 0!==(r=s[o])&&(a[r].node=l.detach()))})};g()},w={},x=[],k={};f--;)a=i[f],g[a.hash]||t.navHash2Elm(a.hash).length||(g[a.hash]=!0,(o=J(a.phash)).length?(p=a.phash||"treeroot","undefined"==typeof k[p]&&(k[p]=o.children(":last")),s=!k[p].length,a.phash&&(s||o.hasClass("elfinder-navbar-hasmore")||(r=G(o,a)).length)?s?(w[a.phash]||(w[a.phash]=[]),w[a.phash].push(a)):r?(d=K(a),r.before(d),!c&&(m=m.add(d))):x.push(a):(d=K(a),s?o.prepend(d):k[p].after(d),a.phash&&!a.isroot||(l=t.navHash2Elm(a.hash).parent()),!c&&ie(null,l))):h.push(a));return Object.keys(w).length&&e.each(w,function(e,t){var n=J(e);t.sort(Q),b(n,t)}),x.length&&o.trigger("update."+t.namespace,{added:x}),h.length&&h.lengthc?r.animate({scrollTop:r.scrollTop()+d-s-l/3},{duration:n.durations.autoScroll,complete:function(){p.resolve()}}):p.resolve()):p.reject()},100),p},ee=function(e){var n,i,a,o=e||t.cwd(),r=o.hash?[o.hash]:[];for(i=t.root(o.hash),a=t.file(i);a&&(n=a.phash)&&(r.unshift(n),i=t.root(n),a=t.file(i),!t.navHash2Elm(a.hash).hasClass(y)););return r},te=function(e){var n=e||t.cwd(),i=n.hash,a=t.navHash2Elm(i);if(!a.length){for(;n&&n.phash;)$[n.phash]&&!t.navHash2Elm(n.hash).length&&$[n.phash].trigger("update."+t.namespace,{select:n.hash}),n=t.file(n.phash);a=t.navHash2Elm(i)}return a},ne=function(n,i){var a,o,s=t.cwd(),l=s.hash,c=void 0===i?h:i,d=function(n){var i,r,s=e.Deferred(),l=[],d=ee(n),p=function(e,n,i){var a={cmd:e,target:n};return i&&(a.until=i),t.request({data:a,preventFail:!0})};return l=e.map(d,function(e){var n,a,o=t.file(e),r=!!o&&t.isRoot(o),s=t.navHash2Elm(e),l=function(e,n){var i,a,o=n||1;return a=!!(i=t.file(e))&&i.phash,a&&o>1?l(a,--o):a},c=function(){var i=l(e);for(n=i;i&&!t.navHash2Elm(i).hasClass(y);)n=i,i=l(i);return i||(n=void 0,i=t.root(e)),i}();return s.hasClass(y)||!r&&o&&t.navHash2Elm(o.phash).hasClass(y)?null:(r||c===l(e)||c===l(e,2)?(n=void 0,a="tree",r||(e=l(e))):a="parents",i||(i="tree"===a?e:c),p(a,e,n))}),l.length?(te(t.file(i)),r=t.navHash2Id(i),c&&Z(r),a=e("#"+r),o=e(t.res("tpl","navspinner")).insertBefore(a.children("."+x)),a.removeClass(v),e.when.apply(e,l).done(function(){var e,t,n,i={};if(t=arguments.length,t>0)for(n=0;n0}).addClass(i)})},oe=e(this).addClass(i).on("mouseenter mouseleave",g,function(i){var a="mouseenter"===i.type;if(!a||!re){var o,r,s=e(this);s.hasClass(C+" "+T)||(c||!a||s.data("dragRegisted")||s.hasClass(d+" "+A+" elfinder-na elfinder-wo")||(s.data("dragRegisted",!0),t.isCommandEnabled("copy",o=t.navId2Hash(s.attr("id")))&&s.draggable(t.draggable)),s.toggleClass(z,a)),a&&n.attrTitle&&(r=t.file(o||t.navId2Hash(s.attr("id"))),r.isroot||s.attr("title")!==(r.i18||r.name)||s.attr("title",t.path(o,!0)))}}).on("dragenter",g,function(t){if(t.originalEvent.dataTransfer){var n=e(this);n.addClass(z),n.is("."+v+":not(."+b+")")&&n.data("expandTimer",setTimeout(function(){n.is("."+v+"."+z)&&n.children("."+x).trigger("click")},500))}}).on("dragleave",g,function(t){if(t.originalEvent.dataTransfer){var n=e(this);n.data("expandTimer")&&clearTimeout(n.data("expandTimer")),n.removeClass(z)}}).on("click",g,function(n){var i=e(this),a=t.navId2Hash(i.attr("id"));t.file(a);return i.data("longtap")?(i.removeData("longtap"),void n.stopPropagation()):(i.hasClass(k)||(oe.find(g+"."+k).removeClass(k),i.addClass(k)),void(a==t.cwd().hash||i.hasClass(T)?(i.hasClass(v)&&i.children("."+x).trigger("click"),t.select({selected:[a],origin:"navbar"})):t.exec("open",a).done(function(){t.one("opendone",function(){t.select({selected:[a],origin:"navbar"})})})))}).on("touchstart",g,function(n){if(!(n.originalEvent.touches.length>1)){var i,a=n.originalEvent;return"INPUT"===n.target.nodeName?void n.stopPropagation():void(i=e(this).addClass(z).removeData("longtap").data("tmlongtap",setTimeout(function(e){i.data("longtap",!0),t.trigger("contextmenu",{type:"navbar",targets:[t.navId2Hash(i.attr("id"))],x:a.touches[0].pageX,y:a.touches[0].pageY})},500)))}}).on("touchmove touchend",g,function(t){return"INPUT"===t.target.nodeName?void t.stopPropagation():(clearTimeout(e(this).data("tmlongtap")),e(this).removeData("tmlongtap"),void("touchmove"==t.type&&e(this).removeClass(z)))}).on("click",g+"."+v+" ."+x,function(i){var a,o=e(this),r=o.parent(g),s=r.next("."+f),l=e.Deferred(),c=30;i.stopPropagation(),r.hasClass(y)?(r.toggleClass(b),t.lazy(function(){a=r.hasClass(b)?s.children().length+s.find("div.elfinder-navbar-subtree[style*=block]").children().length:s.find("div:visible").length,a>c?(s.toggle(),t.draggingUiHelper&&t.draggingUiHelper.data("refreshPositions",1),P()):s.stop(!0,!0)[r.hasClass(b)?"slideDown":"slideUp"](n.durations.slideUpDown,function(){t.draggingUiHelper&&t.draggingUiHelper.data("refreshPositions",1),P()})}).always(function(){l.resolve()})):(N.insertBefore(o),r.removeClass(v),t.request({cmd:"tree",target:t.navId2Hash(r.attr("id"))}).done(function(e){Y(Object.assign([],X(e.tree))),s.children().length&&(r.addClass(v+" "+b),s.children().length>c?(s.show(),t.draggingUiHelper&&t.draggingUiHelper.data("refreshPositions",1),P()):s.stop(!0,!0).slideDown(n.durations.slideUpDown,function(){t.draggingUiHelper&&t.draggingUiHelper.data("refreshPositions",1),P()}))}).always(function(e){N.remove(),r.addClass(y),t.one("treedone",function(){l.resolve()})})),o.data("dfrd",l)}).on("contextmenu",g,function(n){n.stopPropagation();var i=e(this);i.find("input:text").length||(n.preventDefault(),i.data("tmlongtap")||t.trigger("contextmenu",{type:"navbar",targets:[t.navId2Hash(e(this).attr("id"))],x:n.pageX,y:n.pageY}),i.addClass("ui-state-hover"),t.getUI("contextmenu").children().on("mouseenter",function(){i.addClass("ui-state-hover")}),t.bind("closecontextmenu",function(){i.removeClass("ui-state-hover")}))}).on("scrolltoview",g,function(n,i){var a=e(this);Z(a.attr("id")).done(function(){i&&"undefined"!==i.blink&&!i.blink||t.resources.blink(a,"lookme")})}).on("create."+t.namespace,function(n,i){var a=J(i.phash),o=i.move||!1,r=e(K(i)).addClass("elfinder-navbar-wrapper-tmp"),s=t.selected();o&&s.length&&t.trigger("lockfiles",{files:s}),a.prepend(r)}),re=!1,se=t.getUI("navbar").append(oe).show().on("scroll",function(){re=!0,s&&cancelAnimationFrame(s),s=requestAnimationFrame(function(){re=!1,P()})}),le=t.sortAlsoTreeview;t.open(function(e){var n=e.data,i=X(n.files),a=t.getUI("contextmenu");n.init&&oe.empty(),t.UA.iOS&&se.removeClass("overflow-scrolling-touch").addClass("overflow-scrolling-touch"),i.length?t.lazy(function(){a.data("cmdMaps")||a.data("cmdMaps",{}),Y(i),ae(i,y),ne(i)}):ne()}).add(function(e){var t=X(e.data.added);t.length&&(Y(t),ae(t,v))}).change(function(n){if(!r){var i,a,o,s,l,d,p,u,h,m,v,w,x=X(n.data.changed,!0),k=x.length,C=k;e();for(e.each($,function(e,n){n.trigger("update."+t.namespace,{change:"prepare"})});C--;)if(i=x[C],a=i.phash,(o=t.navHash2Elm(i.hash)).length){if(v=o.parent(),a){if(l=o.closest("."+f),d=J(a),p=o.parent().next(),u=G(d,i),!d.length)continue;d[0]===l[0]&&p.get(0)===u.get(0)||(u.length?u.before(v):d.append(v))}h=o.hasClass(b),m=o.hasClass(y),s=e(K(i)),o.replaceWith(s.children(g)),!c&&ie(null,v),i.dirs&&(h||m)&&(o=t.navHash2Elm(i.hash))&&o.next("."+f).children().length&&(h&&o.addClass(b),m&&o.addClass(y)),w|=i.dirs==-1}w&&P(),e.each($,function(e,n){n.trigger("update."+t.namespace,{change:"done"})}),k&&ne(void 0,!1)}}).remove(function(n){var i,a,o,r=n.data.removed,s=r.length;for(e.each($,function(e,n){n.trigger("update."+t.namespace,{removed:r}),n.trigger("update."+t.namespace,{change:"prepare"})});s--;)(i=t.navHash2Elm(r[s])).length&&(o=!0,a=i.closest("."+f),i.parent().detach(),a.children().length||a.hide().prev(g).removeClass(v+" "+b+" "+y));o&&t.getUI("navbar").children(".ui-resizable-handle").trigger("resize"),e.each($,function(e,n){n.trigger("update."+t.namespace,{change:"done"})})}).bind("lockfiles unlockfiles",function(n){var i="lockfiles"==n.type,a=!!n.data.helper&&n.data.helper.data("locked"),o=i&&!a?"disable":"enable",r=e.grep(n.data.files||[],function(e){var n=t.file(e);return!(!n||"directory"!=n.mime)});e.each(r,function(e,n){var r=t.navHash2Elm(n);r.length&&!a&&(r.hasClass(A)&&r.draggable(o),r.hasClass(j)&&r.droppable(o),r[i?"addClass":"removeClass"](T))})}).bind("sortchange",function(){if(t.sortAlsoTreeview||le!==t.sortAlsoTreeview){var n,i,a=[],o={},r={},s="",l=!1;t.lazy(function(){n=X(t.files()),le=t.sortAlsoTreeview,oe.empty(),Y(e.map(t.roots,function(e){var n=t.file(e);return n&&!n.phash?n:null})),Object.keys($).length?(a=ee(),a.length>1?(e.each(a,function(e,n){var i=t.file(t.root(n)).volumeid;0===e&&(s=i),r[i]=n,o[n]=[]}),e.each(n,function(e,t){return t.volumeid?void o[r[t.volumeid]||r[s]].push(t):(l=!0,!1)})):l=!0,l?e.each(a,function(e,a){Y(n),i=te(t.file(a)),ae(n,y)}):e.each(o,function(e,n){Y(n),i=te(t.file(e)),ae(n,y)})):(Y(n),i=te(),ae(n,y)),ne()},100)}})}),this},e.fn.elfinderuploadbutton=function(t){return this.each(function(){var n,i=t.fm,a=e(this).elfinderbutton(t).off("click"),o=e("
").appendTo(a),r=e('').on("change",function(){var t=e(this);t.val()&&(i.exec("upload",{input:t.remove()[0]},void 0,i.cwd().hash),r.clone(!0).appendTo(o))}).on("dragover",function(e){e.originalEvent.dataTransfer.dropEffect="copy"});o.append(r.clone(!0)),t.change(function(){n&&cancelAnimationFrame(n),n=requestAnimationFrame(function(){var e=t.disabled();o.is("visible")?!e&&o.hide():e&&o.show()})}).change()})},e.fn.elfinderviewbutton=function(t){return this.each(function(){var n,i=e(this).elfinderbutton(t),a=i.children(".elfinder-button-icon"),o=i.children(".elfinder-button-text");t.change(function(){n&&cancelAnimationFrame(n),n=requestAnimationFrame(function(){var e="icons"==t.value;a.toggleClass("elfinder-button-icon-view-list",e),t.className=e?"view-list":"",t.title=t.fm.i18n(e?"viewlist":"viewicons"),i.attr("title",t.title),o.html(t.title)})})})},e.fn.elfinderworkzone=function(t){var n="elfinder-workzone";return this.not("."+n).each(function(){var i,a=e(this).addClass(n),o=Math.round(a.height()),r=a.parent(),s=function(){i=a.outerHeight(!0)-a.height()},l=function(s){var l=r.height()-i,c=r.attr("style"),d=Math.round(a.height());s&&(s.preventDefault(),s.stopPropagation()),r.css("overflow","hidden").children(":visible:not(."+n+")").each(function(){var t=e(this);"absolute"!=t.css("position")&&"fixed"!=t.css("position")&&(l-=t.outerHeight(!0))}),r.attr("style",c||""),l=Math.max(0,Math.round(l)),o===l&&d===l||(o=Math.round(a.height()),a.height(l),t.trigger("wzresize"))},c=function(){i=a.outerHeight(!0)-a.height(),l()};s(),r.on("resize."+t.namespace,l),t.one("cssloaded",c).bind("uiresize",l).bind("themechange",s)}),this},i.prototype.commands.archive=function(){var t,n=this,i=n.fm,a=[];this.variants=[],this.disableOnSearch=!1,this.nextAction={},i.bind("open reload",function(){n.variants=[],e.each(a=i.option("archivers").create||[],function(e,t){n.variants.push([t,i.mime2kind(t)])}),n.change()}),this.getstate=function(n){var o,r=this.files(n),s=r.length,l=s&&!i.isRoot(r[0])&&(i.file(r[0].phash)||{}).write,c=function(t){var n=!0;return e.grep(t,function(e){return n=!(!n||!e.read||0!==e.hash.indexOf(o))})};return l&&i.searchStatus.state>1&&(l=s===c(r).length)&&(o=i.cwd().volumeid),l&&!this._disabled&&a.length&&(s||t&&"pending"==t.state())?0:-1},this.exec=function(o,r){var s,l,c=this.files(o),d=c.length,p=r||a[0],u=i.file(c[0].phash)||null,h=["errArchive","errPerm","errCreatingTempDir","errFtpDownloadFile","errFtpUploadFile","errFtpMkdir","errArchiveExec","errExtractExec","errRm"];if(t=e.Deferred().fail(function(e){e&&i.error(e)}),!d||!a.length||e.inArray(p,a)===-1)return t.reject();if(!u.write)return t.reject(h);for(s=0;s1?"Archive":c[0].name)+(i.option("archivers").createext?"."+i.option("archivers").createext[p]:""),n.data={targets:n.hashes(o),type:p},i.cwd().hash!==u.hash?l=i.exec("open",u.hash).done(function(){i.one("cwdrender",function(){i.selectfiles({files:o}),t=e.proxy(i.res("mixin","make"),n)()})}):(i.selectfiles({files:o}),t=e.proxy(i.res("mixin","make"),n)()),t}},(i.prototype.commands.back=function(){this.alwaysEnabled=!0,this.updateOnSelect=!1,this.shortcuts=[{pattern:"ctrl+left backspace"}],this.getstate=function(){return this.fm.history.canBack()?0:-1},this.exec=function(){return this.fm.history.back()}}).prototype={forceLoad:!0},i.prototype.commands.chmod=function(){this.updateOnSelect=!1;var t=this.fm,n={0:"owner",1:"group",2:"other"},i={read:t.i18n("read"),write:t.i18n("write"),execute:t.i18n("execute"),perm:t.i18n("perm"),kind:t.i18n("kind"),files:t.i18n("files")},a=function(e){return!isNaN(parseInt(e,8))&&parseInt(e,8)<=511||e.match(/^([r-][w-][x-]){3}$/i)};this.tpl={main:'
{title}
{dataTable}',itemTitle:'{name}{kind}',groupTitle:"{items}: {num}",dataTable:'
{0}{1}{2}
'+i.perm+':
',fieldset:'
{f_title}{name}


"},this.shortcuts=[{}],this.getstate=function(e){var t=this.fm;return e=e||t.selected(),0==e.length&&(e=[t.cwd().hash]),this.checkstate(this.files(e))?0:-1},this.checkstate=function(t){var n=t.length,i=function(i){var o=!0;return e.grep(t,function(e){return o=!(!(o&&e.isowner&&e.perm&&a(e.perm))||1!=n&&"directory"==e.mime)})};return!(!n||n!==i(t).length)},this.exec=function(t){var o=this.hashes(t),r=this.files(o);r.length||(o=[this.fm.cwd().hash],r=this.files(o));var s,l,c=this.fm,d=e.Deferred().always(function(){c.enable()}),p=this.tpl,u=r.length,h=r[0],f=c.namespace+"-perm-"+h.hash,m=p.main,g=' checked="checked"',v=function(){var e={};return e[c.i18n("btnApply")]=b,e[c.i18n("btnCancel")]=function(){A.elfinderdialog("close")},e},b=function(){var t,n=e.trim(e("#"+f+"-perm").val());return!!a(n)&&(A.elfinderdialog("close"),t={cmd:"chmod",targets:o,mode:n},void c.request({data:t,notify:{type:"chmod",cnt:u}}).fail(function(e){d.reject(e)}).done(function(n){n.changed&&n.changed.length&&(n.undo={cmd:"chmod",callback:function(){var t=[];return e.each(j,function(e,n){t.push(c.request({data:{cmd:"chmod",targets:n,mode:e},notify:{type:"undo",cnt:n.length}}))}),e.when.apply(null,t)}},n.redo={cmd:"chmod",callback:function(){return c.request({data:t,notify:{type:"redo",cnt:o.length}})}}),d.resolve(n)}))},y=function(){for(var t,i="",a=0;a<3;a++)t=0,e("#"+f+"-read-"+n[a]+"-perm").is(":checked")&&(t=4|t),e("#"+f+"-write-"+n[a]+"-perm").is(":checked")&&(t=2|t),e("#"+f+"-execute-"+n[a]+"-perm").is(":checked")&&(t=1|t),i+=t.toString(8);e("#"+f+"-perm").val(i)},w=function(t){for(var i,a=0;a<3;a++)i=parseInt(t.slice(a,a+1),8),e("#"+f+"-read-"+n[a]+"-perm").prop("checked",!1),e("#"+f+"-write-"+n[a]+"-perm").prop("checked",!1),e("#"+f+"-execute-"+n[a]+"-perm").prop("checked",!1),4==(4&i)&&e("#"+f+"-read-"+n[a]+"-perm").prop("checked",!0),2==(2&i)&&e("#"+f+"-write-"+n[a]+"-perm").prop("checked",!0),1==(1&i)&&e("#"+f+"-execute-"+n[a]+"-perm").prop("checked",!0);y()},x=function(e){for(var t,n,i,a="777",o="",r=e.length,s=0;s1?"elfinder-cwd-icon-group":c.mime2class(h.mime)),u>1?s=p.groupTitle.replace("{items}",c.i18n("items")).replace("{num}",u):(s=p.itemTitle.replace("{name}",h.name).replace("{kind}",c.mime2kind(h)),S=c.tmb(h)),l=C(x(r),1==r.length?r[0]:{}),m=m.replace("{title}",s).replace("{dataTable}",l).replace(/{id}/g,f),A=this.fmDialog(m,T),A.attr("id",f),S&&e("").on("load",function(){A.find(".elfinder-cwd-icon").addClass(S.className).css("background-image","url('"+S.url+"')")}).attr("src",S.url),e("#"+f+"-table-perm :checkbox").on("click",function(){y("perm")}),e("#"+f+"-perm").on("keydown",function(t){var n=t.keyCode;if(n==e.ui.keyCode.ENTER)return t.stopPropagation(),void b()}).on("focus",function(t){e(this).trigger("select")}).on("keyup",function(t){3==e(this).val().length&&(e(this).trigger("select"),w(e(this).val()))}),d)}},i.prototype.commands.colwidth=function(){this.alwaysEnabled=!0,this.updateOnSelect=!1,this.getstate=function(){return"fixed"===this.fm.getUI("cwd").find("table").css("table-layout")?0:-1},this.exec=function(){return this.fm.getUI("cwd").trigger("colwidth"),e.Deferred().resolve()}},i.prototype.commands.copy=function(){this.shortcuts=[{pattern:"ctrl+c ctrl+insert"}],this.getstate=function(t){var n=this.files(t),i=n.length,a=function(t){var n=!0;return e.grep(t,function(e){return n=!(!n||!e.read)})};return i&&a(n).length==i?0:-1},this.exec=function(t){var n=this.fm,i=e.Deferred().fail(function(e){n.error(e)});return e.each(this.files(t),function(e,t){if(!t.read)return!i.reject(["errCopy",t.name,"errPerm"])}),"rejected"==i.state()?i:i.resolve(n.clipboard(this.hashes(t)))}},i.prototype.commands.cut=function(){var t=this.fm;this.shortcuts=[{pattern:"ctrl+x shift+insert"}],this.getstate=function(n){var i=this.files(n),a=i.length,o=function(n){var i=!0;return e.grep(n,function(e){return i=!(!i||!e.read||e.locked||t.isRoot(e))})};return a&&o(i).length==a?0:-1},this.exec=function(n){var i=e.Deferred().fail(function(e){t.error(e)});return e.each(this.files(n),function(e,n){return!n.read||n.locked||t.isRoot(n)?!i.reject(["errCopy",n.name,"errPerm"]):n.locked?!i.reject(["errLocked",n.name]):void 0}),"rejected"==i.state()?i:i.resolve(t.clipboard(this.hashes(n),!0))}},i.prototype.commands.zipdl=function(){},i.prototype.commands.download=function(){var t=this,n=this.fm,i=null,a=!1,o=!1,r=!1,s=window.location.pathname||"/",l=function(r,s){var l,c;if(null!==i&&(n.searchStatus.state>1?o=n.searchStatus.mixed:n.leafRoots[n.cwd().hash]&&(l=n.cwd().volumeid,e.each(r,function(e,t){if(0!==t.indexOf(l))return o=!0,!1})),a=n.isCommandEnabled("zipdl",r[0])),o){if(c=i?"zipdl":"download",r=e.grep(r,function(e){var t=n.file(e),a=!(!t||!i&&"directory"===t.mime||!n.isCommandEnabled(c,e));return t&&s&&!a&&n.cwdHash2Elm(t.hash).trigger("unselect"),a}),!r.length)return[]}else if(!n.isCommandEnabled("download",r[0]))return[];return e.grep(t.files(r),function(e){var t=!(!e.read||!a&&"directory"==e.mime);return s&&!t&&n.cwdHash2Elm(e.hash).trigger("unselect"),t})};this.linkedCmds=["zipdl"],this.shortcuts=[{pattern:"shift+enter"}],this.getstate=function(e){var t=this.hashes(e),i=t.length,o=this.options.maxRequests||10;return i<1?-1:(i=l(t).length,i&&(a||i<=o&&(!n.UA.IE&&!n.UA.Mobile||1==i))?0:-1)},n.bind("contextmenu",function(n){var i,a,o=t.fm,r=null,s=function(t){var n=t.url||o.url(t.hash);return{icon:"link",node:e("").attr({href:n,target:"_blank",title:o.i18n("link")}).text(t.name).on("mousedown click touchstart touchmove touchend contextmenu",function(e){e.stopPropagation()}).on("dragstart",function(n){var i=n.dataTransfer||n.originalEvent.dataTransfer||null;if(r=null,i){var a=function(t){var n,i=t.mime,a=o.tmb(t);return n='
',a&&(n=e(n).addClass(a.className).css("background-image","url('"+a.url+"')").get(0).outerHTML),n};i.effectAllowed="copyLink",i.setDragImage&&(r=e('
').append(a(t)).appendTo(e(document.body)),i.setDragImage(r.get(0),50,47)),o.UA.IE||(i.setData("elfinderfrom",window.location.href+t.phash),i.setData("elfinderfrom:"+i.getData("elfinderfrom"),""))}}).on("dragend",function(e){r&&r.remove()})}};if(t.extra=null,n.data&&(i=n.data.targets||[],1===i.length&&(a=o.file(i[0]))&&"directory"!==a.mime))if("1"!=a.url)t.extra=s(a);else{var l;t.extra={icon:"link",node:e("").attr({href:"#",title:o.i18n("getLink"),draggable:"false"}).text(a.name).on("click touchstart",function(e){if(!("touchstart"===e.type&&e.originalEvent.touches.length>1)){var t=l.parent();e.stopPropagation(),e.preventDefault(),t.removeClass("ui-state-disabled").addClass("elfinder-button-icon-spinner"),o.request({data:{cmd:"url",target:a.hash},preventDefault:!0}).always(function(e){if(t.removeClass("elfinder-button-icon-spinner"),e.url){var n=o.file(a.hash);n.url=e.url,l.replaceWith(s(a).node)}else t.addClass("ui-state-disabled")})}})},l=t.extra.node,l.ready(function(){requestAnimationFrame(function(){l.parent().addClass("ui-state-disabled").css("pointer-events","auto")})})}}).one("open",function(){n.api>=2.1012&&(i=n.getCommand("zipdl")),r=n.cookieEnabled&&n.api>2.1038&&!n.isCORS}),this.exec=function(n){var i,c,d,p,u,h,f,m,g,v=this.hashes(n),b=this.fm,y=(b.options.url,l(v,!0)),w=e.Deferred(),x="",k={},C=!1,z=function(n){return function(){var i,a,o,r=e.Deferred(),s=b.file(b.root(n[0])),l=1===n.length,d=s?s.i18||s.name:null;return l?(i=b.file(n[0]))&&(a=i.i18||i.name):(e.each(n,function(){var e=b.file(this);return!e||o&&o!==e.phash?(o=null,!1):void(o=e.phash)}),o&&(i=b.file(o))&&(a=(i.i18||i.name)+"-"+n.length)),a&&(d=a),d&&(d=" ("+d+")"),b.request({data:{cmd:"zipdl",targets:n},notify:{type:"zipdl",cnt:1,hideCnt:!0,msg:b.i18n("ntfzipdl")+d},cancel:!0,eachCancel:!0,preventDefault:!0}).done(function(i){var o,s,l,d,u,h,f={},m="dlw"+ +new Date,g=function(n){l=e("").attr("href",n).attr("download",b.escape(a)).on("click",function(){r.resolve(),s&&s.elfinderdialog("destroy")}),C?(l.attr("target","_blank").append(''+b.escape(a)),f[b.i18n("btnCancel")]=function(){s.elfinderdialog("destroy")},s=t.fmDialog(l,{title:b.i18n("link"),buttons:f,width:"200px",destroyOnClose:!0,close:function(){"resolved"!==r.state()&&r.resolve()}})):(T(l.hide().appendTo("body").get(0)),l.remove())};i.error?(b.error(i.error),r.resolve()):i.zipdl&&(o=i.zipdl,a?(h=b.splitFileExtention(o.name||""),a+=h[1]?"."+h[1]:".zip"):a=o.name,p||C?(c=b.options.url+(b.options.url.indexOf("?")===-1?"?":"&")+"cmd=zipdl&download=1",e.each([n[0],o.file,a,o.mime],function(e,t){c+="&targets%5B%5D="+encodeURIComponent(t)}),e.each(b.customData,function(e,t){c+="&"+encodeURIComponent(e)+"="+encodeURIComponent(t)}),c+="&"+encodeURIComponent(a),b.hasParrotHeaders()?b.getBinaryByUrl({url:c},function(e){e instanceof Blob?(c=(window.URL||window.webkitURL).createObjectURL(e),g(c)):b.error(["errUploadTransfer",b.i18n("kindZIP")])}):g(c)):(d=e('
').append('').append(''),e.each([n[0],o.file,a,o.mime],function(e,t){d.append('')}),e.each(b.customData,function(e,t){d.append('')}),d.attr("target",m).appendTo("body"),u=e('';d.remove(),e(x).appendTo("body").ready(function(){setTimeout(function(){e(x).each(function(){e("#"+e(this).attr("id")).remove()})},2e4+1e4*i)}),b.trigger("download",{files:y}),w.resolve()}),u=y.length,g=[],i=0;i');return t&&e.each(t,function(e,t){a=i.escape(t.value),o.append('")}),e.each(n.options.encodings,function(e,t){o.append('")}),o},d=function(){var t,a,o=i.options.dialogContained?i.getUI():e(window);return a="string"==typeof n.options.dialogWidth&&(t=n.options.dialogWidth.match(/(\d+)%/))?parseInt(o.width()*(t[1]/100)):parseInt(n.options.dialogWidth||650),Math.min(a,o.width())},p=function(){if(n.options.dialogHeight){var t,a,o=i.options.dialogContained?i.getUI():e(window);return a="string"==typeof n.options.dialogHeight&&(t=n.options.dialogHeight.match(/(\d+)%/))?parseInt(o.height()*(t[1]/100)):parseInt(n.options.dialogHeight||o.height()),Math.min(a,o.height())}},u=function(t){var a,l,c,d=t.length;return d>1&&(a=t[0].mime,l=t[0].name.replace(/^.*(\.[^.]+)$/,"$1")),e.grep(t,function(t){var p;return!c&&"directory"!==t.mime&&(p=t.read&&(s||i.mimeIsText(t.mime)||e.inArray(t.mime,1===d?o:r)!==-1)&&(!n.onlyMimes.length||e.inArray(t.mime,n.onlyMimes)!==-1)&&(1===d||t.mime===a&&t.name.substr(l.length*-1)===l)&&!!i.uploadMimeCheck(t.mime,t.phash)&&b(t,d)&&Object.keys(g).length,p||(c=!0),p)})},h=function(e){var t,n=i.file(e);i.request({cmd:"info",targets:[e],preventDefault:!0}).done(function(e){var a;e&&e.files&&e.files.length&&(t=e.files[0],n.ts==t.ts&&n.size==t.size||(a={changed:[t]},i.updateCache(a),i.change(a)))})},f=function(t,o,r,s,u,f){var g,v,b,y,w,k,C=e.Deferred(),z=!1,T=function(){return!!z||(i.toast({mode:"warning",msg:i.i18n("nowLoading")}),!1)},A=function(){f&&Array.isArray(f)&&e.each(f,function(){this.msg&&i.toast(this)})},j=function(){var t,n,a,o=y?y.val():void 0,r=e.Deferred().fail(function(e){b.show().find("button.elfinder-btncnt-0,button.elfinder-btncnt-1").hide()});return T()?(g.editor&&(g.editor.save(g[0],g.editor.instance),t=g.editor.confObj,t.info&&(t.info.schemeContent||t.info.arrayBufferContent)&&(o="scheme")),n=D(),U(n),n.promise?(a=setTimeout(function(){i.notify({type:"chkcontent",cnt:1,hideCnt:!0,cancel:function(){n.reject()}})},100),n.always(function(){a&&clearTimeout(a),i.notify({type:"chkcontent",cnt:-1})}).done(function(e){C.notifyWith(g,[o,g.data("hash"),v,r])}).fail(function(e){r.reject(e)})):C.notifyWith(g,[o,g.data("hash"),v,r]),r):r.resolve()},S=function(){T()&&j().fail(function(e){e&&i.error(e)})},O=function(){g.elfinderdialog("close")},I=function(){T()&&(b.hide(),j().done(function(){z=!1,b.show(),O()}).fail(function(e){b.show(),e&&i.error(e)}))},M=function(){if(T()){var t=v,r=o.phash,s=function(e){p.addClass(a).fadeIn(function(){e&&i.error(e)}),v=t,i.disable()},l=function(){n.mime=R.mime||o.mime,n.prefix=(R.name||o.name).replace(/ \d+(\.[^.]+)?$/,"$1"),n.requestCmd="mkfile",n.nextAction={},n.data={target:r},e.proxy(i.res("mixin","make"),n)().done(function(e){var t;e.added&&e.added.length?(t=g.data("hash"),g.data("hash",e.added[0].hash),j().done(function(){z=!1,b.show(),O(),p.fadeIn()}).fail(function(){i.exec("rm",[e.added[0].hash],{forceRm:!0,quiet:!0}),g.data("hash",t),b.find("button.elfinder-btncnt-2").hide(),s()})):s()}).progress(function(e){e&&"errUploadMime"===e&&g.trigger("saveAsFail")}).fail(s).always(function(){delete n.mime,delete n.prefix,delete n.nextAction,delete n.data}),i.trigger("unselectfiles",{files:[o.hash]})},c=null,d=null,p=i.getUI().children("."+n.dialogClass+":visible");b.is(":hidden")&&(p=p.add(b)),p.removeClass(a).fadeOut(),i.enable(),i.searchStatus.state<2&&r!==i.cwd().hash?c=i.exec("open",[r],{thash:r}):i.file(r)||(d=i.request({cmd:"info",targets:[r]})),e.when([c,d]).done(function(){d?i.one("infodone",function(){i.file(r)?l():s("errFolderNotFound")}):c?i.one("cwdrender",l):l()}).fail(s)}},F=function(){var t,n,a=e.Deferred();return z?(g.editor&&g.editor.save(g[0],g.editor.instance),t=D(),t&&t.promise?(n=setTimeout(function(){i.notify({type:"chkcontent",cnt:1,hideCnt:!0,cancel:function(){t.reject()}})},100),t.always(function(){n&&clearTimeout(n),i.notify({type:"chkcontent",cnt:-1})}).done(function(e){a.resolve(v!==e)}).fail(function(e){a.resolve(e||void 0!==v)})):a.resolve(v!==t),a):a.resolve(!1)},E={title:i.escape(o.name),width:d(),height:p(),buttons:{},cssClass:a,maxWidth:"window",maxHeight:"window",allowMinimize:!0,allowMaximize:!0,openMaximized:x()||u&&u.info&&u.info.openMaximized,btnHoverFocus:!1,closeOnEscape:!1,propagationEvents:["mousemove","mouseup","click"],minimize:function(){var e;g.editor&&b.closest(".ui-dialog").is(":hidden")&&(e=g.editor.confObj,e.info&&e.info.syncInterval&&h(o.hash))},close:function(){var e=function(){var e;C.resolve(),g.editor&&(g.editor.close(g[0],g.editor.instance),e=g.editor.confObj,e.info&&e.info.syncInterval&&h(o.hash)),g.elfinderdialog("destroy")},t="undefined"!=typeof R.name,a=t?{label:"btnSaveAs",callback:function(){requestAnimationFrame(M)}}:{label:"btnSaveClose",callback:function(){j().done(function(){e()})}};F().done(function(o){var r=["confirmNotSave"];o?("string"==typeof o&&r.unshift(o),i.confirm({title:n.title,text:r,accept:a,cancel:{label:"btnClose",callback:e},buttons:t?null:[{label:"btnSaveAs",callback:function(){requestAnimationFrame(M)}}]})):e()})},open:function(){var e,n,a;if(g.initEditArea.call(g,t,o,r,i),g.editor){if(e=g.editor.load(g[0])||null,e&&e.done)e.always(function(){z=!0}).done(function(e){g.editor.instance=e,g.editor.focus(g[0],g.editor.instance),U(D()),requestAnimationFrame(function(){b.trigger("resize")})}).fail(function(e){e&&i.error(e),g.elfinderdialog("destroy")}).always(A);else{if(z=!0,e&&("string"==typeof e||Array.isArray(e)))return i.error(e),void g.elfinderdialog("destroy");g.editor.instance=e,g.editor.focus(g[0],g.editor.instance),U(D()),requestAnimationFrame(function(){b.trigger("resize")}),A()}n=g.editor.confObj,n.info&&n.info.syncInterval&&(a=parseInt(n.info.syncInterval))&&setTimeout(function(){P(a)},a)}else z=!0,U(D())},resize:function(e,t){g.editor&&g.editor.resize(g[0],g.editor.instance,e,t||{})}},D=function(){var t=g.getContent.call(g,g[0]);return void 0!==t&&t!==!1&&null!==t||(t=e.Deferred().reject()),t},U=function(e){e&&e.promise?e.done(function(e){v=e}):v=e},P=function(e){b.is(":visible")&&(h(o.hash),setTimeout(function(){P(e)},e))},q=function(){y&&F().done(function(e){e?y.attr("title",i.i18n("saveAsEncoding")).addClass("elfinder-edit-changed"):y.attr("title",i.i18n("openAsEncoding")).removeClass("elfinder-edit-changed")})},R={};if(u&&(u.html&&(g=e(u.html)),w={init:u.init||null,load:u.load,getContent:u.getContent||null,save:u.save,beforeclose:"function"==typeof u.beforeclose?u.beforeclose:void 0,close:"function"==typeof u.close?u.close:function(){},focus:"function"==typeof u.focus?u.focus:function(){},resize:"function"==typeof u.resize?u.resize:function(){},instance:null,doSave:S,doCancel:O,doClose:I,file:o,fm:i,confObj:u,trigger:function(e,t){i.trigger("editEditor"+e,Object.assign({},u.info||{},t))}}),!g){if(!i.mimeIsText(o.mime))return C.reject("errEditorNotFound");!function(){g=e('').on("input propertychange",q),u&&u.info&&!u.info.useTextAreaEvent||g.on("keydown",function(t){var n,i,a=t.keyCode;t.stopPropagation(),a==e.ui.keyCode.TAB&&(t.preventDefault(),this.setSelectionRange&&(n=this.value,i=this.selectionStart,this.value=n.substr(0,i)+"\t"+n.substr(this.selectionEnd),i+=1,this.setSelectionRange(i,i))),(t.ctrlKey||t.metaKey)&&(a!="Q".charCodeAt(0)&&a!="W".charCodeAt(0)||(t.preventDefault(),O()),a=="S".charCodeAt(0)&&(t.preventDefault(),S()))}).on("mouseenter",function(){this.focus()}),g.initEditArea=function(e,t,n){g.hide().val(n),this._setupSelEncoding(n)}}()}return g._setupSelEncoding=function(t){var n=s&&"unknown"!==s?[{value:s}]:[],a=e("").hide(),r=function(t){t&&a.appendTo(y.parent()),a.empty().append(e("").text(y.val())),y.width(a.width())};""!==t&&s&&"UTF-8"===s||n.push({value:"UTF-8"}),y=c(n).on("touchstart",function(e){e.stopPropagation()}).on("change",function(){F().done(function(e){e||""===D()||(O(),m(o,y.val(),u).fail(function(e){e&&i.error(e)}))}),r()}).on("mouseover",q),g.parent().next().prepend(e('
').append(y)),r(!0)},g.data("hash",o.hash),w&&(g.editor=w,"function"==typeof w.beforeclose&&(E.beforeclose=function(){return w.beforeclose(g[0],w.instance)}),"function"==typeof w.init&&(g.initEditArea=w.init),"function"==typeof w.getContent&&(g.getContent=w.getContent)),g.initEditArea||(g.initEditArea=function(){}),g.getContent||(g.getContent=function(){return l(g.val())}),u&&u.info&&u.info.preventGet||(E.buttons[i.i18n("btnSave")]=S,E.buttons[i.i18n("btnSaveClose")]=I,E.buttons[i.i18n("btnSaveAs")]=M,E.buttons[i.i18n("btnCancel")]=O),u&&"function"==typeof u.prepare&&u.prepare(g,E,o),b=n.fmDialog(g,E).attr("id",t).on("keydown keyup keypress",function(e){e.stopPropagation()}).css({overflow:"hidden",minHeight:"7em"}).addClass("elfinder-edit-editor").closest(".ui-dialog").on("changeType",function(t,n){if(n.extention&&n.mime){var a=(n.extention,n.mime,e(this).children(".ui-dialog-buttonpane").children(".ui-dialog-buttonset"));a.children(".elfinder-btncnt-0,.elfinder-btncnt-1").hide(),R.name=i.splitFileExtention(o.name)[0]+"."+n.extention,R.mime=n.mime,n.keepEditor||a.children(".elfinder-btncnt-2").trigger("click")}}),k=(i.options.dialogContained?i.getUI():e(window)).width(),b.width()>k&&b.width(k),C.promise()},m=function(t,a,o){var r,s,l,d=t.hash,p=(i.options,e.Deferred()),u="edit-"+i.namespace+"-"+t.hash,h=i.getUI().find("#"+u),g=a?a:0,v=!1;if(h.length)return h.elfinderdialog("toTop"),p.resolve();if(!(t.read&&(t.write||o.info&&o.info.converter)))return s=["errOpen",t.name,"errPerm"],p.reject(s);if(o&&o.info){if("function"==typeof o.info.edit)return l=o.info.edit.call(i,t,o),l.promise?l.done(function(){p.resolve()}).fail(function(e){p.reject(e)}):l?p.resolve():p.reject(),p;v=o.info.preventGet||o.info.noContent,o.info.urlAsContent||v?(r=e.Deferred(),o.info.urlAsContent?i.url(d,{async:!0,onetime:!0,temporary:!0}).done(function(e){r.resolve({content:e})}):r.resolve({})):(g&&(t.encoding=g,i.cache(t,"change")),r=i.request({data:{cmd:"get",target:d,conv:g,_t:t.ts},options:{type:"get",cache:!0},notify:{type:"file",cnt:1},preventDefault:!0})),r.done(function(a){var r,s,l;a.doconv?i.confirm({title:n.title,text:"unknown"===a.doconv?"confirmNonUTF8":"confirmConvUTF8",accept:{label:"btnConv",callback:function(){p=m(t,r.val(),o)}},cancel:{label:"btnCancel",callback:function(){p.reject()}},optionsCallback:function(t){t.create=function(){var t=e('
'),n={value:a.doconv};"unknown"===a.doconv&&(n.caption="-"),r=c([n]),e(this).next().find(".ui-dialog-buttonset").prepend(t.append(e("").append(r)))}}}):(!v&&i.mimeIsText(t.mime)&&(s=new RegExp("^(data:"+t.mime.replace(/([.+])/g,"\\$1")+";base64,)","i"),o.info.dataScheme?window.btoa&&!a.content.match(s)&&(a.content="data:"+t.mime+";base64,"+btoa(a.content)):window.atob&&(l=a.content.match(s))&&(a.content=atob(a.content.substr(l[1].length)))),f(u,t,a.content,a.encoding,o,a.toasts).done(function(e){p.resolve(e)}).progress(function(e,t,n,a){var o=this;t&&(d=t),i.request({options:{type:"post"},data:{cmd:"put",target:d,encoding:e||n.encoding,content:n},notify:{type:"save",cnt:1},syncOnFail:!0,preventFail:!0,navigate:{target:"changed",toast:{inbuffer:{msg:i.i18n(["complete",i.i18n("btnSave")])}}}}).fail(function(e){p.reject(e),a.reject()}).done(function(e){requestAnimationFrame(function(){o.trigger("focus"),o.editor&&o.editor.focus(o[0],o.editor.instance)}),a.resolve()})}).fail(function(e){p.reject(e)}))}).fail(function(e){var n=i.parseError(e);n=Array.isArray(n)?n[0]:n,t.encoding&&(t.encoding="",i.cache(t,"change")),"errConvUTF8"!==n&&i.sync(),p.reject(e)})}return p.promise()},g={},v={info:{id:"textarea",name:"TextArea",useTextAreaEvent:!0},load:function(t){this.trigger("Prepare",{node:t,editorObj:void 0,instance:void 0,opts:{}}),t.setSelectionRange&&t.setSelectionRange(0,0),e(t).trigger("focus").show()},save:function(){}},b=function(a,o){var r=function(t,n){if(n){if("*"===n[0]||e.inArray(t,n)!==-1)return!0;var a,o;for(o=n.length,a=0;a0||!t.info.converter&&t.info.canMakeEmpty!==!1&&i.mimesCanMakeEmpty[a.mime])&&(!t.info.maxSize||a.size<=t.info.maxSize)&&r(a.mime,t.mimes||null)&&s(a.name,t.exts||null)&&"function"==typeof t.load&&"function"==typeof t.save&&(n=t.info.name?t.info.name:"Editor "+e,t.id=t.info.id?t.info.id:"editor"+e,t.name=n,t.i18n=i.i18n(n),g[t.id]=t)}),!!Object.keys(g).length},y=function(n,a){n&&a&&(e.isPlainObject(t)||(t={}),t[n]=a.id,i.storage("storedEditors",t),i.trigger("selectfiles",{files:i.selected()}))},w=function(){var e=i.storage("useStoredEditor");return e?e>0:n.options.useStoredEditor},x=function(){var e=i.storage("editorMaximized");return e?e>0:n.options.editorMaximized},k=function(t,n){var a=[];return e.each(g,function(e,o){a.push({label:i.escape(o.i18n),icon:o.info&&o.info.icon?o.info.icon:"edit",options:{iconImg:o.info&&o.info.iconImg?i.baseUrl+o.info.iconImg:void 0},callback:function(){y(t[0].mime,o),n&&n.call(o)}})}),a},C=function(e){return e.toLowerCase().replace(/ +/g,"")},z=function(e){var n=t[e];return n&&Object.keys(g).length?g[C(n)]:void 0};this.getEncSelect=c,this.shortcuts=[{pattern:"ctrl+e"}],this.init=function(){var t,n,i=this,a=this.fm,l=this.options,c=[];this.onlyMimes=this.options.mimes||[],a.one("open",function(){l.editors&&Array.isArray(l.editors)&&(a.trigger("canMakeEmptyFile",{mimes:Object.keys(a.storage("mkfileTextMimes")||{}).concat(l.makeTextMimes||["text/plain"])}),e.each(l.editors,function(e,t){t.info&&t.info.cmdCheck&&c.push(t.info.cmdCheck)}),c.length?a.api>=2.103?n=a.request({data:{cmd:"editor",name:c,method:"enabled"},preventDefault:!0}).done(function(e){t=e}).fail(function(){t={}}):(t={},n=e.Deferred().resolve()):n=e.Deferred().resolve(),n.always(function(){t&&(l.editors=e.grep(l.editors,function(e){return!e.info||!e.info.cmdCheck||!!t[e.info.cmdCheck]})),e.each(l.editors,function(e,t){t.setup&&"function"==typeof t.setup&&t.setup.call(t,l,a),t.disabled||(t.mimes&&Array.isArray(t.mimes)&&(o=o.concat(t.mimes),t.info&&t.info.single||(r=r.concat(t.mimes))),!s&&t.mimes&&"*"===t.mimes[0]&&(s=!0),t.info||(t.info={}),t.info.integrate&&a.trigger("helpIntegration",Object.assign({cmd:"edit"},t.info.integrate)),t.info.canMakeEmpty&&a.trigger("canMakeEmptyFile",{mimes:Array.isArray(t.info.canMakeEmpty)?t.info.canMakeEmpty:t.mimes}))}),o=(e.uniqueSort||e.unique)(o),r=(e.uniqueSort||e.unique)(r),l.editors=e.grep(l.editors,function(e){return!e.disabled})}))}).bind("select",function(){g=null}).bind("contextmenucreate",function(t){var n,o,r=function(e){var t=i.title;a.one("contextmenucreatedone",function(){i.title=t}),i.title=a.escape(e.i18n),e.info&&e.info.iconImg&&(i.contextmenuOpts={iconImg:a.baseUrl+e.info.iconImg}),delete i.variants};i.contextmenuOpts=void 0,"files"===t.data.type&&i.enabled()&&(n=a.file(t.data.targets[0]),b(n,t.data.targets.length)&&(Object.keys(g).length>1?w()&&(o=z(n.mime))?(r(o),i.extra={icon:"menu",node:e("").attr({title:a.i18n("select")}).on("click touchstart",function(t){if(!("touchstart"===t.type&&t.originalEvent.touches.length>1)){var n=e(this);t.stopPropagation(),t.preventDefault(),a.trigger("contextmenu",{raw:k(a.selectedFiles(),function(){var e=a.selected();a.exec("edit",e,{editor:this}),a.trigger("selectfiles",{files:e})}),x:n.offset().left,y:n.offset().top})}})}):(delete i.extra,i.variants=[],e.each(g,function(e,t){i.variants.push([{editor:t},t.i18n,t.info&&t.info.iconImg?a.baseUrl+t.info.iconImg:"edit"])})):(r(g[Object.keys(g)[0]]),delete i.extra)))}).bind("canMakeEmptyFile",function(t){if(t.data&&t.data.resetTexts){var n=a.arrayFlip(i.options.makeTextMimes||["text/plain"]),o=i.getMkfileHides();e.each(a.storage("mkfileTextMimes")||{},function(e,t){n[e]||(delete a.mimesCanMakeEmpty[e],delete o[e])}),a.storage("mkfileTextMimes",null),Object.keys(o).length?a.storage("mkfileHides",o):a.storage("mkfileHides",null)}})},this.getstate=function(e){var t=this.files(e),n=t.length;return n&&u(t).length==n?0:-1},this.exec=function(t,n){var i,a=this.fm,o=u(this.files(t)),r=e.map(o,function(e){return e.hash}),s=[],l=n&&n.editor?n.editor:null,c=e(n&&n._currentNode?n._currentNode:a.cwdHash2Elm(r[0])),d=function(){var t=e.Deferred();return!l&&Object.keys(g).length>1?w()&&(l=z(o[0].mime))?t.resolve(l):(a.trigger("contextmenu",{raw:k(o,function(){t.resolve(this)}),x:c.offset().left,y:c.offset().top+22,opened:function(){a.one("closecontextmenu",function(){requestAnimationFrame(function(){"pending"===t.state()&&t.reject()})})}}),a.trigger("selectfiles",{files:r}),t):(Object.keys(g).length>1&&l&&y(o[0].mime,l),t.resolve(l?l:Object.keys(g).length?g[Object.keys(g)[0]]:null))},p=e.Deferred();return null===g&&b(o[0],r.length),c.length||(c=a.getUI("cwd")),d().done(function(t){for(;i=o.shift();)s.push(m(i,i.encoding||void 0,t).fail(function(e){e&&a.error(e)}));s.length?e.when.apply(null,s).done(function(){p.resolve()}).fail(function(){p.reject()}):p.reject()}).fail(function(){p.reject()}),p},this.getMkfileHides=function(){return i.storage("mkfileHides")||i.arrayFlip(n.options.mkfileHideMimes||[])}},i.prototype.commands.empty=function(){var t,n,i=function(e){var i=t.files(e);return i.length||(i=[n.cwd()]),i};this.linkedCmds=["rm"],this.init=function(){t=this,n=this.fm},this.getstate=function(t){var n,a=i(t),o=function(t){var n=!0;return e.grep(t,function(e){return n=!!(n&&e.read&&e.write&&"directory"===e.mime)})};return n=a.length,o(a).length==n?0:-1},this.exec=function(t){var a=i(t),o=a.length,r=e.Deferred().done(function(){var t={changed:{}};n.toast({msg:n.i18n(['"'+s.join('", ')+'"',"complete",n.i18n("cmdempty")])}),e.each(a,function(e,n){t.changed[n.hash]=n}),n.change(t)}).always(function(){var t=n.cwd().hash;n.trigger("selectfiles",{files:e.map(a,function(e){return t===e.phash?e.hash:null})})}),s=[],l=function(e){"number"==typeof e?(s.push(a[e].name),delete a[e].dirs):e&&n.error(e),--o<1&&r[s.length?"resolve":"reject"]()};return e.each(a,function(t,i){var a;return i.write&&"directory"===i.mime?n.isCommandEnabled("rm",i.hash)?(a=setTimeout(function(){n.notify({type:"search",cnt:1,hideCnt:!(o>1)})},n.notifyDelay),void n.request({data:{cmd:"open",target:i.hash},preventDefault:!0,asNotOpen:!0}).done(function(r){var s=[];a&&clearTimeout(a),n.ui.notify.children(".elfinder-notify-search").length&&n.notify({type:"search",cnt:-1,hideCnt:!(o>1)}),r&&r.files&&r.files.length?r.files.length>n.maxTargets?l(["errEmpty",i.name,"errMaxTargets",n.maxTargets]):(n.updateCache(r),e.each(r.files,function(e,t){return!t.write||t.locked?(l(["errEmpty",i.name,"errRm",t.name,"errPerm"]),s=[],!1):void s.push(t.hash)}),s.length&&n.exec("rm",s,{_userAction:!0,addTexts:[n.i18n("folderToEmpty",i.name)]}).fail(function(e){n.trigger("unselectfiles",{files:n.selected()}),l(n.parseError(e)||"")}).done(function(){l(t)})):(n.toast({mode:"warning",msg:n.i18n("filderIsEmpty",i.name)}),l(""))}).fail(function(e){l(n.parseError(e)||"")})):(l(["errCmdNoSupport",'"rm"']),null):(l(["errEmpty",i.name,"errPerm"]),null)}),r}},i.prototype.commands.extract=function(){var t=this,n=t.fm,i=[],a=function(t){var n=!0;return e.grep(t,function(t){return n=!(!n||!t.read||e.inArray(t.mime,i)===-1)})};this.variants=[],this.disableOnSearch=!0,n.bind("open reload",function(){i=n.option("archivers").extract||[],n.api>2?t.variants=[[{makedir:!0},n.i18n("cmdmkdir")],[{},n.i18n("btnCwd")]]:t.variants=[[{},n.i18n("btnCwd")]],t.change()}),this.getstate=function(t){var i,o,r=this.files(t),s=r.length;return s&&a(r).length==s?n.searchStatus.state>0?(i=this.fm.cwd().hash,e.each(r,function(e,t){return o=t.phash===i}),o?0:-1):this.fm.cwd().write?0:-1:-1},this.exec=function(t,a){var o,r,s,l=this.files(t),c=e.Deferred(),d=l.length,p=a&&a.makedir?1:0,u=!1,h=!1,f=0,m=n.files(l[0].phash),g=[],v={};e.each(m,function(e,t){v[t.name]=t,g.push(t.name)});var b=function(e){switch(e){case"overwrite_all":u=!0;break;case"omit_all":h=!0}},y=function(t){t.read&&n.file(t.phash).write?e.inArray(t.mime,i)===-1?(r=["errExtract",t.name,"errNoArchive"],n.error(r),c.reject(r)):n.request({data:{cmd:"extract",target:t.hash,makedir:p},notify:{type:"extract",cnt:1},syncOnFail:!0,navigate:{toast:p?{incwd:{msg:n.i18n(["complete",n.i18n("cmdextract")]),action:{cmd:"open",msg:"cmdopen"}},inbuffer:{msg:n.i18n(["complete",n.i18n("cmdextract")]),action:{cmd:"open",msg:"cmdopen"}}}:{inbuffer:{msg:n.i18n(["complete",n.i18n("cmdextract")])}}}}).fail(function(e){"rejected"!=c.state()&&c.reject(e)}).done(function(){}):(r=["errExtract",t.name,"errPerm"],n.error(r),c.reject(r))},w=function(t,i){var a=t[i],r=n.splitFileExtention(a.name)[0],l=e.inArray(r,g)>=0,m=function(){i+10&&y(a),m())};return this.enabled()&&d&&i.length?(d>0&&w(l,0),c):c.reject()}},(i.prototype.commands.forward=function(){this.alwaysEnabled=!0,this.updateOnSelect=!0,this.shortcuts=[{pattern:"ctrl+right"}],this.getstate=function(){return this.fm.history.canForward()?0:-1},this.exec=function(){return this.fm.history.forward()}}).prototype={forceLoad:!0},i.prototype.commands.fullscreen=function(){var t=this,n=this.fm,i=function(e,i){var a;e.preventDefault(),e.stopPropagation(),i&&i.fullscreen&&(a="on"===i.fullscreen,t.update(void 0,a),t.title=n.i18n(a?"reinstate":"cmdfullscreen"))};this.alwaysEnabled=!0,this.updateOnSelect=!1,this.syncTitleOnChange=!0,this.value=!1,this.options={ui:"fullscreenbutton"},this.getstate=function(){return 0},this.exec=function(){var i=n.getUI().get(0),a=i===n.toggleFullscreen(i);return t.title=n.i18n(a?"reinstate":"cmdfullscreen"),t.update(void 0,a),e.Deferred().resolve()},n.bind("init",function(){n.getUI().off("resize."+n.namespace,i).on("resize."+n.namespace,i)})},(i.prototype.commands.getfile=function(){var t=this,n=this.fm,i=function(n){var i=t.options,a=!0;return n=e.grep(n,function(e){return a=!(!a||"directory"==e.mime&&!i.folders||!e.read)}),i.multiple||1==n.length?n:[]};this.alwaysEnabled=!0,this.callback=n.options.getFileCallback,this._disabled="function"==typeof this.callback,this.getstate=function(e){var t=this.files(e),n=t.length;return this.callback&&n&&i(t).length==n?0:-1},this.exec=function(n){var i,a,o,r=this.fm,s=this.options,l=this.files(n),c=l.length,d=r.option("url"),p=r.option("tmbUrl"),u=e.Deferred().done(function(e){var n,i=function(){"close"==s.oncomplete?r.hide():"destroy"==s.oncomplete&&r.destroy()},a=function(e){"close"==s.onerror?r.hide():"destroy"==s.onerror?r.destroy():e&&r.error(e)};r.trigger("getfile",{files:e});try{n=t.callback(e,r)}catch(o){return void a(["Error in `getFileCallback`.",o.message])}"object"==typeof n&&"function"==typeof n.done?n.done(i).fail(a):i()}),h=function(t){return s.onlyURL?s.multiple?e.map(l,function(e){return e.url}):l[0].url:s.multiple?l:l[0]},f=[];for(i=0;i {link}
',d='
{author}
{work}
',p=/\{url\}/,u=/\{link\}/,h=/\{author\}/,f=/\{work\}/,m="replace",g="ui-priority-primary",v="ui-priority-secondary",b="elfinder-help-license",y='
  • {title}
    • ',w=['
    ','
      '],x='
      {pattern}
      {descrip}
      ',k='
      ',C=e("base").length?s.escape(document.location.href.replace(/#.*$/,"")):"",z=s.res("class","tabsactive"),T=function(){var e;return e=s.theme&&s.theme.author?d[m]("elfinder-help-team","elfinder-help-team elfinder-help-term-theme")[m](h,s.i18n(s.theme.author)+(s.theme.email?" <"+s.theme.email+">":""))[m](f,s.i18n("theme")+" ("+s.i18n(s.theme.name)+")"):''},A=function(){w.push('
      '),w.push("

      elFinder

      "),w.push('
      '+s.i18n("webfm")+"
      "),w.push('
      '+s.i18n("ver")+": "+s.version+"
      "),w.push('
      '+s.i18n("protocolver")+':
      '),w.push('
      jQuery/jQuery UI: '+e().jquery+"/"+e.ui.version+"
      "),w.push(k),w.push(c[m](p,"https://studio-42.github.io/elFinder/")[m](u,s.i18n("homepage"))),w.push(c[m](p,"https://github.com/Studio-42/elFinder/wiki")[m](u,s.i18n("docs"))),w.push(c[m](p,"https://github.com/Studio-42/elFinder")[m](u,s.i18n("github"))),w.push(k),w.push('
      '+s.i18n("team")+"
      "),w.push(d[m](h,'Dmitry "dio" Levashov <dio@std42.ru>')[m](f,s.i18n("chiefdev"))),w.push(d[m](h,"Naoki Sawada (nao-pon)<hypweb+elfinder@gmail.com>")[m](f,s.i18n("developer"))),w.push(d[m](h,"Troex Nevelin <troex@fury.scancode.ru>")[m](f,s.i18n("maintainer"))),w.push(d[m](h,"Alexey Sukhotin <strogg@yandex.ru>")[m](f,s.i18n("contributor"))),s.i18[s.lang].translator&&e.each(s.i18[s.lang].translator.split(", "),function(){w.push(d[m](h,e.trim(this))[m](f,s.i18n("translator")+" ("+s.i18[s.lang].language+")"))}),w.push(T()),w.push(k),w.push('
      '+s.i18n("icons")+': Pixelmixer, Fugue, Icons8
      '),w.push(k),w.push('
      Licence: 3-clauses BSD Licence
      '),w.push('
      Copyright © 2009-2022, Studio 42 / nao-pon
      '),w.push('
      „ …'+s.i18n("dontforget")+" ”
      "),w.push("
      ")},j=function(){var t=s.shortcuts();w.push('
      '),t.length?(w.push('
      '),e.each(t,function(e,t){w.push(x.replace(/\{pattern\}/,t[0]).replace(/\{descrip\}/,t[1]))}),w.push("
      ")):w.push('
      '+s.i18n("shortcutsof")+"
      "),w.push("
      ")},S=function(){w.push('
      '),w.push('DON\'T PANIC'),w.push("
      ")},O=!1,I=function(){O=!0,w.push('
      ')},M=!1,F=function(){M=!0,w.push('
      '),w.push('
        '),w.push("
        ")},E=function(){var n,i,a,c,d,p,u=function(t,n){return e.each(n,function(n,i){t.append(e("
        ").text(n)),"undefined"==typeof i?t.append(e("
        ").append(e("").text("undfined"))):"object"!=typeof i||i?"object"==typeof i&&(e.isPlainObject(i)||i.length)?t.append(e("
        ").append(u(e("
        "),i))):t.append(e("
        ").append(e("").text(i&&"object"==typeof i?"[]":i?i:'""'))):t.append(e("
        ").append(e("").text("null")))}),t},h=r.children("li").length;(l.debug.options||l.debug.debug)&&(h>=5&&(d=r.children("li:last"),p=o.children("div:last"), p.is(":hidden")?(d.remove(),p.remove()):(d.prev().remove(),p.prev().remove())),a=s.namespace+"-help-debug-"+ +new Date,n=e("
      • ").html(''+l.debug.debug.cmd+"").prependTo(r),i=e('
        ').data("debug",l.debug),n.on("click.debugrender",function(){var t=i.data("debug");i.removeData("debug"),t&&(i.hide(),t.debug&&(c=e("
        ").append(e("").text("debug"),u(e("
        "),t.debug)),i.append(c)),t.options&&(c=e("
        ").append(e("").text("options"),u(e("
        "),t.options)),i.append(c)),i.show()),n.off("click.debugrender")}),r.after(i),t&&o.tabs("refresh"))},D="";this.alwaysEnabled=!0,this.updateOnSelect=!1,this.state=-1,this.shortcuts=[{pattern:"f1",description:this.title}],s.bind("load",function(){var c,d,p,u,h,f,g=l.options.view||["about","shortcuts","help","integrations","debug"];(c=e.inArray("preference",g))!==-1&&g.splice(c,1),e.fn.tabs||(c=e.inArray(g,"debug"))!==-1&&g.splice(c,1),e.each(g,function(e,t){w.push(y[m](/\{id\}/g,t)[m](/\{title\}/,s.i18n(t)))}),w.push("
      "),e.inArray("about",g)!==-1&&A(),e.inArray("shortcuts",g)!==-1&&j(),e.inArray("help",g)!==-1&&(d=s.i18nBaseUrl+"help/%s.html.js",S()),e.inArray("integrations",g)!==-1&&I(),e.inArray("debug",g)!==-1&&F(),w.push("
      "),D=e(w.join("")),D.find(".ui-tabs-nav li").on("mouseenter mouseleave",function(t){e(this).toggleClass("ui-state-hover","mouseenter"===t.type)}).on("focus blur","a",function(t){e(t.delegateTarget).toggleClass("ui-state-focus","focusin"===t.type)}).children().on("click",function(t){var n=e(this);t.preventDefault(),t.stopPropagation(),n.parent().addClass(z).siblings().removeClass(z),D.children(".ui-tabs-panel").hide().filter(n.attr("href")).show()}).filter(":first").trigger("click"),O&&(n=D.find(".elfinder-help-tab-integrations").hide(),i=D.find("#"+s.namespace+"-help-integrations").hide().append(e('
      ').html(s.i18n("integrationWith"))),s.bind("helpIntegration",function(t){var a,o,r,l,c=i.children("ul:first");t.data&&(e.isPlainObject(t.data)?(a=Object.assign({link:"",title:"",banner:""},t.data),(a.title||a.link)&&(a.title||(a.title=a.link),o=a.link?e("").attr("href",a.link).attr("target","_blank").text(a.title):e("").text(a.title),a.banner&&(o=e("").append(e("").attr(a.banner),o)))):(o=e(t.data),o.filter("a").each(function(){var t=e(this);t.attr("target")||t.attr("target","_blank")})),o&&(n.show(),c.length||(c=e('
        ').appendTo(i)),a&&a.cmd?(l="elfinder-help-integration-"+a.cmd,r=c.find("ul."+l),r.length||(r=e('
          '),c.append(e("
        • ").append(e("").html(s.i18n("cmd"+a.cmd))).append(r))),o=r.append(e("
        • ").append(o))):c.append(e("
        • ").append(o))))}).bind("themechange",function(){D.find("div.elfinder-help-term-theme").replaceWith(T())})),M&&(a=D.find(".elfinder-help-tab-debug").hide(),o=D.find("#"+s.namespace+"-help-debug").children("div:first"),r=o.children("ul:first").on("click",function(e){e.preventDefault(),e.stopPropagation()}),l.debug={},s.bind("backenddebug",function(e){M&&e.data&&e.data.debug&&(l.debug={options:e.data.options,debug:Object.assign({cmd:s.currentReqCmd},e.data.debug)},l.dialog&&E())})),D.find("#"+s.namespace+"-help-about").find(".apiver").text(s.api),l.dialog=l.fmDialog(D,{title:l.title,width:530,maxWidth:"window",maxHeight:"window",autoOpen:!1,destroyOnClose:!1,close:function(){M&&(a.hide(),o.tabs("destroy")),t=!1}}).on("click",function(e){e.stopPropagation()}).css({overflow:"hidden"}),p=l.dialog.children(".ui-tabs"),u=p.children(".ui-tabs-nav:first"),h=p.children(".ui-tabs-panel"),f=l.dialog.outerHeight(!0)-l.dialog.height(),l.dialog.closest(".ui-dialog").on("resize",function(){h.height(l.dialog.height()-f-u.outerHeight(!0)-20)}),d&&l.dialog.one("initContents",function(){e.ajax({url:l.options.helpSource?l.options.helpSource:d.replace("%s",s.lang),dataType:"html"}).done(function(t){e("#"+s.namespace+"-help-help").html(t)}).fail(function(){e.ajax({url:d.replace("%s","en"),dataType:"html"}).done(function(t){e("#"+s.namespace+"-help-help").html(t)})})}),l.state=0,s.trigger("helpBuilded",l.dialog)}).one("open",function(){var e=!1;s.one("backenddebug",function(){e=!0}).one("opendone",function(){requestAnimationFrame(function(){!e&&M&&(M=!1,a.hide(),o.hide(),r.hide())})})}),this.getstate=function(){return 0},this.exec=function(n,i){var s=i?i.tab:void 0,l=function(){M&&(o.tabs(),r.find("a:first").trigger("click"),a.show(),t=!0)};return l(),this.dialog.trigger("initContents").elfinderdialog("open").find((s?".elfinder-help-tab-"+s:".ui-tabs-nav li")+" a:first").trigger("click"),e.Deferred().resolve()}}).prototype={forceLoad:!0},i.prototype.commands.hidden=function(){this.hidden=!0,this.updateOnSelect=!1,this.getstate=function(){return-1}},i.prototype.commands.hide=function(){var t,n,i,a,o=this,r={};this.syncTitleOnChange=!0,this.shortcuts=[{pattern:"ctrl+shift+dot",description:this.fm.i18n("toggleHidden")}],this.init=function(){var e=this.fm;t=e.storage("hide")||{items:{}},n=Object.keys(t.items).length,this.title=e.i18n(t.show?"hideHidden":"showHidden"),o.update(void 0,o.title)},this.fm.bind("select contextmenucreate closecontextmenu",function(e,r){var s=(e.data?e.data.selected||e.data.targets:null)||r.selected();"select"===e.type&&e.data?a=e.data.origin:"contextmenucreate"===e.type&&(i=e.data.type),!s.length||("contextmenucreate"!==e.type&&"navbar"!==a||"cwd"===i)&&s[0]===r.cwd().hash?o.title=r.i18n(t.show?"hideHidden":"showHidden"):o.title=r.i18n("cmdhide"),"closecontextmenu"!==e.type?o.update("cwd"===i?n?0:-1:void 0,o.title):(i="",requestAnimationFrame(function(){o.update(void 0,o.title)}))}),this.getstate=function(e){return this.fm.cookieEnabled&&"cwd"!==i&&(e||this.fm.selected()).length||n?0:-1},this.exec=function(i,s){var l,c,d=this.fm,p=e.Deferred().done(function(){d.trigger("hide",{items:h,opts:s})}).fail(function(e){d.error(e)}),u=s||{},h=u.targets?u.targets:i||d.selected(),f=[];if(t=d.storage("hide")||{},e.isPlainObject(t)||(t={}),e.isPlainObject(t.items)||(t.items={}),("shortcut"===s._currentType||!h.length||"navbar"!==s._currentType&&"navbar"!==a&&h[0]===d.cwd().hash)&&(t.show?u.hide=!0:Object.keys(t.items).length&&(u.show=!0)),u.reset&&(u.show=!0,n=0),u.show||u.hide){if(u.show?t.show=!0:delete t.show,u.show)return d.storage("hide",u.reset?null:t),o.title=d.i18n("hideHidden"),o.update(u.reset?-1:void 0,o.title),e.each(t.items,function(e){var t=d.file(e,!0);t&&(d.searchStatus.state||!t.phash||d.file(t.phash))&&f.push(t)}),f.length&&(d.updateCache({added:f}),d.add({added:f})),u.reset&&(t={items:{}}),p.resolve();h=Object.keys(t.items)}return h.length&&(e.each(h,function(e,n){var i;t.items[n]||(i=d.file(n),i&&(r[n]=i.i18||i.name),t.items[n]=r[n]?r[n]:n)}),n=Object.keys(t.items).length,l=this.files(h),d.storage("hide",t),d.remove({removed:h}),t.show&&this.exec(void 0,{hide:!0}),u.hide||(c={},c.undo={cmd:"hide",callback:function(){var t=d.storage("hide");t&&(e.each(h,function(e,n){delete t.items[n]}),n=Object.keys(t.items).length,d.storage("hide",t),d.trigger("hide",{items:h,opts:{}}),o.update(n?0:-1)),d.updateCache({added:l}),d.add({added:l})}},c.redo={cmd:"hide",callback:function(){return d.exec("hide",void 0,{targets:h})}})),"rejected"==p.state()?p:p.resolve(c)}},(i.prototype.commands.home=function(){this.title="Home",this.alwaysEnabled=!0,this.updateOnSelect=!1,this.shortcuts=[{pattern:"ctrl+home ctrl+shift+up",description:"Home"}],this.getstate=function(){var e=this.fm.root(),t=this.fm.cwd().hash;return e&&t&&e!=t?0:-1},this.exec=function(){return this.fm.exec("open",this.fm.root())}}).prototype={forceLoad:!0},(i.prototype.commands.info=function(){var t=this.fm,n="elfinder-spinner",i="elfinder-info-button",a={calc:t.i18n("calc"),size:t.i18n("size"),unknown:t.i18n("unknown"),path:t.i18n("path"),aliasfor:t.i18n("aliasfor"),modify:t.i18n("modify"),perms:t.i18n("perms"),locked:t.i18n("locked"),dim:t.i18n("dim"),kind:t.i18n("kind"),files:t.i18n("files"),folders:t.i18n("folders"),roots:t.i18n("volumeRoots"),items:t.i18n("items"),yes:t.i18n("yes"),no:t.i18n("no"),link:t.i18n("link"),owner:t.i18n("owner"),group:t.i18n("group"),perm:t.i18n("perm"),getlink:t.i18n("getLink")},o=function(e,t){return t?e.replace(/\u200B/g,""):e.replace(/(\/|\\)/g,"$1​")};this.items=["size","aliasfor","path","link","dim","modify","perms","locked","owner","group","perm"],this.options.custom&&Object.keys(this.options.custom).length&&e.each(this.options.custom,function(e,t){t.label&&this.items.push(t.label)}),this.tpl={main:'
          {title}
          {content}
          ',itemTitle:'{name}{kind}',groupTitle:"{items}: {num}",row:'{label} : {value}',spinner:'{text} '},this.alwaysEnabled=!0,this.updateOnSelect=!1,this.shortcuts=[{pattern:"ctrl+i"}],this.init=function(){e.each(a,function(e,n){a[e]=t.i18n(n)})},this.getstate=function(){return 0},this.exec=function(t){var r=this.files(t);r.length||(r=this.files([this.fm.cwd().hash]));var s,l,c,d,p,u,h,f,m,g=this,v=this.fm,b=this.options,y=this.tpl,w=y.row,x=r.length,k=[],C=y.main,z="{label}",T="{value}",A=[],j=null,S={title:v.i18n("selectionInfo"),width:"auto",close:function(){e(this).elfinderdialog("destroy"),j&&"pending"===j.state()&&j.reject(),e.grep(A,function(e){e&&"pending"===e.state()&&e.reject()})}},O=[],I=function(e,t,i){F.find("."+n+"-"+t).parent().html(e).addClass(i||"")},M=v.namespace+"-info-"+e.map(r,function(e){return e.hash}).join("-"),F=v.getUI().find("#"+M),E=[],D="",U="elfinder-font-mono elfinder-info-hash",P=[],q=v.ui.notify;if(q.is(":hidden")&&q.children(".elfinder-notify").length&&q.elfinderdialog("open").height("auto"),!x)return e.Deferred().reject();if(F.length)return F.elfinderdialog("toTop"),e.Deferred().resolve();if(f=v.storage("infohides")||v.arrayFlip(b.hideItems,!0),1===x){if(c=r[0],c.icon&&(D=" "+v.getIconStyle(c)),C=C.replace("{dirclass}",c.csscls?v.escape(c.csscls):"").replace("{class}",v.mime2class(c.mime)).replace("{style}",D),d=y.itemTitle.replace("{name}",v.escape(c.i18||c.name)).replace("{kind}",''+v.mime2kind(c)+""),l=v.tmb(c),c.read?"directory"!=c.mime||c.alias?s=v.formatSize(c.size):(s=y.spinner.replace("{text}",a.calc).replace("{name}","size"),O.push(c.hash)):s=a.unknown,!f.size&&k.push(w.replace(z,a.size).replace(T,s)),!f.aleasfor&&c.alias&&k.push(w.replace(z,a.aliasfor).replace(T,c.alias)),f.path||((h=v.path(c.hash,!0))?k.push(w.replace(z,a.path).replace(T,o(v.escape(h))).replace("{class}","elfinder-info-path")):(k.push(w.replace(z,a.path).replace(T,y.spinner.replace("{text}",a.calc).replace("{name}","path")).replace("{class}","elfinder-info-path")),A.push(v.path(c.hash,!0,{notify:null}).fail(function(){I(a.unknown,"path")}).done(function(e){I(o(e),"path")})))),!f.link&&c.read){var R,H=v.escape(c.name);if("1"==c.url)k.push(w.replace(z,a.link).replace(T,'"));else{if(c.url)R=c.url;else if("directory"===c.mime)if(b.nullUrlDirLinkSelf&&null===c.url){var _=window.location;R=_.pathname+_.search+"#elf_"+c.hash}else""!==c.url&&v.option("url",!v.isRoot(c)&&c.phash||c.hash)&&(R=v.url(c.hash));else R=v.url(c.hash);R&&k.push(w.replace(z,a.link).replace(T,''+H+""))}}f.dim||(c.dim?k.push(w.replace(z,a.dim).replace(T,c.dim)):c.mime.indexOf("image")!==-1&&(c.width&&c.height?k.push(w.replace(z,a.dim).replace(T,c.width+"x"+c.height)):c.size&&"0"!==c.size&&(k.push(w.replace(z,a.dim).replace(T,y.spinner.replace("{text}",a.calc).replace("{name}","dim"))),A.push(v.request({data:{cmd:"dim",target:c.hash},preventDefault:!0}).fail(function(){I(a.unknown,"dim")}).done(function(e){if(I(e.dim||a.unknown,"dim"),e.dim){var t=e.dim.split("x"),n=v.file(c.hash);n.width=t[0],n.height=t[1]}}))))),!f.modify&&k.push(w.replace(z,a.modify).replace(T,v.formatDate(c))),!f.perms&&k.push(w.replace(z,a.perms).replace(T,v.formatPermissions(c))),!f.locked&&k.push(w.replace(z,a.locked).replace(T,c.locked?a.yes:a.no)),!f.owner&&c.owner&&k.push(w.replace(z,a.owner).replace(T,c.owner)),!f.group&&c.group&&k.push(w.replace(z,a.group).replace(T,c.group)),!f.perm&&c.perm&&k.push(w.replace(z,a.perm).replace(T,v.formatFileMode(c.perm))),window.ArrayBuffer&&(v.options.cdns.sparkmd5||v.options.cdns.jssha)&&"directory"!==c.mime&&c.size>0&&(!b.showHashMaxsize||c.size<=b.showHashMaxsize)&&(P=[],e.each(v.storage("hashchekcer")||b.showHashAlgorisms,function(e,t){c[t]?k.push(w.replace(z,v.i18n(t)).replace(T,c[t]).replace("{class}",U)):(k.push(w.replace(z,v.i18n(t)).replace(T,y.spinner.replace("{text}",a.calc).replace("{name}",t))),P.push(t))}),P.length&&(m=e('
          '),A.push(v.getContentsHashes(c.hash,P,b.showHashOpts,{progressBar:m}).progress(function(t){e.each(P,function(e,n){t[n]&&I(t[n],n,U)})}).always(function(){e.each(P,function(e,t){I(a.unknown,t)})})))),b.custom&&e.each(b.custom,function(t,n){f[n.label]||n.mimes&&!e.grep(n.mimes,function(e){return c.mime===e||0===c.mime.indexOf(e+"/")}).length||n.hashRegex&&!c.hash.match(n.hashRegex)||(k.push(w.replace(z,v.i18n(n.label)).replace(T,n.tpl.replace("{id}",M))),n.action&&"function"==typeof n.action&&E.push(n.action))})}else C=C.replace("{class}","elfinder-cwd-icon-group"),d=y.groupTitle.replace("{items}",a.items).replace("{num}",x),p=e.grep(r,function(e){return"directory"==e.mime}).length,p?(u=e.grep(r,function(e){return!("directory"!==e.mime||e.phash&&!e.isroot)}).length,p-=u,k.push(w.replace(z,a.kind).replace(T,u===x||p===x?a[u?"roots":"folders"]:e.map({roots:u,folders:p,files:x-u-p},function(e,t){return e?a[t]+" "+e:null}).join(", "))),!f.size&&k.push(w.replace(z,a.size).replace(T,y.spinner.replace("{text}",a.calc).replace("{name}","size"))),O=e.map(r,function(e){return e.hash})):(s=0,e.each(r,function(e,t){var n=parseInt(t.size);n>=0&&s>=0?s+=n:s="unknown"}),k.push(w.replace(z,a.kind).replace(T,a.files)),!f.size&&k.push(w.replace(z,a.size).replace(T,v.formatSize(s))));return C=C.replace("{title}",d).replace("{content}",k.join("").replace(/{class}/g,"")),F=g.fmDialog(C,S),F.attr("id",M).one("mousedown",".elfinder-info-path",function(){e(this).html(o(e(this).html(),!0))}),P.length&&m.appendTo(F.find("."+n+"-"+P[0]).parent()),v.UA.Mobile&&e.fn.tooltip&&F.children(".ui-dialog-content .elfinder-info-title").tooltip({classes:{"ui-tooltip":"elfinder-ui-tooltip ui-widget-shadow"},tooltipClass:"elfinder-ui-tooltip ui-widget-shadow",track:!0}),c&&"1"==c.url&&F.on("click","."+n+"-url",function(){e(this).parent().html(y.spinner.replace("{text}",v.i18n("ntfurl")).replace("{name}","url")),v.request({data:{cmd:"url",target:c.hash},preventDefault:!0}).fail(function(){I(H,"url")}).done(function(e){if(e.url){I(''+H+""||H,"url");var t=v.file(c.hash);t.url=e.url}else I(H,"url")})}),l&&e("").on("load",function(){F.find(".elfinder-cwd-icon").addClass(l.className).css("background-image","url('"+l.url+"')")}).attr("src",l.url),O.length&&(j=v.getSize(O).done(function(e){I(e.formated,"size")}).fail(function(){I(a.unknown,"size")})),E.length&&e.each(E,function(e,t){try{t(c,v,F)}catch(n){v.debug("error",n)}}),e.Deferred().resolve()}}).prototype={forceLoad:!0},i.prototype.commands.mkdir=function(){var t,n=this.fm,i=this;this.value="",this.disableOnSearch=!0,this.updateOnSelect=!1,this.syncTitleOnChange=!0,this.mime="directory",this.prefix="untitled folder",this.exec=function(a,o){var r;return a&&a.length&&o&&o._currentType&&"navbar"===o._currentType?(this.origin=o._currentType,this.data={target:a[0]}):(r=n.cwd().hash===a[0],this.origin=t&&!r?t:"cwd",delete this.data),a||this.options.intoNewFolderToolbtn||n.getUI("cwd").trigger("unselectall"),this.move=this.value===n.i18n("cmdmkdirin"),e.proxy(n.res("mixin","make"),i)()},this.shortcuts=[{pattern:"ctrl+shift+n"}],this.init=function(){this.options.intoNewFolderToolbtn&&(this.syncTitleOnChange=!0)},n.bind("select contextmenucreate closecontextmenu",function(e){var a=(e.data?e.data.selected||e.data.targets:null)||n.selected();i.className="mkdir",t=e.data&&a.length?e.data.origin||e.data.type||"":"",i.options.intoNewFolderToolbtn||""!==t||(t="cwd"),a.length&&"navbar"!==t&&"cwd"!==t&&n.cwd().hash!==a[0]?(i.title=n.i18n("cmdmkdirin"),i.className+=" elfinder-button-icon-mkdirin"):i.title=n.i18n("cmdmkdir"),"closecontextmenu"!==e.type?i.update(void 0,i.title):requestAnimationFrame(function(){i.update(void 0,i.title)})}),this.getstate=function(i){var a=n.cwd(),o="navbar"===t||i&&i[0]!==a.hash?this.files(i||n.selected()):[],r=o.length,s=function(t){var n=!0;return e.grep(t,function(e){return n=!(!n||!e.read||e.locked)})};return"navbar"===t?r&&o[0].write&&o[0].read?0:-1:!a.write||r&&s(o).length!=r?-1:0}},i.prototype.commands.mkfile=function(){var t=this;this.disableOnSearch=!0,this.updateOnSelect=!1,this.mime="text/plain",this.prefix="untitled file.txt",this.variants=[],this.getTypeName=function(e,n){var i,a=t.fm;return i=(i=a.messages["kind"+a.kinds[e]])?a.i18n(["extentiontype",n.toUpperCase(),i]):a.i18n(["extentionfile",n.toUpperCase()])},this.fm.bind("open reload canMakeEmptyFile",function(){var n=t.fm,i=n.getCommand("edit").getMkfileHides();t.variants=[],n.mimesCanMakeEmpty&&e.each(n.mimesCanMakeEmpty,function(e,a){a&&!i[e]&&n.uploadMimeCheck(e)&&t.variants.push([e,t.getTypeName(e,a)])}),t.change()}),this.getstate=function(){return this.fm.cwd().write?0:-1},this.exec=function(n,i){var a,o,r=t.fm;if(a=r.mimesCanMakeEmpty[i]){if(r.uploadMimeCheck(i))return this.mime=i,this.prefix=r.i18n(["untitled file",a]),e.proxy(r.res("mixin","make"),t)();o=["errMkfile",t.getTypeName(i,a)]}return e.Deferred().reject(o)}},i.prototype.commands.netmount=function(){var t,n=this,i=!1;this.alwaysEnabled=!0,this.updateOnSelect=!1,this.drivers=[],this.handlers={load:function(){var t=n.fm;t.cookieEnabled&&t.one("open",function(){n.drivers=t.netDrivers,n.drivers.length&&e.each(n.drivers,function(){var e=n.options[this];e&&(i=!0,e.integrateInfo&&t.trigger("helpIntegration",Object.assign({cmd:"netmount"},e.integrateInfo)))})})}},this.getstate=function(){return i?0:-1},this.exec=function(){var i,a=n.fm,o=e.Deferred(),r=n.options,s=function(){var s,l=function(){c.protocol.trigger("change","winfocus")},c={protocol:e("").on("change",function(e,n){var o=this.value;t.find(".elfinder-netmount-tr").hide(),t.find(".elfinder-netmount-tr-"+o).show(),i&&i.children(".ui-dialog-buttonpane:first").find("button").show(),"function"==typeof r[o].select&&r[o].select(a,e,n)}).addClass("ui-corner-all")},d={title:a.i18n("netMountDialogTitle"),resizable:!0,modal:!0,destroyOnClose:!1,open:function(){e(window).on("focus."+a.namespace,l),c.protocol.trigger("change")},close:function(){"pending"==o.state()&&o.reject(),e(window).off("focus."+a.namespace,l)},buttons:{}},p=function(){var i,s=c.protocol.val(),l={cmd:"netmount",protocol:s},d=r[s];return e.each(t.find("input.elfinder-netmount-inputs-"+s),function(t,n){var i,a;a=e(n),a.is(":radio,:checkbox")?a.is(":checked")&&(i=e.trim(a.val())):i=e.trim(a.val()),i&&(l[n.name]=i)}),l.host?(l.mnt2res&&(i=!0),a.request({data:l,notify:{type:"netmount",cnt:1,hideCnt:!0}}).done(function(e){var t;e.added&&e.added.length&&(i&&c.protocol.trigger("change","reset"),e.added[0].phash&&(t=a.file(e.added[0].phash))&&(t.dirs||(t.dirs=1,a.change({changed:[t]}))),a.one("netmountdone",function(){a.exec("open",e.added[0].hash)})),o.resolve()}).fail(function(e){d.fail&&"function"==typeof d.fail&&d.fail(a,a.parseError(e)),o.reject(e)}),void n.dialog.elfinderdialog("close")):a.trigger("error",{error:"errNetMountHostReq",opts:{modal:!0}})},u=e('
          ').on("keydown","input",function(t){var n,i=!0;t.keyCode===e.ui.keyCode.ENTER&&(e.each(u.find("input:visible:not(.elfinder-input-optional)"),function(){if(""===e(this).val())return i=!1,n=e(this),!1}),i?p():n.trigger("focus"))}),h=e("
          ");return t=e('
          ').append(e("").append(e(""+a.i18n("protocol")+"")).append(e("").append(c.protocol))),e.each(n.drivers,function(n,i){r[i]&&(c.protocol.append('"),e.each(r[i].inputs,function(n,o){o.attr("name",n),"hidden"!=o.attr("type")?(o.addClass("ui-corner-all elfinder-netmount-inputs-"+i),t.append(e("").addClass("elfinder-netmount-tr elfinder-netmount-tr-"+i).append(e(""+a.i18n(n)+"")).append(e("").append(o)))):(o.addClass("elfinder-netmount-inputs-"+i),h.append(o))}),r[i].protocol=c.protocol)}),t.append(h),t.find(".elfinder-netmount-tr").hide(),t.find(".elfinder-netmount-tr-"+n.drivers[0]).show(),d.buttons[a.i18n("btnMount")]=p,d.buttons[a.i18n("btnCancel")]=function(){n.dialog.elfinderdialog("close")},t.find("select,input").addClass("elfinder-tabstop"),s=n.fmDialog(u.append(t),d).ready(function(){c.protocol.trigger("change"),s.elfinderdialog("posInit")}),i=s.closest(".ui-dialog"),s};return n.dialog?n.dialog.elfinderdialog("open"):n.dialog=s(),o.promise()},n.fm.bind("netmount",function(e){var i=e.data||null,a=n.options,o=function(){a[i.protocol]&&"function"==typeof a[i.protocol].done&&(a[i.protocol].done(n.fm,i),t.find("select,input").addClass("elfinder-tabstop"),n.dialog.elfinderdialog("tabstopsInit"))};i&&i.protocol&&(i.mode&&"redirect"===i.mode?n.fm.request({data:{cmd:"netmount",protocol:i.protocol,host:i.host,user:"init",pass:"return",options:i.options},preventDefault:!0}).done(function(e){i=JSON.parse(e.body),o()}):o())})},i.prototype.commands.netunmount=function(){this.alwaysEnabled=!0,this.updateOnSelect=!1,this.drivers=[],this.handlers={load:function(){this.drivers=this.fm.netDrivers}},this.getstate=function(e){var t,n=this.fm;return e&&this.drivers.length&&!this._disabled&&(t=n.file(e[0]))&&t.netkey?0:-1},this.exec=function(t){var n=this,i=this.fm,a=e.Deferred().fail(function(e){e&&i.error(e)}),o=i.file(t[0]),r=function(t){var n,a=[];return i.leafRoots&&(n=[],e.each(i.leafRoots,function(a,o){var r,s=i.parents(a);(r=e.inArray(t,s))!==-1&&(r=s.length-r,e.each(o,function(e,t){n.push({i:r,hash:t})}))}),n.length&&(n.sort(function(e,t){return e.i').hide().appendTo(e("body"));if(t.UA.Mobile||!h){if(u)h?p.attr("target","_blank"):p.attr("download",a.name),p.attr("href",n).get(0).click();else if(i=window.open(n),!i)return g.reject("errPopup")}else{if(m="string"==typeof w.method&&"get"===w.method.toLowerCase(),!m&&0===n.indexOf(t.options.url)&&t.customData&&Object.keys(t.customData).length&&!a.mime.match(/^(?:video|audio)/)&&(n=""),"window"===x?(s=c=Math.round(2*screen.availWidth/3),l=d=Math.round(2*screen.availHeight/3),parseInt(a.width)&&parseInt(a.height)?(s=parseInt(a.width),l=parseInt(a.height)):a.dim&&(o=a.dim.split("x"),s=parseInt(o[0]),l=parseInt(o[1])),c>=s&&d>=l?(c=s,d=l):s-c>l-d?d=Math.round(l*(c/s)):c=Math.round(s*(d/l)),r="width="+c+",height="+d,i=window.open(n,f,r+",top=50,left=50,scrollbars=yes,resizable=yes,titlebar=no")):("tabs"===x&&(f=a.hash),i=window.open("about:blank",f)),!i)return g.reject("errPopup");if(""===n){var v=document.createElement("form");v.action=t.options.url,v.method="POST",v.target=f,v.style.display="none";var b=Object.assign({},t.customData,{cmd:"file",target:a.hash,_t:a.ts||parseInt(+new Date/1e3)});e.each(b,function(e,t){var n=document.createElement("input");n.name=e,n.value=t,v.appendChild(n)}),document.body.appendChild(v),v.submit()}else"window"!==x&&(i.location=n);e(i).trigger("focus")}p.remove()};try{p=new RegExp(t.option("dispInlineRegex"),"i")}catch(k){p=!1}for(u="string"==typeof e("").get(0).download,b=v.length;b--;){if(f="elf_open_window",a=v[b],!a.read)return g.reject(["errOpen",a.name,"errPerm"]);h=p&&a.mime.match(p),t.openUrl(a.hash,!h,y)}return g.resolve(n)};if(b>1)t.confirm({title:"openMulti",text:["openMultiConfirm",b+""],accept:{label:"cmdopen",callback:function(){k()}},cancel:{label:"btnCancel",callback:function(){g.reject()}},buttons:t.getCommand("zipdl")&&t.isCommandEnabled("zipdl",t.cwd().hash)?[{label:"cmddownload",callback:function(){t.exec("download",n),g.reject()}}]:[]});else{if(f=t.storage("selectAction")||w.selectAction,f&&(e.each(f.split("/"),function(){var e=this.valueOf();return("open"===e||!(m=t.getCommand(e))||!m.enabled())&&void(m=null)}),m))return t.exec(m.name);k()}return g}}).prototype={forceLoad:!0},i.prototype.commands.opendir=function(){this.alwaysEnabled=!0,this.getstate=function(){var e,t=this.fm.selected(),n=t.length;return 1!==n?-1:(e=this.fm.getUI("workzone"),e.hasClass("elfinder-search-result")?0:-1)},this.exec=function(t){var n,i=this.fm,a=e.Deferred(),o=this.files(t),r=o.length;return r&&o[0].phash?(n=o[0].phash,i.trigger("searchend",{noupdate:!0}),i.request({data:{cmd:"open",target:n},notify:{type:"open",cnt:1,hideCnt:!0},syncOnFail:!1}),a):a.reject()}},i.prototype.commands.opennew=function(){var t=this.fm;this.shortcuts=[{pattern:("function"==typeof t.options.getFileCallback?"shift+":"")+"ctrl+enter"}],this.getstate=function(e){var t=this.files(e),n=t.length;return 1===n&&"directory"===t[0].mime&&t[0].read?0:-1},this.exec=function(t){var n,i,a,o,r=e.Deferred(),s=this.files(t),l=s.length,c=this.options;return 1===l&&(n=s[0])&&"directory"===n.mime?(i=window.location,a=c.url?c.url:i.pathname,c.useOriginQuery&&(a.match(/\?/)?i.search&&(a+="&"+i.search.substr(1)):a+=i.search),a+="#elf_"+n.hash,o=window.open(a,"_blank"),setTimeout(function(){o.focus()},1e3),r.resolve()):r.reject()}},i.prototype.commands.paste=function(){this.updateOnSelect=!1,this.handlers={changeclipboard:function(){this.update()}},this.shortcuts=[{pattern:"ctrl+v shift+insert"}],this.getstate=function(e){if(this._disabled)return-1;if(e){if(Array.isArray(e)){if(1!=e.length)return-1;e=this.fm.file(e[0])}}else e=this.fm.cwd();return this.fm.clipboard().length&&"directory"==e.mime&&e.write?0:-1},this.exec=function(t,n){var i,a,o,r=this,s=r.fm,l=n||{},c=t?this.files(t)[0]:s.cwd(),d=s.clipboard(),p=d.length,u=!!p&&d[0].cut,h=l._cmd?l._cmd:u?"move":"copy",f="err"+h.charAt(0).toUpperCase()+h.substr(1),m=[],g=[],v=e.Deferred().fail(function(e){e&&s.error(e)}).always(function(){s.unlockfiles({files:e.map(d,function(e){return e.hash})})}),b=function(t){return t.length&&s._commands.duplicate?s.exec("duplicate",t):e.Deferred().resolve()},y=function(t){var n,i=e.Deferred(),a=[],o={},d=function(t,n){for(var i=[],a=t.length;a--;)e.inArray(t[a].name,n)!==-1&&i.unshift(a);return i},p=function(e){var n=a[e],o=t[n],r=e==a.length-1;o&&s.confirm({title:s.i18n(h+"Files"),text:["errExists",o.name,"restore"===h?"confirmRest":"confirmRepl"],all:!r,accept:{label:"btnYes",callback:function(n){r||n?m(t):p(++e)}},reject:{label:"btnNo",callback:function(n){var i;if(n)for(i=a.length;e +Richard Worth +Yehuda Katz +Sean Catchpole +John Resig +Tane Piper +Dmitri Gaskin +Klaus Hartl +Stefan Petre +Gilles van den Hoven +Micheil Bryan Smith +Jörn Zaefferer +Marc Grabanski +Keith Wood +Brandon Aaron +Scott González +Eduardo Lundgren +Aaron Eisenberger +Joan Piedra +Bruno Basto +Remy Sharp +Bohdan Ganicky +David Bolter +Chi Cheng +Ca-Phun Ung +Ariel Flesler +Maggie Wachs +Scott Jehl +Todd Parker +Andrew Powell +Brant Burnett +Douglas Neiner +Paul Irish +Ralph Whitbeck +Thibault Duplessis +Dominique Vincent +Jack Hsu +Adam Sontag +Carl Fürstenberg +Kevin Dalman +Alberto Fernández Capel +Jacek Jędrzejewski (https://jacek.jedrzejewski.name) +Ting Kuei +Samuel Cormier-Iijima +Jon Palmer +Ben Hollis +Justin MacCarthy +Eyal Kobrigo +Tiago Freire +Diego Tres +Holger Rüprich +Ziling Zhao +Mike Alsup +Robson Braga Araujo +Pierre-Henri Ausseil +Christopher McCulloh +Andrew Newcomb +Lim Chee Aun +Jorge Barreiro +Daniel Steigerwald +John Firebaugh +John Enters +Andrey Kapitcyn +Dmitry Petrov +Eric Hynds +Chairat Sunthornwiphat +Josh Varner +Stéphane Raimbault +Jay Merrifield +J. Ryan Stinnett +Peter Heiberg +Alex Dovenmuehle +Jamie Gegerson +Raymond Schwartz +Phillip Barnes +Kyle Wilkinson +Khaled AlHourani +Marian Rudzynski +Jean-Francois Remy +Doug Blood +Filippo Cavallarin +Heiko Henning +Aliaksandr Rahalevich +Mario Visic +Xavi Ramirez +Max Schnur +Saji Nediyanchath +Corey Frang +Aaron Peterson +Ivan Peters +Mohamed Cherif Bouchelaghem +Marcos Sousa +Michael DellaNoce +George Marshall +Tobias Brunner +Martin Solli +David Petersen +Dan Heberden +William Kevin Manire +Gilmore Davidson +Michael Wu +Adam Parod +Guillaume Gautreau +Marcel Toele +Dan Streetman +Matt Hoskins +Giovanni Giacobbi +Kyle Florence +Pavol Hluchý +Hans Hillen +Mark Johnson +Trey Hunner +Shane Whittet +Edward A Faulkner +Adam Baratz +Kato Kazuyoshi +Eike Send +Kris Borchers +Eddie Monge +Israel Tsadok +Carson McDonald +Jason Davies +Garrison Locke +David Murdoch +Benjamin Scott Boyle +Jesse Baird +Jonathan Vingiano +Dylan Just +Hiroshi Tomita +Glenn Goodrich +Tarafder Ashek-E-Elahi +Ryan Neufeld +Marc Neuwirth +Philip Graham +Benjamin Sterling +Wesley Walser +Kouhei Sutou +Karl Kirch +Chris Kelly +Jason Oster +Felix Nagel +Alexander Polomoshnov +David Leal +Igor Milla +Dave Methvin +Florian Gutmann +Marwan Al Jubeh +Milan Broum +Sebastian Sauer +Gaëtan Muller +Michel Weimerskirch +William Griffiths +Stojce Slavkovski +David Soms +David De Sloovere +Michael P. Jung +Shannon Pekary +Dan Wellman +Matthew Edward Hutton +James Khoury +Rob Loach +Alberto Monteiro +Alex Rhea +Krzysztof Rosiński +Ryan Olton +Genie <386@mail.com> +Rick Waldron +Ian Simpson +Lev Kitsis +TJ VanToll +Justin Domnitz +Douglas Cerna +Bert ter Heide +Jasvir Nagra +Yuriy Khabarov <13real008@gmail.com> +Harri Kilpiö +Lado Lomidze +Amir E. Aharoni +Simon Sattes +Jo Liss +Guntupalli Karunakar +Shahyar Ghobadpour +Lukasz Lipinski +Timo Tijhof +Jason Moon +Martin Frost +Eneko Illarramendi +EungJun Yi +Courtland Allen +Viktar Varvanovich +Danny Trunk +Pavel Stetina +Michael Stay +Steven Roussey +Michael Hollis +Lee Rowlands +Timmy Willison +Karl Swedberg +Baoju Yuan +Maciej Mroziński +Luis Dalmolin +Mark Aaron Shirley +Martin Hoch +Jiayi Yang +Philipp Benjamin Köppchen +Sindre Sorhus +Bernhard Sirlinger +Jared A. Scheel +Rafael Xavier de Souza +John Chen +Robert Beuligmann +Dale Kocian +Mike Sherov +Andrew Couch +Marc-Andre Lafortune +Nate Eagle +David Souther +Mathias Stenbom +Sergey Kartashov +Avinash R +Ethan Romba +Cory Gackenheimer +Juan Pablo Kaniefsky +Roman Salnikov +Anika Henke +Samuel Bovée +Fabrício Matté +Viktor Kojouharov +Pawel Maruszczyk (http://hrabstwo.net) +Pavel Selitskas +Bjørn Johansen +Matthieu Penant +Dominic Barnes +David Sullivan +Thomas Jaggi +Vahid Sohrabloo +Travis Carden +Bruno M. Custódio +Nathanael Silverman +Christian Wenz +Steve Urmston +Zaven Muradyan +Woody Gilk +Zbigniew Motyka +Suhail Alkowaileet +Toshi MARUYAMA +David Hansen +Brian Grinstead +Christian Klammer +Steven Luscher +Gan Eng Chin +Gabriel Schulhof +Alexander Schmitz +Vilhjálmur Skúlason +Siebrand Mazeland +Mohsen Ekhtiari +Pere Orga +Jasper de Groot +Stephane Deschamps +Jyoti Deka +Andrei Picus +Ondrej Novy +Jacob McCutcheon +Monika Piotrowicz +Imants Horsts +Eric Dahl +Dave Stein +Dylan Barrell +Daniel DeGroff +Michael Wiencek +Thomas Meyer +Ruslan Yakhyaev +Brian J. Dowling +Ben Higgins +Yermo Lamers +Patrick Stapleton +Trisha Crowley +Usman Akeju +Rodrigo Menezes +Jacques Perrault +Frederik Elvhage +Will Holley +Uri Gilad +Richard Gibson +Simen Bekkhus +Chen Eshchar +Bruno Pérel +Mohammed Alshehri +Lisa Seacat DeLuca +Anne-Gaelle Colom +Adam Foster +Luke Page +Daniel Owens +Michael Orchard +Marcus Warren +Nils Heuermann +Marco Ziech +Patricia Juarez +Ben Mosher +Ablay Keldibek +Thomas Applencourt +Jiabao Wu +Eric Lee Carraway +Victor Homyakov +Myeongjin Lee +Liran Sharir +Weston Ruter +Mani Mishra +Hannah Methvin +Leonardo Balter +Benjamin Albert +Michał Gołębiowski-Owczarek +Alyosha Pushak +Fahad Ahmad +Matt Brundage +Francesc Baeta +Piotr Baran +Mukul Hase +Konstantin Dinev +Rand Scullard +Dan Strohl +Maksim Ryzhikov +Amine HADDAD +Amanpreet Singh +Alexey Balchunas +Peter Kehl +Peter Dave Hello +Johannes Schäfer +Ville Skyttä +Ryan Oriecuia +Sergei Ratnikov +milk54 +Evelyn Masso +Robin +Simon Asika +Kevin Cupp +Jeremy Mickelson +Kyle Rosenberg +Petri Partio +pallxk +Luke Brookhart +claudi +Eirik Sletteberg +Albert Johansson +A. Wells +Robert Brignull +Horus68 +Maksymenkov Eugene +OskarNS +Gez Quinn +jigar gala +Florian Wegscheider +Fatér Zsolt +Szabolcs Szabolcsi-Toth +Jérémy Munsch +Hrvoje Novosel +Paul Capron +Micah Miller +sakshi87 <53863764+sakshi87@users.noreply.github.com> +Mikolaj Wolicki +Patrick McKay +c-lambert <58025159+c-lambert@users.noreply.github.com> +Josep Sanz +Ben Mullins +Christian Oliff +dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> +Adam Lidén Hällgren +James Hinderks +Denny Septian Panggabean <97607754+ddevsr@users.noreply.github.com> +Matías Cánepa +Ashish Kurmi <100655670+boahc077@users.noreply.github.com> +DeerBear +Дилян Палаузов +Kenneth DeBacker +Timo Tijhof +Timmy Willison +divdeploy <166095818+divdeploy@users.noreply.github.com> +mark van tilburg +Ralf Koller <1665422+rpkoller@users.noreply.github.com> +Porter Clevidence <116387727+porterclev@users.noreply.github.com> +Daniel García <93217193+Daniel-Garmig@users.noreply.github.com> diff --git a/include/thirdparty/jquery_ui/LICENSE.txt b/include/thirdparty/jquery_ui/LICENSE.txt new file mode 100644 index 0000000..7810829 --- /dev/null +++ b/include/thirdparty/jquery_ui/LICENSE.txt @@ -0,0 +1,43 @@ +Copyright OpenJS Foundation and other contributors, https://openjsf.org/ + +This software consists of voluntary contributions made by many +individuals. For exact contribution history, see the revision history +available at https://github.com/jquery/jquery-ui + +The following license applies to all parts of this software except as +documented below: + +==== + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +==== + +Copyright and related rights for sample code are waived via CC0. Sample +code is defined as all source code contained within the demos directory. + +CC0: http://creativecommons.org/publicdomain/zero/1.0/ + +==== + +All files located in the node_modules and external directories are +externally maintained libraries used by this software which have their +own licenses; we recommend you read them, as their terms may differ from +the terms above. diff --git a/include/thirdparty/jquery_ui/core.js b/include/thirdparty/jquery_ui/core.js deleted file mode 100644 index e2dd530..0000000 --- a/include/thirdparty/jquery_ui/core.js +++ /dev/null @@ -1,23 +0,0 @@ -// This file is deprecated in 1.12.0 to be removed in 1.14 -( function() { -"use strict"; - -define( [ - "jquery", - "./data", - "./disable-selection", - "./focusable", - "./form", - "./ie", - "./keycode", - "./labels", - "./jquery-patch.js", - "./plugin", - "./safe-active-element", - "./safe-blur", - "./scroll-parent", - "./tabbable", - "./unique-id", - "./version" -] ); -} )(); diff --git a/include/thirdparty/jquery_ui/data.js b/include/thirdparty/jquery_ui/data.js index 8a449a7..e37461a 100644 --- a/include/thirdparty/jquery_ui/data.js +++ b/include/thirdparty/jquery_ui/data.js @@ -1,16 +1,16 @@ /*! * jQuery UI :data @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: :data Selector //>>group: Core //>>description: Selects elements which have data stored under the specified key. -//>>docs: http://api.jqueryui.com/data-selector/ +//>>docs: https://api.jqueryui.com/data-selector/ ( function( factory ) { "use strict"; @@ -28,16 +28,10 @@ "use strict"; return $.extend( $.expr.pseudos, { - data: $.expr.createPseudo ? - $.expr.createPseudo( function( dataName ) { - return function( elem ) { - return !!$.data( elem, dataName ); - }; - } ) : - - // Support: jQuery <1.8 - function( elem, i, match ) { - return !!$.data( elem, match[ 3 ] ); - } + data: $.expr.createPseudo( function( dataName ) { + return function( elem ) { + return !!$.data( elem, dataName ); + }; + } ) } ); } ); diff --git a/include/thirdparty/jquery_ui/disable-selection.js b/include/thirdparty/jquery_ui/disable-selection.js index 0da2361..98784e5 100644 --- a/include/thirdparty/jquery_ui/disable-selection.js +++ b/include/thirdparty/jquery_ui/disable-selection.js @@ -1,16 +1,16 @@ /*! * jQuery UI Disable Selection @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: disableSelection //>>group: Core //>>description: Disable selection of text content within the set of matched elements. -//>>docs: http://api.jqueryui.com/disableSelection/ +//>>docs: https://api.jqueryui.com/disableSelection/ // This file is deprecated ( function( factory ) { diff --git a/include/thirdparty/jquery_ui/draggable.js b/include/thirdparty/jquery_ui/draggable.js index 0307fb8..e0abdd2 100644 --- a/include/thirdparty/jquery_ui/draggable.js +++ b/include/thirdparty/jquery_ui/draggable.js @@ -1,17 +1,17 @@ /*! * jQuery UI Draggable @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Draggable //>>group: Interactions //>>description: Enables dragging functionality for any element. -//>>docs: http://api.jqueryui.com/draggable/ -//>>demos: http://jqueryui.com/draggable/ +//>>docs: https://api.jqueryui.com/draggable/ +//>>demos: https://jqueryui.com/draggable/ //>>css.structure: ../../themes/base/draggable.css ( function( factory ) { @@ -25,8 +25,6 @@ "./mouse", "../data", "../plugin", - "../safe-active-element", - "../safe-blur", "../scroll-parent", "../version", "../widget" @@ -147,7 +145,7 @@ $.widget( "ui.draggable", $.ui.mouse, { }, _blurActiveElement: function( event ) { - var activeElement = $.ui.safeActiveElement( this.document[ 0 ] ), + var activeElement = this.document[ 0 ].activeElement, target = $( event.target ); // Don't blur if the event occurred on an element that is within @@ -158,7 +156,7 @@ $.widget( "ui.draggable", $.ui.mouse, { } // Blur any element that currently has focus, see #4261 - $.ui.safeBlur( activeElement ); + $( activeElement ).trigger( "blur" ); }, _mouseStart: function( event ) { @@ -386,7 +384,7 @@ $.widget( "ui.draggable", $.ui.mouse, { o.appendTo ) ); } - // Http://bugs.jqueryui.com/ticket/9446 + // https://bugs.jqueryui.com/ticket/9446 // a helper function can return the original element // which wouldn't have been set to relative in _create if ( helperIsFunction && helper[ 0 ] === this.element[ 0 ] ) { diff --git a/include/thirdparty/jquery_ui/droppable.js b/include/thirdparty/jquery_ui/droppable.js index bb91553..1ff3833 100644 --- a/include/thirdparty/jquery_ui/droppable.js +++ b/include/thirdparty/jquery_ui/droppable.js @@ -1,17 +1,17 @@ /*! * jQuery UI Droppable @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Droppable //>>group: Interactions //>>description: Enables drop targets for draggable elements. -//>>docs: http://api.jqueryui.com/droppable/ -//>>demos: http://jqueryui.com/droppable/ +//>>docs: https://api.jqueryui.com/droppable/ +//>>demos: https://jqueryui.com/droppable/ ( function( factory ) { "use strict"; @@ -463,7 +463,7 @@ $.ui.ddmanager = { // DEPRECATED // TODO: switch return back to widget declaration at top of file when this is removed -if ( $.uiBackCompat !== false ) { +if ( $.uiBackCompat === true ) { // Backcompat for activeClass and hoverClass options $.widget( "ui.droppable", $.ui.droppable, { diff --git a/include/thirdparty/jquery_ui/effect.js b/include/thirdparty/jquery_ui/effect.js index 53121d9..cb9ab80 100644 --- a/include/thirdparty/jquery_ui/effect.js +++ b/include/thirdparty/jquery_ui/effect.js @@ -1,19 +1,17 @@ /*! * jQuery UI Effects @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Effects Core //>>group: Effects -/* eslint-disable max-len */ //>>description: Extends the internal jQuery effects. Includes morphing and easing. Required by all other effects. -/* eslint-enable max-len */ -//>>docs: http://api.jqueryui.com/category/effects-core/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/category/effects-core/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; @@ -81,26 +79,14 @@ function camelCase( string ) { function getElementStyles( elem ) { var key, len, - style = elem.ownerDocument.defaultView ? - elem.ownerDocument.defaultView.getComputedStyle( elem, null ) : - elem.currentStyle, + style = elem.ownerDocument.defaultView.getComputedStyle( elem ), styles = {}; - if ( style && style.length && style[ 0 ] && style[ style[ 0 ] ] ) { - len = style.length; - while ( len-- ) { - key = style[ len ]; - if ( typeof style[ key ] === "string" ) { - styles[ camelCase( key ) ] = style[ key ]; - } - } - - // Support: Opera, IE <9 - } else { - for ( key in style ) { - if ( typeof style[ key ] === "string" ) { - styles[ key ] = style[ key ]; - } + len = style.length; + while ( len-- ) { + key = style[ len ]; + if ( typeof style[ key ] === "string" ) { + styles[ camelCase( key ) ] = style[ key ]; } } @@ -125,15 +111,6 @@ function styleDifference( oldStyle, newStyle ) { return diff; } -// Support: jQuery <1.8 -if ( !$.fn.addBack ) { - $.fn.addBack = function( selector ) { - return this.add( selector == null ? - this.prevObject : this.prevObject.filter( selector ) - ); - }; -} - $.effects.animateClass = function( value, duration, easing, callback ) { var o = $.speed( duration, easing, callback ); @@ -273,7 +250,7 @@ if ( $.expr && $.expr.pseudos && $.expr.pseudos.animated ) { } )( $.expr.pseudos.animated ); } -if ( $.uiBackCompat !== false ) { +if ( $.uiBackCompat === true ) { $.extend( $.effects, { // Saves a set of properties in a data storage @@ -341,7 +318,7 @@ if ( $.uiBackCompat !== false ) { try { // eslint-disable-next-line no-unused-expressions active.id; - } catch ( e ) { + } catch ( _e ) { active = document.body; } @@ -525,7 +502,7 @@ $.extend( $.effects, { // Lock in margins first to account for form elements, which // will change margin if you explicitly set height - // see: http://jsfiddle.net/JZSMt/3/ https://bugs.webkit.org/show_bug.cgi?id=107380 + // see: https://jsfiddle.net/JZSMt/3/ https://bugs.webkit.org/show_bug.cgi?id=107380 // Support: Safari element.css( { marginTop: element.css( "marginTop" ), @@ -759,7 +736,7 @@ $.fn.extend( { // as toggle can be either show or hide depending on element state args.mode = modes.shift(); - if ( $.uiBackCompat !== false && !defaultMode ) { + if ( $.uiBackCompat === true && !defaultMode ) { if ( elem.is( ":hidden" ) ? mode === "hide" : mode === "show" ) { // Call the core method to track "olddisplay" properly @@ -919,7 +896,7 @@ $.fx.step.clip = function( fx ) { ( function() { -// Based on easing equations from Robert Penner (http://www.robertpenner.com/easing) +// Based on easing equations from Robert Penner (http://robertpenner.com/easing) var baseEasings = {}; diff --git a/include/thirdparty/jquery_ui/effect-blind.js b/include/thirdparty/jquery_ui/effects/effect-blind.js similarity index 91% rename from include/thirdparty/jquery_ui/effect-blind.js rename to include/thirdparty/jquery_ui/effects/effect-blind.js index 6911624..575eea0 100644 --- a/include/thirdparty/jquery_ui/effect-blind.js +++ b/include/thirdparty/jquery_ui/effects/effect-blind.js @@ -1,17 +1,17 @@ /*! * jQuery UI Effects Blind @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Blind Effect //>>group: Effects //>>description: Blinds the element. -//>>docs: http://api.jqueryui.com/blind-effect/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/blind-effect/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; diff --git a/include/thirdparty/jquery_ui/effect-bounce.js b/include/thirdparty/jquery_ui/effects/effect-bounce.js similarity index 94% rename from include/thirdparty/jquery_ui/effect-bounce.js rename to include/thirdparty/jquery_ui/effects/effect-bounce.js index 8bd423e..bf23ea4 100644 --- a/include/thirdparty/jquery_ui/effect-bounce.js +++ b/include/thirdparty/jquery_ui/effects/effect-bounce.js @@ -1,17 +1,17 @@ /*! * jQuery UI Effects Bounce @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Bounce Effect //>>group: Effects //>>description: Bounces an element horizontally or vertically n times. -//>>docs: http://api.jqueryui.com/bounce-effect/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/bounce-effect/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; diff --git a/include/thirdparty/jquery_ui/effect-clip.js b/include/thirdparty/jquery_ui/effects/effect-clip.js similarity index 91% rename from include/thirdparty/jquery_ui/effect-clip.js rename to include/thirdparty/jquery_ui/effects/effect-clip.js index f7f84c1..c2ba206 100644 --- a/include/thirdparty/jquery_ui/effect-clip.js +++ b/include/thirdparty/jquery_ui/effects/effect-clip.js @@ -1,17 +1,17 @@ /*! * jQuery UI Effects Clip @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Clip Effect //>>group: Effects //>>description: Clips the element on and off like an old TV. -//>>docs: http://api.jqueryui.com/clip-effect/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/clip-effect/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; diff --git a/include/thirdparty/jquery_ui/effect-drop.js b/include/thirdparty/jquery_ui/effects/effect-drop.js similarity index 91% rename from include/thirdparty/jquery_ui/effect-drop.js rename to include/thirdparty/jquery_ui/effects/effect-drop.js index f0a9915..c9e5952 100644 --- a/include/thirdparty/jquery_ui/effect-drop.js +++ b/include/thirdparty/jquery_ui/effects/effect-drop.js @@ -1,17 +1,17 @@ /*! * jQuery UI Effects Drop @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Drop Effect //>>group: Effects //>>description: Moves an element in one direction and hides it at the same time. -//>>docs: http://api.jqueryui.com/drop-effect/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/drop-effect/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; diff --git a/include/thirdparty/jquery_ui/effect-explode.js b/include/thirdparty/jquery_ui/effects/effect-explode.js similarity index 93% rename from include/thirdparty/jquery_ui/effect-explode.js rename to include/thirdparty/jquery_ui/effects/effect-explode.js index 80444fd..da38b4d 100644 --- a/include/thirdparty/jquery_ui/effect-explode.js +++ b/include/thirdparty/jquery_ui/effects/effect-explode.js @@ -1,19 +1,17 @@ /*! * jQuery UI Effects Explode @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Explode Effect //>>group: Effects -/* eslint-disable max-len */ //>>description: Explodes an element in all directions into n pieces. Implodes an element to its original wholeness. -/* eslint-enable max-len */ -//>>docs: http://api.jqueryui.com/explode-effect/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/explode-effect/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; diff --git a/include/thirdparty/jquery_ui/effect-fade.js b/include/thirdparty/jquery_ui/effects/effect-fade.js similarity index 85% rename from include/thirdparty/jquery_ui/effect-fade.js rename to include/thirdparty/jquery_ui/effects/effect-fade.js index f0d7d3d..cc5cc59 100644 --- a/include/thirdparty/jquery_ui/effect-fade.js +++ b/include/thirdparty/jquery_ui/effects/effect-fade.js @@ -1,17 +1,17 @@ /*! * jQuery UI Effects Fade @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Fade Effect //>>group: Effects //>>description: Fades the element. -//>>docs: http://api.jqueryui.com/fade-effect/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/fade-effect/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; diff --git a/include/thirdparty/jquery_ui/effect-fold.js b/include/thirdparty/jquery_ui/effects/effect-fold.js similarity index 93% rename from include/thirdparty/jquery_ui/effect-fold.js rename to include/thirdparty/jquery_ui/effects/effect-fold.js index d191a3a..5368bd7 100644 --- a/include/thirdparty/jquery_ui/effect-fold.js +++ b/include/thirdparty/jquery_ui/effects/effect-fold.js @@ -1,17 +1,17 @@ /*! * jQuery UI Effects Fold @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Fold Effect //>>group: Effects //>>description: Folds an element first horizontally and then vertically. -//>>docs: http://api.jqueryui.com/fold-effect/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/fold-effect/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; diff --git a/include/thirdparty/jquery_ui/effect-highlight.js b/include/thirdparty/jquery_ui/effects/effect-highlight.js similarity index 88% rename from include/thirdparty/jquery_ui/effect-highlight.js rename to include/thirdparty/jquery_ui/effects/effect-highlight.js index 75912b4..ca85e1a 100644 --- a/include/thirdparty/jquery_ui/effect-highlight.js +++ b/include/thirdparty/jquery_ui/effects/effect-highlight.js @@ -1,17 +1,17 @@ /*! * jQuery UI Effects Highlight @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Highlight Effect //>>group: Effects //>>description: Highlights the background of an element in a defined color for a custom duration. -//>>docs: http://api.jqueryui.com/highlight-effect/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/highlight-effect/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; diff --git a/include/thirdparty/jquery_ui/effect-puff.js b/include/thirdparty/jquery_ui/effects/effect-puff.js similarity index 85% rename from include/thirdparty/jquery_ui/effect-puff.js rename to include/thirdparty/jquery_ui/effects/effect-puff.js index 330ecb0..e742fb1 100644 --- a/include/thirdparty/jquery_ui/effect-puff.js +++ b/include/thirdparty/jquery_ui/effects/effect-puff.js @@ -1,17 +1,17 @@ /*! * jQuery UI Effects Puff @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Puff Effect //>>group: Effects //>>description: Creates a puff effect by scaling the element up and hiding it at the same time. -//>>docs: http://api.jqueryui.com/puff-effect/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/puff-effect/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; diff --git a/include/thirdparty/jquery_ui/effect-pulsate.js b/include/thirdparty/jquery_ui/effects/effect-pulsate.js similarity index 90% rename from include/thirdparty/jquery_ui/effect-pulsate.js rename to include/thirdparty/jquery_ui/effects/effect-pulsate.js index 0266236..28313b1 100644 --- a/include/thirdparty/jquery_ui/effect-pulsate.js +++ b/include/thirdparty/jquery_ui/effects/effect-pulsate.js @@ -1,17 +1,17 @@ /*! * jQuery UI Effects Pulsate @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Pulsate Effect //>>group: Effects //>>description: Pulsates an element n times by changing the opacity to zero and back. -//>>docs: http://api.jqueryui.com/pulsate-effect/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/pulsate-effect/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; diff --git a/include/thirdparty/jquery_ui/effect-scale.js b/include/thirdparty/jquery_ui/effects/effect-scale.js similarity index 89% rename from include/thirdparty/jquery_ui/effect-scale.js rename to include/thirdparty/jquery_ui/effects/effect-scale.js index 8953bdd..87a43b4 100644 --- a/include/thirdparty/jquery_ui/effect-scale.js +++ b/include/thirdparty/jquery_ui/effects/effect-scale.js @@ -1,17 +1,17 @@ /*! * jQuery UI Effects Scale @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Scale Effect //>>group: Effects //>>description: Grows or shrinks an element and its content. -//>>docs: http://api.jqueryui.com/scale-effect/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/scale-effect/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; diff --git a/include/thirdparty/jquery_ui/effect-shake.js b/include/thirdparty/jquery_ui/effects/effect-shake.js similarity index 92% rename from include/thirdparty/jquery_ui/effect-shake.js rename to include/thirdparty/jquery_ui/effects/effect-shake.js index 2983337..7fd721c 100644 --- a/include/thirdparty/jquery_ui/effect-shake.js +++ b/include/thirdparty/jquery_ui/effects/effect-shake.js @@ -1,17 +1,17 @@ /*! * jQuery UI Effects Shake @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Shake Effect //>>group: Effects //>>description: Shakes an element horizontally or vertically n times. -//>>docs: http://api.jqueryui.com/shake-effect/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/shake-effect/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; diff --git a/include/thirdparty/jquery_ui/effect-size.js b/include/thirdparty/jquery_ui/effects/effect-size.js similarity index 97% rename from include/thirdparty/jquery_ui/effect-size.js rename to include/thirdparty/jquery_ui/effects/effect-size.js index 52828dc..c039a5a 100644 --- a/include/thirdparty/jquery_ui/effect-size.js +++ b/include/thirdparty/jquery_ui/effects/effect-size.js @@ -1,17 +1,17 @@ /*! * jQuery UI Effects Size @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Size Effect //>>group: Effects //>>description: Resize an element to a specified width and height. -//>>docs: http://api.jqueryui.com/size-effect/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/size-effect/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; diff --git a/include/thirdparty/jquery_ui/effect-slide.js b/include/thirdparty/jquery_ui/effects/effect-slide.js similarity index 92% rename from include/thirdparty/jquery_ui/effect-slide.js rename to include/thirdparty/jquery_ui/effects/effect-slide.js index 8d6f453..bf53aa5 100644 --- a/include/thirdparty/jquery_ui/effect-slide.js +++ b/include/thirdparty/jquery_ui/effects/effect-slide.js @@ -1,17 +1,17 @@ /*! * jQuery UI Effects Slide @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Slide Effect //>>group: Effects //>>description: Slides an element in and out of the viewport. -//>>docs: http://api.jqueryui.com/slide-effect/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/slide-effect/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; diff --git a/include/thirdparty/jquery_ui/effect-transfer.js b/include/thirdparty/jquery_ui/effects/effect-transfer.js similarity index 79% rename from include/thirdparty/jquery_ui/effect-transfer.js rename to include/thirdparty/jquery_ui/effects/effect-transfer.js index 7b1075e..132ccc1 100644 --- a/include/thirdparty/jquery_ui/effect-transfer.js +++ b/include/thirdparty/jquery_ui/effects/effect-transfer.js @@ -1,17 +1,17 @@ /*! * jQuery UI Effects Transfer @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Transfer Effect //>>group: Effects //>>description: Displays a transfer effect from one element to another. -//>>docs: http://api.jqueryui.com/transfer-effect/ -//>>demos: http://jqueryui.com/effect/ +//>>docs: https://api.jqueryui.com/transfer-effect/ +//>>demos: https://jqueryui.com/effect/ ( function( factory ) { "use strict"; @@ -33,7 +33,7 @@ "use strict"; var effect; -if ( $.uiBackCompat !== false ) { +if ( $.uiBackCompat === true ) { effect = $.effects.define( "transfer", function( options, done ) { $( this ).transfer( options, done ); } ); diff --git a/include/thirdparty/jquery_ui/focusable.js b/include/thirdparty/jquery_ui/focusable.js index 9826bb8..4920417 100644 --- a/include/thirdparty/jquery_ui/focusable.js +++ b/include/thirdparty/jquery_ui/focusable.js @@ -1,16 +1,16 @@ /*! * jQuery UI Focusable @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: :focusable Selector //>>group: Core //>>description: Selects elements which can be focused. -//>>docs: http://api.jqueryui.com/focusable-selector/ +//>>docs: https://api.jqueryui.com/focusable-selector/ ( function( factory ) { "use strict"; @@ -62,20 +62,10 @@ $.ui.focusable = function( element, hasTabindex ) { focusableIfVisible = hasTabindex; } - return focusableIfVisible && $( element ).is( ":visible" ) && visible( $( element ) ); + return focusableIfVisible && $( element ).is( ":visible" ) && + $( element ).css( "visibility" ) === "visible"; }; -// Support: IE 8 only -// IE 8 doesn't resolve inherit to visible/hidden for computed values -function visible( element ) { - var visibility = element.css( "visibility" ); - while ( visibility === "inherit" ) { - element = element.parent(); - visibility = element.css( "visibility" ); - } - return visibility === "visible"; -} - $.extend( $.expr.pseudos, { focusable: function( element ) { return $.ui.focusable( element, $.attr( element, "tabindex" ) != null ); diff --git a/include/thirdparty/jquery_ui/form-reset-mixin.js b/include/thirdparty/jquery_ui/form-reset-mixin.js index d20b4e0..9a2e73a 100644 --- a/include/thirdparty/jquery_ui/form-reset-mixin.js +++ b/include/thirdparty/jquery_ui/form-reset-mixin.js @@ -1,16 +1,16 @@ /*! * jQuery UI Form Reset Mixin @VERSION - * http://jqueryui.com + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license */ //>>label: Form Reset Mixin //>>group: Core //>>description: Refresh input widgets when their form is reset -//>>docs: http://api.jqueryui.com/form-reset-mixin/ +//>>docs: https://api.jqueryui.com/form-reset-mixin/ ( function( factory ) { "use strict"; @@ -20,7 +20,6 @@ // AMD. Register as an anonymous module. define( [ "jquery", - "./form", "./version" ], factory ); } else { @@ -45,7 +44,7 @@ return $.ui.formResetMixin = { }, _bindFormResetHandler: function() { - this.form = this.element._form(); + this.form = $( this.element.prop( "form" ) ); if ( !this.form.length ) { return; } diff --git a/include/thirdparty/jquery_ui/form.js b/include/thirdparty/jquery_ui/form.js deleted file mode 100644 index 60b0522..0000000 --- a/include/thirdparty/jquery_ui/form.js +++ /dev/null @@ -1,23 +0,0 @@ -( function( factory ) { - "use strict"; - - if ( typeof define === "function" && define.amd ) { - - // AMD. Register as an anonymous module. - define( [ "jquery", "./version" ], factory ); - } else { - - // Browser globals - factory( jQuery ); - } -} )( function( $ ) { -"use strict"; - -// Support: IE8 Only -// IE8 does not support the form attribute and when it is supplied. It overwrites the form prop -// with a string, so we need to find the proper form. -return $.fn._form = function() { - return typeof this[ 0 ].form === "string" ? this.closest( "form" ) : $( this[ 0 ].form ); -}; - -} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-af.js b/include/thirdparty/jquery_ui/i18n/datepicker-af.js new file mode 100644 index 0000000..d239561 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-af.js @@ -0,0 +1,40 @@ +/* Afrikaans initialisation for the jQuery UI date picker plugin. */ +/* Written by Renier Pretorius. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.af = { + closeText: "Selekteer", + prevText: "Vorige", + nextText: "Volgende", + currentText: "Vandag", + monthNames: [ "Januarie", "Februarie", "Maart", "April", "Mei", "Junie", + "Julie", "Augustus", "September", "Oktober", "November", "Desember" ], + monthNamesShort: [ "Jan", "Feb", "Mrt", "Apr", "Mei", "Jun", + "Jul", "Aug", "Sep", "Okt", "Nov", "Des" ], + dayNames: [ "Sondag", "Maandag", "Dinsdag", "Woensdag", "Donderdag", "Vrydag", "Saterdag" ], + dayNamesShort: [ "Son", "Maa", "Din", "Woe", "Don", "Vry", "Sat" ], + dayNamesMin: [ "So", "Ma", "Di", "Wo", "Do", "Vr", "Sa" ], + weekHeader: "Wk", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.af ); + +return datepicker.regional.af; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-ar-DZ.js b/include/thirdparty/jquery_ui/i18n/datepicker-ar-DZ.js new file mode 100644 index 0000000..2bcdf47 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-ar-DZ.js @@ -0,0 +1,42 @@ +/* Algerian Arabic Translation for jQuery UI date picker plugin. +/* Used in most of Maghreb countries, primarily in Algeria, Tunisia, Morocco. +/* Mohamed Cherif BOUCHELAGHEM -- cherifbouchelaghem@yahoo.fr */ +/* Mohamed Amine HADDAD -- zatamine@gmail.com */ + +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional[ "ar-DZ" ] = { + closeText: "إغلاق", + prevText: "السابق", + nextText: "التالي", + currentText: "اليوم", + monthNames: [ "جانفي", "فيفري", "مارس", "أفريل", "ماي", "جوان", + "جويلية", "أوت", "سبتمبر", "أكتوبر", "نوفمبر", "ديسمبر" ], + monthNamesShort: [ "1", "2", "3", "4", "5", "6", "7", "8", "9", "10", "11", "12" ], + dayNames: [ "الأحد", "الاثنين", "الثلاثاء", "الأربعاء", "الخميس", "الجمعة", "السبت" ], + dayNamesShort: [ "الأحد", "الاثنين", "الثلاثاء", "الأربعاء", "الخميس", "الجمعة", "السبت" ], + dayNamesMin: [ "ح", "ن", "ث", "ر", "خ", "ج", "س" ], + weekHeader: "أسبوع", + dateFormat: "dd/mm/yy", + firstDay: 6, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional[ "ar-DZ" ] ); + +return datepicker.regional[ "ar-DZ" ]; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-ar.js b/include/thirdparty/jquery_ui/i18n/datepicker-ar.js new file mode 100644 index 0000000..0776841 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-ar.js @@ -0,0 +1,42 @@ +/* Arabic Translation for jQuery UI date picker plugin. */ +/* Used in most of Arab countries, primarily in Bahrain, */ +/* Kuwait, Oman, Qatar, Saudi Arabia and the United Arab Emirates, Egypt, Sudan and Yemen. */ +/* Written by Mohammed Alshehri -- m@dralshehri.com */ + +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.ar = { + closeText: "إغلاق", + prevText: "السابق", + nextText: "التالي", + currentText: "اليوم", + monthNames: [ "يناير", "فبراير", "مارس", "أبريل", "مايو", "يونيو", + "يوليو", "أغسطس", "سبتمبر", "أكتوبر", "نوفمبر", "ديسمبر" ], + monthNamesShort: [ "1", "2", "3", "4", "5", "6", "7", "8", "9", "10", "11", "12" ], + dayNames: [ "الأحد", "الاثنين", "الثلاثاء", "الأربعاء", "الخميس", "الجمعة", "السبت" ], + dayNamesShort: [ "أحد", "اثنين", "ثلاثاء", "أربعاء", "خميس", "جمعة", "سبت" ], + dayNamesMin: [ "ح", "ن", "ث", "ر", "خ", "ج", "س" ], + weekHeader: "أسبوع", + dateFormat: "dd/mm/yy", + firstDay: 0, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.ar ); + +return datepicker.regional.ar; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-az.js b/include/thirdparty/jquery_ui/i18n/datepicker-az.js new file mode 100644 index 0000000..8d59547 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-az.js @@ -0,0 +1,40 @@ +/* Azerbaijani (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Jamil Najafov (necefov33@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.az = { + closeText: "Bağla", + prevText: "Geri", + nextText: "İrəli", + currentText: "Bugün", + monthNames: [ "Yanvar", "Fevral", "Mart", "Aprel", "May", "İyun", + "İyul", "Avqust", "Sentyabr", "Oktyabr", "Noyabr", "Dekabr" ], + monthNamesShort: [ "Yan", "Fev", "Mar", "Apr", "May", "İyun", + "İyul", "Avq", "Sen", "Okt", "Noy", "Dek" ], + dayNames: [ "Bazar", "Bazar ertəsi", "Çərşənbə axşamı", "Çərşənbə", "Cümə axşamı", "Cümə", "Şənbə" ], + dayNamesShort: [ "B", "Be", "Ça", "Ç", "Ca", "C", "Ş" ], + dayNamesMin: [ "B", "B", "Ç", "С", "Ç", "C", "Ş" ], + weekHeader: "Hf", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.az ); + +return datepicker.regional.az; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-be.js b/include/thirdparty/jquery_ui/i18n/datepicker-be.js new file mode 100644 index 0000000..125ed0f --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-be.js @@ -0,0 +1,40 @@ +/* Belarusian initialisation for the jQuery UI date picker plugin. */ +/* Written by Pavel Selitskas */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.be = { + closeText: "Зачыніць", + prevText: "Папяр.", + nextText: "Наст.", + currentText: "Сёньня", + monthNames: [ "Студзень", "Люты", "Сакавік", "Красавік", "Травень", "Чэрвень", + "Ліпень", "Жнівень", "Верасень", "Кастрычнік", "Лістапад", "Сьнежань" ], + monthNamesShort: [ "Сту", "Лют", "Сак", "Кра", "Тра", "Чэр", + "Ліп", "Жні", "Вер", "Кас", "Ліс", "Сьн" ], + dayNames: [ "нядзеля", "панядзелак", "аўторак", "серада", "чацьвер", "пятніца", "субота" ], + dayNamesShort: [ "ндз", "пнд", "аўт", "срд", "чцв", "птн", "сбт" ], + dayNamesMin: [ "Нд", "Пн", "Аў", "Ср", "Чц", "Пт", "Сб" ], + weekHeader: "Тд", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.be ); + +return datepicker.regional.be; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-bg.js b/include/thirdparty/jquery_ui/i18n/datepicker-bg.js new file mode 100644 index 0000000..62be734 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-bg.js @@ -0,0 +1,41 @@ +/* Bulgarian initialisation for the jQuery UI date picker plugin. */ +/* Written by Stoyan Kyosev. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.bg = { + closeText: "затвори", + prevText: "назад", + nextText: "напред", + nextBigText: ">>", + currentText: "днес", + monthNames: [ "Януари", "Февруари", "Март", "Април", "Май", "Юни", + "Юли", "Август", "Септември", "Октомври", "Ноември", "Декември" ], + monthNamesShort: [ "Яну", "Фев", "Мар", "Апр", "Май", "Юни", + "Юли", "Авг", "Сеп", "Окт", "Нов", "Дек" ], + dayNames: [ "Неделя", "Понеделник", "Вторник", "Сряда", "Четвъртък", "Петък", "Събота" ], + dayNamesShort: [ "Нед", "Пон", "Вто", "Сря", "Чет", "Пет", "Съб" ], + dayNamesMin: [ "Не", "По", "Вт", "Ср", "Че", "Пе", "Съ" ], + weekHeader: "Wk", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.bg ); + +return datepicker.regional.bg; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-bs.js b/include/thirdparty/jquery_ui/i18n/datepicker-bs.js new file mode 100644 index 0000000..3ee9db4 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-bs.js @@ -0,0 +1,40 @@ +/* Bosnian i18n for the jQuery UI date picker plugin. */ +/* Written by Kenan Konjo. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.bs = { + closeText: "Zatvori", + prevText: "Prethodno", + nextText: "Sljedeći", + currentText: "Danas", + monthNames: [ "Januar", "Februar", "Mart", "April", "Maj", "Juni", + "Juli", "August", "Septembar", "Oktobar", "Novembar", "Decembar" ], + monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "Maj", "Jun", + "Jul", "Aug", "Sep", "Okt", "Nov", "Dec" ], + dayNames: [ "Nedelja", "Ponedeljak", "Utorak", "Srijeda", "Četvrtak", "Petak", "Subota" ], + dayNamesShort: [ "Ned", "Pon", "Uto", "Sri", "Čet", "Pet", "Sub" ], + dayNamesMin: [ "Ne", "Po", "Ut", "Sr", "Če", "Pe", "Su" ], + weekHeader: "Wk", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.bs ); + +return datepicker.regional.bs; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-ca.js b/include/thirdparty/jquery_ui/i18n/datepicker-ca.js new file mode 100644 index 0000000..bca86de --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-ca.js @@ -0,0 +1,40 @@ +/* Inicialització en català per a l'extensió 'UI date picker' per jQuery. */ +/* Writers: (joan.leon@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.ca = { + closeText: "Tanca", + prevText: "Anterior", + nextText: "Següent", + currentText: "Avui", + monthNames: [ "gener", "febrer", "març", "abril", "maig", "juny", + "juliol", "agost", "setembre", "octubre", "novembre", "desembre" ], + monthNamesShort: [ "gen", "feb", "març", "abr", "maig", "juny", + "jul", "ag", "set", "oct", "nov", "des" ], + dayNames: [ "diumenge", "dilluns", "dimarts", "dimecres", "dijous", "divendres", "dissabte" ], + dayNamesShort: [ "dg", "dl", "dt", "dc", "dj", "dv", "ds" ], + dayNamesMin: [ "dg", "dl", "dt", "dc", "dj", "dv", "ds" ], + weekHeader: "Set", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.ca ); + +return datepicker.regional.ca; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-cs.js b/include/thirdparty/jquery_ui/i18n/datepicker-cs.js new file mode 100644 index 0000000..6e5552c --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-cs.js @@ -0,0 +1,40 @@ +/* Czech initialisation for the jQuery UI date picker plugin. */ +/* Written by Tomas Muller (tomas@tomas-muller.net). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.cs = { + closeText: "Zavřít", + prevText: "Dříve", + nextText: "Později", + currentText: "Nyní", + monthNames: [ "leden", "únor", "březen", "duben", "květen", "červen", + "červenec", "srpen", "září", "říjen", "listopad", "prosinec" ], + monthNamesShort: [ "led", "úno", "bře", "dub", "kvě", "čer", + "čvc", "srp", "zář", "říj", "lis", "pro" ], + dayNames: [ "neděle", "pondělí", "úterý", "středa", "čtvrtek", "pátek", "sobota" ], + dayNamesShort: [ "ne", "po", "út", "st", "čt", "pá", "so" ], + dayNamesMin: [ "ne", "po", "út", "st", "čt", "pá", "so" ], + weekHeader: "Týd", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.cs ); + +return datepicker.regional.cs; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-cy-GB.js b/include/thirdparty/jquery_ui/i18n/datepicker-cy-GB.js new file mode 100644 index 0000000..942c24f --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-cy-GB.js @@ -0,0 +1,48 @@ +/* Welsh/UK initialisation for the jQuery UI date picker plugin. */ +/* Written by William Griffiths. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional[ "cy-GB" ] = { + closeText: "Done", + prevText: "Prev", + nextText: "Next", + currentText: "Today", + monthNames: [ "Ionawr", "Chwefror", "Mawrth", "Ebrill", "Mai", "Mehefin", + "Gorffennaf", "Awst", "Medi", "Hydref", "Tachwedd", "Rhagfyr" ], + monthNamesShort: [ "Ion", "Chw", "Maw", "Ebr", "Mai", "Meh", + "Gor", "Aws", "Med", "Hyd", "Tac", "Rha" ], + dayNames: [ + "Dydd Sul", + "Dydd Llun", + "Dydd Mawrth", + "Dydd Mercher", + "Dydd Iau", + "Dydd Gwener", + "Dydd Sadwrn" + ], + dayNamesShort: [ "Sul", "Llu", "Maw", "Mer", "Iau", "Gwe", "Sad" ], + dayNamesMin: [ "Su", "Ll", "Ma", "Me", "Ia", "Gw", "Sa" ], + weekHeader: "Wy", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional[ "cy-GB" ] ); + +return datepicker.regional[ "cy-GB" ]; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-da.js b/include/thirdparty/jquery_ui/i18n/datepicker-da.js new file mode 100644 index 0000000..d2de755 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-da.js @@ -0,0 +1,40 @@ +/* Danish initialisation for the jQuery UI date picker plugin. */ +/* Written by Jan Christensen ( deletestuff@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.da = { + closeText: "Luk", + prevText: "Forrige", + nextText: "Næste", + currentText: "I dag", + monthNames: [ "Januar", "Februar", "Marts", "April", "Maj", "Juni", + "Juli", "August", "September", "Oktober", "November", "December" ], + monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "Maj", "Jun", + "Jul", "Aug", "Sep", "Okt", "Nov", "Dec" ], + dayNames: [ "Søndag", "Mandag", "Tirsdag", "Onsdag", "Torsdag", "Fredag", "Lørdag" ], + dayNamesShort: [ "Søn", "Man", "Tir", "Ons", "Tor", "Fre", "Lør" ], + dayNamesMin: [ "Sø", "Ma", "Ti", "On", "To", "Fr", "Lø" ], + weekHeader: "Uge", + dateFormat: "dd-mm-yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.da ); + +return datepicker.regional.da; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-de-AT.js b/include/thirdparty/jquery_ui/i18n/datepicker-de-AT.js new file mode 100644 index 0000000..4a8b781 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-de-AT.js @@ -0,0 +1,41 @@ +/* German/Austrian initialisation for the jQuery UI date picker plugin. */ +/* Based on the de initialisation. */ + +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional[ "de-AT" ] = { + closeText: "Schließen", + prevText: "Zurück", + nextText: "Vor", + currentText: "Heute", + monthNames: [ "Jänner", "Februar", "März", "April", "Mai", "Juni", + "Juli", "August", "September", "Oktober", "November", "Dezember" ], + monthNamesShort: [ "Jän", "Feb", "Mär", "Apr", "Mai", "Jun", + "Jul", "Aug", "Sep", "Okt", "Nov", "Dez" ], + dayNames: [ "Sonntag", "Montag", "Dienstag", "Mittwoch", "Donnerstag", "Freitag", "Samstag" ], + dayNamesShort: [ "So", "Mo", "Di", "Mi", "Do", "Fr", "Sa" ], + dayNamesMin: [ "So", "Mo", "Di", "Mi", "Do", "Fr", "Sa" ], + weekHeader: "KW", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional[ "de-AT" ] ); + +return datepicker.regional[ "de-AT" ]; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-de.js b/include/thirdparty/jquery_ui/i18n/datepicker-de.js new file mode 100644 index 0000000..8a08ebf --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-de.js @@ -0,0 +1,40 @@ +/* German initialisation for the jQuery UI date picker plugin. */ +/* Written by Milian Wolff (mail@milianw.de). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.de = { + closeText: "Schließen", + prevText: "Zurück", + nextText: "Vor", + currentText: "Heute", + monthNames: [ "Januar", "Februar", "März", "April", "Mai", "Juni", + "Juli", "August", "September", "Oktober", "November", "Dezember" ], + monthNamesShort: [ "Jan", "Feb", "Mär", "Apr", "Mai", "Jun", + "Jul", "Aug", "Sep", "Okt", "Nov", "Dez" ], + dayNames: [ "Sonntag", "Montag", "Dienstag", "Mittwoch", "Donnerstag", "Freitag", "Samstag" ], + dayNamesShort: [ "So", "Mo", "Di", "Mi", "Do", "Fr", "Sa" ], + dayNamesMin: [ "So", "Mo", "Di", "Mi", "Do", "Fr", "Sa" ], + weekHeader: "KW", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.de ); + +return datepicker.regional.de; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-el.js b/include/thirdparty/jquery_ui/i18n/datepicker-el.js new file mode 100644 index 0000000..9716e41 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-el.js @@ -0,0 +1,40 @@ +/* Greek (el) initialisation for the jQuery UI date picker plugin. */ +/* Written by Alex Cicovic (https://alexcicovic.com) */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.el = { + closeText: "Κλείσιμο", + prevText: "Προηγούμενος", + nextText: "Επόμενος", + currentText: "Σήμερα", + monthNames: [ "Ιανουάριος", "Φεβρουάριος", "Μάρτιος", "Απρίλιος", "Μάιος", "Ιούνιος", + "Ιούλιος", "Αύγουστος", "Σεπτέμβριος", "Οκτώβριος", "Νοέμβριος", "Δεκέμβριος" ], + monthNamesShort: [ "Ιαν", "Φεβ", "Μαρ", "Απρ", "Μαι", "Ιουν", + "Ιουλ", "Αυγ", "Σεπ", "Οκτ", "Νοε", "Δεκ" ], + dayNames: [ "Κυριακή", "Δευτέρα", "Τρίτη", "Τετάρτη", "Πέμπτη", "Παρασκευή", "Σάββατο" ], + dayNamesShort: [ "Κυρ", "Δευ", "Τρι", "Τετ", "Πεμ", "Παρ", "Σαβ" ], + dayNamesMin: [ "Κυ", "Δε", "Τρ", "Τε", "Πε", "Πα", "Σα" ], + weekHeader: "Εβδ", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.el ); + +return datepicker.regional.el; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-en-AU.js b/include/thirdparty/jquery_ui/i18n/datepicker-en-AU.js new file mode 100644 index 0000000..baef43a --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-en-AU.js @@ -0,0 +1,40 @@ +/* English/Australia initialisation for the jQuery UI date picker plugin. */ +/* Based on the en-GB initialisation. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional[ "en-AU" ] = { + closeText: "Done", + prevText: "Prev", + nextText: "Next", + currentText: "Today", + monthNames: [ "January", "February", "March", "April", "May", "June", + "July", "August", "September", "October", "November", "December" ], + monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "May", "Jun", + "Jul", "Aug", "Sep", "Oct", "Nov", "Dec" ], + dayNames: [ "Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday" ], + dayNamesShort: [ "Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat" ], + dayNamesMin: [ "Su", "Mo", "Tu", "We", "Th", "Fr", "Sa" ], + weekHeader: "Wk", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional[ "en-AU" ] ); + +return datepicker.regional[ "en-AU" ]; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-en-GB.js b/include/thirdparty/jquery_ui/i18n/datepicker-en-GB.js new file mode 100644 index 0000000..e0a7a32 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-en-GB.js @@ -0,0 +1,40 @@ +/* English/UK initialisation for the jQuery UI date picker plugin. */ +/* Written by Stuart. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional[ "en-GB" ] = { + closeText: "Done", + prevText: "Prev", + nextText: "Next", + currentText: "Today", + monthNames: [ "January", "February", "March", "April", "May", "June", + "July", "August", "September", "October", "November", "December" ], + monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "May", "Jun", + "Jul", "Aug", "Sep", "Oct", "Nov", "Dec" ], + dayNames: [ "Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday" ], + dayNamesShort: [ "Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat" ], + dayNamesMin: [ "Su", "Mo", "Tu", "We", "Th", "Fr", "Sa" ], + weekHeader: "Wk", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional[ "en-GB" ] ); + +return datepicker.regional[ "en-GB" ]; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-en-NZ.js b/include/thirdparty/jquery_ui/i18n/datepicker-en-NZ.js new file mode 100644 index 0000000..6e47689 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-en-NZ.js @@ -0,0 +1,40 @@ +/* English/New Zealand initialisation for the jQuery UI date picker plugin. */ +/* Based on the en-GB initialisation. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional[ "en-NZ" ] = { + closeText: "Done", + prevText: "Prev", + nextText: "Next", + currentText: "Today", + monthNames: [ "January", "February", "March", "April", "May", "June", + "July", "August", "September", "October", "November", "December" ], + monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "May", "Jun", + "Jul", "Aug", "Sep", "Oct", "Nov", "Dec" ], + dayNames: [ "Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday" ], + dayNamesShort: [ "Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat" ], + dayNamesMin: [ "Su", "Mo", "Tu", "We", "Th", "Fr", "Sa" ], + weekHeader: "Wk", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional[ "en-NZ" ] ); + +return datepicker.regional[ "en-NZ" ]; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-eo.js b/include/thirdparty/jquery_ui/i18n/datepicker-eo.js new file mode 100644 index 0000000..08aa96e --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-eo.js @@ -0,0 +1,40 @@ +/* Esperanto initialisation for the jQuery UI date picker plugin. */ +/* Written by Olivier M. (olivierweb@ifrance.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.eo = { + closeText: "Fermi", + prevText: "Anta", + nextText: "Sekv", + currentText: "Nuna", + monthNames: [ "Januaro", "Februaro", "Marto", "Aprilo", "Majo", "Junio", + "Julio", "Aŭgusto", "Septembro", "Oktobro", "Novembro", "Decembro" ], + monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "Maj", "Jun", + "Jul", "Aŭg", "Sep", "Okt", "Nov", "Dec" ], + dayNames: [ "Dimanĉo", "Lundo", "Mardo", "Merkredo", "Ĵaŭdo", "Vendredo", "Sabato" ], + dayNamesShort: [ "Dim", "Lun", "Mar", "Mer", "Ĵaŭ", "Ven", "Sab" ], + dayNamesMin: [ "Di", "Lu", "Ma", "Me", "Ĵa", "Ve", "Sa" ], + weekHeader: "Sb", + dateFormat: "dd/mm/yy", + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.eo ); + +return datepicker.regional.eo; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-es.js b/include/thirdparty/jquery_ui/i18n/datepicker-es.js new file mode 100644 index 0000000..dbb1f0a --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-es.js @@ -0,0 +1,40 @@ +/* Inicialización en español para la extensión 'UI date picker' para jQuery. */ +/* Traducido por Vester (xvester@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.es = { + closeText: "Cerrar", + prevText: "Ant", + nextText: "Sig", + currentText: "Hoy", + monthNames: [ "enero", "febrero", "marzo", "abril", "mayo", "junio", + "julio", "agosto", "septiembre", "octubre", "noviembre", "diciembre" ], + monthNamesShort: [ "ene", "feb", "mar", "abr", "may", "jun", + "jul", "ago", "sep", "oct", "nov", "dic" ], + dayNames: [ "domingo", "lunes", "martes", "miércoles", "jueves", "viernes", "sábado" ], + dayNamesShort: [ "dom", "lun", "mar", "mié", "jue", "vie", "sáb" ], + dayNamesMin: [ "D", "L", "M", "X", "J", "V", "S" ], + weekHeader: "Sm", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.es ); + +return datepicker.regional.es; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-et.js b/include/thirdparty/jquery_ui/i18n/datepicker-et.js new file mode 100644 index 0000000..11d5857 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-et.js @@ -0,0 +1,48 @@ +/* Estonian initialisation for the jQuery UI date picker plugin. */ +/* Written by Mart Sõmermaa (mrts.pydev at gmail com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.et = { + closeText: "Sulge", + prevText: "Eelnev", + nextText: "Järgnev", + currentText: "Täna", + monthNames: [ "Jaanuar", "Veebruar", "Märts", "Aprill", "Mai", "Juuni", + "Juuli", "August", "September", "Oktoober", "November", "Detsember" ], + monthNamesShort: [ "Jaan", "Veebr", "Märts", "Apr", "Mai", "Juuni", + "Juuli", "Aug", "Sept", "Okt", "Nov", "Dets" ], + dayNames: [ + "Pühapäev", + "Esmaspäev", + "Teisipäev", + "Kolmapäev", + "Neljapäev", + "Reede", + "Laupäev" + ], + dayNamesShort: [ "Pühap", "Esmasp", "Teisip", "Kolmap", "Neljap", "Reede", "Laup" ], + dayNamesMin: [ "P", "E", "T", "K", "N", "R", "L" ], + weekHeader: "näd", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.et ); + +return datepicker.regional.et; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-eu.js b/include/thirdparty/jquery_ui/i18n/datepicker-eu.js new file mode 100644 index 0000000..0de057c --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-eu.js @@ -0,0 +1,39 @@ +/* Karrikas-ek itzulia (karrikas@karrikas.com) */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.eu = { + closeText: "Egina", + prevText: "Aur", + nextText: "Hur", + currentText: "Gaur", + monthNames: [ "urtarrila", "otsaila", "martxoa", "apirila", "maiatza", "ekaina", + "uztaila", "abuztua", "iraila", "urria", "azaroa", "abendua" ], + monthNamesShort: [ "urt.", "ots.", "mar.", "api.", "mai.", "eka.", + "uzt.", "abu.", "ira.", "urr.", "aza.", "abe." ], + dayNames: [ "igandea", "astelehena", "asteartea", "asteazkena", "osteguna", "ostirala", "larunbata" ], + dayNamesShort: [ "ig.", "al.", "ar.", "az.", "og.", "ol.", "lr." ], + dayNamesMin: [ "ig", "al", "ar", "az", "og", "ol", "lr" ], + weekHeader: "As", + dateFormat: "yy-mm-dd", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.eu ); + +return datepicker.regional.eu; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-fa.js b/include/thirdparty/jquery_ui/i18n/datepicker-fa.js new file mode 100644 index 0000000..ac30752 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-fa.js @@ -0,0 +1,76 @@ +/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */ +/* Javad Mowlanezhad -- jmowla@gmail.com */ +/* Jalali calendar should supported soon! (Its implemented but I have to test it) */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.fa = { + closeText: "بستن", + prevText: "قبلی", + nextText: "بعدی", + currentText: "امروز", + monthNames: [ + "ژانویه", + "فوریه", + "مارس", + "آوریل", + "مه", + "ژوئن", + "ژوئیه", + "اوت", + "سپتامبر", + "اکتبر", + "نوامبر", + "دسامبر" + ], + monthNamesShort: [ "1", "2", "3", "4", "5", "6", "7", "8", "9", "10", "11", "12" ], + dayNames: [ + "يکشنبه", + "دوشنبه", + "سه‌شنبه", + "چهارشنبه", + "پنجشنبه", + "جمعه", + "شنبه" + ], + dayNamesShort: [ + "ی", + "د", + "س", + "چ", + "پ", + "ج", + "ش" + ], + dayNamesMin: [ + "ی", + "د", + "س", + "چ", + "پ", + "ج", + "ش" + ], + weekHeader: "هف", + dateFormat: "yy/mm/dd", + firstDay: 6, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.fa ); + +return datepicker.regional.fa; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-fi.js b/include/thirdparty/jquery_ui/i18n/datepicker-fi.js new file mode 100644 index 0000000..d355e9e --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-fi.js @@ -0,0 +1,40 @@ +/* Finnish initialisation for the jQuery UI date picker plugin. */ +/* Written by Harri Kilpiö (harrikilpio@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.fi = { + closeText: "Sulje", + prevText: "Edellinen", + nextText: "Seuraava", + currentText: "Tänään", + monthNames: [ "Tammikuu", "Helmikuu", "Maaliskuu", "Huhtikuu", "Toukokuu", "Kesäkuu", + "Heinäkuu", "Elokuu", "Syyskuu", "Lokakuu", "Marraskuu", "Joulukuu" ], + monthNamesShort: [ "Tammi", "Helmi", "Maalis", "Huhti", "Touko", "Kesä", + "Heinä", "Elo", "Syys", "Loka", "Marras", "Joulu" ], + dayNamesShort: [ "Su", "Ma", "Ti", "Ke", "To", "Pe", "La" ], + dayNames: [ "Sunnuntai", "Maanantai", "Tiistai", "Keskiviikko", "Torstai", "Perjantai", "Lauantai" ], + dayNamesMin: [ "Su", "Ma", "Ti", "Ke", "To", "Pe", "La" ], + weekHeader: "Vk", + dateFormat: "d.m.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.fi ); + +return datepicker.regional.fi; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-fo.js b/include/thirdparty/jquery_ui/i18n/datepicker-fo.js new file mode 100644 index 0000000..d2ec9d7 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-fo.js @@ -0,0 +1,48 @@ +/* Faroese initialisation for the jQuery UI date picker plugin */ +/* Written by Sverri Mohr Olsen, sverrimo@gmail.com */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.fo = { + closeText: "Lat aftur", + prevText: "Fyrra", + nextText: "Næsta", + currentText: "Í dag", + monthNames: [ "Januar", "Februar", "Mars", "Apríl", "Mei", "Juni", + "Juli", "August", "September", "Oktober", "November", "Desember" ], + monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "Mei", "Jun", + "Jul", "Aug", "Sep", "Okt", "Nov", "Des" ], + dayNames: [ + "Sunnudagur", + "Mánadagur", + "Týsdagur", + "Mikudagur", + "Hósdagur", + "Fríggjadagur", + "Leyardagur" + ], + dayNamesShort: [ "Sun", "Mán", "Týs", "Mik", "Hós", "Frí", "Ley" ], + dayNamesMin: [ "Su", "Má", "Tý", "Mi", "Hó", "Fr", "Le" ], + weekHeader: "Vk", + dateFormat: "dd-mm-yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.fo ); + +return datepicker.regional.fo; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-fr-CA.js b/include/thirdparty/jquery_ui/i18n/datepicker-fr-CA.js new file mode 100644 index 0000000..a14b1d3 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-fr-CA.js @@ -0,0 +1,40 @@ +/* Canadian-French initialisation for the jQuery UI date picker plugin. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional[ "fr-CA" ] = { + closeText: "Fermer", + prevText: "Précédent", + nextText: "Suivant", + currentText: "Aujourd'hui", + monthNames: [ "janvier", "février", "mars", "avril", "mai", "juin", + "juillet", "août", "septembre", "octobre", "novembre", "décembre" ], + monthNamesShort: [ "janv.", "févr.", "mars", "avril", "mai", "juin", + "juil.", "août", "sept.", "oct.", "nov.", "déc." ], + dayNames: [ "dimanche", "lundi", "mardi", "mercredi", "jeudi", "vendredi", "samedi" ], + dayNamesShort: [ "dim.", "lun.", "mar.", "mer.", "jeu.", "ven.", "sam." ], + dayNamesMin: [ "D", "L", "M", "M", "J", "V", "S" ], + weekHeader: "Sem.", + dateFormat: "yy-mm-dd", + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" +}; +datepicker.setDefaults( datepicker.regional[ "fr-CA" ] ); + +return datepicker.regional[ "fr-CA" ]; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-fr-CH.js b/include/thirdparty/jquery_ui/i18n/datepicker-fr-CH.js new file mode 100644 index 0000000..7221d14 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-fr-CH.js @@ -0,0 +1,40 @@ +/* Swiss-French initialisation for the jQuery UI date picker plugin. */ +/* Written Martin Voelkle (martin.voelkle@e-tc.ch). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional[ "fr-CH" ] = { + closeText: "Fermer", + prevText: "Préc", + nextText: "Suiv", + currentText: "Courant", + monthNames: [ "janvier", "février", "mars", "avril", "mai", "juin", + "juillet", "août", "septembre", "octobre", "novembre", "décembre" ], + monthNamesShort: [ "janv.", "févr.", "mars", "avril", "mai", "juin", + "juil.", "août", "sept.", "oct.", "nov.", "déc." ], + dayNames: [ "dimanche", "lundi", "mardi", "mercredi", "jeudi", "vendredi", "samedi" ], + dayNamesShort: [ "dim.", "lun.", "mar.", "mer.", "jeu.", "ven.", "sam." ], + dayNamesMin: [ "D", "L", "M", "M", "J", "V", "S" ], + weekHeader: "Sm", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional[ "fr-CH" ] ); + +return datepicker.regional[ "fr-CH" ]; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-fr.js b/include/thirdparty/jquery_ui/i18n/datepicker-fr.js new file mode 100644 index 0000000..42b582b --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-fr.js @@ -0,0 +1,42 @@ +/* French initialisation for the jQuery UI date picker plugin. */ +/* Written by Keith Wood (kbwood{at}iinet.com.au), + Stéphane Nahmani (sholby@sholby.net), + Stéphane Raimbault */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.fr = { + closeText: "Fermer", + prevText: "Précédent", + nextText: "Suivant", + currentText: "Aujourd'hui", + monthNames: [ "janvier", "février", "mars", "avril", "mai", "juin", + "juillet", "août", "septembre", "octobre", "novembre", "décembre" ], + monthNamesShort: [ "janv.", "févr.", "mars", "avr.", "mai", "juin", + "juil.", "août", "sept.", "oct.", "nov.", "déc." ], + dayNames: [ "dimanche", "lundi", "mardi", "mercredi", "jeudi", "vendredi", "samedi" ], + dayNamesShort: [ "dim.", "lun.", "mar.", "mer.", "jeu.", "ven.", "sam." ], + dayNamesMin: [ "D", "L", "M", "M", "J", "V", "S" ], + weekHeader: "Sem.", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.fr ); + +return datepicker.regional.fr; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-gl.js b/include/thirdparty/jquery_ui/i18n/datepicker-gl.js new file mode 100644 index 0000000..27abb02 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-gl.js @@ -0,0 +1,40 @@ +/* Galician localization for 'UI date picker' jQuery extension. */ +/* Translated by Jorge Barreiro . */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.gl = { + closeText: "Pechar", + prevText: "Ant", + nextText: "Seg", + currentText: "Hoxe", + monthNames: [ "Xaneiro", "Febreiro", "Marzo", "Abril", "Maio", "Xuño", + "Xullo", "Agosto", "Setembro", "Outubro", "Novembro", "Decembro" ], + monthNamesShort: [ "Xan", "Feb", "Mar", "Abr", "Mai", "Xuñ", + "Xul", "Ago", "Set", "Out", "Nov", "Dec" ], + dayNames: [ "Domingo", "Luns", "Martes", "Mércores", "Xoves", "Venres", "Sábado" ], + dayNamesShort: [ "Dom", "Lun", "Mar", "Mér", "Xov", "Ven", "Sáb" ], + dayNamesMin: [ "Do", "Lu", "Ma", "Mé", "Xo", "Ve", "Sá" ], + weekHeader: "Sm", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.gl ); + +return datepicker.regional.gl; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-he.js b/include/thirdparty/jquery_ui/i18n/datepicker-he.js new file mode 100644 index 0000000..fbe3c40 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-he.js @@ -0,0 +1,40 @@ +/* Hebrew initialisation for the UI Datepicker extension. */ +/* Written by Amir Hardon (ahardon at gmail dot com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.he = { + closeText: "סגור", + prevText: "הקודם", + nextText: "הבא", + currentText: "היום", + monthNames: [ "ינואר", "פברואר", "מרץ", "אפריל", "מאי", "יוני", + "יולי", "אוגוסט", "ספטמבר", "אוקטובר", "נובמבר", "דצמבר" ], + monthNamesShort: [ "ינו", "פבר", "מרץ", "אפר", "מאי", "יוני", + "יולי", "אוג", "ספט", "אוק", "נוב", "דצמ" ], + dayNames: [ "ראשון", "שני", "שלישי", "רביעי", "חמישי", "שישי", "שבת" ], + dayNamesShort: [ "א'", "ב'", "ג'", "ד'", "ה'", "ו'", "שבת" ], + dayNamesMin: [ "א'", "ב'", "ג'", "ד'", "ה'", "ו'", "שבת" ], + weekHeader: "Wk", + dateFormat: "dd/mm/yy", + firstDay: 0, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.he ); + +return datepicker.regional.he; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-hi.js b/include/thirdparty/jquery_ui/i18n/datepicker-hi.js new file mode 100644 index 0000000..e3b72e5 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-hi.js @@ -0,0 +1,40 @@ +/* Hindi initialisation for the jQuery UI date picker plugin. */ +/* Written by Michael Dawart. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.hi = { + closeText: "बंद", + prevText: "पिछला", + nextText: "अगला", + currentText: "आज", + monthNames: [ "जनवरी ", "फरवरी", "मार्च", "अप्रेल", "मई", "जून", + "जूलाई", "अगस्त ", "सितम्बर", "अक्टूबर", "नवम्बर", "दिसम्बर" ], + monthNamesShort: [ "जन", "फर", "मार्च", "अप्रेल", "मई", "जून", + "जूलाई", "अग", "सित", "अक्ट", "नव", "दि" ], + dayNames: [ "रविवार", "सोमवार", "मंगलवार", "बुधवार", "गुरुवार", "शुक्रवार", "शनिवार" ], + dayNamesShort: [ "रवि", "सोम", "मंगल", "बुध", "गुरु", "शुक्र", "शनि" ], + dayNamesMin: [ "रवि", "सोम", "मंगल", "बुध", "गुरु", "शुक्र", "शनि" ], + weekHeader: "हफ्ता", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.hi ); + +return datepicker.regional.hi; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-hr.js b/include/thirdparty/jquery_ui/i18n/datepicker-hr.js new file mode 100644 index 0000000..2898d5c --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-hr.js @@ -0,0 +1,40 @@ +/* Croatian i18n for the jQuery UI date picker plugin. */ +/* Written by Vjekoslav Nesek. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.hr = { + closeText: "Zatvori", + prevText: "Prethodno", + nextText: "Sljedeći", + currentText: "Danas", + monthNames: [ "Siječanj", "Veljača", "Ožujak", "Travanj", "Svibanj", "Lipanj", + "Srpanj", "Kolovoz", "Rujan", "Listopad", "Studeni", "Prosinac" ], + monthNamesShort: [ "Sij", "Velj", "Ožu", "Tra", "Svi", "Lip", + "Srp", "Kol", "Ruj", "Lis", "Stu", "Pro" ], + dayNames: [ "Nedjelja", "Ponedjeljak", "Utorak", "Srijeda", "Četvrtak", "Petak", "Subota" ], + dayNamesShort: [ "Ned", "Pon", "Uto", "Sri", "Čet", "Pet", "Sub" ], + dayNamesMin: [ "Ne", "Po", "Ut", "Sr", "Če", "Pe", "Su" ], + weekHeader: "Tje", + dateFormat: "dd.mm.yy.", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.hr ); + +return datepicker.regional.hr; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-hu.js b/include/thirdparty/jquery_ui/i18n/datepicker-hu.js new file mode 100644 index 0000000..3bb86da --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-hu.js @@ -0,0 +1,39 @@ +/* Hungarian initialisation for the jQuery UI date picker plugin. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.hu = { + closeText: "Bezár", + prevText: "Vissza", + nextText: "Előre", + currentText: "Ma", + monthNames: [ "Január", "Február", "Március", "Április", "Május", "Június", + "Július", "Augusztus", "Szeptember", "Október", "November", "December" ], + monthNamesShort: [ "Jan", "Feb", "Már", "Ápr", "Máj", "Jún", + "Júl", "Aug", "Szep", "Okt", "Nov", "Dec" ], + dayNames: [ "Vasárnap", "Hétfő", "Kedd", "Szerda", "Csütörtök", "Péntek", "Szombat" ], + dayNamesShort: [ "Vas", "Hét", "Ked", "Sze", "Csü", "Pén", "Szo" ], + dayNamesMin: [ "V", "H", "K", "Sze", "Cs", "P", "Szo" ], + weekHeader: "Hét", + dateFormat: "yy.mm.dd.", + firstDay: 1, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.hu ); + +return datepicker.regional.hu; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-hy.js b/include/thirdparty/jquery_ui/i18n/datepicker-hy.js new file mode 100644 index 0000000..7d4da5a --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-hy.js @@ -0,0 +1,40 @@ +/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.hy = { + closeText: "Փակել", + prevText: "Նախ.", + nextText: "Հաջ.", + currentText: "Այսօր", + monthNames: [ "Հունվար", "Փետրվար", "Մարտ", "Ապրիլ", "Մայիս", "Հունիս", + "Հուլիս", "Օգոստոս", "Սեպտեմբեր", "Հոկտեմբեր", "Նոյեմբեր", "Դեկտեմբեր" ], + monthNamesShort: [ "Հունվ", "Փետր", "Մարտ", "Ապր", "Մայիս", "Հունիս", + "Հուլ", "Օգս", "Սեպ", "Հոկ", "Նոյ", "Դեկ" ], + dayNames: [ "կիրակի", "եկուշաբթի", "երեքշաբթի", "չորեքշաբթի", "հինգշաբթի", "ուրբաթ", "շաբաթ" ], + dayNamesShort: [ "կիր", "երկ", "երք", "չրք", "հնգ", "ուրբ", "շբթ" ], + dayNamesMin: [ "կիր", "երկ", "երք", "չրք", "հնգ", "ուրբ", "շբթ" ], + weekHeader: "ՇԲՏ", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.hy ); + +return datepicker.regional.hy; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-id.js b/include/thirdparty/jquery_ui/i18n/datepicker-id.js new file mode 100644 index 0000000..17082e9 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-id.js @@ -0,0 +1,41 @@ +/* Indonesian initialisation for the jQuery UI date picker plugin. */ +/* Written by Deden Fathurahman (dedenf@gmail.com). */ +/* Fixed by Denny Septian Panggabean (xamidimura@gmail.com) */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.id = { + closeText: "Tutup", + prevText: "Mundur", + nextText: "Maju", + currentText: "Hari ini", + monthNames: [ "Januari", "Februari", "Maret", "April", "Mei", "Juni", + "Juli", "Agustus", "September", "Oktober", "Nopember", "Desember" ], + monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "Mei", "Jun", + "Jul", "Agus", "Sep", "Okt", "Nop", "Des" ], + dayNames: [ "Minggu", "Senin", "Selasa", "Rabu", "Kamis", "Jumat", "Sabtu" ], + dayNamesShort: [ "Min", "Sen", "Sel", "Rab", "Kam", "Jum", "Sab" ], + dayNamesMin: [ "Mg", "Sn", "Sl", "Rb", "Km", "Jm", "Sb" ], + weekHeader: "Mg", + dateFormat: "dd/mm/yy", + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.id ); + +return datepicker.regional.id; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-is.js b/include/thirdparty/jquery_ui/i18n/datepicker-is.js new file mode 100644 index 0000000..c453fa4 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-is.js @@ -0,0 +1,48 @@ +/* Icelandic initialisation for the jQuery UI date picker plugin. */ +/* Written by Haukur H. Thorsson (haukur@eskill.is). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.is = { + closeText: "Loka", + prevText: "Fyrri", + nextText: "Næsti ", + currentText: "Í dag", + monthNames: [ "Janúar", "Febrúar", "Mars", "Apríl", "Maí", "Júní", + "Júlí", "Ágúst", "September", "Október", "Nóvember", "Desember" ], + monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "Maí", "Jún", + "Júl", "Ágú", "Sep", "Okt", "Nóv", "Des" ], + dayNames: [ + "Sunnudagur", + "Mánudagur", + "Þriðjudagur", + "Miðvikudagur", + "Fimmtudagur", + "Föstudagur", + "Laugardagur" + ], + dayNamesShort: [ "Sun", "Mán", "Þri", "Mið", "Fim", "Fös", "Lau" ], + dayNamesMin: [ "Su", "Má", "Þr", "Mi", "Fi", "Fö", "La" ], + weekHeader: "Vika", + dateFormat: "dd.mm.yy", + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.is ); + +return datepicker.regional.is; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-it-CH.js b/include/thirdparty/jquery_ui/i18n/datepicker-it-CH.js new file mode 100644 index 0000000..73b7918 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-it-CH.js @@ -0,0 +1,40 @@ +/* Italian initialisation for the jQuery UI date picker plugin. */ +/* Written by Antonello Pasella (antonello.pasella@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional[ "it-CH" ] = { + closeText: "Chiudi", + prevText: "Prec", + nextText: "Succ", + currentText: "Oggi", + monthNames: [ "Gennaio", "Febbraio", "Marzo", "Aprile", "Maggio", "Giugno", + "Luglio", "Agosto", "Settembre", "Ottobre", "Novembre", "Dicembre" ], + monthNamesShort: [ "Gen", "Feb", "Mar", "Apr", "Mag", "Giu", + "Lug", "Ago", "Set", "Ott", "Nov", "Dic" ], + dayNames: [ "Domenica", "Lunedì", "Martedì", "Mercoledì", "Giovedì", "Venerdì", "Sabato" ], + dayNamesShort: [ "Dom", "Lun", "Mar", "Mer", "Gio", "Ven", "Sab" ], + dayNamesMin: [ "Do", "Lu", "Ma", "Me", "Gi", "Ve", "Sa" ], + weekHeader: "Sm", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional[ "it-CH" ] ); + +return datepicker.regional[ "it-CH" ]; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-it.js b/include/thirdparty/jquery_ui/i18n/datepicker-it.js new file mode 100644 index 0000000..d1d4980 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-it.js @@ -0,0 +1,40 @@ +/* Italian initialisation for the jQuery UI date picker plugin. */ +/* Written by Antonello Pasella (antonello.pasella@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.it = { + closeText: "Chiudi", + prevText: "Prec", + nextText: "Succ", + currentText: "Oggi", + monthNames: [ "Gennaio", "Febbraio", "Marzo", "Aprile", "Maggio", "Giugno", + "Luglio", "Agosto", "Settembre", "Ottobre", "Novembre", "Dicembre" ], + monthNamesShort: [ "Gen", "Feb", "Mar", "Apr", "Mag", "Giu", + "Lug", "Ago", "Set", "Ott", "Nov", "Dic" ], + dayNames: [ "Domenica", "Lunedì", "Martedì", "Mercoledì", "Giovedì", "Venerdì", "Sabato" ], + dayNamesShort: [ "Dom", "Lun", "Mar", "Mer", "Gio", "Ven", "Sab" ], + dayNamesMin: [ "Do", "Lu", "Ma", "Me", "Gi", "Ve", "Sa" ], + weekHeader: "Sm", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.it ); + +return datepicker.regional.it; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-ja.js b/include/thirdparty/jquery_ui/i18n/datepicker-ja.js new file mode 100644 index 0000000..95fa6fd --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-ja.js @@ -0,0 +1,40 @@ +/* Japanese initialisation for the jQuery UI date picker plugin. */ +/* Written by Kentaro SATO (kentaro@ranvis.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.ja = { + closeText: "閉じる", + prevText: "前", + nextText: "次", + currentText: "今日", + monthNames: [ "1月", "2月", "3月", "4月", "5月", "6月", + "7月", "8月", "9月", "10月", "11月", "12月" ], + monthNamesShort: [ "1月", "2月", "3月", "4月", "5月", "6月", + "7月", "8月", "9月", "10月", "11月", "12月" ], + dayNames: [ "日曜日", "月曜日", "火曜日", "水曜日", "木曜日", "金曜日", "土曜日" ], + dayNamesShort: [ "日", "月", "火", "水", "木", "金", "土" ], + dayNamesMin: [ "日", "月", "火", "水", "木", "金", "土" ], + weekHeader: "週", + dateFormat: "yy/mm/dd", + firstDay: 0, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: "年" }; +datepicker.setDefaults( datepicker.regional.ja ); + +return datepicker.regional.ja; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-ka.js b/include/thirdparty/jquery_ui/i18n/datepicker-ka.js new file mode 100644 index 0000000..d347de8 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-ka.js @@ -0,0 +1,51 @@ +/* Georgian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Lado Lomidze (lado.lomidze@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.ka = { + closeText: "დახურვა", + prevText: "წინა", + nextText: "შემდეგი ", + currentText: "დღეს", + monthNames: [ + "იანვარი", + "თებერვალი", + "მარტი", + "აპრილი", + "მაისი", + "ივნისი", + "ივლისი", + "აგვისტო", + "სექტემბერი", + "ოქტომბერი", + "ნოემბერი", + "დეკემბერი" + ], + monthNamesShort: [ "იან", "თებ", "მარ", "აპრ", "მაი", "ივნ", "ივლ", "აგვ", "სექ", "ოქტ", "ნოე", "დეკ" ], + dayNames: [ "კვირა", "ორშაბათი", "სამშაბათი", "ოთხშაბათი", "ხუთშაბათი", "პარასკევი", "შაბათი" ], + dayNamesShort: [ "კვ", "ორშ", "სამ", "ოთხ", "ხუთ", "პარ", "შაბ" ], + dayNamesMin: [ "კვ", "ორშ", "სამ", "ოთხ", "ხუთ", "პარ", "შაბ" ], + weekHeader: "კვირა", + dateFormat: "dd-mm-yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.ka ); + +return datepicker.regional.ka; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-kk.js b/include/thirdparty/jquery_ui/i18n/datepicker-kk.js new file mode 100644 index 0000000..20a8486 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-kk.js @@ -0,0 +1,40 @@ +/* Kazakh (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Dmitriy Karasyov (dmitriy.karasyov@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.kk = { + closeText: "Жабу", + prevText: "Алдыңғы", + nextText: "Келесі", + currentText: "Бүгін", + monthNames: [ "Қаңтар", "Ақпан", "Наурыз", "Сәуір", "Мамыр", "Маусым", + "Шілде", "Тамыз", "Қыркүйек", "Қазан", "Қараша", "Желтоқсан" ], + monthNamesShort: [ "Қаң", "Ақп", "Нау", "Сәу", "Мам", "Мау", + "Шіл", "Там", "Қыр", "Қаз", "Қар", "Жел" ], + dayNames: [ "Жексенбі", "Дүйсенбі", "Сейсенбі", "Сәрсенбі", "Бейсенбі", "Жұма", "Сенбі" ], + dayNamesShort: [ "жкс", "дсн", "ссн", "срс", "бсн", "жма", "снб" ], + dayNamesMin: [ "Жк", "Дс", "Сс", "Ср", "Бс", "Жм", "Сн" ], + weekHeader: "Не", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.kk ); + +return datepicker.regional.kk; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-km.js b/include/thirdparty/jquery_ui/i18n/datepicker-km.js new file mode 100644 index 0000000..ab3d89a --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-km.js @@ -0,0 +1,40 @@ +/* Khmer initialisation for the jQuery calendar extension. */ +/* Written by Chandara Om (chandara.teacher@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.km = { + closeText: "ធ្វើ​រួច", + prevText: "មុន", + nextText: "បន្ទាប់", + currentText: "ថ្ងៃ​នេះ", + monthNames: [ "មករា", "កុម្ភៈ", "មីនា", "មេសា", "ឧសភា", "មិថុនា", + "កក្កដា", "សីហា", "កញ្ញា", "តុលា", "វិច្ឆិកា", "ធ្នូ" ], + monthNamesShort: [ "មករា", "កុម្ភៈ", "មីនា", "មេសា", "ឧសភា", "មិថុនា", + "កក្កដា", "សីហា", "កញ្ញា", "តុលា", "វិច្ឆិកា", "ធ្នូ" ], + dayNames: [ "អាទិត្យ", "ចន្ទ", "អង្គារ", "ពុធ", "ព្រហស្បតិ៍", "សុក្រ", "សៅរ៍" ], + dayNamesShort: [ "អា", "ច", "អ", "ពុ", "ព្រហ", "សុ", "សៅ" ], + dayNamesMin: [ "អា", "ច", "អ", "ពុ", "ព្រហ", "សុ", "សៅ" ], + weekHeader: "សប្ដាហ៍", + dateFormat: "dd-mm-yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.km ); + +return datepicker.regional.km; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-ko.js b/include/thirdparty/jquery_ui/i18n/datepicker-ko.js new file mode 100644 index 0000000..deb1475 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-ko.js @@ -0,0 +1,40 @@ +/* Korean initialisation for the jQuery calendar extension. */ +/* Written by DaeKwon Kang (ncrash.dk@gmail.com), Edited by Genie and Myeongjin Lee. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.ko = { + closeText: "닫기", + prevText: "이전달", + nextText: "다음달", + currentText: "오늘", + monthNames: [ "1월", "2월", "3월", "4월", "5월", "6월", + "7월", "8월", "9월", "10월", "11월", "12월" ], + monthNamesShort: [ "1월", "2월", "3월", "4월", "5월", "6월", + "7월", "8월", "9월", "10월", "11월", "12월" ], + dayNames: [ "일요일", "월요일", "화요일", "수요일", "목요일", "금요일", "토요일" ], + dayNamesShort: [ "일", "월", "화", "수", "목", "금", "토" ], + dayNamesMin: [ "일", "월", "화", "수", "목", "금", "토" ], + weekHeader: "주", + dateFormat: "yy. m. d.", + firstDay: 0, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: "년" }; +datepicker.setDefaults( datepicker.regional.ko ); + +return datepicker.regional.ko; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-ky.js b/include/thirdparty/jquery_ui/i18n/datepicker-ky.js new file mode 100644 index 0000000..05dc5dd --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-ky.js @@ -0,0 +1,41 @@ +/* Kyrgyz (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Sergey Kartashov (ebishkek@yandex.ru). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.ky = { + closeText: "Жабуу", + prevText: "Мур", + nextText: "Кий", + currentText: "Бүгүн", + monthNames: [ "Январь", "Февраль", "Март", "Апрель", "Май", "Июнь", + "Июль", "Август", "Сентябрь", "Октябрь", "Ноябрь", "Декабрь" ], + monthNamesShort: [ "Янв", "Фев", "Мар", "Апр", "Май", "Июн", + "Июл", "Авг", "Сен", "Окт", "Ноя", "Дек" ], + dayNames: [ "жекшемби", "дүйшөмбү", "шейшемби", "шаршемби", "бейшемби", "жума", "ишемби" ], + dayNamesShort: [ "жек", "дүй", "шей", "шар", "бей", "жум", "ише" ], + dayNamesMin: [ "Жк", "Дш", "Шш", "Шр", "Бш", "Жм", "Иш" ], + weekHeader: "Жум", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" +}; +datepicker.setDefaults( datepicker.regional.ky ); + +return datepicker.regional.ky; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-lb.js b/include/thirdparty/jquery_ui/i18n/datepicker-lb.js new file mode 100644 index 0000000..936eb44 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-lb.js @@ -0,0 +1,48 @@ +/* Luxembourgish initialisation for the jQuery UI date picker plugin. */ +/* Written by Michel Weimerskirch */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.lb = { + closeText: "Fäerdeg", + prevText: "Zréck", + nextText: "Weider", + currentText: "Haut", + monthNames: [ "Januar", "Februar", "Mäerz", "Abrëll", "Mee", "Juni", + "Juli", "August", "September", "Oktober", "November", "Dezember" ], + monthNamesShort: [ "Jan", "Feb", "Mäe", "Abr", "Mee", "Jun", + "Jul", "Aug", "Sep", "Okt", "Nov", "Dez" ], + dayNames: [ + "Sonndeg", + "Méindeg", + "Dënschdeg", + "Mëttwoch", + "Donneschdeg", + "Freideg", + "Samschdeg" + ], + dayNamesShort: [ "Son", "Méi", "Dën", "Mët", "Don", "Fre", "Sam" ], + dayNamesMin: [ "So", "Mé", "Dë", "Më", "Do", "Fr", "Sa" ], + weekHeader: "W", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.lb ); + +return datepicker.regional.lb; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-lt.js b/include/thirdparty/jquery_ui/i18n/datepicker-lt.js new file mode 100644 index 0000000..5f45734 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-lt.js @@ -0,0 +1,48 @@ +/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* @author Arturas Paleicikas */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.lt = { + closeText: "Uždaryti", + prevText: "Atgal", + nextText: "Pirmyn", + currentText: "Šiandien", + monthNames: [ "Sausis", "Vasaris", "Kovas", "Balandis", "Gegužė", "Birželis", + "Liepa", "Rugpjūtis", "Rugsėjis", "Spalis", "Lapkritis", "Gruodis" ], + monthNamesShort: [ "Sau", "Vas", "Kov", "Bal", "Geg", "Bir", + "Lie", "Rugp", "Rugs", "Spa", "Lap", "Gru" ], + dayNames: [ + "sekmadienis", + "pirmadienis", + "antradienis", + "trečiadienis", + "ketvirtadienis", + "penktadienis", + "šeštadienis" + ], + dayNamesShort: [ "sek", "pir", "ant", "tre", "ket", "pen", "šeš" ], + dayNamesMin: [ "Se", "Pr", "An", "Tr", "Ke", "Pe", "Še" ], + weekHeader: "SAV", + dateFormat: "yy-mm-dd", + firstDay: 1, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.lt ); + +return datepicker.regional.lt; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-lv.js b/include/thirdparty/jquery_ui/i18n/datepicker-lv.js new file mode 100644 index 0000000..25d4a37 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-lv.js @@ -0,0 +1,48 @@ +/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* @author Arturas Paleicikas */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.lv = { + closeText: "Aizvērt", + prevText: "Iepr.", + nextText: "Nāk.", + currentText: "Šodien", + monthNames: [ "Janvāris", "Februāris", "Marts", "Aprīlis", "Maijs", "Jūnijs", + "Jūlijs", "Augusts", "Septembris", "Oktobris", "Novembris", "Decembris" ], + monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "Mai", "Jūn", + "Jūl", "Aug", "Sep", "Okt", "Nov", "Dec" ], + dayNames: [ + "svētdiena", + "pirmdiena", + "otrdiena", + "trešdiena", + "ceturtdiena", + "piektdiena", + "sestdiena" + ], + dayNamesShort: [ "svt", "prm", "otr", "tre", "ctr", "pkt", "sst" ], + dayNamesMin: [ "Sv", "Pr", "Ot", "Tr", "Ct", "Pk", "Ss" ], + weekHeader: "Ned.", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.lv ); + +return datepicker.regional.lv; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-mk.js b/include/thirdparty/jquery_ui/i18n/datepicker-mk.js new file mode 100644 index 0000000..6f430e9 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-mk.js @@ -0,0 +1,40 @@ +/* Macedonian i18n for the jQuery UI date picker plugin. */ +/* Written by Stojce Slavkovski. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.mk = { + closeText: "Затвори", + prevText: "Претходна", + nextText: "Следно", + currentText: "Денес", + monthNames: [ "Јануари", "Февруари", "Март", "Април", "Мај", "Јуни", + "Јули", "Август", "Септември", "Октомври", "Ноември", "Декември" ], + monthNamesShort: [ "Јан", "Фев", "Мар", "Апр", "Мај", "Јун", + "Јул", "Авг", "Сеп", "Окт", "Ное", "Дек" ], + dayNames: [ "Недела", "Понеделник", "Вторник", "Среда", "Четврток", "Петок", "Сабота" ], + dayNamesShort: [ "Нед", "Пон", "Вто", "Сре", "Чет", "Пет", "Саб" ], + dayNamesMin: [ "Не", "По", "Вт", "Ср", "Че", "Пе", "Са" ], + weekHeader: "Сед", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.mk ); + +return datepicker.regional.mk; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-ml.js b/include/thirdparty/jquery_ui/i18n/datepicker-ml.js new file mode 100644 index 0000000..b6223c8 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-ml.js @@ -0,0 +1,40 @@ +/* Malayalam (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Saji Nediyanchath (saji89@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.ml = { + closeText: "ശരി", + prevText: "മുന്നത്തെ", + nextText: "അടുത്തത് ", + currentText: "ഇന്ന്", + monthNames: [ "ജനുവരി", "ഫെബ്രുവരി", "മാര്‍ച്ച്", "ഏപ്രില്‍", "മേയ്", "ജൂണ്‍", + "ജൂലൈ", "ആഗസ്റ്റ്", "സെപ്റ്റംബര്‍", "ഒക്ടോബര്‍", "നവംബര്‍", "ഡിസംബര്‍" ], + monthNamesShort: [ "ജനു", "ഫെബ്", "മാര്‍", "ഏപ്രി", "മേയ്", "ജൂണ്‍", + "ജൂലാ", "ആഗ", "സെപ്", "ഒക്ടോ", "നവം", "ഡിസ" ], + dayNames: [ "ഞായര്‍", "തിങ്കള്‍", "ചൊവ്വ", "ബുധന്‍", "വ്യാഴം", "വെള്ളി", "ശനി" ], + dayNamesShort: [ "ഞായ", "തിങ്ക", "ചൊവ്വ", "ബുധ", "വ്യാഴം", "വെള്ളി", "ശനി" ], + dayNamesMin: [ "ഞാ", "തി", "ചൊ", "ബു", "വ്യാ", "വെ", "ശ" ], + weekHeader: "ആ", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.ml ); + +return datepicker.regional.ml; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-ms.js b/include/thirdparty/jquery_ui/i18n/datepicker-ms.js new file mode 100644 index 0000000..4170519 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-ms.js @@ -0,0 +1,40 @@ +/* Malaysian initialisation for the jQuery UI date picker plugin. */ +/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.ms = { + closeText: "Tutup", + prevText: "Sebelum", + nextText: "Selepas", + currentText: "hari ini", + monthNames: [ "Januari", "Februari", "Mac", "April", "Mei", "Jun", + "Julai", "Ogos", "September", "Oktober", "November", "Disember" ], + monthNamesShort: [ "Jan", "Feb", "Mac", "Apr", "Mei", "Jun", + "Jul", "Ogo", "Sep", "Okt", "Nov", "Dis" ], + dayNames: [ "Ahad", "Isnin", "Selasa", "Rabu", "Khamis", "Jumaat", "Sabtu" ], + dayNamesShort: [ "Aha", "Isn", "Sel", "Rab", "kha", "Jum", "Sab" ], + dayNamesMin: [ "Ah", "Is", "Se", "Ra", "Kh", "Ju", "Sa" ], + weekHeader: "Mg", + dateFormat: "dd/mm/yy", + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.ms ); + +return datepicker.regional.ms; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-nb.js b/include/thirdparty/jquery_ui/i18n/datepicker-nb.js new file mode 100644 index 0000000..19bb0bc --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-nb.js @@ -0,0 +1,52 @@ +/* Norwegian Bokmål initialisation for the jQuery UI date picker plugin. */ +/* Written by Bjørn Johansen (post@bjornjohansen.no). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.nb = { + closeText: "Lukk", + prevText: "Forrige", + nextText: "Neste", + currentText: "I dag", + monthNames: [ + "januar", + "februar", + "mars", + "april", + "mai", + "juni", + "juli", + "august", + "september", + "oktober", + "november", + "desember" + ], + monthNamesShort: [ "jan", "feb", "mar", "apr", "mai", "jun", "jul", "aug", "sep", "okt", "nov", "des" ], + dayNamesShort: [ "søn", "man", "tir", "ons", "tor", "fre", "lør" ], + dayNames: [ "søndag", "mandag", "tirsdag", "onsdag", "torsdag", "fredag", "lørdag" ], + dayNamesMin: [ "sø", "ma", "ti", "on", "to", "fr", "lø" ], + weekHeader: "Uke", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" +}; +datepicker.setDefaults( datepicker.regional.nb ); + +return datepicker.regional.nb; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-nl-BE.js b/include/thirdparty/jquery_ui/i18n/datepicker-nl-BE.js new file mode 100644 index 0000000..1b37288 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-nl-BE.js @@ -0,0 +1,40 @@ +/* Dutch (Belgium) initialisation for the jQuery UI date picker plugin. */ +/* David De Sloovere @DavidDeSloovere */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional[ "nl-BE" ] = { + closeText: "Sluiten", + prevText: "Vorig", + nextText: "Volgende", + currentText: "Vandaag", + monthNames: [ "januari", "februari", "maart", "april", "mei", "juni", + "juli", "augustus", "september", "oktober", "november", "december" ], + monthNamesShort: [ "jan", "feb", "mrt", "apr", "mei", "jun", + "jul", "aug", "sep", "okt", "nov", "dec" ], + dayNames: [ "zondag", "maandag", "dinsdag", "woensdag", "donderdag", "vrijdag", "zaterdag" ], + dayNamesShort: [ "zon", "maa", "din", "woe", "don", "vri", "zat" ], + dayNamesMin: [ "zo", "ma", "di", "wo", "do", "vr", "za" ], + weekHeader: "Wk", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional[ "nl-BE" ] ); + +return datepicker.regional[ "nl-BE" ]; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-nl.js b/include/thirdparty/jquery_ui/i18n/datepicker-nl.js new file mode 100644 index 0000000..6ac5d07 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-nl.js @@ -0,0 +1,40 @@ +/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Mathias Bynens */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.nl = { + closeText: "Sluiten", + prevText: "Vorig", + nextText: "Volgende", + currentText: "Vandaag", + monthNames: [ "januari", "februari", "maart", "april", "mei", "juni", + "juli", "augustus", "september", "oktober", "november", "december" ], + monthNamesShort: [ "jan", "feb", "mrt", "apr", "mei", "jun", + "jul", "aug", "sep", "okt", "nov", "dec" ], + dayNames: [ "zondag", "maandag", "dinsdag", "woensdag", "donderdag", "vrijdag", "zaterdag" ], + dayNamesShort: [ "zon", "maa", "din", "woe", "don", "vri", "zat" ], + dayNamesMin: [ "zo", "ma", "di", "wo", "do", "vr", "za" ], + weekHeader: "Wk", + dateFormat: "dd-mm-yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.nl ); + +return datepicker.regional.nl; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-nn.js b/include/thirdparty/jquery_ui/i18n/datepicker-nn.js new file mode 100644 index 0000000..5eccb4a --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-nn.js @@ -0,0 +1,52 @@ +/* Norwegian Nynorsk initialisation for the jQuery UI date picker plugin. */ +/* Written by Bjørn Johansen (post@bjornjohansen.no). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.nn = { + closeText: "Lukk", + prevText: "Førre", + nextText: "Neste", + currentText: "I dag", + monthNames: [ + "januar", + "februar", + "mars", + "april", + "mai", + "juni", + "juli", + "august", + "september", + "oktober", + "november", + "desember" + ], + monthNamesShort: [ "jan", "feb", "mar", "apr", "mai", "jun", "jul", "aug", "sep", "okt", "nov", "des" ], + dayNamesShort: [ "sun", "mån", "tys", "ons", "tor", "fre", "lau" ], + dayNames: [ "sundag", "måndag", "tysdag", "onsdag", "torsdag", "fredag", "laurdag" ], + dayNamesMin: [ "su", "må", "ty", "on", "to", "fr", "la" ], + weekHeader: "Veke", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" +}; +datepicker.setDefaults( datepicker.regional.nn ); + +return datepicker.regional.nn; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-no.js b/include/thirdparty/jquery_ui/i18n/datepicker-no.js new file mode 100644 index 0000000..becc8bf --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-no.js @@ -0,0 +1,53 @@ +/* Norwegian initialisation for the jQuery UI date picker plugin. */ +/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */ + +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.no = { + closeText: "Lukk", + prevText: "Forrige", + nextText: "Neste", + currentText: "I dag", + monthNames: [ + "januar", + "februar", + "mars", + "april", + "mai", + "juni", + "juli", + "august", + "september", + "oktober", + "november", + "desember" + ], + monthNamesShort: [ "jan", "feb", "mar", "apr", "mai", "jun", "jul", "aug", "sep", "okt", "nov", "des" ], + dayNamesShort: [ "søn", "man", "tir", "ons", "tor", "fre", "lør" ], + dayNames: [ "søndag", "mandag", "tirsdag", "onsdag", "torsdag", "fredag", "lørdag" ], + dayNamesMin: [ "sø", "ma", "ti", "on", "to", "fr", "lø" ], + weekHeader: "Uke", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" +}; +datepicker.setDefaults( datepicker.regional.no ); + +return datepicker.regional.no; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-pl.js b/include/thirdparty/jquery_ui/i18n/datepicker-pl.js new file mode 100644 index 0000000..4d31086 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-pl.js @@ -0,0 +1,40 @@ +/* Polish initialisation for the jQuery UI date picker plugin. */ +/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.pl = { + closeText: "Zamknij", + prevText: "Poprzedni", + nextText: "Następny", + currentText: "Dziś", + monthNames: [ "Styczeń", "Luty", "Marzec", "Kwiecień", "Maj", "Czerwiec", + "Lipiec", "Sierpień", "Wrzesień", "Październik", "Listopad", "Grudzień" ], + monthNamesShort: [ "Sty", "Lu", "Mar", "Kw", "Maj", "Cze", + "Lip", "Sie", "Wrz", "Pa", "Lis", "Gru" ], + dayNames: [ "Niedziela", "Poniedziałek", "Wtorek", "Środa", "Czwartek", "Piątek", "Sobota" ], + dayNamesShort: [ "Nie", "Pn", "Wt", "Śr", "Czw", "Pt", "So" ], + dayNamesMin: [ "N", "Pn", "Wt", "Śr", "Cz", "Pt", "So" ], + weekHeader: "Tydz", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.pl ); + +return datepicker.regional.pl; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-pt-BR.js b/include/thirdparty/jquery_ui/i18n/datepicker-pt-BR.js new file mode 100644 index 0000000..3c3984f --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-pt-BR.js @@ -0,0 +1,48 @@ +/* Brazilian initialisation for the jQuery UI date picker plugin. */ +/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional[ "pt-BR" ] = { + closeText: "Fechar", + prevText: "Anterior", + nextText: "Próximo", + currentText: "Hoje", + monthNames: [ "Janeiro", "Fevereiro", "Março", "Abril", "Maio", "Junho", + "Julho", "Agosto", "Setembro", "Outubro", "Novembro", "Dezembro" ], + monthNamesShort: [ "Jan", "Fev", "Mar", "Abr", "Mai", "Jun", + "Jul", "Ago", "Set", "Out", "Nov", "Dez" ], + dayNames: [ + "Domingo", + "Segunda-feira", + "Terça-feira", + "Quarta-feira", + "Quinta-feira", + "Sexta-feira", + "Sábado" + ], + dayNamesShort: [ "Dom", "Seg", "Ter", "Qua", "Qui", "Sex", "Sáb" ], + dayNamesMin: [ "Dom", "Seg", "Ter", "Qua", "Qui", "Sex", "Sáb" ], + weekHeader: "Sm", + dateFormat: "dd/mm/yy", + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional[ "pt-BR" ] ); + +return datepicker.regional[ "pt-BR" ]; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-pt.js b/include/thirdparty/jquery_ui/i18n/datepicker-pt.js new file mode 100644 index 0000000..3112cb4 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-pt.js @@ -0,0 +1,47 @@ +/* Portuguese initialisation for the jQuery UI date picker plugin. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.pt = { + closeText: "Fechar", + prevText: "Anterior", + nextText: "Seguinte", + currentText: "Hoje", + monthNames: [ "Janeiro", "Fevereiro", "Março", "Abril", "Maio", "Junho", + "Julho", "Agosto", "Setembro", "Outubro", "Novembro", "Dezembro" ], + monthNamesShort: [ "Jan", "Fev", "Mar", "Abr", "Mai", "Jun", + "Jul", "Ago", "Set", "Out", "Nov", "Dez" ], + dayNames: [ + "Domingo", + "Segunda-feira", + "Terça-feira", + "Quarta-feira", + "Quinta-feira", + "Sexta-feira", + "Sábado" + ], + dayNamesShort: [ "Dom", "Seg", "Ter", "Qua", "Qui", "Sex", "Sáb" ], + dayNamesMin: [ "Dom", "Seg", "Ter", "Qua", "Qui", "Sex", "Sáb" ], + weekHeader: "Sem", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.pt ); + +return datepicker.regional.pt; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-rm.js b/include/thirdparty/jquery_ui/i18n/datepicker-rm.js new file mode 100644 index 0000000..4f150c5 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-rm.js @@ -0,0 +1,64 @@ +/* Romansh initialisation for the jQuery UI date picker plugin. */ +/* Written by Yvonne Gienal (yvonne.gienal@educa.ch). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.rm = { + closeText: "Serrar", + prevText: "Suandant", + nextText: "Precedent", + currentText: "Actual", + monthNames: [ + "Schaner", + "Favrer", + "Mars", + "Avrigl", + "Matg", + "Zercladur", + "Fanadur", + "Avust", + "Settember", + "October", + "November", + "December" + ], + monthNamesShort: [ + "Scha", + "Fev", + "Mar", + "Avr", + "Matg", + "Zer", + "Fan", + "Avu", + "Sett", + "Oct", + "Nov", + "Dec" + ], + dayNames: [ "Dumengia", "Glindesdi", "Mardi", "Mesemna", "Gievgia", "Venderdi", "Sonda" ], + dayNamesShort: [ "Dum", "Gli", "Mar", "Mes", "Gie", "Ven", "Som" ], + dayNamesMin: [ "Du", "Gl", "Ma", "Me", "Gi", "Ve", "So" ], + weekHeader: "emna", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.rm ); + +return datepicker.regional.rm; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-ro.js b/include/thirdparty/jquery_ui/i18n/datepicker-ro.js new file mode 100644 index 0000000..60f56ae --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-ro.js @@ -0,0 +1,43 @@ +/* Romanian initialisation for the jQuery UI date picker plugin. + * + * Written by Edmond L. (ll_edmond@walla.com) + * and Ionut G. Stan (ionut.g.stan@gmail.com) + */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.ro = { + closeText: "Închide", + prevText: "Luna precedentă", + nextText: "Luna următoare ", + currentText: "Azi", + monthNames: [ "Ianuarie", "Februarie", "Martie", "Aprilie", "Mai", "Iunie", + "Iulie", "August", "Septembrie", "Octombrie", "Noiembrie", "Decembrie" ], + monthNamesShort: [ "Ian", "Feb", "Mar", "Apr", "Mai", "Iun", + "Iul", "Aug", "Sep", "Oct", "Nov", "Dec" ], + dayNames: [ "Duminică", "Luni", "Marţi", "Miercuri", "Joi", "Vineri", "Sâmbătă" ], + dayNamesShort: [ "Dum", "Lun", "Mar", "Mie", "Joi", "Vin", "Sâm" ], + dayNamesMin: [ "Du", "Lu", "Ma", "Mi", "Jo", "Vi", "Sâ" ], + weekHeader: "Săpt", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.ro ); + +return datepicker.regional.ro; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-ru.js b/include/thirdparty/jquery_ui/i18n/datepicker-ru.js new file mode 100644 index 0000000..5a8b3b7 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-ru.js @@ -0,0 +1,40 @@ +/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Andrew Stromnov (stromnov@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.ru = { + closeText: "Закрыть", + prevText: "Пред", + nextText: "След", + currentText: "Сегодня", + monthNames: [ "Январь", "Февраль", "Март", "Апрель", "Май", "Июнь", + "Июль", "Август", "Сентябрь", "Октябрь", "Ноябрь", "Декабрь" ], + monthNamesShort: [ "Янв", "Фев", "Мар", "Апр", "Май", "Июн", + "Июл", "Авг", "Сен", "Окт", "Ноя", "Дек" ], + dayNames: [ "воскресенье", "понедельник", "вторник", "среда", "четверг", "пятница", "суббота" ], + dayNamesShort: [ "вск", "пнд", "втр", "срд", "чтв", "птн", "сбт" ], + dayNamesMin: [ "Вс", "Пн", "Вт", "Ср", "Чт", "Пт", "Сб" ], + weekHeader: "Нед", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.ru ); + +return datepicker.regional.ru; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-sk.js b/include/thirdparty/jquery_ui/i18n/datepicker-sk.js new file mode 100644 index 0000000..826dfcb --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-sk.js @@ -0,0 +1,40 @@ +/* Slovak initialisation for the jQuery UI date picker plugin. */ +/* Written by Vojtech Rinik (vojto@hmm.sk). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.sk = { + closeText: "Zavrieť", + prevText: "Predchádzajúci", + nextText: "Nasledujúci", + currentText: "Dnes", + monthNames: [ "január", "február", "marec", "apríl", "máj", "jún", + "júl", "august", "september", "október", "november", "december" ], + monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "Máj", "Jún", + "Júl", "Aug", "Sep", "Okt", "Nov", "Dec" ], + dayNames: [ "nedeľa", "pondelok", "utorok", "streda", "štvrtok", "piatok", "sobota" ], + dayNamesShort: [ "Ned", "Pon", "Uto", "Str", "Štv", "Pia", "Sob" ], + dayNamesMin: [ "Ne", "Po", "Ut", "St", "Št", "Pia", "So" ], + weekHeader: "Ty", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.sk ); + +return datepicker.regional.sk; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-sl.js b/include/thirdparty/jquery_ui/i18n/datepicker-sl.js new file mode 100644 index 0000000..4b329e2 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-sl.js @@ -0,0 +1,41 @@ +/* Slovenian initialisation for the jQuery UI date picker plugin. */ +/* Written by Jaka Jancar (jaka@kubje.org). */ +/* c = č, s = š z = ž C = Č S = Š Z = Ž */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.sl = { + closeText: "Zapri", + prevText: "Prejšnji", + nextText: "Naslednji", + currentText: "Trenutni", + monthNames: [ "Januar", "Februar", "Marec", "April", "Maj", "Junij", + "Julij", "Avgust", "September", "Oktober", "November", "December" ], + monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "Maj", "Jun", + "Jul", "Avg", "Sep", "Okt", "Nov", "Dec" ], + dayNames: [ "Nedelja", "Ponedeljek", "Torek", "Sreda", "Četrtek", "Petek", "Sobota" ], + dayNamesShort: [ "Ned", "Pon", "Tor", "Sre", "Čet", "Pet", "Sob" ], + dayNamesMin: [ "Ne", "Po", "To", "Sr", "Če", "Pe", "So" ], + weekHeader: "Teden", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.sl ); + +return datepicker.regional.sl; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-sq.js b/include/thirdparty/jquery_ui/i18n/datepicker-sq.js new file mode 100644 index 0000000..9952fb1 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-sq.js @@ -0,0 +1,40 @@ +/* Albanian initialisation for the jQuery UI date picker plugin. */ +/* Written by Flakron Bytyqi (flakron@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.sq = { + closeText: "mbylle", + prevText: "mbrapa", + nextText: "Përpara", + currentText: "sot", + monthNames: [ "Janar", "Shkurt", "Mars", "Prill", "Maj", "Qershor", + "Korrik", "Gusht", "Shtator", "Tetor", "Nëntor", "Dhjetor" ], + monthNamesShort: [ "Jan", "Shk", "Mar", "Pri", "Maj", "Qer", + "Kor", "Gus", "Sht", "Tet", "Nën", "Dhj" ], + dayNames: [ "E Diel", "E Hënë", "E Martë", "E Mërkurë", "E Enjte", "E Premte", "E Shtune" ], + dayNamesShort: [ "Di", "Hë", "Ma", "Më", "En", "Pr", "Sh" ], + dayNamesMin: [ "Di", "Hë", "Ma", "Më", "En", "Pr", "Sh" ], + weekHeader: "Ja", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.sq ); + +return datepicker.regional.sq; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-sr-SR.js b/include/thirdparty/jquery_ui/i18n/datepicker-sr-SR.js new file mode 100644 index 0000000..b28ceed --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-sr-SR.js @@ -0,0 +1,40 @@ +/* Serbian i18n for the jQuery UI date picker plugin. */ +/* Written by Dejan Dimić. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional[ "sr-SR" ] = { + closeText: "Zatvori", + prevText: "Prethodno", + nextText: "Sljedeći", + currentText: "Danas", + monthNames: [ "Januar", "Februar", "Mart", "April", "Maj", "Jun", + "Jul", "Avgust", "Septembar", "Oktobar", "Novembar", "Decembar" ], + monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "Maj", "Jun", + "Jul", "Avg", "Sep", "Okt", "Nov", "Dec" ], + dayNames: [ "Nedelja", "Ponedeljak", "Utorak", "Sreda", "Četvrtak", "Petak", "Subota" ], + dayNamesShort: [ "Ned", "Pon", "Uto", "Sre", "Čet", "Pet", "Sub" ], + dayNamesMin: [ "Ne", "Po", "Ut", "Sr", "Če", "Pe", "Su" ], + weekHeader: "Sed", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional[ "sr-SR" ] ); + +return datepicker.regional[ "sr-SR" ]; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-sr.js b/include/thirdparty/jquery_ui/i18n/datepicker-sr.js new file mode 100644 index 0000000..8b04d9b --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-sr.js @@ -0,0 +1,40 @@ +/* Serbian i18n for the jQuery UI date picker plugin. */ +/* Written by Dejan Dimić. */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.sr = { + closeText: "Затвори", + prevText: "Претходна", + nextText: "Следећи", + currentText: "Данас", + monthNames: [ "Јануар", "Фебруар", "Март", "Април", "Мај", "Јун", + "Јул", "Август", "Септембар", "Октобар", "Новембар", "Децембар" ], + monthNamesShort: [ "Јан", "Феб", "Мар", "Апр", "Мај", "Јун", + "Јул", "Авг", "Сеп", "Окт", "Нов", "Дец" ], + dayNames: [ "Недеља", "Понедељак", "Уторак", "Среда", "Четвртак", "Петак", "Субота" ], + dayNamesShort: [ "Нед", "Пон", "Уто", "Сре", "Чет", "Пет", "Суб" ], + dayNamesMin: [ "Не", "По", "Ут", "Ср", "Че", "Пе", "Су" ], + weekHeader: "Сед", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.sr ); + +return datepicker.regional.sr; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-sv.js b/include/thirdparty/jquery_ui/i18n/datepicker-sv.js new file mode 100644 index 0000000..ee9296e --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-sv.js @@ -0,0 +1,40 @@ +/* Swedish initialisation for the jQuery UI date picker plugin. */ +/* Written by Anders Ekdahl ( anders@nomadiz.se). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.sv = { + closeText: "Stäng", + prevText: "Förra", + nextText: "Nästa", + currentText: "Idag", + monthNames: [ "januari", "februari", "mars", "april", "maj", "juni", + "juli", "augusti", "september", "oktober", "november", "december" ], + monthNamesShort: [ "jan.", "feb.", "mars", "apr.", "maj", "juni", + "juli", "aug.", "sep.", "okt.", "nov.", "dec." ], + dayNamesShort: [ "sön", "mån", "tis", "ons", "tor", "fre", "lör" ], + dayNames: [ "söndag", "måndag", "tisdag", "onsdag", "torsdag", "fredag", "lördag" ], + dayNamesMin: [ "sö", "må", "ti", "on", "to", "fr", "lö" ], + weekHeader: "Ve", + dateFormat: "yy-mm-dd", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.sv ); + +return datepicker.regional.sv; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-ta.js b/include/thirdparty/jquery_ui/i18n/datepicker-ta.js new file mode 100644 index 0000000..730c5df --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-ta.js @@ -0,0 +1,56 @@ +/* Tamil (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by S A Sureshkumar (saskumar@live.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.ta = { + closeText: "மூடு", + prevText: "முன்னையது", + nextText: "அடுத்தது", + currentText: "இன்று", + monthNames: [ "தை", "மாசி", "பங்குனி", "சித்திரை", "வைகாசி", "ஆனி", + "ஆடி", "ஆவணி", "புரட்டாசி", "ஐப்பசி", "கார்த்திகை", "மார்கழி" ], + monthNamesShort: [ "தை", "மாசி", "பங்", "சித்", "வைகா", "ஆனி", + "ஆடி", "ஆவ", "புர", "ஐப்", "கார்", "மார்" ], + dayNames: [ + "ஞாயிற்றுக்கிழமை", + "திங்கட்கிழமை", + "செவ்வாய்க்கிழமை", + "புதன்கிழமை", + "வியாழக்கிழமை", + "வெள்ளிக்கிழமை", + "சனிக்கிழமை" + ], + dayNamesShort: [ + "ஞாயிறு", + "திங்கள்", + "செவ்வாய்", + "புதன்", + "வியாழன்", + "வெள்ளி", + "சனி" + ], + dayNamesMin: [ "ஞா", "தி", "செ", "பு", "வி", "வெ", "ச" ], + weekHeader: "Не", + dateFormat: "dd/mm/yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.ta ); + +return datepicker.regional.ta; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-th.js b/include/thirdparty/jquery_ui/i18n/datepicker-th.js new file mode 100644 index 0000000..41cef52 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-th.js @@ -0,0 +1,40 @@ +/* Thai initialisation for the jQuery UI date picker plugin. */ +/* Written by pipo (pipo@sixhead.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.th = { + closeText: "ปิด", + prevText: "ย้อน", + nextText: "ถัดไป", + currentText: "วันนี้", + monthNames: [ "มกราคม", "กุมภาพันธ์", "มีนาคม", "เมษายน", "พฤษภาคม", "มิถุนายน", + "กรกฎาคม", "สิงหาคม", "กันยายน", "ตุลาคม", "พฤศจิกายน", "ธันวาคม" ], + monthNamesShort: [ "ม.ค.", "ก.พ.", "มี.ค.", "เม.ย.", "พ.ค.", "มิ.ย.", + "ก.ค.", "ส.ค.", "ก.ย.", "ต.ค.", "พ.ย.", "ธ.ค." ], + dayNames: [ "อาทิตย์", "จันทร์", "อังคาร", "พุธ", "พฤหัสบดี", "ศุกร์", "เสาร์" ], + dayNamesShort: [ "อา.", "จ.", "อ.", "พ.", "พฤ.", "ศ.", "ส." ], + dayNamesMin: [ "อา.", "จ.", "อ.", "พ.", "พฤ.", "ศ.", "ส." ], + weekHeader: "Wk", + dateFormat: "dd/mm/yy", + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.th ); + +return datepicker.regional.th; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-tj.js b/include/thirdparty/jquery_ui/i18n/datepicker-tj.js new file mode 100644 index 0000000..a3669da --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-tj.js @@ -0,0 +1,40 @@ +/* Tajiki (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Abdurahmon Saidov (saidovab@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.tj = { + closeText: "Идома", + prevText: "Қафо", + nextText: "Пеш", + currentText: "Имрӯз", + monthNames: [ "Январ", "Феврал", "Март", "Апрел", "Май", "Июн", + "Июл", "Август", "Сентябр", "Октябр", "Ноябр", "Декабр" ], + monthNamesShort: [ "Янв", "Фев", "Мар", "Апр", "Май", "Июн", + "Июл", "Авг", "Сен", "Окт", "Ноя", "Дек" ], + dayNames: [ "якшанбе", "душанбе", "сешанбе", "чоршанбе", "панҷшанбе", "ҷумъа", "шанбе" ], + dayNamesShort: [ "якш", "душ", "сеш", "чор", "пан", "ҷум", "шан" ], + dayNamesMin: [ "Як", "Дш", "Сш", "Чш", "Пш", "Ҷм", "Шн" ], + weekHeader: "Хф", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.tj ); + +return datepicker.regional.tj; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-tr.js b/include/thirdparty/jquery_ui/i18n/datepicker-tr.js new file mode 100644 index 0000000..32eb3ed --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-tr.js @@ -0,0 +1,40 @@ +/* Turkish initialisation for the jQuery UI date picker plugin. */ +/* Written by Izzet Emre Erkan (kara@karalamalar.net). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.tr = { + closeText: "kapat", + prevText: "geri", + nextText: "ileri", + currentText: "bugün", + monthNames: [ "Ocak", "Şubat", "Mart", "Nisan", "Mayıs", "Haziran", + "Temmuz", "Ağustos", "Eylül", "Ekim", "Kasım", "Aralık" ], + monthNamesShort: [ "Oca", "Şub", "Mar", "Nis", "May", "Haz", + "Tem", "Ağu", "Eyl", "Eki", "Kas", "Ara" ], + dayNames: [ "Pazar", "Pazartesi", "Salı", "Çarşamba", "Perşembe", "Cuma", "Cumartesi" ], + dayNamesShort: [ "Pz", "Pt", "Sa", "Ça", "Pe", "Cu", "Ct" ], + dayNamesMin: [ "Pz", "Pt", "Sa", "Ça", "Pe", "Cu", "Ct" ], + weekHeader: "Hf", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.tr ); + +return datepicker.regional.tr; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-uk.js b/include/thirdparty/jquery_ui/i18n/datepicker-uk.js new file mode 100644 index 0000000..c273fd6 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-uk.js @@ -0,0 +1,41 @@ +/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */ +/* Corrected by Igor Milla (igor.fsp.milla@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.uk = { + closeText: "Закрити", + prevText: "Попередній", + nextText: "найближчий", + currentText: "Сьогодні", + monthNames: [ "Січень", "Лютий", "Березень", "Квітень", "Травень", "Червень", + "Липень", "Серпень", "Вересень", "Жовтень", "Листопад", "Грудень" ], + monthNamesShort: [ "Січ", "Лют", "Бер", "Кві", "Тра", "Чер", + "Лип", "Сер", "Вер", "Жов", "Лис", "Гру" ], + dayNames: [ "неділя", "понеділок", "вівторок", "середа", "четвер", "п’ятниця", "субота" ], + dayNamesShort: [ "нед", "пнд", "вів", "срд", "чтв", "птн", "сбт" ], + dayNamesMin: [ "Нд", "Пн", "Вт", "Ср", "Чт", "Пт", "Сб" ], + weekHeader: "Тиж", + dateFormat: "dd.mm.yy", + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.uk ); + +return datepicker.regional.uk; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-vi.js b/include/thirdparty/jquery_ui/i18n/datepicker-vi.js new file mode 100644 index 0000000..8664c4f --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-vi.js @@ -0,0 +1,40 @@ +/* Vietnamese initialisation for the jQuery UI date picker plugin. */ +/* Translated by Le Thanh Huy (lthanhhuy@cit.ctu.edu.vn). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional.vi = { + closeText: "Đóng", + prevText: "Trước", + nextText: "Tiếp", + currentText: "Hôm nay", + monthNames: [ "Tháng Một", "Tháng Hai", "Tháng Ba", "Tháng Tư", "Tháng Năm", "Tháng Sáu", + "Tháng Bảy", "Tháng Tám", "Tháng Chín", "Tháng Mười", "Tháng Mười Một", "Tháng Mười Hai" ], + monthNamesShort: [ "Tháng 1", "Tháng 2", "Tháng 3", "Tháng 4", "Tháng 5", "Tháng 6", + "Tháng 7", "Tháng 8", "Tháng 9", "Tháng 10", "Tháng 11", "Tháng 12" ], + dayNames: [ "Chủ Nhật", "Thứ Hai", "Thứ Ba", "Thứ Tư", "Thứ Năm", "Thứ Sáu", "Thứ Bảy" ], + dayNamesShort: [ "CN", "T2", "T3", "T4", "T5", "T6", "T7" ], + dayNamesMin: [ "CN", "T2", "T3", "T4", "T5", "T6", "T7" ], + weekHeader: "Tu", + dateFormat: "dd/mm/yy", + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: "" }; +datepicker.setDefaults( datepicker.regional.vi ); + +return datepicker.regional.vi; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-zh-CN.js b/include/thirdparty/jquery_ui/i18n/datepicker-zh-CN.js new file mode 100644 index 0000000..a00553e --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-zh-CN.js @@ -0,0 +1,40 @@ +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by Cloudream (cloudream@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional[ "zh-CN" ] = { + closeText: "关闭", + prevText: "上月", + nextText: "下月", + currentText: "今天", + monthNames: [ "一月", "二月", "三月", "四月", "五月", "六月", + "七月", "八月", "九月", "十月", "十一月", "十二月" ], + monthNamesShort: [ "一月", "二月", "三月", "四月", "五月", "六月", + "七月", "八月", "九月", "十月", "十一月", "十二月" ], + dayNames: [ "星期日", "星期一", "星期二", "星期三", "星期四", "星期五", "星期六" ], + dayNamesShort: [ "周日", "周一", "周二", "周三", "周四", "周五", "周六" ], + dayNamesMin: [ "日", "一", "二", "三", "四", "五", "六" ], + weekHeader: "周", + dateFormat: "yy-mm-dd", + firstDay: 1, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: "年" }; +datepicker.setDefaults( datepicker.regional[ "zh-CN" ] ); + +return datepicker.regional[ "zh-CN" ]; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-zh-HK.js b/include/thirdparty/jquery_ui/i18n/datepicker-zh-HK.js new file mode 100644 index 0000000..e61bf66 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-zh-HK.js @@ -0,0 +1,40 @@ +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by SCCY (samuelcychan@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional[ "zh-HK" ] = { + closeText: "關閉", + prevText: "上月", + nextText: "下月", + currentText: "今天", + monthNames: [ "一月", "二月", "三月", "四月", "五月", "六月", + "七月", "八月", "九月", "十月", "十一月", "十二月" ], + monthNamesShort: [ "一月", "二月", "三月", "四月", "五月", "六月", + "七月", "八月", "九月", "十月", "十一月", "十二月" ], + dayNames: [ "星期日", "星期一", "星期二", "星期三", "星期四", "星期五", "星期六" ], + dayNamesShort: [ "周日", "周一", "周二", "周三", "周四", "周五", "周六" ], + dayNamesMin: [ "日", "一", "二", "三", "四", "五", "六" ], + weekHeader: "周", + dateFormat: "dd-mm-yy", + firstDay: 0, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: "年" }; +datepicker.setDefaults( datepicker.regional[ "zh-HK" ] ); + +return datepicker.regional[ "zh-HK" ]; + +} ); diff --git a/include/thirdparty/jquery_ui/i18n/datepicker-zh-TW.js b/include/thirdparty/jquery_ui/i18n/datepicker-zh-TW.js new file mode 100644 index 0000000..f5e02a6 --- /dev/null +++ b/include/thirdparty/jquery_ui/i18n/datepicker-zh-TW.js @@ -0,0 +1,40 @@ +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by Ressol (ressol@gmail.com). */ +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "../widgets/datepicker" ], factory ); + } else { + + // Browser globals + factory( jQuery.datepicker ); + } +} )( function( datepicker ) { +"use strict"; + +datepicker.regional[ "zh-TW" ] = { + closeText: "關閉", + prevText: "上個月", + nextText: "下個月", + currentText: "今天", + monthNames: [ "一月", "二月", "三月", "四月", "五月", "六月", + "七月", "八月", "九月", "十月", "十一月", "十二月" ], + monthNamesShort: [ "一月", "二月", "三月", "四月", "五月", "六月", + "七月", "八月", "九月", "十月", "十一月", "十二月" ], + dayNames: [ "星期日", "星期一", "星期二", "星期三", "星期四", "星期五", "星期六" ], + dayNamesShort: [ "週日", "週一", "週二", "週三", "週四", "週五", "週六" ], + dayNamesMin: [ "日", "一", "二", "三", "四", "五", "六" ], + weekHeader: "週", + dateFormat: "yy/mm/dd", + firstDay: 1, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: "年" }; +datepicker.setDefaults( datepicker.regional[ "zh-TW" ] ); + +return datepicker.regional[ "zh-TW" ]; + +} ); diff --git a/include/thirdparty/jquery_ui/ie.js b/include/thirdparty/jquery_ui/ie.js deleted file mode 100644 index 1754b94..0000000 --- a/include/thirdparty/jquery_ui/ie.js +++ /dev/null @@ -1,18 +0,0 @@ -( function( factory ) { - "use strict"; - - if ( typeof define === "function" && define.amd ) { - - // AMD. Register as an anonymous module. - define( [ "jquery", "./version" ], factory ); - } else { - - // Browser globals - factory( jQuery ); - } -} )( function( $ ) { -"use strict"; - -// This file is deprecated -return $.ui.ie = !!/msie [\w.]+/.exec( navigator.userAgent.toLowerCase() ); -} ); diff --git a/include/thirdparty/jquery_ui/images/ui-bg_diagonals-thick_18_b81900_40x40.png b/include/thirdparty/jquery_ui/images/ui-bg_diagonals-thick_18_b81900_40x40.png deleted file mode 100644 index ed79373..0000000 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_diagonals-thick_18_b81900_40x40.png and /dev/null differ diff --git a/include/thirdparty/jquery_ui/images/ui-bg_diagonals-thick_20_666666_40x40.png b/include/thirdparty/jquery_ui/images/ui-bg_diagonals-thick_20_666666_40x40.png deleted file mode 100644 index 337d9ed..0000000 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_diagonals-thick_20_666666_40x40.png and /dev/null differ diff --git a/include/thirdparty/jquery_ui/images/ui-bg_flat_0_aaaaaa_40x100.png b/include/thirdparty/jquery_ui/images/ui-bg_flat_0_aaaaaa_40x100.png deleted file mode 100644 index 2991f73..0000000 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_flat_0_aaaaaa_40x100.png and /dev/null differ diff --git a/include/thirdparty/jquery_ui/images/ui-bg_flat_10_000000_40x100.png b/include/thirdparty/jquery_ui/images/ui-bg_flat_10_000000_40x100.png deleted file mode 100644 index 2fd24e2..0000000 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_flat_10_000000_40x100.png and /dev/null differ diff --git a/include/thirdparty/jquery_ui/images/ui-bg_flat_75_ffffff_40x100.png b/include/thirdparty/jquery_ui/images/ui-bg_flat_75_ffffff_40x100.png deleted file mode 100644 index eacaf60..0000000 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_flat_75_ffffff_40x100.png and /dev/null differ diff --git a/include/thirdparty/jquery_ui/images/ui-bg_glass_100_f6f6f6_1x400.png b/include/thirdparty/jquery_ui/images/ui-bg_glass_100_f6f6f6_1x400.png deleted file mode 100644 index 0fccfbc..0000000 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_glass_100_f6f6f6_1x400.png and /dev/null differ diff --git a/include/thirdparty/jquery_ui/images/ui-bg_glass_100_fdf5ce_1x400.png b/include/thirdparty/jquery_ui/images/ui-bg_glass_100_fdf5ce_1x400.png deleted file mode 100644 index d789996..0000000 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_glass_100_fdf5ce_1x400.png and /dev/null differ diff --git a/include/thirdparty/jquery_ui/images/ui-bg_glass_55_fbf9ee_1x400.png b/include/thirdparty/jquery_ui/images/ui-bg_glass_55_fbf9ee_1x400.png index d1a47ab..18086c6 100644 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_glass_55_fbf9ee_1x400.png and b/include/thirdparty/jquery_ui/images/ui-bg_glass_55_fbf9ee_1x400.png differ diff --git a/include/thirdparty/jquery_ui/images/ui-bg_glass_65_ffffff_1x400.png b/include/thirdparty/jquery_ui/images/ui-bg_glass_65_ffffff_1x400.png index 32e6d9f..4626336 100644 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_glass_65_ffffff_1x400.png and b/include/thirdparty/jquery_ui/images/ui-bg_glass_65_ffffff_1x400.png differ diff --git a/include/thirdparty/jquery_ui/images/ui-bg_glass_75_dadada_1x400.png b/include/thirdparty/jquery_ui/images/ui-bg_glass_75_dadada_1x400.png index cf2040a..b3cd30c 100644 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_glass_75_dadada_1x400.png and b/include/thirdparty/jquery_ui/images/ui-bg_glass_75_dadada_1x400.png differ diff --git a/include/thirdparty/jquery_ui/images/ui-bg_glass_75_e6e6e6_1x400.png b/include/thirdparty/jquery_ui/images/ui-bg_glass_75_e6e6e6_1x400.png index 584006c..e877dc8 100644 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_glass_75_e6e6e6_1x400.png and b/include/thirdparty/jquery_ui/images/ui-bg_glass_75_e6e6e6_1x400.png differ diff --git a/include/thirdparty/jquery_ui/images/ui-bg_glass_95_fef1ec_1x400.png b/include/thirdparty/jquery_ui/images/ui-bg_glass_95_fef1ec_1x400.png index 7e9cfd0..fde61a5 100644 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_glass_95_fef1ec_1x400.png and b/include/thirdparty/jquery_ui/images/ui-bg_glass_95_fef1ec_1x400.png differ diff --git a/include/thirdparty/jquery_ui/images/ui-bg_gloss-wave_35_f6a828_500x100.png b/include/thirdparty/jquery_ui/images/ui-bg_gloss-wave_35_f6a828_500x100.png deleted file mode 100644 index 06a7321..0000000 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_gloss-wave_35_f6a828_500x100.png and /dev/null differ diff --git a/include/thirdparty/jquery_ui/images/ui-bg_highlight-soft_100_eeeeee_1x100.png b/include/thirdparty/jquery_ui/images/ui-bg_highlight-soft_100_eeeeee_1x100.png deleted file mode 100644 index 2561545..0000000 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_highlight-soft_100_eeeeee_1x100.png and /dev/null differ diff --git a/include/thirdparty/jquery_ui/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/include/thirdparty/jquery_ui/images/ui-bg_highlight-soft_75_cccccc_1x100.png index a73cde6..f1783a3 100644 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_highlight-soft_75_cccccc_1x100.png and b/include/thirdparty/jquery_ui/images/ui-bg_highlight-soft_75_cccccc_1x100.png differ diff --git a/include/thirdparty/jquery_ui/images/ui-bg_highlight-soft_75_ffe45c_1x100.png b/include/thirdparty/jquery_ui/images/ui-bg_highlight-soft_75_ffe45c_1x100.png deleted file mode 100644 index 367be20..0000000 Binary files a/include/thirdparty/jquery_ui/images/ui-bg_highlight-soft_75_ffe45c_1x100.png and /dev/null differ diff --git a/include/thirdparty/jquery_ui/images/ui-icons_222222_256x240.png b/include/thirdparty/jquery_ui/images/ui-icons_222222_256x240.png index 89793a8..d7e5cbe 100644 Binary files a/include/thirdparty/jquery_ui/images/ui-icons_222222_256x240.png and b/include/thirdparty/jquery_ui/images/ui-icons_222222_256x240.png differ diff --git a/include/thirdparty/jquery_ui/images/ui-icons_228ef1_256x240.png b/include/thirdparty/jquery_ui/images/ui-icons_228ef1_256x240.png deleted file mode 100644 index 0c554ac..0000000 Binary files a/include/thirdparty/jquery_ui/images/ui-icons_228ef1_256x240.png and /dev/null differ diff --git a/include/thirdparty/jquery_ui/images/ui-icons_2e83ff_256x240.png b/include/thirdparty/jquery_ui/images/ui-icons_2e83ff_256x240.png index 4f47a15..33a0df7 100644 Binary files a/include/thirdparty/jquery_ui/images/ui-icons_2e83ff_256x240.png and b/include/thirdparty/jquery_ui/images/ui-icons_2e83ff_256x240.png differ diff --git a/include/thirdparty/jquery_ui/images/ui-icons_454545_256x240.png b/include/thirdparty/jquery_ui/images/ui-icons_454545_256x240.png index bf0e4b1..f640dc3 100644 Binary files a/include/thirdparty/jquery_ui/images/ui-icons_454545_256x240.png and b/include/thirdparty/jquery_ui/images/ui-icons_454545_256x240.png differ diff --git a/include/thirdparty/jquery_ui/images/ui-icons_888888_256x240.png b/include/thirdparty/jquery_ui/images/ui-icons_888888_256x240.png index 28b9644..bad245b 100644 Binary files a/include/thirdparty/jquery_ui/images/ui-icons_888888_256x240.png and b/include/thirdparty/jquery_ui/images/ui-icons_888888_256x240.png differ diff --git a/include/thirdparty/jquery_ui/images/ui-icons_cd0a0a_256x240.png b/include/thirdparty/jquery_ui/images/ui-icons_cd0a0a_256x240.png index 8623f32..854f7b7 100644 Binary files a/include/thirdparty/jquery_ui/images/ui-icons_cd0a0a_256x240.png and b/include/thirdparty/jquery_ui/images/ui-icons_cd0a0a_256x240.png differ diff --git a/include/thirdparty/jquery_ui/images/ui-icons_ef8c08_256x240.png b/include/thirdparty/jquery_ui/images/ui-icons_ef8c08_256x240.png deleted file mode 100644 index d76d10a..0000000 Binary files a/include/thirdparty/jquery_ui/images/ui-icons_ef8c08_256x240.png and /dev/null differ diff --git a/include/thirdparty/jquery_ui/images/ui-icons_ffd27a_256x240.png b/include/thirdparty/jquery_ui/images/ui-icons_ffd27a_256x240.png deleted file mode 100644 index 5e9d27a..0000000 Binary files a/include/thirdparty/jquery_ui/images/ui-icons_ffd27a_256x240.png and /dev/null differ diff --git a/include/thirdparty/jquery_ui/images/ui-icons_ffffff_256x240.png b/include/thirdparty/jquery_ui/images/ui-icons_ffffff_256x240.png deleted file mode 100644 index cd6c265..0000000 Binary files a/include/thirdparty/jquery_ui/images/ui-icons_ffffff_256x240.png and /dev/null differ diff --git a/include/thirdparty/jquery_ui/index.html b/include/thirdparty/jquery_ui/index.html new file mode 100644 index 0000000..ac95bcb --- /dev/null +++ b/include/thirdparty/jquery_ui/index.html @@ -0,0 +1,503 @@ + + + + + jQuery UI Example Page + + + + + +

          Welcome to jQuery UI!

          + +
          +

          This page demonstrates the widgets and theme you selected in Download Builder. Please make sure you are using them with a compatible jQuery version.

          +
          + +

          YOUR COMPONENTS:

          + + +

          Accordion

          +
          +

          First

          +
          Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet.
          +

          Second

          +
          Phasellus mattis tincidunt nibh.
          +

          Third

          +
          Nam dui erat, auctor a, dignissim quis.
          +
          + + +

          Autocomplete

          +
          + +
          + + +

          Button

          + + + + +

          Checkboxradio

          +
          +
          + + + +
          +
          + + +

          Controlgroup

          +
          + Rental Car +
          + + + + + + + + + + +
          +
          + + +

          Tabs

          +
          + +
          Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat.
          +
          Phasellus mattis tincidunt nibh. Cras orci urna, blandit id, pretium vel, aliquet ornare, felis. Maecenas scelerisque sem non nisl. Fusce sed lorem in enim dictum bibendum.
          +
          Nam dui erat, auctor a, dignissim quis, sollicitudin eu, felis. Pellentesque nisi urna, interdum eget, sagittis et, consequat vestibulum, lacus. Mauris porttitor ullamcorper augue.
          +
          + +

          Dialog

          +

          + +

          + +

          Overlay and Shadow Classes

          +
          +

          Lorem ipsum dolor sit amet, Nulla nec tortor. Donec id elit quis purus consectetur consequat.

          Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante. Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi in orci.

          Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam. Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat.

          Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante. Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi in orci. Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam.

          Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat. Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante.

          Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi in orci. Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam. Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat. Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi.

          + + +
          +
          + Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat. +
          + +
          + + +
          +

          Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat.

          +
          + + +

          Framework Icons (content color preview)

          +
            +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
            • +
          + + +

          Slider

          +
          + + +

          Datepicker

          +
          + + +

          Progressbar

          +
          + + +

          Selectmenu

          + + + +

          Spinner

          + + + +

          Menu

          + + + +

          Tooltip

          +

          + Tooltips can be attached to any element. When you hover +the element with your mouse, the title attribute is displayed in a little box next to the element, just like a native tooltip. +

          + + +

          Highlight / Error

          +
          +
          +

          + Hey! Sample ui-state-highlight style.

          +
          +
          +
          +
          +
          +

          + Alert: Sample ui-state-error style.

          +
          +
          + + + + + + diff --git a/include/thirdparty/jquery_ui/jquery-patch.js b/include/thirdparty/jquery_ui/jquery-patch.js index aba5ec0..a400104 100644 --- a/include/thirdparty/jquery_ui/jquery-patch.js +++ b/include/thirdparty/jquery_ui/jquery-patch.js @@ -1,16 +1,16 @@ /*! - * jQuery UI Support for jQuery core 1.8.x and newer @VERSION - * http://jqueryui.com + * jQuery UI Legacy jQuery Core patches @VERSION + * https://jqueryui.com * * Copyright OpenJS Foundation and other contributors * Released under the MIT license. - * http://jquery.org/license + * https://jquery.org/license * */ -//>>label: jQuery 1.8+ Support +//>>label: Legacy jQuery Core patches //>>group: Core -//>>description: Support version 1.8.x and newer of jQuery core +//>>description: Backport `.even()`, `.odd()` and `$.escapeSelector` to older jQuery Core versions (deprecated) ( function( factory ) { "use strict"; @@ -27,45 +27,12 @@ } )( function( $ ) { "use strict"; -// Support: jQuery 1.9.x or older -// $.expr[ ":" ] is deprecated. -if ( !$.expr.pseudos ) { - $.expr.pseudos = $.expr[ ":" ]; -} - -// Support: jQuery 1.11.x or older -// $.unique has been renamed to $.uniqueSort -if ( !$.uniqueSort ) { - $.uniqueSort = $.unique; -} - // Support: jQuery 2.2.x or older. // This method has been defined in jQuery 3.0.0. // Code from https://github.com/jquery/jquery/blob/e539bac79e666bba95bba86d690b4e609dca2286/src/selector/escapeSelector.js if ( !$.escapeSelector ) { - - // CSS string/identifier serialization - // https://drafts.csswg.org/cssom/#common-serializing-idioms - var rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g; - - var fcssescape = function( ch, asCodePoint ) { - if ( asCodePoint ) { - - // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER - if ( ch === "\0" ) { - return "\uFFFD"; - } - - // Control characters and (dependent upon position) numbers get escaped as code points - return ch.slice( 0, -1 ) + "\\" + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " "; - } - - // Other potentially-special ASCII characters get backslash-escaped - return "\\" + ch; - }; - - $.escapeSelector = function( sel ) { - return ( sel + "" ).replace( rcssescape, fcssescape ); + $.escapeSelector = function( id ) { + return CSS.escape( id + "" ); }; } diff --git a/include/thirdparty/jquery_ui/jquery-ui-12.1.min.css b/include/thirdparty/jquery_ui/jquery-ui-12.1.min.css deleted file mode 100644 index dbd7235..0000000 --- a/include/thirdparty/jquery_ui/jquery-ui-12.1.min.css +++ /dev/null @@ -1,7 +0,0 @@ -/*! jQuery UI - v1.12.1 - 2016-09-14 -* http://jqueryui.com -* Includes: core.css, accordion.css, autocomplete.css, menu.css, button.css, controlgroup.css, checkboxradio.css, datepicker.css, dialog.css, draggable.css, resizable.css, progressbar.css, selectable.css, selectmenu.css, slider.css, sortable.css, spinner.css, tabs.css, tooltip.css, theme.css -* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana%2CArial%2Csans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=highlight_soft&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=flat&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=glass&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=glass&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=glass&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=glass&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=glass&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=flat&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=flat&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px -* Copyright jQuery Foundation and other contributors; Licensed MIT */ - -.ui-helper-hidden{display:none}.ui-helper-hidden-accessible{border:0;clip:rect(0 0 0 0);height:1px;margin:-1px;overflow:hidden;padding:0;position:absolute;width:1px}.ui-helper-reset{margin:0;padding:0;border:0;outline:0;line-height:1.3;text-decoration:none;font-size:100%;list-style:none}.ui-helper-clearfix:before,.ui-helper-clearfix:after{content:"";display:table;border-collapse:collapse}.ui-helper-clearfix:after{clear:both}.ui-helper-zfix{width:100%;height:100%;top:0;left:0;position:absolute;opacity:0;filter:Alpha(Opacity=0)}.ui-front{z-index:100}.ui-state-disabled{cursor:default!important;pointer-events:none}.ui-icon{display:inline-block;vertical-align:middle;margin-top:-.25em;position:relative;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat}.ui-widget-icon-block{left:50%;margin-left:-8px;display:block}.ui-widget-overlay{position:fixed;top:0;left:0;width:100%;height:100%}.ui-accordion .ui-accordion-header{display:block;cursor:pointer;position:relative;margin:2px 0 0 0;padding:.5em .5em .5em .7em;font-size:100%}.ui-accordion .ui-accordion-content{padding:1em 2.2em;border-top:0;overflow:auto}.ui-autocomplete{position:absolute;top:0;left:0;cursor:default}.ui-menu{list-style:none;padding:0;margin:0;display:block;outline:0}.ui-menu .ui-menu{position:absolute}.ui-menu .ui-menu-item{margin:0;cursor:pointer;list-style-image:url("data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7")}.ui-menu .ui-menu-item-wrapper{position:relative;padding:3px 1em 3px .4em}.ui-menu .ui-menu-divider{margin:5px 0;height:0;font-size:0;line-height:0;border-width:1px 0 0 0}.ui-menu .ui-state-focus,.ui-menu .ui-state-active{margin:-1px}.ui-menu-icons{position:relative}.ui-menu-icons .ui-menu-item-wrapper{padding-left:2em}.ui-menu .ui-icon{position:absolute;top:0;bottom:0;left:.2em;margin:auto 0}.ui-menu .ui-menu-icon{left:auto;right:0}.ui-button{padding:.4em 1em;display:inline-block;position:relative;line-height:normal;margin-right:.1em;cursor:pointer;vertical-align:middle;text-align:center;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;overflow:visible}.ui-button,.ui-button:link,.ui-button:visited,.ui-button:hover,.ui-button:active{text-decoration:none}.ui-button-icon-only{width:2em;box-sizing:border-box;text-indent:-9999px;white-space:nowrap}input.ui-button.ui-button-icon-only{text-indent:0}.ui-button-icon-only .ui-icon{position:absolute;top:50%;left:50%;margin-top:-8px;margin-left:-8px}.ui-button.ui-icon-notext .ui-icon{padding:0;width:2.1em;height:2.1em;text-indent:-9999px;white-space:nowrap}input.ui-button.ui-icon-notext .ui-icon{width:auto;height:auto;text-indent:0;white-space:normal;padding:.4em 1em}input.ui-button::-moz-focus-inner,button.ui-button::-moz-focus-inner{border:0;padding:0}.ui-controlgroup{vertical-align:middle;display:inline-block}.ui-controlgroup > .ui-controlgroup-item{float:left;margin-left:0;margin-right:0}.ui-controlgroup > .ui-controlgroup-item:focus,.ui-controlgroup > .ui-controlgroup-item.ui-visual-focus{z-index:9999}.ui-controlgroup-vertical > .ui-controlgroup-item{display:block;float:none;width:100%;margin-top:0;margin-bottom:0;text-align:left}.ui-controlgroup-vertical .ui-controlgroup-item{box-sizing:border-box}.ui-controlgroup .ui-controlgroup-label{padding:.4em 1em}.ui-controlgroup .ui-controlgroup-label span{font-size:80%}.ui-controlgroup-horizontal .ui-controlgroup-label + .ui-controlgroup-item{border-left:none}.ui-controlgroup-vertical .ui-controlgroup-label + .ui-controlgroup-item{border-top:none}.ui-controlgroup-horizontal .ui-controlgroup-label.ui-widget-content{border-right:none}.ui-controlgroup-vertical .ui-controlgroup-label.ui-widget-content{border-bottom:none}.ui-controlgroup-vertical .ui-spinner-input{width:75%;width:calc( 100% - 2.4em )}.ui-controlgroup-vertical .ui-spinner .ui-spinner-up{border-top-style:solid}.ui-checkboxradio-label .ui-icon-background{box-shadow:inset 1px 1px 1px #ccc;border-radius:.12em;border:none}.ui-checkboxradio-radio-label .ui-icon-background{width:16px;height:16px;border-radius:1em;overflow:visible;border:none}.ui-checkboxradio-radio-label.ui-checkboxradio-checked .ui-icon,.ui-checkboxradio-radio-label.ui-checkboxradio-checked:hover .ui-icon{background-image:none;width:8px;height:8px;border-width:4px;border-style:solid}.ui-checkboxradio-disabled{pointer-events:none}.ui-datepicker{width:17em;padding:.2em .2em 0;display:none}.ui-datepicker .ui-datepicker-header{position:relative;padding:.2em 0}.ui-datepicker .ui-datepicker-prev,.ui-datepicker .ui-datepicker-next{position:absolute;top:2px;width:1.8em;height:1.8em}.ui-datepicker .ui-datepicker-prev-hover,.ui-datepicker .ui-datepicker-next-hover{top:1px}.ui-datepicker .ui-datepicker-prev{left:2px}.ui-datepicker .ui-datepicker-next{right:2px}.ui-datepicker .ui-datepicker-prev-hover{left:1px}.ui-datepicker .ui-datepicker-next-hover{right:1px}.ui-datepicker .ui-datepicker-prev span,.ui-datepicker .ui-datepicker-next span{display:block;position:absolute;left:50%;margin-left:-8px;top:50%;margin-top:-8px}.ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center}.ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0}.ui-datepicker select.ui-datepicker-month,.ui-datepicker select.ui-datepicker-year{width:45%}.ui-datepicker table{width:100%;font-size:.9em;border-collapse:collapse;margin:0 0 .4em}.ui-datepicker th{padding:.7em .3em;text-align:center;font-weight:bold;border:0}.ui-datepicker td{border:0;padding:1px}.ui-datepicker td span,.ui-datepicker td a{display:block;padding:.2em;text-align:right;text-decoration:none}.ui-datepicker .ui-datepicker-buttonpane{background-image:none;margin:.7em 0 0 0;padding:0 .2em;border-left:0;border-right:0;border-bottom:0}.ui-datepicker .ui-datepicker-buttonpane button{float:right;margin:.5em .2em .4em;cursor:pointer;padding:.2em .6em .3em .6em;width:auto;overflow:visible}.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current{float:left}.ui-datepicker.ui-datepicker-multi{width:auto}.ui-datepicker-multi .ui-datepicker-group{float:left}.ui-datepicker-multi .ui-datepicker-group table{width:95%;margin:0 auto .4em}.ui-datepicker-multi-2 .ui-datepicker-group{width:50%}.ui-datepicker-multi-3 .ui-datepicker-group{width:33.3%}.ui-datepicker-multi-4 .ui-datepicker-group{width:25%}.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header,.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-buttonpane{clear:left}.ui-datepicker-row-break{clear:both;width:100%;font-size:0}.ui-datepicker-rtl{direction:rtl}.ui-datepicker-rtl .ui-datepicker-prev{right:2px;left:auto}.ui-datepicker-rtl .ui-datepicker-next{left:2px;right:auto}.ui-datepicker-rtl .ui-datepicker-prev:hover{right:1px;left:auto}.ui-datepicker-rtl .ui-datepicker-next:hover{left:1px;right:auto}.ui-datepicker-rtl .ui-datepicker-buttonpane{clear:right}.ui-datepicker-rtl .ui-datepicker-buttonpane button{float:left}.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current,.ui-datepicker-rtl .ui-datepicker-group{float:right}.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header,.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-datepicker .ui-icon{display:block;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat;left:.5em;top:.3em}.ui-dialog{position:absolute;top:0;left:0;padding:.2em;outline:0}.ui-dialog .ui-dialog-titlebar{padding:.4em 1em;position:relative}.ui-dialog .ui-dialog-title{float:left;margin:.1em 0;white-space:nowrap;width:90%;overflow:hidden;text-overflow:ellipsis}.ui-dialog .ui-dialog-titlebar-close{position:absolute;right:.3em;top:50%;width:20px;margin:-10px 0 0 0;padding:1px;height:20px}.ui-dialog .ui-dialog-content{position:relative;border:0;padding:.5em 1em;background:none;overflow:auto}.ui-dialog .ui-dialog-buttonpane{text-align:left;border-width:1px 0 0 0;background-image:none;margin-top:.5em;padding:.3em 1em .5em .4em}.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset{float:right}.ui-dialog .ui-dialog-buttonpane button{margin:.5em .4em .5em 0;cursor:pointer}.ui-dialog .ui-resizable-n{height:2px;top:0}.ui-dialog .ui-resizable-e{width:2px;right:0}.ui-dialog .ui-resizable-s{height:2px;bottom:0}.ui-dialog .ui-resizable-w{width:2px;left:0}.ui-dialog .ui-resizable-se,.ui-dialog .ui-resizable-sw,.ui-dialog .ui-resizable-ne,.ui-dialog .ui-resizable-nw{width:7px;height:7px}.ui-dialog .ui-resizable-se{right:0;bottom:0}.ui-dialog .ui-resizable-sw{left:0;bottom:0}.ui-dialog .ui-resizable-ne{right:0;top:0}.ui-dialog .ui-resizable-nw{left:0;top:0}.ui-draggable .ui-dialog-titlebar{cursor:move}.ui-draggable-handle{-ms-touch-action:none;touch-action:none}.ui-resizable{position:relative}.ui-resizable-handle{position:absolute;font-size:0.1px;display:block;-ms-touch-action:none;touch-action:none}.ui-resizable-disabled .ui-resizable-handle,.ui-resizable-autohide .ui-resizable-handle{display:none}.ui-resizable-n{cursor:n-resize;height:7px;width:100%;top:-5px;left:0}.ui-resizable-s{cursor:s-resize;height:7px;width:100%;bottom:-5px;left:0}.ui-resizable-e{cursor:e-resize;width:7px;right:-5px;top:0;height:100%}.ui-resizable-w{cursor:w-resize;width:7px;left:-5px;top:0;height:100%}.ui-resizable-se{cursor:se-resize;width:12px;height:12px;right:1px;bottom:1px}.ui-resizable-sw{cursor:sw-resize;width:9px;height:9px;left:-5px;bottom:-5px}.ui-resizable-nw{cursor:nw-resize;width:9px;height:9px;left:-5px;top:-5px}.ui-resizable-ne{cursor:ne-resize;width:9px;height:9px;right:-5px;top:-5px}.ui-progressbar{height:2em;text-align:left;overflow:hidden}.ui-progressbar .ui-progressbar-value{margin:-1px;height:100%}.ui-progressbar .ui-progressbar-overlay{background:url("data:image/gif;base64,R0lGODlhKAAoAIABAAAAAP///yH/C05FVFNDQVBFMi4wAwEAAAAh+QQJAQABACwAAAAAKAAoAAACkYwNqXrdC52DS06a7MFZI+4FHBCKoDeWKXqymPqGqxvJrXZbMx7Ttc+w9XgU2FB3lOyQRWET2IFGiU9m1frDVpxZZc6bfHwv4c1YXP6k1Vdy292Fb6UkuvFtXpvWSzA+HycXJHUXiGYIiMg2R6W459gnWGfHNdjIqDWVqemH2ekpObkpOlppWUqZiqr6edqqWQAAIfkECQEAAQAsAAAAACgAKAAAApSMgZnGfaqcg1E2uuzDmmHUBR8Qil95hiPKqWn3aqtLsS18y7G1SzNeowWBENtQd+T1JktP05nzPTdJZlR6vUxNWWjV+vUWhWNkWFwxl9VpZRedYcflIOLafaa28XdsH/ynlcc1uPVDZxQIR0K25+cICCmoqCe5mGhZOfeYSUh5yJcJyrkZWWpaR8doJ2o4NYq62lAAACH5BAkBAAEALAAAAAAoACgAAAKVDI4Yy22ZnINRNqosw0Bv7i1gyHUkFj7oSaWlu3ovC8GxNso5fluz3qLVhBVeT/Lz7ZTHyxL5dDalQWPVOsQWtRnuwXaFTj9jVVh8pma9JjZ4zYSj5ZOyma7uuolffh+IR5aW97cHuBUXKGKXlKjn+DiHWMcYJah4N0lYCMlJOXipGRr5qdgoSTrqWSq6WFl2ypoaUAAAIfkECQEAAQAsAAAAACgAKAAAApaEb6HLgd/iO7FNWtcFWe+ufODGjRfoiJ2akShbueb0wtI50zm02pbvwfWEMWBQ1zKGlLIhskiEPm9R6vRXxV4ZzWT2yHOGpWMyorblKlNp8HmHEb/lCXjcW7bmtXP8Xt229OVWR1fod2eWqNfHuMjXCPkIGNileOiImVmCOEmoSfn3yXlJWmoHGhqp6ilYuWYpmTqKUgAAIfkECQEAAQAsAAAAACgAKAAAApiEH6kb58biQ3FNWtMFWW3eNVcojuFGfqnZqSebuS06w5V80/X02pKe8zFwP6EFWOT1lDFk8rGERh1TTNOocQ61Hm4Xm2VexUHpzjymViHrFbiELsefVrn6XKfnt2Q9G/+Xdie499XHd2g4h7ioOGhXGJboGAnXSBnoBwKYyfioubZJ2Hn0RuRZaflZOil56Zp6iioKSXpUAAAh+QQJAQABACwAAAAAKAAoAAACkoQRqRvnxuI7kU1a1UU5bd5tnSeOZXhmn5lWK3qNTWvRdQxP8qvaC+/yaYQzXO7BMvaUEmJRd3TsiMAgswmNYrSgZdYrTX6tSHGZO73ezuAw2uxuQ+BbeZfMxsexY35+/Qe4J1inV0g4x3WHuMhIl2jXOKT2Q+VU5fgoSUI52VfZyfkJGkha6jmY+aaYdirq+lQAACH5BAkBAAEALAAAAAAoACgAAAKWBIKpYe0L3YNKToqswUlvznigd4wiR4KhZrKt9Upqip61i9E3vMvxRdHlbEFiEXfk9YARYxOZZD6VQ2pUunBmtRXo1Lf8hMVVcNl8JafV38aM2/Fu5V16Bn63r6xt97j09+MXSFi4BniGFae3hzbH9+hYBzkpuUh5aZmHuanZOZgIuvbGiNeomCnaxxap2upaCZsq+1kAACH5BAkBAAEALAAAAAAoACgAAAKXjI8By5zf4kOxTVrXNVlv1X0d8IGZGKLnNpYtm8Lr9cqVeuOSvfOW79D9aDHizNhDJidFZhNydEahOaDH6nomtJjp1tutKoNWkvA6JqfRVLHU/QUfau9l2x7G54d1fl995xcIGAdXqMfBNadoYrhH+Mg2KBlpVpbluCiXmMnZ2Sh4GBqJ+ckIOqqJ6LmKSllZmsoq6wpQAAAh+QQJAQABACwAAAAAKAAoAAAClYx/oLvoxuJDkU1a1YUZbJ59nSd2ZXhWqbRa2/gF8Gu2DY3iqs7yrq+xBYEkYvFSM8aSSObE+ZgRl1BHFZNr7pRCavZ5BW2142hY3AN/zWtsmf12p9XxxFl2lpLn1rseztfXZjdIWIf2s5dItwjYKBgo9yg5pHgzJXTEeGlZuenpyPmpGQoKOWkYmSpaSnqKileI2FAAACH5BAkBAAEALAAAAAAoACgAAAKVjB+gu+jG4kORTVrVhRlsnn2dJ3ZleFaptFrb+CXmO9OozeL5VfP99HvAWhpiUdcwkpBH3825AwYdU8xTqlLGhtCosArKMpvfa1mMRae9VvWZfeB2XfPkeLmm18lUcBj+p5dnN8jXZ3YIGEhYuOUn45aoCDkp16hl5IjYJvjWKcnoGQpqyPlpOhr3aElaqrq56Bq7VAAAOw==");height:100%;filter:alpha(opacity=25);opacity:0.25}.ui-progressbar-indeterminate .ui-progressbar-value{background-image:none}.ui-selectable{-ms-touch-action:none;touch-action:none}.ui-selectable-helper{position:absolute;z-index:100;border:1px dotted black}.ui-selectmenu-menu{padding:0;margin:0;position:absolute;top:0;left:0;display:none}.ui-selectmenu-menu .ui-menu{overflow:auto;overflow-x:hidden;padding-bottom:1px}.ui-selectmenu-menu .ui-menu .ui-selectmenu-optgroup{font-size:1em;font-weight:bold;line-height:1.5;padding:2px 0.4em;margin:0.5em 0 0 0;height:auto;border:0}.ui-selectmenu-open{display:block}.ui-selectmenu-text{display:block;margin-right:20px;overflow:hidden;text-overflow:ellipsis}.ui-selectmenu-button.ui-button{text-align:left;white-space:nowrap;width:14em}.ui-selectmenu-icon.ui-icon{float:right;margin-top:0}.ui-slider{position:relative;text-align:left}.ui-slider .ui-slider-handle{position:absolute;z-index:2;width:1.2em;height:1.2em;cursor:default;-ms-touch-action:none;touch-action:none}.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background-position:0 0}.ui-slider.ui-state-disabled .ui-slider-handle,.ui-slider.ui-state-disabled .ui-slider-range{filter:inherit}.ui-slider-horizontal{height:.8em}.ui-slider-horizontal .ui-slider-handle{top:-.3em;margin-left:-.6em}.ui-slider-horizontal .ui-slider-range{top:0;height:100%}.ui-slider-horizontal .ui-slider-range-min{left:0}.ui-slider-horizontal .ui-slider-range-max{right:0}.ui-slider-vertical{width:.8em;height:100px}.ui-slider-vertical .ui-slider-handle{left:-.3em;margin-left:0;margin-bottom:-.6em}.ui-slider-vertical .ui-slider-range{left:0;width:100%}.ui-slider-vertical .ui-slider-range-min{bottom:0}.ui-slider-vertical .ui-slider-range-max{top:0}.ui-sortable-handle{-ms-touch-action:none;touch-action:none}.ui-spinner{position:relative;display:inline-block;overflow:hidden;padding:0;vertical-align:middle}.ui-spinner-input{border:none;background:none;color:inherit;padding:.222em 0;margin:.2em 0;vertical-align:middle;margin-left:.4em;margin-right:2em}.ui-spinner-button{width:1.6em;height:50%;font-size:.5em;padding:0;margin:0;text-align:center;position:absolute;cursor:default;display:block;overflow:hidden;right:0}.ui-spinner a.ui-spinner-button{border-top-style:none;border-bottom-style:none;border-right-style:none}.ui-spinner-up{top:0}.ui-spinner-down{bottom:0}.ui-tabs{position:relative;padding:.2em}.ui-tabs .ui-tabs-nav{margin:0;padding:.2em .2em 0}.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:0;margin:1px .2em 0 0;border-bottom-width:0;padding:0;white-space:nowrap}.ui-tabs .ui-tabs-nav .ui-tabs-anchor{float:left;padding:.5em 1em;text-decoration:none}.ui-tabs .ui-tabs-nav li.ui-tabs-active{margin-bottom:-1px;padding-bottom:1px}.ui-tabs .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor,.ui-tabs .ui-tabs-nav li.ui-state-disabled .ui-tabs-anchor,.ui-tabs .ui-tabs-nav li.ui-tabs-loading .ui-tabs-anchor{cursor:text}.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor{cursor:pointer}.ui-tabs .ui-tabs-panel{display:block;border-width:0;padding:1em 1.4em;background:none}.ui-tooltip{padding:8px;position:absolute;z-index:9999;max-width:300px}body .ui-tooltip{border-width:2px}.ui-widget{font-family:Verdana,Arial,sans-serif;font-size:1.1em}.ui-widget .ui-widget{font-size:1em}.ui-widget input,.ui-widget select,.ui-widget textarea,.ui-widget button{font-family:Verdana,Arial,sans-serif;font-size:1em}.ui-widget.ui-widget-content{border:1px solid #d3d3d3}.ui-widget-content{border:1px solid #aaa;background:#fff;color:#222}.ui-widget-content a{color:#222}.ui-widget-header{border:1px solid #aaa;background:#ccc url("images/ui-bg_highlight-soft_75_cccccc_1x100.png") 50% 50% repeat-x;color:#222;font-weight:bold}.ui-widget-header a{color:#222}.ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default,.ui-button,html .ui-button.ui-state-disabled:hover,html .ui-button.ui-state-disabled:active{border:1px solid #d3d3d3;background:#e6e6e6 url("images/ui-bg_glass_75_e6e6e6_1x400.png") 50% 50% repeat-x;font-weight:normal;color:#555}.ui-state-default a,.ui-state-default a:link,.ui-state-default a:visited,a.ui-button,a:link.ui-button,a:visited.ui-button,.ui-button{color:#555;text-decoration:none}.ui-state-hover,.ui-widget-content .ui-state-hover,.ui-widget-header .ui-state-hover,.ui-state-focus,.ui-widget-content .ui-state-focus,.ui-widget-header .ui-state-focus,.ui-button:hover,.ui-button:focus{border:1px solid #999;background:#dadada url("images/ui-bg_glass_75_dadada_1x400.png") 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-hover a,.ui-state-hover a:hover,.ui-state-hover a:link,.ui-state-hover a:visited,.ui-state-focus a,.ui-state-focus a:hover,.ui-state-focus a:link,.ui-state-focus a:visited,a.ui-button:hover,a.ui-button:focus{color:#212121;text-decoration:none}.ui-visual-focus{box-shadow:0 0 3px 1px rgb(94,158,214)}.ui-state-active,.ui-widget-content .ui-state-active,.ui-widget-header .ui-state-active,a.ui-button:active,.ui-button:active,.ui-button.ui-state-active:hover{border:1px solid #aaa;background:#fff url("images/ui-bg_glass_65_ffffff_1x400.png") 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-icon-background,.ui-state-active .ui-icon-background{border:#aaa;background-color:#212121}.ui-state-active a,.ui-state-active a:link,.ui-state-active a:visited{color:#212121;text-decoration:none}.ui-state-highlight,.ui-widget-content .ui-state-highlight,.ui-widget-header .ui-state-highlight{border:1px solid #fcefa1;background:#fbf9ee url("images/ui-bg_glass_55_fbf9ee_1x400.png") 50% 50% repeat-x;color:#363636}.ui-state-checked{border:1px solid #fcefa1;background:#fbf9ee}.ui-state-highlight a,.ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a{color:#363636}.ui-state-error,.ui-widget-content .ui-state-error,.ui-widget-header .ui-state-error{border:1px solid #cd0a0a;background:#fef1ec url("images/ui-bg_glass_95_fef1ec_1x400.png") 50% 50% repeat-x;color:#cd0a0a}.ui-state-error a,.ui-widget-content .ui-state-error a,.ui-widget-header .ui-state-error a{color:#cd0a0a}.ui-state-error-text,.ui-widget-content .ui-state-error-text,.ui-widget-header .ui-state-error-text{color:#cd0a0a}.ui-priority-primary,.ui-widget-content .ui-priority-primary,.ui-widget-header .ui-priority-primary{font-weight:bold}.ui-priority-secondary,.ui-widget-content .ui-priority-secondary,.ui-widget-header .ui-priority-secondary{opacity:.7;filter:Alpha(Opacity=70);font-weight:normal}.ui-state-disabled,.ui-widget-content .ui-state-disabled,.ui-widget-header .ui-state-disabled{opacity:.35;filter:Alpha(Opacity=35);background-image:none}.ui-state-disabled .ui-icon{filter:Alpha(Opacity=35)}.ui-icon{width:16px;height:16px}.ui-icon,.ui-widget-content .ui-icon{background-image:url("images/ui-icons_222222_256x240.png")}.ui-widget-header .ui-icon{background-image:url("images/ui-icons_222222_256x240.png")}.ui-state-hover .ui-icon,.ui-state-focus .ui-icon,.ui-button:hover .ui-icon,.ui-button:focus .ui-icon{background-image:url("images/ui-icons_454545_256x240.png")}.ui-state-active .ui-icon,.ui-button:active .ui-icon{background-image:url("images/ui-icons_454545_256x240.png")}.ui-state-highlight .ui-icon,.ui-button .ui-state-highlight.ui-icon{background-image:url("images/ui-icons_2e83ff_256x240.png")}.ui-state-error .ui-icon,.ui-state-error-text .ui-icon{background-image:url("images/ui-icons_cd0a0a_256x240.png")}.ui-button .ui-icon{background-image:url("images/ui-icons_888888_256x240.png")}.ui-icon-blank{background-position:16px 16px}.ui-icon-caret-1-n{background-position:0 0}.ui-icon-caret-1-ne{background-position:-16px 0}.ui-icon-caret-1-e{background-position:-32px 0}.ui-icon-caret-1-se{background-position:-48px 0}.ui-icon-caret-1-s{background-position:-65px 0}.ui-icon-caret-1-sw{background-position:-80px 0}.ui-icon-caret-1-w{background-position:-96px 0}.ui-icon-caret-1-nw{background-position:-112px 0}.ui-icon-caret-2-n-s{background-position:-128px 0}.ui-icon-caret-2-e-w{background-position:-144px 0}.ui-icon-triangle-1-n{background-position:0 -16px}.ui-icon-triangle-1-ne{background-position:-16px -16px}.ui-icon-triangle-1-e{background-position:-32px -16px}.ui-icon-triangle-1-se{background-position:-48px -16px}.ui-icon-triangle-1-s{background-position:-65px -16px}.ui-icon-triangle-1-sw{background-position:-80px -16px}.ui-icon-triangle-1-w{background-position:-96px -16px}.ui-icon-triangle-1-nw{background-position:-112px -16px}.ui-icon-triangle-2-n-s{background-position:-128px -16px}.ui-icon-triangle-2-e-w{background-position:-144px -16px}.ui-icon-arrow-1-n{background-position:0 -32px}.ui-icon-arrow-1-ne{background-position:-16px -32px}.ui-icon-arrow-1-e{background-position:-32px -32px}.ui-icon-arrow-1-se{background-position:-48px -32px}.ui-icon-arrow-1-s{background-position:-65px -32px}.ui-icon-arrow-1-sw{background-position:-80px -32px}.ui-icon-arrow-1-w{background-position:-96px -32px}.ui-icon-arrow-1-nw{background-position:-112px -32px}.ui-icon-arrow-2-n-s{background-position:-128px -32px}.ui-icon-arrow-2-ne-sw{background-position:-144px -32px}.ui-icon-arrow-2-e-w{background-position:-160px -32px}.ui-icon-arrow-2-se-nw{background-position:-176px -32px}.ui-icon-arrowstop-1-n{background-position:-192px -32px}.ui-icon-arrowstop-1-e{background-position:-208px -32px}.ui-icon-arrowstop-1-s{background-position:-224px -32px}.ui-icon-arrowstop-1-w{background-position:-240px -32px}.ui-icon-arrowthick-1-n{background-position:1px -48px}.ui-icon-arrowthick-1-ne{background-position:-16px -48px}.ui-icon-arrowthick-1-e{background-position:-32px -48px}.ui-icon-arrowthick-1-se{background-position:-48px -48px}.ui-icon-arrowthick-1-s{background-position:-64px -48px}.ui-icon-arrowthick-1-sw{background-position:-80px -48px}.ui-icon-arrowthick-1-w{background-position:-96px -48px}.ui-icon-arrowthick-1-nw{background-position:-112px -48px}.ui-icon-arrowthick-2-n-s{background-position:-128px -48px}.ui-icon-arrowthick-2-ne-sw{background-position:-144px -48px}.ui-icon-arrowthick-2-e-w{background-position:-160px -48px}.ui-icon-arrowthick-2-se-nw{background-position:-176px -48px}.ui-icon-arrowthickstop-1-n{background-position:-192px -48px}.ui-icon-arrowthickstop-1-e{background-position:-208px -48px}.ui-icon-arrowthickstop-1-s{background-position:-224px -48px}.ui-icon-arrowthickstop-1-w{background-position:-240px -48px}.ui-icon-arrowreturnthick-1-w{background-position:0 -64px}.ui-icon-arrowreturnthick-1-n{background-position:-16px -64px}.ui-icon-arrowreturnthick-1-e{background-position:-32px -64px}.ui-icon-arrowreturnthick-1-s{background-position:-48px -64px}.ui-icon-arrowreturn-1-w{background-position:-64px -64px}.ui-icon-arrowreturn-1-n{background-position:-80px -64px}.ui-icon-arrowreturn-1-e{background-position:-96px -64px}.ui-icon-arrowreturn-1-s{background-position:-112px -64px}.ui-icon-arrowrefresh-1-w{background-position:-128px -64px}.ui-icon-arrowrefresh-1-n{background-position:-144px -64px}.ui-icon-arrowrefresh-1-e{background-position:-160px -64px}.ui-icon-arrowrefresh-1-s{background-position:-176px -64px}.ui-icon-arrow-4{background-position:0 -80px}.ui-icon-arrow-4-diag{background-position:-16px -80px}.ui-icon-extlink{background-position:-32px -80px}.ui-icon-newwin{background-position:-48px -80px}.ui-icon-refresh{background-position:-64px -80px}.ui-icon-shuffle{background-position:-80px -80px}.ui-icon-transfer-e-w{background-position:-96px -80px}.ui-icon-transferthick-e-w{background-position:-112px -80px}.ui-icon-folder-collapsed{background-position:0 -96px}.ui-icon-folder-open{background-position:-16px -96px}.ui-icon-document{background-position:-32px -96px}.ui-icon-document-b{background-position:-48px -96px}.ui-icon-note{background-position:-64px -96px}.ui-icon-mail-closed{background-position:-80px -96px}.ui-icon-mail-open{background-position:-96px -96px}.ui-icon-suitcase{background-position:-112px -96px}.ui-icon-comment{background-position:-128px -96px}.ui-icon-person{background-position:-144px -96px}.ui-icon-print{background-position:-160px -96px}.ui-icon-trash{background-position:-176px -96px}.ui-icon-locked{background-position:-192px -96px}.ui-icon-unlocked{background-position:-208px -96px}.ui-icon-bookmark{background-position:-224px -96px}.ui-icon-tag{background-position:-240px -96px}.ui-icon-home{background-position:0 -112px}.ui-icon-flag{background-position:-16px -112px}.ui-icon-calendar{background-position:-32px -112px}.ui-icon-cart{background-position:-48px -112px}.ui-icon-pencil{background-position:-64px -112px}.ui-icon-clock{background-position:-80px -112px}.ui-icon-disk{background-position:-96px -112px}.ui-icon-calculator{background-position:-112px -112px}.ui-icon-zoomin{background-position:-128px -112px}.ui-icon-zoomout{background-position:-144px -112px}.ui-icon-search{background-position:-160px -112px}.ui-icon-wrench{background-position:-176px -112px}.ui-icon-gear{background-position:-192px -112px}.ui-icon-heart{background-position:-208px -112px}.ui-icon-star{background-position:-224px -112px}.ui-icon-link{background-position:-240px -112px}.ui-icon-cancel{background-position:0 -128px}.ui-icon-plus{background-position:-16px -128px}.ui-icon-plusthick{background-position:-32px -128px}.ui-icon-minus{background-position:-48px -128px}.ui-icon-minusthick{background-position:-64px -128px}.ui-icon-close{background-position:-80px -128px}.ui-icon-closethick{background-position:-96px -128px}.ui-icon-key{background-position:-112px -128px}.ui-icon-lightbulb{background-position:-128px -128px}.ui-icon-scissors{background-position:-144px -128px}.ui-icon-clipboard{background-position:-160px -128px}.ui-icon-copy{background-position:-176px -128px}.ui-icon-contact{background-position:-192px -128px}.ui-icon-image{background-position:-208px -128px}.ui-icon-video{background-position:-224px -128px}.ui-icon-script{background-position:-240px -128px}.ui-icon-alert{background-position:0 -144px}.ui-icon-info{background-position:-16px -144px}.ui-icon-notice{background-position:-32px -144px}.ui-icon-help{background-position:-48px -144px}.ui-icon-check{background-position:-64px -144px}.ui-icon-bullet{background-position:-80px -144px}.ui-icon-radio-on{background-position:-96px -144px}.ui-icon-radio-off{background-position:-112px -144px}.ui-icon-pin-w{background-position:-128px -144px}.ui-icon-pin-s{background-position:-144px -144px}.ui-icon-play{background-position:0 -160px}.ui-icon-pause{background-position:-16px -160px}.ui-icon-seek-next{background-position:-32px -160px}.ui-icon-seek-prev{background-position:-48px -160px}.ui-icon-seek-end{background-position:-64px -160px}.ui-icon-seek-start{background-position:-80px -160px}.ui-icon-seek-first{background-position:-80px -160px}.ui-icon-stop{background-position:-96px -160px}.ui-icon-eject{background-position:-112px -160px}.ui-icon-volume-off{background-position:-128px -160px}.ui-icon-volume-on{background-position:-144px -160px}.ui-icon-power{background-position:0 -176px}.ui-icon-signal-diag{background-position:-16px -176px}.ui-icon-signal{background-position:-32px -176px}.ui-icon-battery-0{background-position:-48px -176px}.ui-icon-battery-1{background-position:-64px -176px}.ui-icon-battery-2{background-position:-80px -176px}.ui-icon-battery-3{background-position:-96px -176px}.ui-icon-circle-plus{background-position:0 -192px}.ui-icon-circle-minus{background-position:-16px -192px}.ui-icon-circle-close{background-position:-32px -192px}.ui-icon-circle-triangle-e{background-position:-48px -192px}.ui-icon-circle-triangle-s{background-position:-64px -192px}.ui-icon-circle-triangle-w{background-position:-80px -192px}.ui-icon-circle-triangle-n{background-position:-96px -192px}.ui-icon-circle-arrow-e{background-position:-112px -192px}.ui-icon-circle-arrow-s{background-position:-128px -192px}.ui-icon-circle-arrow-w{background-position:-144px -192px}.ui-icon-circle-arrow-n{background-position:-160px -192px}.ui-icon-circle-zoomin{background-position:-176px -192px}.ui-icon-circle-zoomout{background-position:-192px -192px}.ui-icon-circle-check{background-position:-208px -192px}.ui-icon-circlesmall-plus{background-position:0 -208px}.ui-icon-circlesmall-minus{background-position:-16px -208px}.ui-icon-circlesmall-close{background-position:-32px -208px}.ui-icon-squaresmall-plus{background-position:-48px -208px}.ui-icon-squaresmall-minus{background-position:-64px -208px}.ui-icon-squaresmall-close{background-position:-80px -208px}.ui-icon-grip-dotted-vertical{background-position:0 -224px}.ui-icon-grip-dotted-horizontal{background-position:-16px -224px}.ui-icon-grip-solid-vertical{background-position:-32px -224px}.ui-icon-grip-solid-horizontal{background-position:-48px -224px}.ui-icon-gripsmall-diagonal-se{background-position:-64px -224px}.ui-icon-grip-diagonal-se{background-position:-80px -224px}.ui-corner-all,.ui-corner-top,.ui-corner-left,.ui-corner-tl{border-top-left-radius:4px}.ui-corner-all,.ui-corner-top,.ui-corner-right,.ui-corner-tr{border-top-right-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-left,.ui-corner-bl{border-bottom-left-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-right,.ui-corner-br{border-bottom-right-radius:4px}.ui-widget-overlay{background:#aaa;opacity:.3;filter:Alpha(Opacity=30)}.ui-widget-shadow{-webkit-box-shadow:-8px -8px 8px #aaa;box-shadow:-8px -8px 8px #aaa} \ No newline at end of file diff --git a/include/thirdparty/jquery_ui/jquery-ui.css b/include/thirdparty/jquery_ui/jquery-ui.css new file mode 100644 index 0000000..148ec74 --- /dev/null +++ b/include/thirdparty/jquery_ui/jquery-ui.css @@ -0,0 +1,1285 @@ +/*! jQuery UI - v1.14.1 - 2025-04-04 +* https://jqueryui.com +* Includes: draggable.css, core.css, resizable.css, selectable.css, sortable.css, accordion.css, autocomplete.css, menu.css, button.css, controlgroup.css, checkboxradio.css, datepicker.css, dialog.css, progressbar.css, selectmenu.css, slider.css, spinner.css, tabs.css, tooltip.css, theme.css +* To view and modify this theme, visit https://jqueryui.com/themeroller/?ffDefault=Verdana%2CArial%2Csans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=highlight_soft&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=flat&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=glass&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=glass&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=glass&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=glass&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=glass&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=flat&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=flat&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px +* Copyright OpenJS Foundation and other contributors; Licensed MIT */ + +.ui-draggable-handle { + touch-action: none; +} +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { + display: none; +} +.ui-helper-hidden-accessible { + border: 0; + clip: rect(0 0 0 0); + height: 1px; + margin: -1px; + overflow: hidden; + padding: 0; + position: absolute; + width: 1px; +} +.ui-helper-reset { + margin: 0; + padding: 0; + border: 0; + outline: 0; + line-height: 1.3; + text-decoration: none; + font-size: 100%; + list-style: none; +} +.ui-helper-clearfix:before, +.ui-helper-clearfix:after { + content: ""; + display: table; + border-collapse: collapse; +} +.ui-helper-clearfix:after { + clear: both; +} +.ui-helper-zfix { + width: 100%; + height: 100%; + top: 0; + left: 0; + position: absolute; + opacity: 0; +} + +.ui-front { + z-index: 100; +} + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { + cursor: default !important; + pointer-events: none; +} + + +/* Icons +----------------------------------*/ +.ui-icon { + display: inline-block; + vertical-align: middle; + margin-top: -.25em; + position: relative; + text-indent: -99999px; + overflow: hidden; + background-repeat: no-repeat; +} + +.ui-widget-icon-block { + left: 50%; + margin-left: -8px; + display: block; +} + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { + position: fixed; + top: 0; + left: 0; + width: 100%; + height: 100%; +} +.ui-resizable { + position: relative; +} +.ui-resizable-handle { + position: absolute; + font-size: 0.1px; + display: block; + touch-action: none; +} +.ui-resizable-disabled .ui-resizable-handle, +.ui-resizable-autohide .ui-resizable-handle { + display: none; +} +.ui-resizable-n { + cursor: n-resize; + height: 7px; + width: 100%; + top: -5px; + left: 0; +} +.ui-resizable-s { + cursor: s-resize; + height: 7px; + width: 100%; + bottom: -5px; + left: 0; +} +.ui-resizable-e { + cursor: e-resize; + width: 7px; + right: -5px; + top: 0; + height: 100%; +} +.ui-resizable-w { + cursor: w-resize; + width: 7px; + left: -5px; + top: 0; + height: 100%; +} +.ui-resizable-se { + cursor: se-resize; + width: 12px; + height: 12px; + right: 1px; + bottom: 1px; +} +.ui-resizable-sw { + cursor: sw-resize; + width: 9px; + height: 9px; + left: -5px; + bottom: -5px; +} +.ui-resizable-nw { + cursor: nw-resize; + width: 9px; + height: 9px; + left: -5px; + top: -5px; +} +.ui-resizable-ne { + cursor: ne-resize; + width: 9px; + height: 9px; + right: -5px; + top: -5px; +} +.ui-selectable { + touch-action: none; +} +.ui-selectable-helper { + position: absolute; + z-index: 100; + border: 1px dotted black; +} +.ui-sortable-handle { + touch-action: none; +} +.ui-accordion .ui-accordion-header { + display: block; + cursor: pointer; + position: relative; + margin: 2px 0 0 0; + padding: .5em .5em .5em .7em; + font-size: 100%; +} +.ui-accordion .ui-accordion-content { + padding: 1em 2.2em; + border-top: 0; + overflow: auto; +} +.ui-autocomplete { + position: absolute; + top: 0; + left: 0; + cursor: default; +} +.ui-menu { + list-style: none; + padding: 0; + margin: 0; + display: block; + outline: 0; +} +.ui-menu .ui-menu { + position: absolute; +} +.ui-menu .ui-menu-item { + margin: 0; + cursor: pointer; +} +.ui-menu .ui-menu-item-wrapper { + position: relative; + padding: 3px 1em 3px .4em; +} +.ui-menu .ui-menu-divider { + margin: 5px 0; + height: 0; + font-size: 0; + line-height: 0; + border-width: 1px 0 0 0; +} +.ui-menu .ui-state-focus, +.ui-menu .ui-state-active { + margin: -1px; +} + +/* icon support */ +.ui-menu-icons { + position: relative; +} +.ui-menu-icons .ui-menu-item-wrapper { + padding-left: 2em; +} + +/* left-aligned */ +.ui-menu .ui-icon { + position: absolute; + top: 0; + bottom: 0; + left: .2em; + margin: auto 0; +} + +/* right-aligned */ +.ui-menu .ui-menu-icon { + left: auto; + right: 0; +} +.ui-button { + padding: .4em 1em; + display: inline-block; + position: relative; + line-height: normal; + margin-right: .1em; + cursor: pointer; + vertical-align: middle; + text-align: center; + -webkit-user-select: none; + user-select: none; +} + +.ui-button, +.ui-button:link, +.ui-button:visited, +.ui-button:hover, +.ui-button:active { + text-decoration: none; +} + +/* to make room for the icon, a width needs to be set here */ +.ui-button-icon-only { + width: 2em; + box-sizing: border-box; + text-indent: -9999px; + white-space: nowrap; +} + +/* no icon support for input elements */ +input.ui-button.ui-button-icon-only { + text-indent: 0; +} + +/* button icon element(s) */ +.ui-button-icon-only .ui-icon { + position: absolute; + top: 50%; + left: 50%; + margin-top: -8px; + margin-left: -8px; +} + +.ui-button.ui-icon-notext .ui-icon { + padding: 0; + width: 2.1em; + height: 2.1em; + text-indent: -9999px; + white-space: nowrap; + +} + +input.ui-button.ui-icon-notext .ui-icon { + width: auto; + height: auto; + text-indent: 0; + white-space: normal; + padding: .4em 1em; +} + +/* workarounds */ +/* Support: Firefox 5 - 125+ */ +input.ui-button::-moz-focus-inner, +button.ui-button::-moz-focus-inner { + border: 0; + padding: 0; +} +.ui-controlgroup { + vertical-align: middle; + display: inline-block; +} +.ui-controlgroup > .ui-controlgroup-item { + float: left; + margin-left: 0; + margin-right: 0; +} +.ui-controlgroup > .ui-controlgroup-item:focus, +.ui-controlgroup > .ui-controlgroup-item.ui-visual-focus { + z-index: 9999; +} +.ui-controlgroup-vertical > .ui-controlgroup-item { + display: block; + float: none; + width: 100%; + margin-top: 0; + margin-bottom: 0; + text-align: left; +} +.ui-controlgroup-vertical .ui-controlgroup-item { + box-sizing: border-box; +} +.ui-controlgroup .ui-controlgroup-label { + padding: .4em 1em; +} +.ui-controlgroup .ui-controlgroup-label span { + font-size: 80%; +} +.ui-controlgroup-horizontal .ui-controlgroup-label + .ui-controlgroup-item { + border-left: none; +} +.ui-controlgroup-vertical .ui-controlgroup-label + .ui-controlgroup-item { + border-top: none; +} +.ui-controlgroup-horizontal .ui-controlgroup-label.ui-widget-content { + border-right: none; +} +.ui-controlgroup-vertical .ui-controlgroup-label.ui-widget-content { + border-bottom: none; +} + +/* Spinner specific style fixes */ +.ui-controlgroup-vertical .ui-spinner-input { + width: calc( 100% - 2.4em ); +} +.ui-controlgroup-vertical .ui-spinner .ui-spinner-up { + border-top-style: solid; +} + +.ui-checkboxradio-label .ui-icon-background { + box-shadow: inset 1px 1px 1px #ccc; + border-radius: .12em; + border: none; +} +.ui-checkboxradio-radio-label .ui-icon-background { + width: 16px; + height: 16px; + border-radius: 1em; + overflow: visible; + border: none; +} +.ui-checkboxradio-radio-label.ui-checkboxradio-checked .ui-icon, +.ui-checkboxradio-radio-label.ui-checkboxradio-checked:hover .ui-icon { + background-image: none; + width: 8px; + height: 8px; + border-width: 4px; + border-style: solid; +} +.ui-checkboxradio-disabled { + pointer-events: none; +} +.ui-datepicker { + width: 17em; + padding: .2em .2em 0; + display: none; +} +.ui-datepicker .ui-datepicker-header { + position: relative; + padding: .2em 0; +} +.ui-datepicker .ui-datepicker-prev, +.ui-datepicker .ui-datepicker-next { + position: absolute; + top: 2px; + width: 1.8em; + height: 1.8em; +} +.ui-datepicker .ui-datepicker-prev-hover, +.ui-datepicker .ui-datepicker-next-hover { + top: 1px; +} +.ui-datepicker .ui-datepicker-prev { + left: 2px; +} +.ui-datepicker .ui-datepicker-next { + right: 2px; +} +.ui-datepicker .ui-datepicker-prev-hover { + left: 1px; +} +.ui-datepicker .ui-datepicker-next-hover { + right: 1px; +} +.ui-datepicker .ui-datepicker-prev span, +.ui-datepicker .ui-datepicker-next span { + display: block; + position: absolute; + left: 50%; + margin-left: -8px; + top: 50%; + margin-top: -8px; +} +.ui-datepicker .ui-datepicker-title { + margin: 0 2.3em; + line-height: 1.8em; + text-align: center; +} +.ui-datepicker .ui-datepicker-title select { + font-size: 1em; + margin: 1px 0; +} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { + width: 45%; +} +.ui-datepicker table { + width: 100%; + font-size: .9em; + border-collapse: collapse; + margin: 0 0 .4em; +} +.ui-datepicker th { + padding: .7em .3em; + text-align: center; + font-weight: bold; + border: 0; +} +.ui-datepicker td { + border: 0; + padding: 1px; +} +.ui-datepicker td span, +.ui-datepicker td a { + display: block; + padding: .2em; + text-align: right; + text-decoration: none; +} +.ui-datepicker .ui-datepicker-buttonpane { + background-image: none; + margin: .7em 0 0 0; + padding: 0 .2em; + border-left: 0; + border-right: 0; + border-bottom: 0; +} +.ui-datepicker .ui-datepicker-buttonpane button { + float: right; + margin: .5em .2em .4em; + cursor: pointer; + padding: .2em .6em .3em .6em; + width: auto; + overflow: visible; +} +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { + float: left; +} + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { + width: auto; +} +.ui-datepicker-multi .ui-datepicker-group { + float: left; +} +.ui-datepicker-multi .ui-datepicker-group table { + width: 95%; + margin: 0 auto .4em; +} +.ui-datepicker-multi-2 .ui-datepicker-group { + width: 50%; +} +.ui-datepicker-multi-3 .ui-datepicker-group { + width: 33.3%; +} +.ui-datepicker-multi-4 .ui-datepicker-group { + width: 25%; +} +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header, +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { + border-left-width: 0; +} +.ui-datepicker-multi .ui-datepicker-buttonpane { + clear: left; +} +.ui-datepicker-row-break { + clear: both; + width: 100%; + font-size: 0; +} + +/* RTL support */ +.ui-datepicker-rtl { + direction: rtl; +} +.ui-datepicker-rtl .ui-datepicker-prev { + right: 2px; + left: auto; +} +.ui-datepicker-rtl .ui-datepicker-next { + left: 2px; + right: auto; +} +.ui-datepicker-rtl .ui-datepicker-prev:hover { + right: 1px; + left: auto; +} +.ui-datepicker-rtl .ui-datepicker-next:hover { + left: 1px; + right: auto; +} +.ui-datepicker-rtl .ui-datepicker-buttonpane { + clear: right; +} +.ui-datepicker-rtl .ui-datepicker-buttonpane button { + float: left; +} +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current, +.ui-datepicker-rtl .ui-datepicker-group { + float: right; +} +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header, +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { + border-right-width: 0; + border-left-width: 1px; +} + +/* Icons */ +.ui-datepicker .ui-icon { + display: block; + text-indent: -99999px; + overflow: hidden; + background-repeat: no-repeat; + left: .5em; + top: .3em; +} +.ui-dialog { + position: absolute; + top: 0; + left: 0; + padding: .2em; + outline: 0; +} +.ui-dialog .ui-dialog-titlebar { + padding: .4em 1em; + position: relative; +} +.ui-dialog .ui-dialog-title { + float: left; + margin: .1em 0; + white-space: nowrap; + width: 90%; + overflow: hidden; + text-overflow: ellipsis; +} +.ui-dialog .ui-dialog-titlebar-close { + position: absolute; + right: .3em; + top: 50%; + width: 20px; + margin: -10px 0 0 0; + padding: 1px; + height: 20px; +} +.ui-dialog .ui-dialog-content { + position: relative; + border: 0; + padding: .5em 1em; + background: none; + overflow: auto; +} +.ui-dialog .ui-dialog-buttonpane { + text-align: left; + border-width: 1px 0 0 0; + background-image: none; + margin-top: .5em; + padding: .3em 1em .5em .4em; +} +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { + float: right; +} +.ui-dialog .ui-dialog-buttonpane button { + margin: .5em .4em .5em 0; + cursor: pointer; +} +.ui-dialog .ui-resizable-n { + height: 2px; + top: 0; +} +.ui-dialog .ui-resizable-e { + width: 2px; + right: 0; +} +.ui-dialog .ui-resizable-s { + height: 2px; + bottom: 0; +} +.ui-dialog .ui-resizable-w { + width: 2px; + left: 0; +} +.ui-dialog .ui-resizable-se, +.ui-dialog .ui-resizable-sw, +.ui-dialog .ui-resizable-ne, +.ui-dialog .ui-resizable-nw { + width: 7px; + height: 7px; +} +.ui-dialog .ui-resizable-se { + right: 0; + bottom: 0; +} +.ui-dialog .ui-resizable-sw { + left: 0; + bottom: 0; +} +.ui-dialog .ui-resizable-ne { + right: 0; + top: 0; +} +.ui-dialog .ui-resizable-nw { + left: 0; + top: 0; +} +.ui-draggable .ui-dialog-titlebar { + cursor: move; +} +.ui-progressbar { + height: 2em; + text-align: left; + overflow: hidden; +} +.ui-progressbar .ui-progressbar-value { + margin: -1px; + height: 100%; +} +.ui-progressbar .ui-progressbar-overlay { + background: url("data:image/gif;base64,R0lGODlhKAAoAIABAAAAAP///yH/C05FVFNDQVBFMi4wAwEAAAAh+QQJAQABACwAAAAAKAAoAAACkYwNqXrdC52DS06a7MFZI+4FHBCKoDeWKXqymPqGqxvJrXZbMx7Ttc+w9XgU2FB3lOyQRWET2IFGiU9m1frDVpxZZc6bfHwv4c1YXP6k1Vdy292Fb6UkuvFtXpvWSzA+HycXJHUXiGYIiMg2R6W459gnWGfHNdjIqDWVqemH2ekpObkpOlppWUqZiqr6edqqWQAAIfkECQEAAQAsAAAAACgAKAAAApSMgZnGfaqcg1E2uuzDmmHUBR8Qil95hiPKqWn3aqtLsS18y7G1SzNeowWBENtQd+T1JktP05nzPTdJZlR6vUxNWWjV+vUWhWNkWFwxl9VpZRedYcflIOLafaa28XdsH/ynlcc1uPVDZxQIR0K25+cICCmoqCe5mGhZOfeYSUh5yJcJyrkZWWpaR8doJ2o4NYq62lAAACH5BAkBAAEALAAAAAAoACgAAAKVDI4Yy22ZnINRNqosw0Bv7i1gyHUkFj7oSaWlu3ovC8GxNso5fluz3qLVhBVeT/Lz7ZTHyxL5dDalQWPVOsQWtRnuwXaFTj9jVVh8pma9JjZ4zYSj5ZOyma7uuolffh+IR5aW97cHuBUXKGKXlKjn+DiHWMcYJah4N0lYCMlJOXipGRr5qdgoSTrqWSq6WFl2ypoaUAAAIfkECQEAAQAsAAAAACgAKAAAApaEb6HLgd/iO7FNWtcFWe+ufODGjRfoiJ2akShbueb0wtI50zm02pbvwfWEMWBQ1zKGlLIhskiEPm9R6vRXxV4ZzWT2yHOGpWMyorblKlNp8HmHEb/lCXjcW7bmtXP8Xt229OVWR1fod2eWqNfHuMjXCPkIGNileOiImVmCOEmoSfn3yXlJWmoHGhqp6ilYuWYpmTqKUgAAIfkECQEAAQAsAAAAACgAKAAAApiEH6kb58biQ3FNWtMFWW3eNVcojuFGfqnZqSebuS06w5V80/X02pKe8zFwP6EFWOT1lDFk8rGERh1TTNOocQ61Hm4Xm2VexUHpzjymViHrFbiELsefVrn6XKfnt2Q9G/+Xdie499XHd2g4h7ioOGhXGJboGAnXSBnoBwKYyfioubZJ2Hn0RuRZaflZOil56Zp6iioKSXpUAAAh+QQJAQABACwAAAAAKAAoAAACkoQRqRvnxuI7kU1a1UU5bd5tnSeOZXhmn5lWK3qNTWvRdQxP8qvaC+/yaYQzXO7BMvaUEmJRd3TsiMAgswmNYrSgZdYrTX6tSHGZO73ezuAw2uxuQ+BbeZfMxsexY35+/Qe4J1inV0g4x3WHuMhIl2jXOKT2Q+VU5fgoSUI52VfZyfkJGkha6jmY+aaYdirq+lQAACH5BAkBAAEALAAAAAAoACgAAAKWBIKpYe0L3YNKToqswUlvznigd4wiR4KhZrKt9Upqip61i9E3vMvxRdHlbEFiEXfk9YARYxOZZD6VQ2pUunBmtRXo1Lf8hMVVcNl8JafV38aM2/Fu5V16Bn63r6xt97j09+MXSFi4BniGFae3hzbH9+hYBzkpuUh5aZmHuanZOZgIuvbGiNeomCnaxxap2upaCZsq+1kAACH5BAkBAAEALAAAAAAoACgAAAKXjI8By5zf4kOxTVrXNVlv1X0d8IGZGKLnNpYtm8Lr9cqVeuOSvfOW79D9aDHizNhDJidFZhNydEahOaDH6nomtJjp1tutKoNWkvA6JqfRVLHU/QUfau9l2x7G54d1fl995xcIGAdXqMfBNadoYrhH+Mg2KBlpVpbluCiXmMnZ2Sh4GBqJ+ckIOqqJ6LmKSllZmsoq6wpQAAAh+QQJAQABACwAAAAAKAAoAAAClYx/oLvoxuJDkU1a1YUZbJ59nSd2ZXhWqbRa2/gF8Gu2DY3iqs7yrq+xBYEkYvFSM8aSSObE+ZgRl1BHFZNr7pRCavZ5BW2142hY3AN/zWtsmf12p9XxxFl2lpLn1rseztfXZjdIWIf2s5dItwjYKBgo9yg5pHgzJXTEeGlZuenpyPmpGQoKOWkYmSpaSnqKileI2FAAACH5BAkBAAEALAAAAAAoACgAAAKVjB+gu+jG4kORTVrVhRlsnn2dJ3ZleFaptFrb+CXmO9OozeL5VfP99HvAWhpiUdcwkpBH3825AwYdU8xTqlLGhtCosArKMpvfa1mMRae9VvWZfeB2XfPkeLmm18lUcBj+p5dnN8jXZ3YIGEhYuOUn45aoCDkp16hl5IjYJvjWKcnoGQpqyPlpOhr3aElaqrq56Bq7VAAAOw=="); + height: 100%; + opacity: 0.25; +} +.ui-progressbar-indeterminate .ui-progressbar-value { + background-image: none; +} +.ui-selectmenu-menu { + padding: 0; + margin: 0; + position: absolute; + top: 0; + left: 0; + display: none; +} +.ui-selectmenu-menu .ui-menu { + overflow: auto; + overflow-x: hidden; + padding-bottom: 1px; +} +.ui-selectmenu-menu .ui-menu .ui-selectmenu-optgroup { + font-size: 1em; + font-weight: bold; + line-height: 1.5; + padding: 2px 0.4em; + margin: 0.5em 0 0 0; + height: auto; + border: 0; +} +.ui-selectmenu-open { + display: block; +} +.ui-selectmenu-text { + display: block; + margin-right: 20px; + overflow: hidden; + text-overflow: ellipsis; +} +.ui-selectmenu-button.ui-button { + text-align: left; + white-space: nowrap; + width: 14em; +} +.ui-selectmenu-icon.ui-icon { + float: right; + margin-top: 0; +} +.ui-slider { + position: relative; + text-align: left; +} +.ui-slider .ui-slider-handle { + position: absolute; + z-index: 2; + width: 1.2em; + height: 1.2em; + cursor: pointer; + touch-action: none; +} +.ui-slider .ui-slider-range { + position: absolute; + z-index: 1; + font-size: .7em; + display: block; + border: 0; + background-position: 0 0; +} + +.ui-slider-horizontal { + height: .8em; +} +.ui-slider-horizontal .ui-slider-handle { + top: -.3em; + margin-left: -.6em; +} +.ui-slider-horizontal .ui-slider-range { + top: 0; + height: 100%; +} +.ui-slider-horizontal .ui-slider-range-min { + left: 0; +} +.ui-slider-horizontal .ui-slider-range-max { + right: 0; +} + +.ui-slider-vertical { + width: .8em; + height: 100px; +} +.ui-slider-vertical .ui-slider-handle { + left: -.3em; + margin-left: 0; + margin-bottom: -.6em; +} +.ui-slider-vertical .ui-slider-range { + left: 0; + width: 100%; +} +.ui-slider-vertical .ui-slider-range-min { + bottom: 0; +} +.ui-slider-vertical .ui-slider-range-max { + top: 0; +} +.ui-spinner { + position: relative; + display: inline-block; + overflow: hidden; + padding: 0; + vertical-align: middle; +} +.ui-spinner-input { + border: none; + background: none; + color: inherit; + padding: .222em 0; + margin: .2em 0; + vertical-align: middle; + margin-left: .4em; + margin-right: 2em; +} +.ui-spinner-button { + width: 1.6em; + height: 50%; + font-size: .5em; + padding: 0; + margin: 0; + text-align: center; + position: absolute; + cursor: default; + display: block; + overflow: hidden; + right: 0; +} +/* more specificity required here to override default borders */ +.ui-spinner a.ui-spinner-button { + border-top-style: none; + border-bottom-style: none; + border-right-style: none; +} +.ui-spinner-up { + top: 0; +} +.ui-spinner-down { + bottom: 0; +} +.ui-tabs { + position: relative;/* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ + padding: .2em; +} +.ui-tabs .ui-tabs-nav { + margin: 0; + padding: .2em .2em 0; +} +.ui-tabs .ui-tabs-nav li { + list-style: none; + float: left; + position: relative; + top: 0; + margin: 1px .2em 0 0; + border-bottom-width: 0; + padding: 0; + white-space: nowrap; +} +.ui-tabs .ui-tabs-nav .ui-tabs-anchor { + float: left; + padding: .5em 1em; + text-decoration: none; +} +.ui-tabs .ui-tabs-nav li.ui-tabs-active { + margin-bottom: -1px; + padding-bottom: 1px; +} +.ui-tabs .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor, +.ui-tabs .ui-tabs-nav li.ui-state-disabled .ui-tabs-anchor, +.ui-tabs .ui-tabs-nav li.ui-tabs-loading .ui-tabs-anchor { + cursor: text; +} +.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor { + cursor: pointer; +} +.ui-tabs .ui-tabs-panel { + display: block; + border-width: 0; + padding: 1em 1.4em; + background: none; +} +.ui-tooltip { + padding: 8px; + position: absolute; + z-index: 9999; + max-width: 300px; +} +body .ui-tooltip { + border-width: 2px; +} + +/* Component containers +----------------------------------*/ +.ui-widget { + font-family: Verdana,Arial,sans-serif; + font-size: 1.1em; +} +.ui-widget .ui-widget { + font-size: 1em; +} +.ui-widget input, +.ui-widget select, +.ui-widget textarea, +.ui-widget button { + font-family: Verdana,Arial,sans-serif; + font-size: 1em; +} +.ui-widget.ui-widget-content { + border: 1px solid #d3d3d3; +} +.ui-widget-content { + border: 1px solid #aaaaaa; + background: #ffffff; + color: #222222; +} +.ui-widget-content a { + color: #222222; +} +.ui-widget-header { + border: 1px solid #aaaaaa; + background: #cccccc url("images/ui-bg_highlight-soft_75_cccccc_1x100.png") 50% 50% repeat-x; + color: #222222; + font-weight: bold; +} +.ui-widget-header a { + color: #222222; +} + +/* Interaction states +----------------------------------*/ +.ui-state-default, +.ui-widget-content .ui-state-default, +.ui-widget-header .ui-state-default, +.ui-button, + +/* We use html here because we need a greater specificity to make sure disabled +works properly when clicked or hovered */ +html .ui-button.ui-state-disabled:hover, +html .ui-button.ui-state-disabled:active { + border: 1px solid #d3d3d3; + background: #e6e6e6 url("images/ui-bg_glass_75_e6e6e6_1x400.png") 50% 50% repeat-x; + font-weight: normal; + color: #555555; +} +.ui-state-default a, +.ui-state-default a:link, +.ui-state-default a:visited, +a.ui-button, +a:link.ui-button, +a:visited.ui-button, +.ui-button { + color: #555555; + text-decoration: none; +} +.ui-state-hover, +.ui-widget-content .ui-state-hover, +.ui-widget-header .ui-state-hover, +.ui-state-focus, +.ui-widget-content .ui-state-focus, +.ui-widget-header .ui-state-focus, +.ui-button:hover, +.ui-button:focus { + border: 1px solid #999999; + background: #dadada url("images/ui-bg_glass_75_dadada_1x400.png") 50% 50% repeat-x; + font-weight: normal; + color: #212121; +} +.ui-state-hover a, +.ui-state-hover a:hover, +.ui-state-hover a:link, +.ui-state-hover a:visited, +.ui-state-focus a, +.ui-state-focus a:hover, +.ui-state-focus a:link, +.ui-state-focus a:visited, +a.ui-button:hover, +a.ui-button:focus { + color: #212121; + text-decoration: none; +} + +.ui-visual-focus { + box-shadow: 0 0 3px 1px rgb(94, 158, 214); +} +.ui-state-active, +.ui-widget-content .ui-state-active, +.ui-widget-header .ui-state-active, +a.ui-button:active, +.ui-button:active, +.ui-button.ui-state-active:hover { + border: 1px solid #aaaaaa; + background: #ffffff url("images/ui-bg_glass_65_ffffff_1x400.png") 50% 50% repeat-x; + font-weight: normal; + color: #212121; +} +.ui-icon-background, +.ui-state-active .ui-icon-background { + border: #aaaaaa; + background-color: #212121; +} +.ui-state-active a, +.ui-state-active a:link, +.ui-state-active a:visited { + color: #212121; + text-decoration: none; +} + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, +.ui-widget-content .ui-state-highlight, +.ui-widget-header .ui-state-highlight { + border: 1px solid #fcefa1; + background: #fbf9ee url("images/ui-bg_glass_55_fbf9ee_1x400.png") 50% 50% repeat-x; + color: #363636; +} +.ui-state-checked { + border: 1px solid #fcefa1; + background: #fbf9ee; +} +.ui-state-highlight a, +.ui-widget-content .ui-state-highlight a, +.ui-widget-header .ui-state-highlight a { + color: #363636; +} +.ui-state-error, +.ui-widget-content .ui-state-error, +.ui-widget-header .ui-state-error { + border: 1px solid #cd0a0a; + background: #fef1ec url("images/ui-bg_glass_95_fef1ec_1x400.png") 50% 50% repeat-x; + color: #cd0a0a; +} +.ui-state-error a, +.ui-widget-content .ui-state-error a, +.ui-widget-header .ui-state-error a { + color: #cd0a0a; +} +.ui-state-error-text, +.ui-widget-content .ui-state-error-text, +.ui-widget-header .ui-state-error-text { + color: #cd0a0a; +} +.ui-priority-primary, +.ui-widget-content .ui-priority-primary, +.ui-widget-header .ui-priority-primary { + font-weight: bold; +} +.ui-priority-secondary, +.ui-widget-content .ui-priority-secondary, +.ui-widget-header .ui-priority-secondary { + opacity: .7; + font-weight: normal; +} +.ui-state-disabled, +.ui-widget-content .ui-state-disabled, +.ui-widget-header .ui-state-disabled { + opacity: .35; + background-image: none; +} + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { + width: 16px; + height: 16px; +} +.ui-icon, +.ui-widget-content .ui-icon { + background-image: url("images/ui-icons_222222_256x240.png"); +} +.ui-widget-header .ui-icon { + background-image: url("images/ui-icons_222222_256x240.png"); +} +.ui-state-hover .ui-icon, +.ui-state-focus .ui-icon, +.ui-button:hover .ui-icon, +.ui-button:focus .ui-icon { + background-image: url("images/ui-icons_454545_256x240.png"); +} +.ui-state-active .ui-icon, +.ui-button:active .ui-icon { + background-image: url("images/ui-icons_454545_256x240.png"); +} +.ui-state-highlight .ui-icon, +.ui-button .ui-state-highlight.ui-icon { + background-image: url("images/ui-icons_2e83ff_256x240.png"); +} +.ui-state-error .ui-icon, +.ui-state-error-text .ui-icon { + background-image: url("images/ui-icons_cd0a0a_256x240.png"); +} +.ui-button .ui-icon { + background-image: url("images/ui-icons_888888_256x240.png"); +} + +/* positioning */ +/* Three classes needed to override `.ui-button:hover .ui-icon` */ +.ui-icon-blank.ui-icon-blank.ui-icon-blank { + background-image: none; +} +.ui-icon-caret-1-n { background-position: 0 0; } +.ui-icon-caret-1-ne { background-position: -16px 0; } +.ui-icon-caret-1-e { background-position: -32px 0; } +.ui-icon-caret-1-se { background-position: -48px 0; } +.ui-icon-caret-1-s { background-position: -65px 0; } +.ui-icon-caret-1-sw { background-position: -80px 0; } +.ui-icon-caret-1-w { background-position: -96px 0; } +.ui-icon-caret-1-nw { background-position: -112px 0; } +.ui-icon-caret-2-n-s { background-position: -128px 0; } +.ui-icon-caret-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -65px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -65px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 1px -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-on { background-position: -96px -144px; } +.ui-icon-radio-off { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, +.ui-corner-top, +.ui-corner-left, +.ui-corner-tl { + border-top-left-radius: 4px; +} +.ui-corner-all, +.ui-corner-top, +.ui-corner-right, +.ui-corner-tr { + border-top-right-radius: 4px; +} +.ui-corner-all, +.ui-corner-bottom, +.ui-corner-left, +.ui-corner-bl { + border-bottom-left-radius: 4px; +} +.ui-corner-all, +.ui-corner-bottom, +.ui-corner-right, +.ui-corner-br { + border-bottom-right-radius: 4px; +} + +/* Overlays */ +.ui-widget-overlay { + background: #aaaaaa; + opacity: .3; +} +.ui-widget-shadow { + box-shadow: -8px -8px 8px #aaaaaa; +} diff --git a/include/thirdparty/jquery_ui/jquery-ui.js b/include/thirdparty/jquery_ui/jquery-ui.js new file mode 100644 index 0000000..04f6def --- /dev/null +++ b/include/thirdparty/jquery_ui/jquery-ui.js @@ -0,0 +1,18809 @@ +/*! jQuery UI - v1.14.1 - 2025-04-04 +* https://jqueryui.com +* Includes: widget.js, position.js, data.js, disable-selection.js, focusable.js, form-reset-mixin.js, jquery-patch.js, keycode.js, labels.js, scroll-parent.js, tabbable.js, unique-id.js, widgets/draggable.js, widgets/droppable.js, widgets/resizable.js, widgets/selectable.js, widgets/sortable.js, widgets/accordion.js, widgets/autocomplete.js, widgets/button.js, widgets/checkboxradio.js, widgets/controlgroup.js, widgets/datepicker.js, widgets/dialog.js, widgets/menu.js, widgets/mouse.js, widgets/progressbar.js, widgets/selectmenu.js, widgets/slider.js, widgets/spinner.js, widgets/tabs.js, widgets/tooltip.js, effect.js, effects/effect-blind.js, effects/effect-bounce.js, effects/effect-clip.js, effects/effect-drop.js, effects/effect-explode.js, effects/effect-fade.js, effects/effect-fold.js, effects/effect-highlight.js, effects/effect-puff.js, effects/effect-pulsate.js, effects/effect-scale.js, effects/effect-shake.js, effects/effect-size.js, effects/effect-slide.js, effects/effect-transfer.js +* Copyright OpenJS Foundation and other contributors; Licensed MIT */ + +( function( factory ) { + "use strict"; + + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define( [ "jquery" ], factory ); + } else { + + // Browser globals + factory( jQuery ); + } +} )( function( $ ) { +"use strict"; + +$.ui = $.ui || {}; + +var version = $.ui.version = "1.14.1"; + + +/*! + * jQuery UI Widget 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: Widget +//>>group: Core +//>>description: Provides a factory for creating stateful widgets with a common API. +//>>docs: https://api.jqueryui.com/jQuery.widget/ +//>>demos: https://jqueryui.com/widget/ + + +var widgetUuid = 0; +var widgetHasOwnProperty = Array.prototype.hasOwnProperty; +var widgetSlice = Array.prototype.slice; + +$.cleanData = ( function( orig ) { + return function( elems ) { + var events, elem, i; + for ( i = 0; ( elem = elems[ i ] ) != null; i++ ) { + + // Only trigger remove when necessary to save time + events = $._data( elem, "events" ); + if ( events && events.remove ) { + $( elem ).triggerHandler( "remove" ); + } + } + orig( elems ); + }; +} )( $.cleanData ); + +$.widget = function( name, base, prototype ) { + var existingConstructor, constructor, basePrototype; + + // ProxiedPrototype allows the provided prototype to remain unmodified + // so that it can be used as a mixin for multiple widgets (#8876) + var proxiedPrototype = {}; + + var namespace = name.split( "." )[ 0 ]; + name = name.split( "." )[ 1 ]; + if ( name === "__proto__" || name === "constructor" ) { + return $.error( "Invalid widget name: " + name ); + } + var fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + if ( Array.isArray( prototype ) ) { + prototype = $.extend.apply( null, [ {} ].concat( prototype ) ); + } + + // Create selector for plugin + $.expr.pseudos[ fullName.toLowerCase() ] = function( elem ) { + return !!$.data( elem, fullName ); + }; + + $[ namespace ] = $[ namespace ] || {}; + existingConstructor = $[ namespace ][ name ]; + constructor = $[ namespace ][ name ] = function( options, element ) { + + // Allow instantiation without "new" keyword + if ( !this || !this._createWidget ) { + return new constructor( options, element ); + } + + // Allow instantiation without initializing for simple inheritance + // must use "new" keyword (the code above always passes args) + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + // Extend with the existing constructor to carry over any static properties + $.extend( constructor, existingConstructor, { + version: prototype.version, + + // Copy the object used to create the prototype in case we need to + // redefine the widget later + _proto: $.extend( {}, prototype ), + + // Track widgets that inherit from this widget in case this widget is + // redefined after a widget inherits from it + _childConstructors: [] + } ); + + basePrototype = new base(); + + // We need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from + basePrototype.options = $.widget.extend( {}, basePrototype.options ); + $.each( prototype, function( prop, value ) { + if ( typeof value !== "function" ) { + proxiedPrototype[ prop ] = value; + return; + } + proxiedPrototype[ prop ] = ( function() { + function _super() { + return base.prototype[ prop ].apply( this, arguments ); + } + + function _superApply( args ) { + return base.prototype[ prop ].apply( this, args ); + } + + return function() { + var __super = this._super; + var __superApply = this._superApply; + var returnValue; + + this._super = _super; + this._superApply = _superApply; + + returnValue = value.apply( this, arguments ); + + this._super = __super; + this._superApply = __superApply; + + return returnValue; + }; + } )(); + } ); + constructor.prototype = $.widget.extend( basePrototype, { + + // TODO: remove support for widgetEventPrefix + // always use the name + a colon as the prefix, e.g., draggable:start + // don't prefix for widgets that aren't DOM-based + widgetEventPrefix: existingConstructor ? ( basePrototype.widgetEventPrefix || name ) : name + }, proxiedPrototype, { + constructor: constructor, + namespace: namespace, + widgetName: name, + widgetFullName: fullName + } ); + + // If this widget is being redefined then we need to find all widgets that + // are inheriting from it and redefine all of them so that they inherit from + // the new version of this widget. We're essentially trying to replace one + // level in the prototype chain. + if ( existingConstructor ) { + $.each( existingConstructor._childConstructors, function( i, child ) { + var childPrototype = child.prototype; + + // Redefine the child widget using the same prototype that was + // originally used, but inherit from the new version of the base + $.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor, + child._proto ); + } ); + + // Remove the list of existing child constructors from the old constructor + // so the old child constructors can be garbage collected + delete existingConstructor._childConstructors; + } else { + base._childConstructors.push( constructor ); + } + + $.widget.bridge( name, constructor ); + + return constructor; +}; + +$.widget.extend = function( target ) { + var input = widgetSlice.call( arguments, 1 ); + var inputIndex = 0; + var inputLength = input.length; + var key; + var value; + + for ( ; inputIndex < inputLength; inputIndex++ ) { + for ( key in input[ inputIndex ] ) { + value = input[ inputIndex ][ key ]; + if ( widgetHasOwnProperty.call( input[ inputIndex ], key ) && value !== undefined ) { + + // Clone objects + if ( $.isPlainObject( value ) ) { + target[ key ] = $.isPlainObject( target[ key ] ) ? + $.widget.extend( {}, target[ key ], value ) : + + // Don't extend strings, arrays, etc. with objects + $.widget.extend( {}, value ); + + // Copy everything else by reference + } else { + target[ key ] = value; + } + } + } + } + return target; +}; + +$.widget.bridge = function( name, object ) { + var fullName = object.prototype.widgetFullName || name; + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string"; + var args = widgetSlice.call( arguments, 1 ); + var returnValue = this; + + if ( isMethodCall ) { + + // If this is an empty collection, we need to have the instance method + // return undefined instead of the jQuery instance + if ( !this.length && options === "instance" ) { + returnValue = undefined; + } else { + this.each( function() { + var methodValue; + var instance = $.data( this, fullName ); + + if ( options === "instance" ) { + returnValue = instance; + return false; + } + + if ( !instance ) { + return $.error( "cannot call methods on " + name + + " prior to initialization; " + + "attempted to call method '" + options + "'" ); + } + + if ( typeof instance[ options ] !== "function" || + options.charAt( 0 ) === "_" ) { + return $.error( "no such method '" + options + "' for " + name + + " widget instance" ); + } + + methodValue = instance[ options ].apply( instance, args ); + + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue && methodValue.jquery ? + returnValue.pushStack( methodValue.get() ) : + methodValue; + return false; + } + } ); + } + } else { + + // Allow multiple hashes to be passed on init + if ( args.length ) { + options = $.widget.extend.apply( null, [ options ].concat( args ) ); + } + + this.each( function() { + var instance = $.data( this, fullName ); + if ( instance ) { + instance.option( options || {} ); + if ( instance._init ) { + instance._init(); + } + } else { + $.data( this, fullName, new object( options, this ) ); + } + } ); + } + + return returnValue; + }; +}; + +$.Widget = function( /* options, element */ ) {}; +$.Widget._childConstructors = []; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + defaultElement: "
          ", + + options: { + classes: {}, + disabled: false, + + // Callbacks + create: null + }, + + _createWidget: function( options, element ) { + element = $( element || this.defaultElement || this )[ 0 ]; + this.element = $( element ); + this.uuid = widgetUuid++; + this.eventNamespace = "." + this.widgetName + this.uuid; + + this.bindings = $(); + this.hoverable = $(); + this.focusable = $(); + this.classesElementLookup = {}; + + if ( element !== this ) { + $.data( element, this.widgetFullName, this ); + this._on( true, this.element, { + remove: function( event ) { + if ( event.target === element ) { + this.destroy(); + } + } + } ); + this.document = $( element.style ? + + // Element within the document + element.ownerDocument : + + // Element is window or document + element.document || element ); + this.window = $( this.document[ 0 ].defaultView || this.document[ 0 ].parentWindow ); + } + + this.options = $.widget.extend( {}, + this.options, + this._getCreateOptions(), + options ); + + this._create(); + + if ( this.options.disabled ) { + this._setOptionDisabled( this.options.disabled ); + } + + this._trigger( "create", null, this._getCreateEventData() ); + this._init(); + }, + + _getCreateOptions: function() { + return {}; + }, + + _getCreateEventData: $.noop, + + _create: $.noop, + + _init: $.noop, + + destroy: function() { + var that = this; + + this._destroy(); + $.each( this.classesElementLookup, function( key, value ) { + that._removeClass( value, key ); + } ); + + // We can probably remove the unbind calls in 2.0 + // all event bindings should go through this._on() + this.element + .off( this.eventNamespace ) + .removeData( this.widgetFullName ); + this.widget() + .off( this.eventNamespace ) + .removeAttr( "aria-disabled" ); + + // Clean up events and states + this.bindings.off( this.eventNamespace ); + }, + + _destroy: $.noop, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + var parts; + var curOption; + var i; + + if ( arguments.length === 0 ) { + + // Don't return a reference to the internal hash + return $.widget.extend( {}, this.options ); + } + + if ( typeof key === "string" ) { + + // Handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } } + options = {}; + parts = key.split( "." ); + key = parts.shift(); + if ( parts.length ) { + curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] ); + for ( i = 0; i < parts.length - 1; i++ ) { + curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {}; + curOption = curOption[ parts[ i ] ]; + } + key = parts.pop(); + if ( arguments.length === 1 ) { + return curOption[ key ] === undefined ? null : curOption[ key ]; + } + curOption[ key ] = value; + } else { + if ( arguments.length === 1 ) { + return this.options[ key ] === undefined ? null : this.options[ key ]; + } + options[ key ] = value; + } + } + + this._setOptions( options ); + + return this; + }, + + _setOptions: function( options ) { + var key; + + for ( key in options ) { + this._setOption( key, options[ key ] ); + } + + return this; + }, + + _setOption: function( key, value ) { + if ( key === "classes" ) { + this._setOptionClasses( value ); + } + + this.options[ key ] = value; + + if ( key === "disabled" ) { + this._setOptionDisabled( value ); + } + + return this; + }, + + _setOptionClasses: function( value ) { + var classKey, elements, currentElements; + + for ( classKey in value ) { + currentElements = this.classesElementLookup[ classKey ]; + if ( value[ classKey ] === this.options.classes[ classKey ] || + !currentElements || + !currentElements.length ) { + continue; + } + + // We are doing this to create a new jQuery object because the _removeClass() call + // on the next line is going to destroy the reference to the current elements being + // tracked. We need to save a copy of this collection so that we can add the new classes + // below. + elements = $( currentElements.get() ); + this._removeClass( currentElements, classKey ); + + // We don't use _addClass() here, because that uses this.options.classes + // for generating the string of classes. We want to use the value passed in from + // _setOption(), this is the new value of the classes option which was passed to + // _setOption(). We pass this value directly to _classes(). + elements.addClass( this._classes( { + element: elements, + keys: classKey, + classes: value, + add: true + } ) ); + } + }, + + _setOptionDisabled: function( value ) { + this._toggleClass( this.widget(), this.widgetFullName + "-disabled", null, !!value ); + + // If the widget is becoming disabled, then nothing is interactive + if ( value ) { + this._removeClass( this.hoverable, null, "ui-state-hover" ); + this._removeClass( this.focusable, null, "ui-state-focus" ); + } + }, + + enable: function() { + return this._setOptions( { disabled: false } ); + }, + + disable: function() { + return this._setOptions( { disabled: true } ); + }, + + _classes: function( options ) { + var full = []; + var that = this; + + options = $.extend( { + element: this.element, + classes: this.options.classes || {} + }, options ); + + function bindRemoveEvent() { + var nodesToBind = []; + + options.element.each( function( _, element ) { + var isTracked = $.map( that.classesElementLookup, function( elements ) { + return elements; + } ) + .some( function( elements ) { + return elements.is( element ); + } ); + + if ( !isTracked ) { + nodesToBind.push( element ); + } + } ); + + that._on( $( nodesToBind ), { + remove: "_untrackClassesElement" + } ); + } + + function processClassString( classes, checkOption ) { + var current, i; + for ( i = 0; i < classes.length; i++ ) { + current = that.classesElementLookup[ classes[ i ] ] || $(); + if ( options.add ) { + bindRemoveEvent(); + current = $( $.uniqueSort( current.get().concat( options.element.get() ) ) ); + } else { + current = $( current.not( options.element ).get() ); + } + that.classesElementLookup[ classes[ i ] ] = current; + full.push( classes[ i ] ); + if ( checkOption && options.classes[ classes[ i ] ] ) { + full.push( options.classes[ classes[ i ] ] ); + } + } + } + + if ( options.keys ) { + processClassString( options.keys.match( /\S+/g ) || [], true ); + } + if ( options.extra ) { + processClassString( options.extra.match( /\S+/g ) || [] ); + } + + return full.join( " " ); + }, + + _untrackClassesElement: function( event ) { + var that = this; + $.each( that.classesElementLookup, function( key, value ) { + if ( $.inArray( event.target, value ) !== -1 ) { + that.classesElementLookup[ key ] = $( value.not( event.target ).get() ); + } + } ); + + this._off( $( event.target ) ); + }, + + _removeClass: function( element, keys, extra ) { + return this._toggleClass( element, keys, extra, false ); + }, + + _addClass: function( element, keys, extra ) { + return this._toggleClass( element, keys, extra, true ); + }, + + _toggleClass: function( element, keys, extra, add ) { + add = ( typeof add === "boolean" ) ? add : extra; + var shift = ( typeof element === "string" || element === null ), + options = { + extra: shift ? keys : extra, + keys: shift ? element : keys, + element: shift ? this.element : element, + add: add + }; + options.element.toggleClass( this._classes( options ), add ); + return this; + }, + + _on: function( suppressDisabledCheck, element, handlers ) { + var delegateElement; + var instance = this; + + // No suppressDisabledCheck flag, shuffle arguments + if ( typeof suppressDisabledCheck !== "boolean" ) { + handlers = element; + element = suppressDisabledCheck; + suppressDisabledCheck = false; + } + + // No element argument, shuffle and use this.element + if ( !handlers ) { + handlers = element; + element = this.element; + delegateElement = this.widget(); + } else { + element = delegateElement = $( element ); + this.bindings = this.bindings.add( element ); + } + + $.each( handlers, function( event, handler ) { + function handlerProxy() { + + // Allow widgets to customize the disabled handling + // - disabled as an array instead of boolean + // - disabled class as method for disabling individual parts + if ( !suppressDisabledCheck && + ( instance.options.disabled === true || + $( this ).hasClass( "ui-state-disabled" ) ) ) { + return; + } + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + + // Copy the guid so direct unbinding works + if ( typeof handler !== "string" ) { + handlerProxy.guid = handler.guid = + handler.guid || handlerProxy.guid || $.guid++; + } + + var match = event.match( /^([\w:-]*)\s*(.*)$/ ); + var eventName = match[ 1 ] + instance.eventNamespace; + var selector = match[ 2 ]; + + if ( selector ) { + delegateElement.on( eventName, selector, handlerProxy ); + } else { + element.on( eventName, handlerProxy ); + } + } ); + }, + + _off: function( element, eventName ) { + eventName = ( eventName || "" ).split( " " ).join( this.eventNamespace + " " ) + + this.eventNamespace; + element.off( eventName ); + + // Clear the stack to avoid memory leaks (#10056) + this.bindings = $( this.bindings.not( element ).get() ); + this.focusable = $( this.focusable.not( element ).get() ); + this.hoverable = $( this.hoverable.not( element ).get() ); + }, + + _delay: function( handler, delay ) { + function handlerProxy() { + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + var instance = this; + return setTimeout( handlerProxy, delay || 0 ); + }, + + _hoverable: function( element ) { + this.hoverable = this.hoverable.add( element ); + this._on( element, { + mouseenter: function( event ) { + this._addClass( $( event.currentTarget ), null, "ui-state-hover" ); + }, + mouseleave: function( event ) { + this._removeClass( $( event.currentTarget ), null, "ui-state-hover" ); + } + } ); + }, + + _focusable: function( element ) { + this.focusable = this.focusable.add( element ); + this._on( element, { + focusin: function( event ) { + this._addClass( $( event.currentTarget ), null, "ui-state-focus" ); + }, + focusout: function( event ) { + this._removeClass( $( event.currentTarget ), null, "ui-state-focus" ); + } + } ); + }, + + _trigger: function( type, event, data ) { + var prop, orig; + var callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + + // The original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // Copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + return !( typeof callback === "function" && + callback.apply( this.element[ 0 ], [ event ].concat( data ) ) === false || + event.isDefaultPrevented() ); + } +}; + +$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) { + $.Widget.prototype[ "_" + method ] = function( element, options, callback ) { + if ( typeof options === "string" ) { + options = { effect: options }; + } + + var hasOptions; + var effectName = !options ? + method : + options === true || typeof options === "number" ? + defaultEffect : + options.effect || defaultEffect; + + options = options || {}; + if ( typeof options === "number" ) { + options = { duration: options }; + } else if ( options === true ) { + options = {}; + } + + hasOptions = !$.isEmptyObject( options ); + options.complete = callback; + + if ( options.delay ) { + element.delay( options.delay ); + } + + if ( hasOptions && $.effects && $.effects.effect[ effectName ] ) { + element[ method ]( options ); + } else if ( effectName !== method && element[ effectName ] ) { + element[ effectName ]( options.duration, options.easing, callback ); + } else { + element.queue( function( next ) { + $( this )[ method ](); + if ( callback ) { + callback.call( element[ 0 ] ); + } + next(); + } ); + } + }; +} ); + +var widget = $.widget; + + +/*! + * jQuery UI Position 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + * + * https://api.jqueryui.com/position/ + */ + +//>>label: Position +//>>group: Core +//>>description: Positions elements relative to other elements. +//>>docs: https://api.jqueryui.com/position/ +//>>demos: https://jqueryui.com/position/ + + +( function() { +var cachedScrollbarWidth, + max = Math.max, + abs = Math.abs, + rhorizontal = /left|center|right/, + rvertical = /top|center|bottom/, + roffset = /[\+\-]\d+(\.[\d]+)?%?/, + rposition = /^\w+/, + rpercent = /%$/, + _position = $.fn.position; + +function getOffsets( offsets, width, height ) { + return [ + parseFloat( offsets[ 0 ] ) * ( rpercent.test( offsets[ 0 ] ) ? width / 100 : 1 ), + parseFloat( offsets[ 1 ] ) * ( rpercent.test( offsets[ 1 ] ) ? height / 100 : 1 ) + ]; +} + +function parseCss( element, property ) { + return parseInt( $.css( element, property ), 10 ) || 0; +} + +function isWindow( obj ) { + return obj != null && obj === obj.window; +} + +function getDimensions( elem ) { + var raw = elem[ 0 ]; + if ( raw.nodeType === 9 ) { + return { + width: elem.width(), + height: elem.height(), + offset: { top: 0, left: 0 } + }; + } + if ( isWindow( raw ) ) { + return { + width: elem.width(), + height: elem.height(), + offset: { top: elem.scrollTop(), left: elem.scrollLeft() } + }; + } + if ( raw.preventDefault ) { + return { + width: 0, + height: 0, + offset: { top: raw.pageY, left: raw.pageX } + }; + } + return { + width: elem.outerWidth(), + height: elem.outerHeight(), + offset: elem.offset() + }; +} + +$.position = { + scrollbarWidth: function() { + if ( cachedScrollbarWidth !== undefined ) { + return cachedScrollbarWidth; + } + var w1, w2, + div = $( "
          " + + "
          " ), + innerDiv = div.children()[ 0 ]; + + $( "body" ).append( div ); + w1 = innerDiv.offsetWidth; + div.css( "overflow", "scroll" ); + + w2 = innerDiv.offsetWidth; + + if ( w1 === w2 ) { + w2 = div[ 0 ].clientWidth; + } + + div.remove(); + + return ( cachedScrollbarWidth = w1 - w2 ); + }, + getScrollInfo: function( within ) { + var overflowX = within.isWindow || within.isDocument ? "" : + within.element.css( "overflow-x" ), + overflowY = within.isWindow || within.isDocument ? "" : + within.element.css( "overflow-y" ), + hasOverflowX = overflowX === "scroll" || + ( overflowX === "auto" && within.width < within.element[ 0 ].scrollWidth ), + hasOverflowY = overflowY === "scroll" || + ( overflowY === "auto" && within.height < within.element[ 0 ].scrollHeight ); + return { + width: hasOverflowY ? $.position.scrollbarWidth() : 0, + height: hasOverflowX ? $.position.scrollbarWidth() : 0 + }; + }, + getWithinInfo: function( element ) { + var withinElement = $( element || window ), + isElemWindow = isWindow( withinElement[ 0 ] ), + isDocument = !!withinElement[ 0 ] && withinElement[ 0 ].nodeType === 9, + hasOffset = !isElemWindow && !isDocument; + return { + element: withinElement, + isWindow: isElemWindow, + isDocument: isDocument, + offset: hasOffset ? $( element ).offset() : { left: 0, top: 0 }, + scrollLeft: withinElement.scrollLeft(), + scrollTop: withinElement.scrollTop(), + width: withinElement.outerWidth(), + height: withinElement.outerHeight() + }; + } +}; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // Make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var atOffset, targetWidth, targetHeight, targetOffset, basePosition, dimensions, + + // Make sure string options are treated as CSS selectors + target = typeof options.of === "string" ? + $( document ).find( options.of ) : + $( options.of ), + + within = $.position.getWithinInfo( options.within ), + scrollInfo = $.position.getScrollInfo( within ), + collision = ( options.collision || "flip" ).split( " " ), + offsets = {}; + + dimensions = getDimensions( target ); + if ( target[ 0 ].preventDefault ) { + + // Force left top to allow flipping + options.at = "left top"; + } + targetWidth = dimensions.width; + targetHeight = dimensions.height; + targetOffset = dimensions.offset; + + // Clone to reuse original targetOffset later + basePosition = $.extend( {}, targetOffset ); + + // Force my and at to have valid horizontal and vertical positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[ this ] || "" ).split( " " ), + horizontalOffset, + verticalOffset; + + if ( pos.length === 1 ) { + pos = rhorizontal.test( pos[ 0 ] ) ? + pos.concat( [ "center" ] ) : + rvertical.test( pos[ 0 ] ) ? + [ "center" ].concat( pos ) : + [ "center", "center" ]; + } + pos[ 0 ] = rhorizontal.test( pos[ 0 ] ) ? pos[ 0 ] : "center"; + pos[ 1 ] = rvertical.test( pos[ 1 ] ) ? pos[ 1 ] : "center"; + + // Calculate offsets + horizontalOffset = roffset.exec( pos[ 0 ] ); + verticalOffset = roffset.exec( pos[ 1 ] ); + offsets[ this ] = [ + horizontalOffset ? horizontalOffset[ 0 ] : 0, + verticalOffset ? verticalOffset[ 0 ] : 0 + ]; + + // Reduce to just the positions without the offsets + options[ this ] = [ + rposition.exec( pos[ 0 ] )[ 0 ], + rposition.exec( pos[ 1 ] )[ 0 ] + ]; + } ); + + // Normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + if ( options.at[ 0 ] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[ 0 ] === "center" ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[ 1 ] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[ 1 ] === "center" ) { + basePosition.top += targetHeight / 2; + } + + atOffset = getOffsets( offsets.at, targetWidth, targetHeight ); + basePosition.left += atOffset[ 0 ]; + basePosition.top += atOffset[ 1 ]; + + return this.each( function() { + var collisionPosition, using, + elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseCss( this, "marginLeft" ), + marginTop = parseCss( this, "marginTop" ), + collisionWidth = elemWidth + marginLeft + parseCss( this, "marginRight" ) + + scrollInfo.width, + collisionHeight = elemHeight + marginTop + parseCss( this, "marginBottom" ) + + scrollInfo.height, + position = $.extend( {}, basePosition ), + myOffset = getOffsets( offsets.my, elem.outerWidth(), elem.outerHeight() ); + + if ( options.my[ 0 ] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[ 0 ] === "center" ) { + position.left -= elemWidth / 2; + } + + if ( options.my[ 1 ] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[ 1 ] === "center" ) { + position.top -= elemHeight / 2; + } + + position.left += myOffset[ 0 ]; + position.top += myOffset[ 1 ]; + + collisionPosition = { + marginLeft: marginLeft, + marginTop: marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[ i ] ] ) { + $.ui.position[ collision[ i ] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: [ atOffset[ 0 ] + myOffset[ 0 ], atOffset [ 1 ] + myOffset[ 1 ] ], + my: options.my, + at: options.at, + within: within, + elem: elem + } ); + } + } ); + + if ( options.using ) { + + // Adds feedback as second argument to using callback, if present + using = function( props ) { + var left = targetOffset.left - position.left, + right = left + targetWidth - elemWidth, + top = targetOffset.top - position.top, + bottom = top + targetHeight - elemHeight, + feedback = { + target: { + element: target, + left: targetOffset.left, + top: targetOffset.top, + width: targetWidth, + height: targetHeight + }, + element: { + element: elem, + left: position.left, + top: position.top, + width: elemWidth, + height: elemHeight + }, + horizontal: right < 0 ? "left" : left > 0 ? "right" : "center", + vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle" + }; + if ( targetWidth < elemWidth && abs( left + right ) < targetWidth ) { + feedback.horizontal = "center"; + } + if ( targetHeight < elemHeight && abs( top + bottom ) < targetHeight ) { + feedback.vertical = "middle"; + } + if ( max( abs( left ), abs( right ) ) > max( abs( top ), abs( bottom ) ) ) { + feedback.important = "horizontal"; + } else { + feedback.important = "vertical"; + } + options.using.call( this, props, feedback ); + }; + } + + elem.offset( $.extend( position, { using: using } ) ); + } ); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollLeft : within.offset.left, + outerWidth = within.width, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = withinOffset - collisionPosLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset, + newOverRight; + + // Element is wider than within + if ( data.collisionWidth > outerWidth ) { + + // Element is initially over the left side of within + if ( overLeft > 0 && overRight <= 0 ) { + newOverRight = position.left + overLeft + data.collisionWidth - outerWidth - + withinOffset; + position.left += overLeft - newOverRight; + + // Element is initially over right side of within + } else if ( overRight > 0 && overLeft <= 0 ) { + position.left = withinOffset; + + // Element is initially over both left and right sides of within + } else { + if ( overLeft > overRight ) { + position.left = withinOffset + outerWidth - data.collisionWidth; + } else { + position.left = withinOffset; + } + } + + // Too far left -> align with left edge + } else if ( overLeft > 0 ) { + position.left += overLeft; + + // Too far right -> align with right edge + } else if ( overRight > 0 ) { + position.left -= overRight; + + // Adjust based on position and margin + } else { + position.left = max( position.left - collisionPosLeft, position.left ); + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollTop : within.offset.top, + outerHeight = data.within.height, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = withinOffset - collisionPosTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset, + newOverBottom; + + // Element is taller than within + if ( data.collisionHeight > outerHeight ) { + + // Element is initially over the top of within + if ( overTop > 0 && overBottom <= 0 ) { + newOverBottom = position.top + overTop + data.collisionHeight - outerHeight - + withinOffset; + position.top += overTop - newOverBottom; + + // Element is initially over bottom of within + } else if ( overBottom > 0 && overTop <= 0 ) { + position.top = withinOffset; + + // Element is initially over both top and bottom of within + } else { + if ( overTop > overBottom ) { + position.top = withinOffset + outerHeight - data.collisionHeight; + } else { + position.top = withinOffset; + } + } + + // Too far up -> align with top + } else if ( overTop > 0 ) { + position.top += overTop; + + // Too far down -> align with bottom edge + } else if ( overBottom > 0 ) { + position.top -= overBottom; + + // Adjust based on position and margin + } else { + position.top = max( position.top - collisionPosTop, position.top ); + } + } + }, + flip: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.offset.left + within.scrollLeft, + outerWidth = within.width, + offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = collisionPosLeft - offsetLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft, + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + data.at[ 0 ] === "right" ? + -data.targetWidth : + 0, + offset = -2 * data.offset[ 0 ], + newOverRight, + newOverLeft; + + if ( overLeft < 0 ) { + newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth - + outerWidth - withinOffset; + if ( newOverRight < 0 || newOverRight < abs( overLeft ) ) { + position.left += myOffset + atOffset + offset; + } + } else if ( overRight > 0 ) { + newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset + + atOffset + offset - offsetLeft; + if ( newOverLeft > 0 || abs( newOverLeft ) < overRight ) { + position.left += myOffset + atOffset + offset; + } + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.offset.top + within.scrollTop, + outerHeight = within.height, + offsetTop = within.isWindow ? within.scrollTop : within.offset.top, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = collisionPosTop - offsetTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop, + top = data.my[ 1 ] === "top", + myOffset = top ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + data.at[ 1 ] === "bottom" ? + -data.targetHeight : + 0, + offset = -2 * data.offset[ 1 ], + newOverTop, + newOverBottom; + if ( overTop < 0 ) { + newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight - + outerHeight - withinOffset; + if ( newOverBottom < 0 || newOverBottom < abs( overTop ) ) { + position.top += myOffset + atOffset + offset; + } + } else if ( overBottom > 0 ) { + newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset + + offset - offsetTop; + if ( newOverTop > 0 || abs( newOverTop ) < overBottom ) { + position.top += myOffset + atOffset + offset; + } + } + } + }, + flipfit: { + left: function() { + $.ui.position.flip.left.apply( this, arguments ); + $.ui.position.fit.left.apply( this, arguments ); + }, + top: function() { + $.ui.position.flip.top.apply( this, arguments ); + $.ui.position.fit.top.apply( this, arguments ); + } + } +}; + +} )(); + +var position = $.ui.position; + + +/*! + * jQuery UI :data 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: :data Selector +//>>group: Core +//>>description: Selects elements which have data stored under the specified key. +//>>docs: https://api.jqueryui.com/data-selector/ + + +var data = $.extend( $.expr.pseudos, { + data: $.expr.createPseudo( function( dataName ) { + return function( elem ) { + return !!$.data( elem, dataName ); + }; + } ) +} ); + +/*! + * jQuery UI Disable Selection 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: disableSelection +//>>group: Core +//>>description: Disable selection of text content within the set of matched elements. +//>>docs: https://api.jqueryui.com/disableSelection/ + +// This file is deprecated + +var disableSelection = $.fn.extend( { + disableSelection: ( function() { + var eventType = "onselectstart" in document.createElement( "div" ) ? + "selectstart" : + "mousedown"; + + return function() { + return this.on( eventType + ".ui-disableSelection", function( event ) { + event.preventDefault(); + } ); + }; + } )(), + + enableSelection: function() { + return this.off( ".ui-disableSelection" ); + } +} ); + + +/*! + * jQuery UI Focusable 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: :focusable Selector +//>>group: Core +//>>description: Selects elements which can be focused. +//>>docs: https://api.jqueryui.com/focusable-selector/ + + +// Selectors +$.ui.focusable = function( element, hasTabindex ) { + var map, mapName, img, focusableIfVisible, fieldset, + nodeName = element.nodeName.toLowerCase(); + + if ( "area" === nodeName ) { + map = element.parentNode; + mapName = map.name; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap='#" + mapName + "']" ); + return img.length > 0 && img.is( ":visible" ); + } + + if ( /^(input|select|textarea|button|object)$/.test( nodeName ) ) { + focusableIfVisible = !element.disabled; + + if ( focusableIfVisible ) { + + // Form controls within a disabled fieldset are disabled. + // However, controls within the fieldset's legend do not get disabled. + // Since controls generally aren't placed inside legends, we skip + // this portion of the check. + fieldset = $( element ).closest( "fieldset" )[ 0 ]; + if ( fieldset ) { + focusableIfVisible = !fieldset.disabled; + } + } + } else if ( "a" === nodeName ) { + focusableIfVisible = element.href || hasTabindex; + } else { + focusableIfVisible = hasTabindex; + } + + return focusableIfVisible && $( element ).is( ":visible" ) && + $( element ).css( "visibility" ) === "visible"; +}; + +$.extend( $.expr.pseudos, { + focusable: function( element ) { + return $.ui.focusable( element, $.attr( element, "tabindex" ) != null ); + } +} ); + +var focusable = $.ui.focusable; + + +/*! + * jQuery UI Form Reset Mixin 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: Form Reset Mixin +//>>group: Core +//>>description: Refresh input widgets when their form is reset +//>>docs: https://api.jqueryui.com/form-reset-mixin/ + + +var formResetMixin = $.ui.formResetMixin = { + _formResetHandler: function() { + var form = $( this ); + + // Wait for the form reset to actually happen before refreshing + setTimeout( function() { + var instances = form.data( "ui-form-reset-instances" ); + $.each( instances, function() { + this.refresh(); + } ); + } ); + }, + + _bindFormResetHandler: function() { + this.form = $( this.element.prop( "form" ) ); + if ( !this.form.length ) { + return; + } + + var instances = this.form.data( "ui-form-reset-instances" ) || []; + if ( !instances.length ) { + + // We don't use _on() here because we use a single event handler per form + this.form.on( "reset.ui-form-reset", this._formResetHandler ); + } + instances.push( this ); + this.form.data( "ui-form-reset-instances", instances ); + }, + + _unbindFormResetHandler: function() { + if ( !this.form.length ) { + return; + } + + var instances = this.form.data( "ui-form-reset-instances" ); + instances.splice( $.inArray( this, instances ), 1 ); + if ( instances.length ) { + this.form.data( "ui-form-reset-instances", instances ); + } else { + this.form + .removeData( "ui-form-reset-instances" ) + .off( "reset.ui-form-reset" ); + } + } +}; + + +/*! + * jQuery UI Legacy jQuery Core patches 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + * + */ + +//>>label: Legacy jQuery Core patches +//>>group: Core +//>>description: Backport `.even()`, `.odd()` and `$.escapeSelector` to older jQuery Core versions (deprecated) + + +// Support: jQuery 2.2.x or older. +// This method has been defined in jQuery 3.0.0. +// Code from https://github.com/jquery/jquery/blob/e539bac79e666bba95bba86d690b4e609dca2286/src/selector/escapeSelector.js +if ( !$.escapeSelector ) { + $.escapeSelector = function( id ) { + return CSS.escape( id + "" ); + }; +} + +// Support: jQuery 3.4.x or older +// These methods have been defined in jQuery 3.5.0. +if ( !$.fn.even || !$.fn.odd ) { + $.fn.extend( { + even: function() { + return this.filter( function( i ) { + return i % 2 === 0; + } ); + }, + odd: function() { + return this.filter( function( i ) { + return i % 2 === 1; + } ); + } + } ); +} + +; +/*! + * jQuery UI Keycode 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: Keycode +//>>group: Core +//>>description: Provide keycodes as keynames +//>>docs: https://api.jqueryui.com/jQuery.ui.keyCode/ + + +var keycode = $.ui.keyCode = { + BACKSPACE: 8, + COMMA: 188, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + LEFT: 37, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SPACE: 32, + TAB: 9, + UP: 38 +}; + + +/*! + * jQuery UI Labels 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: labels +//>>group: Core +//>>description: Find all the labels associated with a given input +//>>docs: https://api.jqueryui.com/labels/ + + +var labels = $.fn.labels = function() { + var ancestor, selector, id, labels, ancestors; + + if ( !this.length ) { + return this.pushStack( [] ); + } + + // Check control.labels first + if ( this[ 0 ].labels && this[ 0 ].labels.length ) { + return this.pushStack( this[ 0 ].labels ); + } + + // If `control.labels` is empty - e.g. inside of document fragments - find + // the labels manually + labels = this.eq( 0 ).parents( "label" ); + + // Look for the label based on the id + id = this.attr( "id" ); + if ( id ) { + + // We don't search against the document in case the element + // is disconnected from the DOM + ancestor = this.eq( 0 ).parents().last(); + + // Get a full set of top level ancestors + ancestors = ancestor.add( ancestor.length ? ancestor.siblings() : this.siblings() ); + + // Create a selector for the label based on the id + selector = "label[for='" + CSS.escape( id ) + "']"; + + labels = labels.add( ancestors.find( selector ).addBack( selector ) ); + + } + + // Return whatever we have found for labels + return this.pushStack( labels ); +}; + + +/*! + * jQuery UI Scroll Parent 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: scrollParent +//>>group: Core +//>>description: Get the closest ancestor element that is scrollable. +//>>docs: https://api.jqueryui.com/scrollParent/ + + +var scrollParent = $.fn.scrollParent = function( includeHidden ) { + var position = this.css( "position" ), + excludeStaticParent = position === "absolute", + overflowRegex = includeHidden ? /(auto|scroll|hidden)/ : /(auto|scroll)/, + scrollParent = this.parents().filter( function() { + var parent = $( this ); + if ( excludeStaticParent && parent.css( "position" ) === "static" ) { + return false; + } + return overflowRegex.test( parent.css( "overflow" ) + parent.css( "overflow-y" ) + + parent.css( "overflow-x" ) ); + } ).eq( 0 ); + + return position === "fixed" || !scrollParent.length ? + $( this[ 0 ].ownerDocument || document ) : + scrollParent; +}; + + +/*! + * jQuery UI Tabbable 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: :tabbable Selector +//>>group: Core +//>>description: Selects elements which can be tabbed to. +//>>docs: https://api.jqueryui.com/tabbable-selector/ + + +var tabbable = $.extend( $.expr.pseudos, { + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + hasTabindex = tabIndex != null; + return ( !hasTabindex || tabIndex >= 0 ) && $.ui.focusable( element, hasTabindex ); + } +} ); + + +/*! + * jQuery UI Unique ID 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: uniqueId +//>>group: Core +//>>description: Functions to generate and remove uniqueId's +//>>docs: https://api.jqueryui.com/uniqueId/ + + +var uniqueId = $.fn.extend( { + uniqueId: ( function() { + var uuid = 0; + + return function() { + return this.each( function() { + if ( !this.id ) { + this.id = "ui-id-" + ( ++uuid ); + } + } ); + }; + } )(), + + removeUniqueId: function() { + return this.each( function() { + if ( /^ui-id-\d+$/.test( this.id ) ) { + $( this ).removeAttr( "id" ); + } + } ); + } +} ); + + +/*! + * jQuery UI Mouse 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: Mouse +//>>group: Widgets +//>>description: Abstracts mouse-based interactions to assist in creating certain widgets. +//>>docs: https://api.jqueryui.com/mouse/ + + +var mouseHandled = false; +$( document ).on( "mouseup", function() { + mouseHandled = false; +} ); + +var widgetsMouse = $.widget( "ui.mouse", { + version: "1.14.1", + options: { + cancel: "input, textarea, button, select, option", + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var that = this; + + this.element + .on( "mousedown." + this.widgetName, function( event ) { + return that._mouseDown( event ); + } ) + .on( "click." + this.widgetName, function( event ) { + if ( true === $.data( event.target, that.widgetName + ".preventClickEvent" ) ) { + $.removeData( event.target, that.widgetName + ".preventClickEvent" ); + event.stopImmediatePropagation(); + return false; + } + } ); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.off( "." + this.widgetName ); + if ( this._mouseMoveDelegate ) { + this.document + .off( "mousemove." + this.widgetName, this._mouseMoveDelegate ) + .off( "mouseup." + this.widgetName, this._mouseUpDelegate ); + } + }, + + _mouseDown: function( event ) { + + // don't let more than one widget handle mouseStart + if ( mouseHandled ) { + return; + } + + this._mouseMoved = false; + + // We may have missed mouseup (out of window) + if ( this._mouseStarted ) { + this._mouseUp( event ); + } + + this._mouseDownEvent = event; + + var that = this, + btnIsLeft = event.which === 1, + elIsCancel = typeof this.options.cancel === "string" ? + $( event.target ).closest( this.options.cancel ).length : + false; + if ( !btnIsLeft || elIsCancel || !this._mouseCapture( event ) ) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if ( !this.mouseDelayMet ) { + this._mouseDelayTimer = setTimeout( function() { + that.mouseDelayMet = true; + }, this.options.delay ); + } + + if ( this._mouseDistanceMet( event ) && this._mouseDelayMet( event ) ) { + this._mouseStarted = ( this._mouseStart( event ) !== false ); + if ( !this._mouseStarted ) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if ( true === $.data( event.target, this.widgetName + ".preventClickEvent" ) ) { + $.removeData( event.target, this.widgetName + ".preventClickEvent" ); + } + + // These delegates are required to keep context + this._mouseMoveDelegate = function( event ) { + return that._mouseMove( event ); + }; + this._mouseUpDelegate = function( event ) { + return that._mouseUp( event ); + }; + + this.document + .on( "mousemove." + this.widgetName, this._mouseMoveDelegate ) + .on( "mouseup." + this.widgetName, this._mouseUpDelegate ); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function( event ) { + + // Only check for mouseups outside the document if you've moved inside the document + // at least once. + if ( this._mouseMoved && !event.which ) { + + // Support: Safari <=8 - 9 + // Safari sets which to 0 if you press any of the following keys + // during a drag (#14461) + if ( event.originalEvent.altKey || event.originalEvent.ctrlKey || + event.originalEvent.metaKey || event.originalEvent.shiftKey ) { + this.ignoreMissingWhich = true; + } else if ( !this.ignoreMissingWhich ) { + return this._mouseUp( event ); + } + } + + if ( event.which || event.button ) { + this._mouseMoved = true; + } + + if ( this._mouseStarted ) { + this._mouseDrag( event ); + return event.preventDefault(); + } + + if ( this._mouseDistanceMet( event ) && this._mouseDelayMet( event ) ) { + this._mouseStarted = + ( this._mouseStart( this._mouseDownEvent, event ) !== false ); + if ( this._mouseStarted ) { + this._mouseDrag( event ); + } else { + this._mouseUp( event ); + } + } + + return !this._mouseStarted; + }, + + _mouseUp: function( event ) { + this.document + .off( "mousemove." + this.widgetName, this._mouseMoveDelegate ) + .off( "mouseup." + this.widgetName, this._mouseUpDelegate ); + + if ( this._mouseStarted ) { + this._mouseStarted = false; + + if ( event.target === this._mouseDownEvent.target ) { + $.data( event.target, this.widgetName + ".preventClickEvent", true ); + } + + this._mouseStop( event ); + } + + if ( this._mouseDelayTimer ) { + clearTimeout( this._mouseDelayTimer ); + delete this._mouseDelayTimer; + } + + this.ignoreMissingWhich = false; + mouseHandled = false; + event.preventDefault(); + }, + + _mouseDistanceMet: function( event ) { + return ( Math.max( + Math.abs( this._mouseDownEvent.pageX - event.pageX ), + Math.abs( this._mouseDownEvent.pageY - event.pageY ) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function( /* event */ ) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function( /* event */ ) {}, + _mouseDrag: function( /* event */ ) {}, + _mouseStop: function( /* event */ ) {}, + _mouseCapture: function( /* event */ ) { + return true; + } +} ); + + + +// $.ui.plugin is deprecated. Use $.widget() extensions instead. +var plugin = $.ui.plugin = { + add: function( module, option, set ) { + var i, + proto = $.ui[ module ].prototype; + for ( i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args, allowDisconnected ) { + var i, + set = instance.plugins[ name ]; + + if ( !set ) { + return; + } + + if ( !allowDisconnected && ( !instance.element[ 0 ].parentNode || + instance.element[ 0 ].parentNode.nodeType === 11 ) ) { + return; + } + + for ( i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } +}; + + +/*! + * jQuery UI Draggable 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: Draggable +//>>group: Interactions +//>>description: Enables dragging functionality for any element. +//>>docs: https://api.jqueryui.com/draggable/ +//>>demos: https://jqueryui.com/draggable/ +//>>css.structure: ../../themes/base/draggable.css + + +$.widget( "ui.draggable", $.ui.mouse, { + version: "1.14.1", + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false, + + // Callbacks + drag: null, + start: null, + stop: null + }, + _create: function() { + + if ( this.options.helper === "original" ) { + this._setPositionRelative(); + } + if ( this.options.addClasses ) { + this._addClass( "ui-draggable" ); + } + this._setHandleClassName(); + + this._mouseInit(); + }, + + _setOption: function( key, value ) { + this._super( key, value ); + if ( key === "handle" ) { + this._removeHandleClassName(); + this._setHandleClassName(); + } + }, + + _destroy: function() { + if ( ( this.helper || this.element ).is( ".ui-draggable-dragging" ) ) { + this.destroyOnClear = true; + return; + } + this._removeHandleClassName(); + this._mouseDestroy(); + }, + + _mouseCapture: function( event ) { + var o = this.options; + + // Among others, prevent a drag on a resizable-handle + if ( this.helper || o.disabled || + $( event.target ).closest( ".ui-resizable-handle" ).length > 0 ) { + return false; + } + + //Quit if we're not on a valid handle + this.handle = this._getHandle( event ); + if ( !this.handle ) { + return false; + } + + this._blurActiveElement( event ); + + this._blockFrames( o.iframeFix === true ? "iframe" : o.iframeFix ); + + return true; + + }, + + _blockFrames: function( selector ) { + this.iframeBlocks = this.document.find( selector ).map( function() { + var iframe = $( this ); + + return $( "
          " ) + .css( "position", "absolute" ) + .appendTo( iframe.parent() ) + .outerWidth( iframe.outerWidth() ) + .outerHeight( iframe.outerHeight() ) + .offset( iframe.offset() )[ 0 ]; + } ); + }, + + _unblockFrames: function() { + if ( this.iframeBlocks ) { + this.iframeBlocks.remove(); + delete this.iframeBlocks; + } + }, + + _blurActiveElement: function( event ) { + var activeElement = this.document[ 0 ].activeElement, + target = $( event.target ); + + // Don't blur if the event occurred on an element that is within + // the currently focused element + // See #10527, #12472 + if ( target.closest( activeElement ).length ) { + return; + } + + // Blur any element that currently has focus, see #4261 + $( activeElement ).trigger( "blur" ); + }, + + _mouseStart: function( event ) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper( event ); + + this._addClass( this.helper, "ui-draggable-dragging" ); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if ( $.ui.ddmanager ) { + $.ui.ddmanager.current = this; + } + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css( "position" ); + this.scrollParent = this.helper.scrollParent( true ); + this.offsetParent = this.helper.offsetParent(); + this.hasFixedAncestor = this.helper.parents().filter( function() { + return $( this ).css( "position" ) === "fixed"; + } ).length > 0; + + //The element's absolute position on the page minus margins + this.positionAbs = this.element.offset(); + this._refreshOffsets( event ); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition( event, false ); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if "cursorAt" is supplied + if ( o.cursorAt ) { + this._adjustOffsetFromHelper( o.cursorAt ); + } + + //Set a containment if given in the options + this._setContainment(); + + //Trigger event + callbacks + if ( this._trigger( "start", event ) === false ) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ( $.ui.ddmanager && !o.dropBehaviour ) { + $.ui.ddmanager.prepareOffsets( this, event ); + } + + // Execute the drag once - this causes the helper not to be visible before getting its + // correct position + this._mouseDrag( event, true ); + + // If the ddmanager is used for droppables, inform the manager that dragging has started + // (see #5003) + if ( $.ui.ddmanager ) { + $.ui.ddmanager.dragStart( this, event ); + } + + return true; + }, + + _refreshOffsets: function( event ) { + this.offset = { + top: this.positionAbs.top - this.margins.top, + left: this.positionAbs.left - this.margins.left, + scroll: false, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() + }; + + this.offset.click = { + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }; + }, + + _mouseDrag: function( event, noPropagation ) { + + // reset any necessary cached properties (see #5009) + if ( this.hasFixedAncestor ) { + this.offset.parent = this._getParentOffset(); + } + + //Compute the helpers position + this.position = this._generatePosition( event, true ); + this.positionAbs = this._convertPositionTo( "absolute" ); + + //Call plugins and callbacks and use the resulting position if something is returned + if ( !noPropagation ) { + var ui = this._uiHash(); + if ( this._trigger( "drag", event, ui ) === false ) { + this._mouseUp( new $.Event( "mouseup", event ) ); + return false; + } + this.position = ui.position; + } + + this.helper[ 0 ].style.left = this.position.left + "px"; + this.helper[ 0 ].style.top = this.position.top + "px"; + + if ( $.ui.ddmanager ) { + $.ui.ddmanager.drag( this, event ); + } + + return false; + }, + + _mouseStop: function( event ) { + + //If we are using droppables, inform the manager about the drop + var that = this, + dropped = false; + if ( $.ui.ddmanager && !this.options.dropBehaviour ) { + dropped = $.ui.ddmanager.drop( this, event ); + } + + //if a drop comes from outside (a sortable) + if ( this.dropped ) { + dropped = this.dropped; + this.dropped = false; + } + + if ( ( this.options.revert === "invalid" && !dropped ) || + ( this.options.revert === "valid" && dropped ) || + this.options.revert === true || ( typeof this.options.revert === "function" && + this.options.revert.call( this.element, dropped ) ) + ) { + $( this.helper ).animate( + this.originalPosition, + parseInt( this.options.revertDuration, 10 ), + function() { + if ( that._trigger( "stop", event ) !== false ) { + that._clear(); + } + } + ); + } else { + if ( this._trigger( "stop", event ) !== false ) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function( event ) { + this._unblockFrames(); + + // If the ddmanager is used for droppables, inform the manager that dragging has stopped + // (see #5003) + if ( $.ui.ddmanager ) { + $.ui.ddmanager.dragStop( this, event ); + } + + // Only need to focus if the event occurred on the draggable itself, see #10527 + if ( this.handleElement.is( event.target ) ) { + + // The interaction is over; whether or not the click resulted in a drag, + // focus the element + this.element.trigger( "focus" ); + } + + return $.ui.mouse.prototype._mouseUp.call( this, event ); + }, + + cancel: function() { + + if ( this.helper.is( ".ui-draggable-dragging" ) ) { + this._mouseUp( new $.Event( "mouseup", { target: this.element[ 0 ] } ) ); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function( event ) { + return this.options.handle ? + !!$( event.target ).closest( this.element.find( this.options.handle ) ).length : + true; + }, + + _setHandleClassName: function() { + this.handleElement = this.options.handle ? + this.element.find( this.options.handle ) : this.element; + this._addClass( this.handleElement, "ui-draggable-handle" ); + }, + + _removeHandleClassName: function() { + this._removeClass( this.handleElement, "ui-draggable-handle" ); + }, + + _createHelper: function( event ) { + + var o = this.options, + helperIsFunction = typeof o.helper === "function", + helper = helperIsFunction ? + $( o.helper.apply( this.element[ 0 ], [ event ] ) ) : + ( o.helper === "clone" ? + this.element.clone().removeAttr( "id" ) : + this.element ); + + if ( !helper.parents( "body" ).length ) { + helper.appendTo( ( o.appendTo === "parent" ? + this.element[ 0 ].parentNode : + o.appendTo ) ); + } + + // https://bugs.jqueryui.com/ticket/9446 + // a helper function can return the original element + // which wouldn't have been set to relative in _create + if ( helperIsFunction && helper[ 0 ] === this.element[ 0 ] ) { + this._setPositionRelative(); + } + + if ( helper[ 0 ] !== this.element[ 0 ] && + !( /(fixed|absolute)/ ).test( helper.css( "position" ) ) ) { + helper.css( "position", "absolute" ); + } + + return helper; + + }, + + _setPositionRelative: function() { + if ( !( /^(?:r|a|f)/ ).test( this.element.css( "position" ) ) ) { + this.element[ 0 ].style.position = "relative"; + } + }, + + _adjustOffsetFromHelper: function( obj ) { + if ( typeof obj === "string" ) { + obj = obj.split( " " ); + } + if ( Array.isArray( obj ) ) { + obj = { left: +obj[ 0 ], top: +obj[ 1 ] || 0 }; + } + if ( "left" in obj ) { + this.offset.click.left = obj.left + this.margins.left; + } + if ( "right" in obj ) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ( "top" in obj ) { + this.offset.click.top = obj.top + this.margins.top; + } + if ( "bottom" in obj ) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _isRootNode: function( element ) { + return ( /(html|body)/i ).test( element.tagName ) || element === this.document[ 0 ]; + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + var po = this.offsetParent.offset(), + document = this.document[ 0 ]; + + // This is a special case where we need to modify a offset calculated on start, since the + // following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the + // next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't + // the document, which means that the scroll is included in the initial calculation of the + // offset of the parent, and never recalculated upon drag + if ( this.cssPosition === "absolute" && this.scrollParent[ 0 ] !== document && + $.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if ( this._isRootNode( this.offsetParent[ 0 ] ) ) { + po = { top: 0, left: 0 }; + } + + return { + top: po.top + ( parseInt( this.offsetParent.css( "borderTopWidth" ), 10 ) || 0 ), + left: po.left + ( parseInt( this.offsetParent.css( "borderLeftWidth" ), 10 ) || 0 ) + }; + + }, + + _getRelativeOffset: function() { + if ( this.cssPosition !== "relative" ) { + return { top: 0, left: 0 }; + } + + var p = this.element.position(), + scrollIsRootNode = this._isRootNode( this.scrollParent[ 0 ] ); + + return { + top: p.top - ( parseInt( this.helper.css( "top" ), 10 ) || 0 ) + + ( !scrollIsRootNode ? this.scrollParent.scrollTop() : 0 ), + left: p.left - ( parseInt( this.helper.css( "left" ), 10 ) || 0 ) + + ( !scrollIsRootNode ? this.scrollParent.scrollLeft() : 0 ) + }; + + }, + + _cacheMargins: function() { + this.margins = { + left: ( parseInt( this.element.css( "marginLeft" ), 10 ) || 0 ), + top: ( parseInt( this.element.css( "marginTop" ), 10 ) || 0 ), + right: ( parseInt( this.element.css( "marginRight" ), 10 ) || 0 ), + bottom: ( parseInt( this.element.css( "marginBottom" ), 10 ) || 0 ) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var isUserScrollable, c, ce, + o = this.options, + document = this.document[ 0 ]; + + this.relativeContainer = null; + + if ( !o.containment ) { + this.containment = null; + return; + } + + if ( o.containment === "window" ) { + this.containment = [ + $( window ).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + $( window ).scrollTop() - this.offset.relative.top - this.offset.parent.top, + $( window ).scrollLeft() + $( window ).width() - + this.helperProportions.width - this.margins.left, + $( window ).scrollTop() + + ( $( window ).height() || document.body.parentNode.scrollHeight ) - + this.helperProportions.height - this.margins.top + ]; + return; + } + + if ( o.containment === "document" ) { + this.containment = [ + 0, + 0, + $( document ).width() - this.helperProportions.width - this.margins.left, + ( $( document ).height() || document.body.parentNode.scrollHeight ) - + this.helperProportions.height - this.margins.top + ]; + return; + } + + if ( o.containment.constructor === Array ) { + this.containment = o.containment; + return; + } + + if ( o.containment === "parent" ) { + o.containment = this.helper[ 0 ].parentNode; + } + + c = $( o.containment ); + ce = c[ 0 ]; + + if ( !ce ) { + return; + } + + isUserScrollable = /(scroll|auto)/.test( c.css( "overflow" ) ); + + this.containment = [ + ( parseInt( c.css( "borderLeftWidth" ), 10 ) || 0 ) + + ( parseInt( c.css( "paddingLeft" ), 10 ) || 0 ), + ( parseInt( c.css( "borderTopWidth" ), 10 ) || 0 ) + + ( parseInt( c.css( "paddingTop" ), 10 ) || 0 ), + ( isUserScrollable ? Math.max( ce.scrollWidth, ce.offsetWidth ) : ce.offsetWidth ) - + ( parseInt( c.css( "borderRightWidth" ), 10 ) || 0 ) - + ( parseInt( c.css( "paddingRight" ), 10 ) || 0 ) - + this.helperProportions.width - + this.margins.left - + this.margins.right, + ( isUserScrollable ? Math.max( ce.scrollHeight, ce.offsetHeight ) : ce.offsetHeight ) - + ( parseInt( c.css( "borderBottomWidth" ), 10 ) || 0 ) - + ( parseInt( c.css( "paddingBottom" ), 10 ) || 0 ) - + this.helperProportions.height - + this.margins.top - + this.margins.bottom + ]; + this.relativeContainer = c; + }, + + _convertPositionTo: function( d, pos ) { + + if ( !pos ) { + pos = this.position; + } + + var mod = d === "absolute" ? 1 : -1, + scrollIsRootNode = this._isRootNode( this.scrollParent[ 0 ] ); + + return { + top: ( + + // The absolute mouse position + pos.top + + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.top * mod + + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.top * mod - + ( ( this.cssPosition === "fixed" ? + -this.offset.scroll.top : + ( scrollIsRootNode ? 0 : this.offset.scroll.top ) ) * mod ) + ), + left: ( + + // The absolute mouse position + pos.left + + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.left * mod + + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.left * mod - + ( ( this.cssPosition === "fixed" ? + -this.offset.scroll.left : + ( scrollIsRootNode ? 0 : this.offset.scroll.left ) ) * mod ) + ) + }; + + }, + + _generatePosition: function( event, constrainPosition ) { + + var containment, co, top, left, + o = this.options, + scrollIsRootNode = this._isRootNode( this.scrollParent[ 0 ] ), + pageX = event.pageX, + pageY = event.pageY; + + // Cache the scroll + if ( !scrollIsRootNode || !this.offset.scroll ) { + this.offset.scroll = { + top: this.scrollParent.scrollTop(), + left: this.scrollParent.scrollLeft() + }; + } + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + // If we are not dragging yet, we won't check for options + if ( constrainPosition ) { + if ( this.containment ) { + if ( this.relativeContainer ) { + co = this.relativeContainer.offset(); + containment = [ + this.containment[ 0 ] + co.left, + this.containment[ 1 ] + co.top, + this.containment[ 2 ] + co.left, + this.containment[ 3 ] + co.top + ]; + } else { + containment = this.containment; + } + + if ( event.pageX - this.offset.click.left < containment[ 0 ] ) { + pageX = containment[ 0 ] + this.offset.click.left; + } + if ( event.pageY - this.offset.click.top < containment[ 1 ] ) { + pageY = containment[ 1 ] + this.offset.click.top; + } + if ( event.pageX - this.offset.click.left > containment[ 2 ] ) { + pageX = containment[ 2 ] + this.offset.click.left; + } + if ( event.pageY - this.offset.click.top > containment[ 3 ] ) { + pageY = containment[ 3 ] + this.offset.click.top; + } + } + + if ( o.grid ) { + + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid + // argument errors in IE (see ticket #6950) + top = o.grid[ 1 ] ? this.originalPageY + Math.round( ( pageY - + this.originalPageY ) / o.grid[ 1 ] ) * o.grid[ 1 ] : this.originalPageY; + pageY = containment ? ( ( top - this.offset.click.top >= containment[ 1 ] || + top - this.offset.click.top > containment[ 3 ] ) ? + top : + ( ( top - this.offset.click.top >= containment[ 1 ] ) ? + top - o.grid[ 1 ] : top + o.grid[ 1 ] ) ) : top; + + left = o.grid[ 0 ] ? this.originalPageX + + Math.round( ( pageX - this.originalPageX ) / o.grid[ 0 ] ) * o.grid[ 0 ] : + this.originalPageX; + pageX = containment ? ( ( left - this.offset.click.left >= containment[ 0 ] || + left - this.offset.click.left > containment[ 2 ] ) ? + left : + ( ( left - this.offset.click.left >= containment[ 0 ] ) ? + left - o.grid[ 0 ] : left + o.grid[ 0 ] ) ) : left; + } + + if ( o.axis === "y" ) { + pageX = this.originalPageX; + } + + if ( o.axis === "x" ) { + pageY = this.originalPageY; + } + } + + return { + top: ( + + // The absolute mouse position + pageY - + + // Click offset (relative to the element) + this.offset.click.top - + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.top - + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.top + + ( this.cssPosition === "fixed" ? + -this.offset.scroll.top : + ( scrollIsRootNode ? 0 : this.offset.scroll.top ) ) + ), + left: ( + + // The absolute mouse position + pageX - + + // Click offset (relative to the element) + this.offset.click.left - + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.left - + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.left + + ( this.cssPosition === "fixed" ? + -this.offset.scroll.left : + ( scrollIsRootNode ? 0 : this.offset.scroll.left ) ) + ) + }; + + }, + + _clear: function() { + this._removeClass( this.helper, "ui-draggable-dragging" ); + if ( this.helper[ 0 ] !== this.element[ 0 ] && !this.cancelHelperRemoval ) { + this.helper.remove(); + } + this.helper = null; + this.cancelHelperRemoval = false; + if ( this.destroyOnClear ) { + this.destroy(); + } + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function( type, event, ui ) { + ui = ui || this._uiHash(); + $.ui.plugin.call( this, type, [ event, ui, this ], true ); + + // Absolute position and offset (see #6884 ) have to be recalculated after plugins + if ( /^(drag|start|stop)/.test( type ) ) { + this.positionAbs = this._convertPositionTo( "absolute" ); + ui.offset = this.positionAbs; + } + return $.Widget.prototype._trigger.call( this, type, event, ui ); + }, + + plugins: {}, + + _uiHash: function() { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +} ); + +$.ui.plugin.add( "draggable", "connectToSortable", { + start: function( event, ui, draggable ) { + var uiSortable = $.extend( {}, ui, { + item: draggable.element + } ); + + draggable.sortables = []; + $( draggable.options.connectToSortable ).each( function() { + var sortable = $( this ).sortable( "instance" ); + + if ( sortable && !sortable.options.disabled ) { + draggable.sortables.push( sortable ); + + // RefreshPositions is called at drag start to refresh the containerCache + // which is used in drag. This ensures it's initialized and synchronized + // with any changes that might have happened on the page since initialization. + sortable.refreshPositions(); + sortable._trigger( "activate", event, uiSortable ); + } + } ); + }, + stop: function( event, ui, draggable ) { + var uiSortable = $.extend( {}, ui, { + item: draggable.element + } ); + + draggable.cancelHelperRemoval = false; + + $.each( draggable.sortables, function() { + var sortable = this; + + if ( sortable.isOver ) { + sortable.isOver = 0; + + // Allow this sortable to handle removing the helper + draggable.cancelHelperRemoval = true; + sortable.cancelHelperRemoval = false; + + // Use _storedCSS To restore properties in the sortable, + // as this also handles revert (#9675) since the draggable + // may have modified them in unexpected ways (#8809) + sortable._storedCSS = { + position: sortable.placeholder.css( "position" ), + top: sortable.placeholder.css( "top" ), + left: sortable.placeholder.css( "left" ) + }; + + sortable._mouseStop( event ); + + // Once drag has ended, the sortable should return to using + // its original helper, not the shared helper from draggable + sortable.options.helper = sortable.options._helper; + } else { + + // Prevent this Sortable from removing the helper. + // However, don't set the draggable to remove the helper + // either as another connected Sortable may yet handle the removal. + sortable.cancelHelperRemoval = true; + + sortable._trigger( "deactivate", event, uiSortable ); + } + } ); + }, + drag: function( event, ui, draggable ) { + $.each( draggable.sortables, function() { + var innermostIntersecting = false, + sortable = this; + + // Copy over variables that sortable's _intersectsWith uses + sortable.positionAbs = draggable.positionAbs; + sortable.helperProportions = draggable.helperProportions; + sortable.offset.click = draggable.offset.click; + + if ( sortable._intersectsWith( sortable.containerCache ) ) { + innermostIntersecting = true; + + $.each( draggable.sortables, function() { + + // Copy over variables that sortable's _intersectsWith uses + this.positionAbs = draggable.positionAbs; + this.helperProportions = draggable.helperProportions; + this.offset.click = draggable.offset.click; + + if ( this !== sortable && + this._intersectsWith( this.containerCache ) && + $.contains( sortable.element[ 0 ], this.element[ 0 ] ) ) { + innermostIntersecting = false; + } + + return innermostIntersecting; + } ); + } + + if ( innermostIntersecting ) { + + // If it intersects, we use a little isOver variable and set it once, + // so that the move-in stuff gets fired only once. + if ( !sortable.isOver ) { + sortable.isOver = 1; + + // Store draggable's parent in case we need to reappend to it later. + draggable._parent = ui.helper.parent(); + + sortable.currentItem = ui.helper + .appendTo( sortable.element ) + .data( "ui-sortable-item", true ); + + // Store helper option to later restore it + sortable.options._helper = sortable.options.helper; + + sortable.options.helper = function() { + return ui.helper[ 0 ]; + }; + + // Fire the start events of the sortable with our passed browser event, + // and our own helper (so it doesn't create a new one) + event.target = sortable.currentItem[ 0 ]; + sortable._mouseCapture( event, true ); + sortable._mouseStart( event, true, true ); + + // Because the browser event is way off the new appended portlet, + // modify necessary variables to reflect the changes + sortable.offset.click.top = draggable.offset.click.top; + sortable.offset.click.left = draggable.offset.click.left; + sortable.offset.parent.left -= draggable.offset.parent.left - + sortable.offset.parent.left; + sortable.offset.parent.top -= draggable.offset.parent.top - + sortable.offset.parent.top; + + draggable._trigger( "toSortable", event ); + + // Inform draggable that the helper is in a valid drop zone, + // used solely in the revert option to handle "valid/invalid". + draggable.dropped = sortable.element; + + // Need to refreshPositions of all sortables in the case that + // adding to one sortable changes the location of the other sortables (#9675) + $.each( draggable.sortables, function() { + this.refreshPositions(); + } ); + + // Hack so receive/update callbacks work (mostly) + draggable.currentItem = draggable.element; + sortable.fromOutside = draggable; + } + + if ( sortable.currentItem ) { + sortable._mouseDrag( event ); + + // Copy the sortable's position because the draggable's can potentially reflect + // a relative position, while sortable is always absolute, which the dragged + // element has now become. (#8809) + ui.position = sortable.position; + } + } else { + + // If it doesn't intersect with the sortable, and it intersected before, + // we fake the drag stop of the sortable, but make sure it doesn't remove + // the helper by using cancelHelperRemoval. + if ( sortable.isOver ) { + + sortable.isOver = 0; + sortable.cancelHelperRemoval = true; + + // Calling sortable's mouseStop would trigger a revert, + // so revert must be temporarily false until after mouseStop is called. + sortable.options._revert = sortable.options.revert; + sortable.options.revert = false; + + sortable._trigger( "out", event, sortable._uiHash( sortable ) ); + sortable._mouseStop( event, true ); + + // Restore sortable behaviors that were modfied + // when the draggable entered the sortable area (#9481) + sortable.options.revert = sortable.options._revert; + sortable.options.helper = sortable.options._helper; + + if ( sortable.placeholder ) { + sortable.placeholder.remove(); + } + + // Restore and recalculate the draggable's offset considering the sortable + // may have modified them in unexpected ways. (#8809, #10669) + ui.helper.appendTo( draggable._parent ); + draggable._refreshOffsets( event ); + ui.position = draggable._generatePosition( event, true ); + + draggable._trigger( "fromSortable", event ); + + // Inform draggable that the helper is no longer in a valid drop zone + draggable.dropped = false; + + // Need to refreshPositions of all sortables just in case removing + // from one sortable changes the location of other sortables (#9675) + $.each( draggable.sortables, function() { + this.refreshPositions(); + } ); + } + } + } ); + } +} ); + +$.ui.plugin.add( "draggable", "cursor", { + start: function( event, ui, instance ) { + var t = $( "body" ), + o = instance.options; + + if ( t.css( "cursor" ) ) { + o._cursor = t.css( "cursor" ); + } + t.css( "cursor", o.cursor ); + }, + stop: function( event, ui, instance ) { + var o = instance.options; + if ( o._cursor ) { + $( "body" ).css( "cursor", o._cursor ); + } + } +} ); + +$.ui.plugin.add( "draggable", "opacity", { + start: function( event, ui, instance ) { + var t = $( ui.helper ), + o = instance.options; + if ( t.css( "opacity" ) ) { + o._opacity = t.css( "opacity" ); + } + t.css( "opacity", o.opacity ); + }, + stop: function( event, ui, instance ) { + var o = instance.options; + if ( o._opacity ) { + $( ui.helper ).css( "opacity", o._opacity ); + } + } +} ); + +$.ui.plugin.add( "draggable", "scroll", { + start: function( event, ui, i ) { + if ( !i.scrollParentNotHidden ) { + i.scrollParentNotHidden = i.helper.scrollParent( false ); + } + + if ( i.scrollParentNotHidden[ 0 ] !== i.document[ 0 ] && + i.scrollParentNotHidden[ 0 ].tagName !== "HTML" ) { + i.overflowOffset = i.scrollParentNotHidden.offset(); + } + }, + drag: function( event, ui, i ) { + + var o = i.options, + scrolled = false, + scrollParent = i.scrollParentNotHidden[ 0 ], + document = i.document[ 0 ]; + + if ( scrollParent !== document && scrollParent.tagName !== "HTML" ) { + if ( !o.axis || o.axis !== "x" ) { + if ( ( i.overflowOffset.top + scrollParent.offsetHeight ) - event.pageY < + o.scrollSensitivity ) { + scrollParent.scrollTop = scrolled = scrollParent.scrollTop + o.scrollSpeed; + } else if ( event.pageY - i.overflowOffset.top < o.scrollSensitivity ) { + scrollParent.scrollTop = scrolled = scrollParent.scrollTop - o.scrollSpeed; + } + } + + if ( !o.axis || o.axis !== "y" ) { + if ( ( i.overflowOffset.left + scrollParent.offsetWidth ) - event.pageX < + o.scrollSensitivity ) { + scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft + o.scrollSpeed; + } else if ( event.pageX - i.overflowOffset.left < o.scrollSensitivity ) { + scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft - o.scrollSpeed; + } + } + + } else { + + if ( !o.axis || o.axis !== "x" ) { + if ( event.pageY - $( document ).scrollTop() < o.scrollSensitivity ) { + scrolled = $( document ).scrollTop( $( document ).scrollTop() - o.scrollSpeed ); + } else if ( $( window ).height() - ( event.pageY - $( document ).scrollTop() ) < + o.scrollSensitivity ) { + scrolled = $( document ).scrollTop( $( document ).scrollTop() + o.scrollSpeed ); + } + } + + if ( !o.axis || o.axis !== "y" ) { + if ( event.pageX - $( document ).scrollLeft() < o.scrollSensitivity ) { + scrolled = $( document ).scrollLeft( + $( document ).scrollLeft() - o.scrollSpeed + ); + } else if ( $( window ).width() - ( event.pageX - $( document ).scrollLeft() ) < + o.scrollSensitivity ) { + scrolled = $( document ).scrollLeft( + $( document ).scrollLeft() + o.scrollSpeed + ); + } + } + + } + + if ( scrolled !== false && $.ui.ddmanager && !o.dropBehaviour ) { + $.ui.ddmanager.prepareOffsets( i, event ); + } + + } +} ); + +$.ui.plugin.add( "draggable", "snap", { + start: function( event, ui, i ) { + + var o = i.options; + + i.snapElements = []; + + $( o.snap.constructor !== String ? ( o.snap.items || ":data(ui-draggable)" ) : o.snap ) + .each( function() { + var $t = $( this ), + $o = $t.offset(); + if ( this !== i.element[ 0 ] ) { + i.snapElements.push( { + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + } ); + } + } ); + + }, + drag: function( event, ui, inst ) { + + var ts, bs, ls, rs, l, r, t, b, i, first, + o = inst.options, + d = o.snapTolerance, + x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for ( i = inst.snapElements.length - 1; i >= 0; i-- ) { + + l = inst.snapElements[ i ].left - inst.margins.left; + r = l + inst.snapElements[ i ].width; + t = inst.snapElements[ i ].top - inst.margins.top; + b = t + inst.snapElements[ i ].height; + + if ( x2 < l - d || x1 > r + d || y2 < t - d || y1 > b + d || + !$.contains( inst.snapElements[ i ].item.ownerDocument, + inst.snapElements[ i ].item ) ) { + if ( inst.snapElements[ i ].snapping ) { + if ( inst.options.snap.release ) { + inst.options.snap.release.call( + inst.element, + event, + $.extend( inst._uiHash(), { snapItem: inst.snapElements[ i ].item } ) + ); + } + } + inst.snapElements[ i ].snapping = false; + continue; + } + + if ( o.snapMode !== "inner" ) { + ts = Math.abs( t - y2 ) <= d; + bs = Math.abs( b - y1 ) <= d; + ls = Math.abs( l - x2 ) <= d; + rs = Math.abs( r - x1 ) <= d; + if ( ts ) { + ui.position.top = inst._convertPositionTo( "relative", { + top: t - inst.helperProportions.height, + left: 0 + } ).top; + } + if ( bs ) { + ui.position.top = inst._convertPositionTo( "relative", { + top: b, + left: 0 + } ).top; + } + if ( ls ) { + ui.position.left = inst._convertPositionTo( "relative", { + top: 0, + left: l - inst.helperProportions.width + } ).left; + } + if ( rs ) { + ui.position.left = inst._convertPositionTo( "relative", { + top: 0, + left: r + } ).left; + } + } + + first = ( ts || bs || ls || rs ); + + if ( o.snapMode !== "outer" ) { + ts = Math.abs( t - y1 ) <= d; + bs = Math.abs( b - y2 ) <= d; + ls = Math.abs( l - x1 ) <= d; + rs = Math.abs( r - x2 ) <= d; + if ( ts ) { + ui.position.top = inst._convertPositionTo( "relative", { + top: t, + left: 0 + } ).top; + } + if ( bs ) { + ui.position.top = inst._convertPositionTo( "relative", { + top: b - inst.helperProportions.height, + left: 0 + } ).top; + } + if ( ls ) { + ui.position.left = inst._convertPositionTo( "relative", { + top: 0, + left: l + } ).left; + } + if ( rs ) { + ui.position.left = inst._convertPositionTo( "relative", { + top: 0, + left: r - inst.helperProportions.width + } ).left; + } + } + + if ( !inst.snapElements[ i ].snapping && ( ts || bs || ls || rs || first ) ) { + if ( inst.options.snap.snap ) { + inst.options.snap.snap.call( + inst.element, + event, + $.extend( inst._uiHash(), { + snapItem: inst.snapElements[ i ].item + } ) ); + } + } + inst.snapElements[ i ].snapping = ( ts || bs || ls || rs || first ); + + } + + } +} ); + +$.ui.plugin.add( "draggable", "stack", { + start: function( event, ui, instance ) { + var min, + o = instance.options, + group = $.makeArray( $( o.stack ) ).sort( function( a, b ) { + return ( parseInt( $( a ).css( "zIndex" ), 10 ) || 0 ) - + ( parseInt( $( b ).css( "zIndex" ), 10 ) || 0 ); + } ); + + if ( !group.length ) { + return; + } + + min = parseInt( $( group[ 0 ] ).css( "zIndex" ), 10 ) || 0; + $( group ).each( function( i ) { + $( this ).css( "zIndex", min + i ); + } ); + this.css( "zIndex", ( min + group.length ) ); + } +} ); + +$.ui.plugin.add( "draggable", "zIndex", { + start: function( event, ui, instance ) { + var t = $( ui.helper ), + o = instance.options; + + if ( t.css( "zIndex" ) ) { + o._zIndex = t.css( "zIndex" ); + } + t.css( "zIndex", o.zIndex ); + }, + stop: function( event, ui, instance ) { + var o = instance.options; + + if ( o._zIndex ) { + $( ui.helper ).css( "zIndex", o._zIndex ); + } + } +} ); + +var widgetsDraggable = $.ui.draggable; + + +/*! + * jQuery UI Droppable 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: Droppable +//>>group: Interactions +//>>description: Enables drop targets for draggable elements. +//>>docs: https://api.jqueryui.com/droppable/ +//>>demos: https://jqueryui.com/droppable/ + + +$.widget( "ui.droppable", { + version: "1.14.1", + widgetEventPrefix: "drop", + options: { + accept: "*", + addClasses: true, + greedy: false, + scope: "default", + tolerance: "intersect", + + // Callbacks + activate: null, + deactivate: null, + drop: null, + out: null, + over: null + }, + _create: function() { + + var proportions, + o = this.options, + accept = o.accept; + + this.isover = false; + this.isout = true; + + this.accept = typeof accept === "function" ? accept : function( d ) { + return d.is( accept ); + }; + + this.proportions = function( /* valueToWrite */ ) { + if ( arguments.length ) { + + // Store the droppable's proportions + proportions = arguments[ 0 ]; + } else { + + // Retrieve or derive the droppable's proportions + return proportions ? + proportions : + proportions = { + width: this.element[ 0 ].offsetWidth, + height: this.element[ 0 ].offsetHeight + }; + } + }; + + this._addToManager( o.scope ); + + if ( o.addClasses ) { + this._addClass( "ui-droppable" ); + } + + }, + + _addToManager: function( scope ) { + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[ scope ] = $.ui.ddmanager.droppables[ scope ] || []; + $.ui.ddmanager.droppables[ scope ].push( this ); + }, + + _splice: function( drop ) { + var i = 0; + for ( ; i < drop.length; i++ ) { + if ( drop[ i ] === this ) { + drop.splice( i, 1 ); + } + } + }, + + _destroy: function() { + var drop = $.ui.ddmanager.droppables[ this.options.scope ]; + + this._splice( drop ); + }, + + _setOption: function( key, value ) { + + if ( key === "accept" ) { + this.accept = typeof value === "function" ? value : function( d ) { + return d.is( value ); + }; + } else if ( key === "scope" ) { + var drop = $.ui.ddmanager.droppables[ this.options.scope ]; + + this._splice( drop ); + this._addToManager( value ); + } + + this._super( key, value ); + }, + + _activate: function( event ) { + var draggable = $.ui.ddmanager.current; + + this._addActiveClass(); + if ( draggable ) { + this._trigger( "activate", event, this.ui( draggable ) ); + } + }, + + _deactivate: function( event ) { + var draggable = $.ui.ddmanager.current; + + this._removeActiveClass(); + if ( draggable ) { + this._trigger( "deactivate", event, this.ui( draggable ) ); + } + }, + + _over: function( event ) { + + var draggable = $.ui.ddmanager.current; + + // Bail if draggable and droppable are same element + if ( !draggable || ( draggable.currentItem || + draggable.element )[ 0 ] === this.element[ 0 ] ) { + return; + } + + if ( this.accept.call( this.element[ 0 ], ( draggable.currentItem || + draggable.element ) ) ) { + this._addHoverClass(); + this._trigger( "over", event, this.ui( draggable ) ); + } + + }, + + _out: function( event ) { + + var draggable = $.ui.ddmanager.current; + + // Bail if draggable and droppable are same element + if ( !draggable || ( draggable.currentItem || + draggable.element )[ 0 ] === this.element[ 0 ] ) { + return; + } + + if ( this.accept.call( this.element[ 0 ], ( draggable.currentItem || + draggable.element ) ) ) { + this._removeHoverClass(); + this._trigger( "out", event, this.ui( draggable ) ); + } + + }, + + _drop: function( event, custom ) { + + var draggable = custom || $.ui.ddmanager.current, + childrenIntersection = false; + + // Bail if draggable and droppable are same element + if ( !draggable || ( draggable.currentItem || + draggable.element )[ 0 ] === this.element[ 0 ] ) { + return false; + } + + this.element + .find( ":data(ui-droppable)" ) + .not( ".ui-draggable-dragging" ) + .each( function() { + var inst = $( this ).droppable( "instance" ); + if ( + inst.options.greedy && + !inst.options.disabled && + inst.options.scope === draggable.options.scope && + inst.accept.call( + inst.element[ 0 ], ( draggable.currentItem || draggable.element ) + ) && + $.ui.intersect( + draggable, + $.extend( inst, { offset: inst.element.offset() } ), + inst.options.tolerance, event + ) + ) { + childrenIntersection = true; + return false; + } + } ); + if ( childrenIntersection ) { + return false; + } + + if ( this.accept.call( this.element[ 0 ], + ( draggable.currentItem || draggable.element ) ) ) { + this._removeActiveClass(); + this._removeHoverClass(); + + this._trigger( "drop", event, this.ui( draggable ) ); + return this.element; + } + + return false; + + }, + + ui: function( c ) { + return { + draggable: ( c.currentItem || c.element ), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + }, + + // Extension points just to make backcompat sane and avoid duplicating logic + // TODO: Remove in 1.14 along with call to it below + _addHoverClass: function() { + this._addClass( "ui-droppable-hover" ); + }, + + _removeHoverClass: function() { + this._removeClass( "ui-droppable-hover" ); + }, + + _addActiveClass: function() { + this._addClass( "ui-droppable-active" ); + }, + + _removeActiveClass: function() { + this._removeClass( "ui-droppable-active" ); + } +} ); + +$.ui.intersect = ( function() { + function isOverAxis( x, reference, size ) { + return ( x >= reference ) && ( x < ( reference + size ) ); + } + + return function( draggable, droppable, toleranceMode, event ) { + + if ( !droppable.offset ) { + return false; + } + + var x1 = ( draggable.positionAbs || + draggable.position.absolute ).left + draggable.margins.left, + y1 = ( draggable.positionAbs || + draggable.position.absolute ).top + draggable.margins.top, + x2 = x1 + draggable.helperProportions.width, + y2 = y1 + draggable.helperProportions.height, + l = droppable.offset.left, + t = droppable.offset.top, + r = l + droppable.proportions().width, + b = t + droppable.proportions().height; + + switch ( toleranceMode ) { + case "fit": + return ( l <= x1 && x2 <= r && t <= y1 && y2 <= b ); + case "intersect": + return ( l < x1 + ( draggable.helperProportions.width / 2 ) && // Right Half + x2 - ( draggable.helperProportions.width / 2 ) < r && // Left Half + t < y1 + ( draggable.helperProportions.height / 2 ) && // Bottom Half + y2 - ( draggable.helperProportions.height / 2 ) < b ); // Top Half + case "pointer": + return isOverAxis( event.pageY, t, droppable.proportions().height ) && + isOverAxis( event.pageX, l, droppable.proportions().width ); + case "touch": + return ( + ( y1 >= t && y1 <= b ) || // Top edge touching + ( y2 >= t && y2 <= b ) || // Bottom edge touching + ( y1 < t && y2 > b ) // Surrounded vertically + ) && ( + ( x1 >= l && x1 <= r ) || // Left edge touching + ( x2 >= l && x2 <= r ) || // Right edge touching + ( x1 < l && x2 > r ) // Surrounded horizontally + ); + default: + return false; + } + }; +} )(); + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { "default": [] }, + prepareOffsets: function( t, event ) { + + var i, j, + m = $.ui.ddmanager.droppables[ t.options.scope ] || [], + type = event ? event.type : null, // workaround for #2317 + list = ( t.currentItem || t.element ).find( ":data(ui-droppable)" ).addBack(); + + droppablesLoop: for ( i = 0; i < m.length; i++ ) { + + // No disabled and non-accepted + if ( m[ i ].options.disabled || ( t && !m[ i ].accept.call( m[ i ].element[ 0 ], + ( t.currentItem || t.element ) ) ) ) { + continue; + } + + // Filter out elements in the current dragged item + for ( j = 0; j < list.length; j++ ) { + if ( list[ j ] === m[ i ].element[ 0 ] ) { + m[ i ].proportions().height = 0; + continue droppablesLoop; + } + } + + m[ i ].visible = m[ i ].element.css( "display" ) !== "none"; + if ( !m[ i ].visible ) { + continue; + } + + // Activate the droppable if used directly from draggables + if ( type === "mousedown" ) { + m[ i ]._activate.call( m[ i ], event ); + } + + m[ i ].offset = m[ i ].element.offset(); + m[ i ].proportions( { + width: m[ i ].element[ 0 ].offsetWidth, + height: m[ i ].element[ 0 ].offsetHeight + } ); + + } + + }, + drop: function( draggable, event ) { + + var dropped = false; + + // Create a copy of the droppables in case the list changes during the drop (#9116) + $.each( ( $.ui.ddmanager.droppables[ draggable.options.scope ] || [] ).slice(), function() { + + if ( !this.options ) { + return; + } + if ( !this.options.disabled && this.visible && + $.ui.intersect( draggable, this, this.options.tolerance, event ) ) { + dropped = this._drop.call( this, event ) || dropped; + } + + if ( !this.options.disabled && this.visible && this.accept.call( this.element[ 0 ], + ( draggable.currentItem || draggable.element ) ) ) { + this.isout = true; + this.isover = false; + this._deactivate.call( this, event ); + } + + } ); + return dropped; + + }, + dragStart: function( draggable, event ) { + + // Listen for scrolling so that if the dragging causes scrolling the position of the + // droppables can be recalculated (see #5003) + draggable.element.parentsUntil( "body" ).on( "scroll.droppable", function() { + if ( !draggable.options.refreshPositions ) { + $.ui.ddmanager.prepareOffsets( draggable, event ); + } + } ); + }, + drag: function( draggable, event ) { + + // If you have a highly dynamic page, you might try this option. It renders positions + // every time you move the mouse. + if ( draggable.options.refreshPositions ) { + $.ui.ddmanager.prepareOffsets( draggable, event ); + } + + // Run through all droppables and check their positions based on specific tolerance options + $.each( $.ui.ddmanager.droppables[ draggable.options.scope ] || [], function() { + + if ( this.options.disabled || this.greedyChild || !this.visible ) { + return; + } + + var parentInstance, scope, parent, + intersects = $.ui.intersect( draggable, this, this.options.tolerance, event ), + c = !intersects && this.isover ? + "isout" : + ( intersects && !this.isover ? "isover" : null ); + if ( !c ) { + return; + } + + if ( this.options.greedy ) { + + // find droppable parents with same scope + scope = this.options.scope; + parent = this.element.parents( ":data(ui-droppable)" ).filter( function() { + return $( this ).droppable( "instance" ).options.scope === scope; + } ); + + if ( parent.length ) { + parentInstance = $( parent[ 0 ] ).droppable( "instance" ); + parentInstance.greedyChild = ( c === "isover" ); + } + } + + // We just moved into a greedy child + if ( parentInstance && c === "isover" ) { + parentInstance.isover = false; + parentInstance.isout = true; + parentInstance._out.call( parentInstance, event ); + } + + this[ c ] = true; + this[ c === "isout" ? "isover" : "isout" ] = false; + this[ c === "isover" ? "_over" : "_out" ].call( this, event ); + + // We just moved out of a greedy child + if ( parentInstance && c === "isout" ) { + parentInstance.isout = false; + parentInstance.isover = true; + parentInstance._over.call( parentInstance, event ); + } + } ); + + }, + dragStop: function( draggable, event ) { + draggable.element.parentsUntil( "body" ).off( "scroll.droppable" ); + + // Call prepareOffsets one final time since IE does not fire return scroll events when + // overflow was caused by drag (see #5003) + if ( !draggable.options.refreshPositions ) { + $.ui.ddmanager.prepareOffsets( draggable, event ); + } + } +}; + +// DEPRECATED +// TODO: switch return back to widget declaration at top of file when this is removed +if ( $.uiBackCompat === true ) { + + // Backcompat for activeClass and hoverClass options + $.widget( "ui.droppable", $.ui.droppable, { + options: { + hoverClass: false, + activeClass: false + }, + _addActiveClass: function() { + this._super(); + if ( this.options.activeClass ) { + this.element.addClass( this.options.activeClass ); + } + }, + _removeActiveClass: function() { + this._super(); + if ( this.options.activeClass ) { + this.element.removeClass( this.options.activeClass ); + } + }, + _addHoverClass: function() { + this._super(); + if ( this.options.hoverClass ) { + this.element.addClass( this.options.hoverClass ); + } + }, + _removeHoverClass: function() { + this._super(); + if ( this.options.hoverClass ) { + this.element.removeClass( this.options.hoverClass ); + } + } + } ); +} + +var widgetsDroppable = $.ui.droppable; + + +/*! + * jQuery UI Resizable 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: Resizable +//>>group: Interactions +//>>description: Enables resize functionality for any element. +//>>docs: https://api.jqueryui.com/resizable/ +//>>demos: https://jqueryui.com/resizable/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/resizable.css +//>>css.theme: ../../themes/base/theme.css + + +$.widget( "ui.resizable", $.ui.mouse, { + version: "1.14.1", + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + classes: { + "ui-resizable-se": "ui-icon ui-icon-gripsmall-diagonal-se" + }, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + + // See #7960 + zIndex: 90, + + // Callbacks + resize: null, + start: null, + stop: null + }, + + _num: function( value ) { + return parseFloat( value ) || 0; + }, + + _isNumber: function( value ) { + return !isNaN( parseFloat( value ) ); + }, + + _hasScroll: function( el, a ) { + + var scroll, + has = false, + overflow = $( el ).css( "overflow" ); + + if ( overflow === "hidden" ) { + return false; + } + if ( overflow === "scroll" ) { + return true; + } + + scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop"; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + try { + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + } catch ( e ) { + + // `el` might be a string, then setting `scroll` will throw + // an error in strict mode; ignore it. + } + return has; + }, + + _create: function() { + + var margins, + o = this.options, + that = this; + this._addClass( "ui-resizable" ); + + $.extend( this, { + _aspectRatio: !!( o.aspectRatio ), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || "ui-resizable-helper" : null + } ); + + // Wrap the element if it cannot hold child nodes + if ( this.element[ 0 ].nodeName.match( /^(canvas|textarea|input|select|button|img)$/i ) ) { + + this.element.wrap( + $( "
          " ).css( { + overflow: "hidden", + position: this.element.css( "position" ), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css( "top" ), + left: this.element.css( "left" ) + } ) + ); + + this.element = this.element.parent().data( + "ui-resizable", this.element.resizable( "instance" ) + ); + + this.elementIsWrapper = true; + + margins = { + marginTop: this.originalElement.css( "marginTop" ), + marginRight: this.originalElement.css( "marginRight" ), + marginBottom: this.originalElement.css( "marginBottom" ), + marginLeft: this.originalElement.css( "marginLeft" ) + }; + + this.element.css( margins ); + + // Support: Safari + // Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css( "resize" ); + this.originalElement.css( "resize", "none" ); + + this._proportionallyResizeElements.push( this.originalElement.css( { + position: "static", + zoom: 1, + display: "block" + } ) ); + + this._proportionallyResize(); + } + + this._setupHandles(); + + if ( o.autoHide ) { + $( this.element ) + .on( "mouseenter", function() { + if ( o.disabled ) { + return; + } + that._removeClass( "ui-resizable-autohide" ); + that._handles.show(); + } ) + .on( "mouseleave", function() { + if ( o.disabled ) { + return; + } + if ( !that.resizing ) { + that._addClass( "ui-resizable-autohide" ); + that._handles.hide(); + } + } ); + } + + this._mouseInit(); + }, + + _destroy: function() { + + this._mouseDestroy(); + this._addedHandles.remove(); + + var wrapper, + _destroy = function( exp ) { + $( exp ) + .removeData( "resizable" ) + .removeData( "ui-resizable" ) + .off( ".resizable" ); + }; + + // TODO: Unwrap at same DOM position + if ( this.elementIsWrapper ) { + _destroy( this.element ); + wrapper = this.element; + this.originalElement.css( { + position: wrapper.css( "position" ), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css( "top" ), + left: wrapper.css( "left" ) + } ).insertAfter( wrapper ); + wrapper.remove(); + } + + this.originalElement.css( "resize", this.originalResizeStyle ); + _destroy( this.originalElement ); + + return this; + }, + + _setOption: function( key, value ) { + this._super( key, value ); + + switch ( key ) { + case "handles": + this._removeHandles(); + this._setupHandles(); + break; + case "aspectRatio": + this._aspectRatio = !!value; + break; + default: + break; + } + }, + + _setupHandles: function() { + var o = this.options, handle, i, n, hname, axis, that = this; + this.handles = o.handles || + ( !$( ".ui-resizable-handle", this.element ).length ? + "e,s,se" : { + n: ".ui-resizable-n", + e: ".ui-resizable-e", + s: ".ui-resizable-s", + w: ".ui-resizable-w", + se: ".ui-resizable-se", + sw: ".ui-resizable-sw", + ne: ".ui-resizable-ne", + nw: ".ui-resizable-nw" + } ); + + this._handles = $(); + this._addedHandles = $(); + if ( this.handles.constructor === String ) { + + if ( this.handles === "all" ) { + this.handles = "n,e,s,w,se,sw,ne,nw"; + } + + n = this.handles.split( "," ); + this.handles = {}; + + for ( i = 0; i < n.length; i++ ) { + + handle = String.prototype.trim.call( n[ i ] ); + hname = "ui-resizable-" + handle; + axis = $( "
          " ); + this._addClass( axis, "ui-resizable-handle " + hname ); + + axis.css( { zIndex: o.zIndex } ); + + this.handles[ handle ] = ".ui-resizable-" + handle; + if ( !this.element.children( this.handles[ handle ] ).length ) { + this.element.append( axis ); + this._addedHandles = this._addedHandles.add( axis ); + } + } + + } + + this._renderAxis = function( target ) { + + var i, axis, padPos, padWrapper; + + target = target || this.element; + + for ( i in this.handles ) { + + if ( this.handles[ i ].constructor === String ) { + this.handles[ i ] = this.element.children( this.handles[ i ] ).first().show(); + } else if ( this.handles[ i ].jquery || this.handles[ i ].nodeType ) { + this.handles[ i ] = $( this.handles[ i ] ); + this._on( this.handles[ i ], { "mousedown": that._mouseDown } ); + } + + if ( this.elementIsWrapper && + this.originalElement[ 0 ] + .nodeName + .match( /^(textarea|input|select|button)$/i ) ) { + axis = $( this.handles[ i ], this.element ); + + padWrapper = /sw|ne|nw|se|n|s/.test( i ) ? + axis.outerHeight() : + axis.outerWidth(); + + padPos = [ "padding", + /ne|nw|n/.test( i ) ? "Top" : + /se|sw|s/.test( i ) ? "Bottom" : + /^e$/.test( i ) ? "Right" : "Left" ].join( "" ); + + target.css( padPos, padWrapper ); + + this._proportionallyResize(); + } + + this._handles = this._handles.add( this.handles[ i ] ); + } + }; + + // TODO: make renderAxis a prototype function + this._renderAxis( this.element ); + + this._handles = this._handles.add( this.element.find( ".ui-resizable-handle" ) ); + this._handles.disableSelection(); + + this._handles.on( "mouseover", function() { + if ( !that.resizing ) { + if ( this.className ) { + axis = this.className.match( /ui-resizable-(se|sw|ne|nw|n|e|s|w)/i ); + } + that.axis = axis && axis[ 1 ] ? axis[ 1 ] : "se"; + } + } ); + + if ( o.autoHide ) { + this._handles.hide(); + this._addClass( "ui-resizable-autohide" ); + } + }, + + _removeHandles: function() { + this._addedHandles.remove(); + }, + + _mouseCapture: function( event ) { + var i, handle, + capture = false; + + for ( i in this.handles ) { + handle = $( this.handles[ i ] )[ 0 ]; + if ( handle === event.target || $.contains( handle, event.target ) ) { + capture = true; + } + } + + return !this.options.disabled && capture; + }, + + _mouseStart: function( event ) { + + var curleft, curtop, cursor, calculatedSize, + o = this.options, + el = this.element; + + this.resizing = true; + + this._renderProxy(); + + curleft = this._num( this.helper.css( "left" ) ); + curtop = this._num( this.helper.css( "top" ) ); + + if ( o.containment ) { + curleft += $( o.containment ).scrollLeft() || 0; + curtop += $( o.containment ).scrollTop() || 0; + } + + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + + if ( !this._helper ) { + calculatedSize = this._calculateAdjustedElementDimensions( el ); + } + + this.size = this._helper ? { + width: this.helper.width(), + height: this.helper.height() + } : { + width: calculatedSize.width, + height: calculatedSize.height + }; + + this.originalSize = this._helper ? { + width: el.outerWidth(), + height: el.outerHeight() + } : { + width: calculatedSize.width, + height: calculatedSize.height + }; + + this.sizeDiff = { + width: el.outerWidth() - el.width(), + height: el.outerHeight() - el.height() + }; + + this.originalPosition = { left: curleft, top: curtop }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + this.aspectRatio = ( typeof o.aspectRatio === "number" ) ? + o.aspectRatio : + ( ( this.originalSize.width / this.originalSize.height ) || 1 ); + + cursor = $( ".ui-resizable-" + this.axis ).css( "cursor" ); + $( "body" ).css( "cursor", cursor === "auto" ? this.axis + "-resize" : cursor ); + + this._addClass( "ui-resizable-resizing" ); + this._propagate( "start", event ); + return true; + }, + + _mouseDrag: function( event ) { + + var data, props, + smp = this.originalMousePosition, + a = this.axis, + dx = ( event.pageX - smp.left ) || 0, + dy = ( event.pageY - smp.top ) || 0, + trigger = this._change[ a ]; + + this._updatePrevProperties(); + + if ( !trigger ) { + return false; + } + + data = trigger.apply( this, [ event, dx, dy ] ); + + this._updateVirtualBoundaries( event.shiftKey ); + if ( this._aspectRatio || event.shiftKey ) { + data = this._updateRatio( data, event ); + } + + data = this._respectSize( data, event ); + + this._updateCache( data ); + + this._propagate( "resize", event ); + + props = this._applyChanges(); + + if ( !this._helper && this._proportionallyResizeElements.length ) { + this._proportionallyResize(); + } + + if ( !$.isEmptyObject( props ) ) { + this._updatePrevProperties(); + this._trigger( "resize", event, this.ui() ); + this._applyChanges(); + } + + return false; + }, + + _mouseStop: function( event ) { + + this.resizing = false; + var pr, ista, soffseth, soffsetw, s, left, top, + o = this.options, that = this; + + if ( this._helper ) { + + pr = this._proportionallyResizeElements; + ista = pr.length && ( /textarea/i ).test( pr[ 0 ].nodeName ); + soffseth = ista && this._hasScroll( pr[ 0 ], "left" ) ? 0 : that.sizeDiff.height; + soffsetw = ista ? 0 : that.sizeDiff.width; + + s = { + width: ( that.helper.width() - soffsetw ), + height: ( that.helper.height() - soffseth ) + }; + left = ( parseFloat( that.element.css( "left" ) ) + + ( that.position.left - that.originalPosition.left ) ) || null; + top = ( parseFloat( that.element.css( "top" ) ) + + ( that.position.top - that.originalPosition.top ) ) || null; + + if ( !o.animate ) { + this.element.css( $.extend( s, { top: top, left: left } ) ); + } + + that.helper.height( that.size.height ); + that.helper.width( that.size.width ); + + if ( this._helper && !o.animate ) { + this._proportionallyResize(); + } + } + + $( "body" ).css( "cursor", "auto" ); + + this._removeClass( "ui-resizable-resizing" ); + + this._propagate( "stop", event ); + + if ( this._helper ) { + this.helper.remove(); + } + + return false; + + }, + + _updatePrevProperties: function() { + this.prevPosition = { + top: this.position.top, + left: this.position.left + }; + this.prevSize = { + width: this.size.width, + height: this.size.height + }; + }, + + _applyChanges: function() { + var props = {}; + + if ( this.position.top !== this.prevPosition.top ) { + props.top = this.position.top + "px"; + } + if ( this.position.left !== this.prevPosition.left ) { + props.left = this.position.left + "px"; + } + + this.helper.css( props ); + + if ( this.size.width !== this.prevSize.width ) { + props.width = this.size.width + "px"; + this.helper.width( props.width ); + } + if ( this.size.height !== this.prevSize.height ) { + props.height = this.size.height + "px"; + this.helper.height( props.height ); + } + + return props; + }, + + _updateVirtualBoundaries: function( forceAspectRatio ) { + var pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b, + o = this.options; + + b = { + minWidth: this._isNumber( o.minWidth ) ? o.minWidth : 0, + maxWidth: this._isNumber( o.maxWidth ) ? o.maxWidth : Infinity, + minHeight: this._isNumber( o.minHeight ) ? o.minHeight : 0, + maxHeight: this._isNumber( o.maxHeight ) ? o.maxHeight : Infinity + }; + + if ( this._aspectRatio || forceAspectRatio ) { + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if ( pMinWidth > b.minWidth ) { + b.minWidth = pMinWidth; + } + if ( pMinHeight > b.minHeight ) { + b.minHeight = pMinHeight; + } + if ( pMaxWidth < b.maxWidth ) { + b.maxWidth = pMaxWidth; + } + if ( pMaxHeight < b.maxHeight ) { + b.maxHeight = pMaxHeight; + } + } + this._vBoundaries = b; + }, + + _updateCache: function( data ) { + this.offset = this.helper.offset(); + if ( this._isNumber( data.left ) ) { + this.position.left = data.left; + } + if ( this._isNumber( data.top ) ) { + this.position.top = data.top; + } + if ( this._isNumber( data.height ) ) { + this.size.height = data.height; + } + if ( this._isNumber( data.width ) ) { + this.size.width = data.width; + } + }, + + _updateRatio: function( data ) { + + var cpos = this.position, + csize = this.size, + a = this.axis; + + if ( this._isNumber( data.height ) ) { + data.width = ( data.height * this.aspectRatio ); + } else if ( this._isNumber( data.width ) ) { + data.height = ( data.width / this.aspectRatio ); + } + + if ( a === "sw" ) { + data.left = cpos.left + ( csize.width - data.width ); + data.top = null; + } + if ( a === "nw" ) { + data.top = cpos.top + ( csize.height - data.height ); + data.left = cpos.left + ( csize.width - data.width ); + } + + return data; + }, + + _respectSize: function( data ) { + + var o = this._vBoundaries, + a = this.axis, + ismaxw = this._isNumber( data.width ) && o.maxWidth && ( o.maxWidth < data.width ), + ismaxh = this._isNumber( data.height ) && o.maxHeight && ( o.maxHeight < data.height ), + isminw = this._isNumber( data.width ) && o.minWidth && ( o.minWidth > data.width ), + isminh = this._isNumber( data.height ) && o.minHeight && ( o.minHeight > data.height ), + dw = this.originalPosition.left + this.originalSize.width, + dh = this.originalPosition.top + this.originalSize.height, + cw = /sw|nw|w/.test( a ), ch = /nw|ne|n/.test( a ); + if ( isminw ) { + data.width = o.minWidth; + } + if ( isminh ) { + data.height = o.minHeight; + } + if ( ismaxw ) { + data.width = o.maxWidth; + } + if ( ismaxh ) { + data.height = o.maxHeight; + } + + if ( isminw && cw ) { + data.left = dw - o.minWidth; + } + if ( ismaxw && cw ) { + data.left = dw - o.maxWidth; + } + if ( isminh && ch ) { + data.top = dh - o.minHeight; + } + if ( ismaxh && ch ) { + data.top = dh - o.maxHeight; + } + + // Fixing jump error on top/left - bug #2330 + if ( !data.width && !data.height && !data.left && data.top ) { + data.top = null; + } else if ( !data.width && !data.height && !data.top && data.left ) { + data.left = null; + } + + return data; + }, + + _getPaddingPlusBorderDimensions: function( element ) { + var i = 0, + widths = [], + borders = [ + element.css( "borderTopWidth" ), + element.css( "borderRightWidth" ), + element.css( "borderBottomWidth" ), + element.css( "borderLeftWidth" ) + ], + paddings = [ + element.css( "paddingTop" ), + element.css( "paddingRight" ), + element.css( "paddingBottom" ), + element.css( "paddingLeft" ) + ]; + + for ( ; i < 4; i++ ) { + widths[ i ] = ( parseFloat( borders[ i ] ) || 0 ); + widths[ i ] += ( parseFloat( paddings[ i ] ) || 0 ); + } + + return { + height: widths[ 0 ] + widths[ 2 ], + width: widths[ 1 ] + widths[ 3 ] + }; + }, + + _calculateAdjustedElementDimensions: function( element ) { + var elWidth, elHeight, paddingBorder, + ce = element.get( 0 ); + + if ( element.css( "box-sizing" ) !== "content-box" || + ( !this._hasScroll( ce ) && !this._hasScroll( ce, "left" ) ) ) { + return { + height: parseFloat( element.css( "height" ) ), + width: parseFloat( element.css( "width" ) ) + }; + } + + // Check if CSS inline styles are set and use those (usually from previous resizes) + elWidth = parseFloat( ce.style.width ); + elHeight = parseFloat( ce.style.height ); + + paddingBorder = this._getPaddingPlusBorderDimensions( element ); + elWidth = isNaN( elWidth ) ? + this._getElementTheoreticalSize( element, paddingBorder, "width" ) : + elWidth; + elHeight = isNaN( elHeight ) ? + this._getElementTheoreticalSize( element, paddingBorder, "height" ) : + elHeight; + + return { + height: elHeight, + width: elWidth + }; + }, + + _getElementTheoreticalSize: function( element, extraSize, dimension ) { + + // offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border + var size = Math.max( 0, Math.ceil( + element.get( 0 )[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + extraSize[ dimension ] - + 0.5 + + // If offsetWidth/offsetHeight is unknown, then we can't determine theoretical size. + // Use an explicit zero to avoid NaN. + // See https://github.com/jquery/jquery/issues/3964 + ) ) || 0; + + return size; + }, + + _proportionallyResize: function() { + + if ( !this._proportionallyResizeElements.length ) { + return; + } + + var prel, + i = 0, + element = this.helper || this.element; + + for ( ; i < this._proportionallyResizeElements.length; i++ ) { + + prel = this._proportionallyResizeElements[ i ]; + + // TODO: Seems like a bug to cache this.outerDimensions + // considering that we are in a loop. + if ( !this.outerDimensions ) { + this.outerDimensions = this._getPaddingPlusBorderDimensions( prel ); + } + + prel.css( { + height: ( element.height() - this.outerDimensions.height ) || 0, + width: ( element.width() - this.outerDimensions.width ) || 0 + } ); + + } + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if ( this._helper ) { + + this.helper = this.helper || $( "
          " ).css( { overflow: "hidden" } ); + + this._addClass( this.helper, this._helper ); + this.helper.css( { + width: this.element.outerWidth(), + height: this.element.outerHeight(), + position: "absolute", + left: this.elementOffset.left + "px", + top: this.elementOffset.top + "px", + zIndex: ++o.zIndex //TODO: Don't modify option + } ); + + this.helper + .appendTo( "body" ) + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function( event, dx ) { + return { width: this.originalSize.width + dx }; + }, + w: function( event, dx ) { + var cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function( event, dx, dy ) { + var cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function( event, dx, dy ) { + return { height: this.originalSize.height + dy }; + }, + se: function( event, dx, dy ) { + return $.extend( this._change.s.apply( this, arguments ), + this._change.e.apply( this, [ event, dx, dy ] ) ); + }, + sw: function( event, dx, dy ) { + return $.extend( this._change.s.apply( this, arguments ), + this._change.w.apply( this, [ event, dx, dy ] ) ); + }, + ne: function( event, dx, dy ) { + return $.extend( this._change.n.apply( this, arguments ), + this._change.e.apply( this, [ event, dx, dy ] ) ); + }, + nw: function( event, dx, dy ) { + return $.extend( this._change.n.apply( this, arguments ), + this._change.w.apply( this, [ event, dx, dy ] ) ); + } + }, + + _propagate: function( n, event ) { + $.ui.plugin.call( this, n, [ event, this.ui() ] ); + if ( n !== "resize" ) { + this._trigger( n, event, this.ui() ); + } + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +} ); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add( "resizable", "animate", { + + stop: function( event ) { + var that = $( this ).resizable( "instance" ), + o = that.options, + pr = that._proportionallyResizeElements, + ista = pr.length && ( /textarea/i ).test( pr[ 0 ].nodeName ), + soffseth = ista && that._hasScroll( pr[ 0 ], "left" ) ? 0 : that.sizeDiff.height, + soffsetw = ista ? 0 : that.sizeDiff.width, + style = { + width: ( that.size.width - soffsetw ), + height: ( that.size.height - soffseth ) + }, + left = ( parseFloat( that.element.css( "left" ) ) + + ( that.position.left - that.originalPosition.left ) ) || null, + top = ( parseFloat( that.element.css( "top" ) ) + + ( that.position.top - that.originalPosition.top ) ) || null; + + that.element.animate( + $.extend( style, top && left ? { top: top, left: left } : {} ), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseFloat( that.element.css( "width" ) ), + height: parseFloat( that.element.css( "height" ) ), + top: parseFloat( that.element.css( "top" ) ), + left: parseFloat( that.element.css( "left" ) ) + }; + + if ( pr && pr.length ) { + $( pr[ 0 ] ).css( { width: data.width, height: data.height } ); + } + + // Propagating resize, and updating values for each animation step + that._updateCache( data ); + that._propagate( "resize", event ); + + } + } + ); + } + +} ); + +$.ui.plugin.add( "resizable", "containment", { + + start: function() { + var element, p, co, ch, cw, width, height, + that = $( this ).resizable( "instance" ), + o = that.options, + el = that.element, + oc = o.containment, + ce = ( oc instanceof $ ) ? + oc.get( 0 ) : + ( /parent/.test( oc ) ) ? el.parent().get( 0 ) : oc; + + if ( !ce ) { + return; + } + + that.containerElement = $( ce ); + + if ( /document/.test( oc ) || oc === document ) { + that.containerOffset = { + left: 0, + top: 0 + }; + that.containerPosition = { + left: 0, + top: 0 + }; + + that.parentData = { + element: $( document ), + left: 0, + top: 0, + width: $( document ).width(), + height: $( document ).height() || document.body.parentNode.scrollHeight + }; + } else { + element = $( ce ); + p = []; + $( [ "Top", "Right", "Left", "Bottom" ] ).each( function( i, name ) { + p[ i ] = that._num( element.css( "padding" + name ) ); + } ); + + that.containerOffset = element.offset(); + that.containerPosition = element.position(); + that.containerSize = { + height: ( element.innerHeight() - p[ 3 ] ), + width: ( element.innerWidth() - p[ 1 ] ) + }; + + co = that.containerOffset; + ch = that.containerSize.height; + cw = that.containerSize.width; + width = ( that._hasScroll( ce, "left" ) ? ce.scrollWidth : cw ); + height = ( that._hasScroll( ce ) ? ce.scrollHeight : ch ); + + that.parentData = { + element: ce, + left: co.left, + top: co.top, + width: width, + height: height + }; + } + }, + + resize: function( event ) { + var woset, hoset, isParent, isOffsetRelative, + that = $( this ).resizable( "instance" ), + o = that.options, + co = that.containerOffset, + cp = that.position, + pRatio = that._aspectRatio || event.shiftKey, + cop = { + top: 0, + left: 0 + }, + ce = that.containerElement, + continueResize = true; + + if ( ce[ 0 ] !== document && ( /static/ ).test( ce.css( "position" ) ) ) { + cop = co; + } + + if ( cp.left < ( that._helper ? co.left : 0 ) ) { + that.size.width = that.size.width + + ( that._helper ? + ( that.position.left - co.left ) : + ( that.position.left - cop.left ) ); + + if ( pRatio ) { + that.size.height = that.size.width / that.aspectRatio; + continueResize = false; + } + that.position.left = o.helper ? co.left : 0; + } + + if ( cp.top < ( that._helper ? co.top : 0 ) ) { + that.size.height = that.size.height + + ( that._helper ? + ( that.position.top - co.top ) : + that.position.top ); + + if ( pRatio ) { + that.size.width = that.size.height * that.aspectRatio; + continueResize = false; + } + that.position.top = that._helper ? co.top : 0; + } + + isParent = that.containerElement.get( 0 ) === that.element.parent().get( 0 ); + isOffsetRelative = /relative|absolute/.test( that.containerElement.css( "position" ) ); + + if ( isParent && isOffsetRelative ) { + that.offset.left = that.parentData.left + that.position.left; + that.offset.top = that.parentData.top + that.position.top; + } else { + that.offset.left = that.element.offset().left; + that.offset.top = that.element.offset().top; + } + + woset = Math.abs( that.sizeDiff.width + + ( that._helper ? + that.offset.left - cop.left : + ( that.offset.left - co.left ) ) ); + + hoset = Math.abs( that.sizeDiff.height + + ( that._helper ? + that.offset.top - cop.top : + ( that.offset.top - co.top ) ) ); + + if ( woset + that.size.width >= that.parentData.width ) { + that.size.width = that.parentData.width - woset; + if ( pRatio ) { + that.size.height = that.size.width / that.aspectRatio; + continueResize = false; + } + } + + if ( hoset + that.size.height >= that.parentData.height ) { + that.size.height = that.parentData.height - hoset; + if ( pRatio ) { + that.size.width = that.size.height * that.aspectRatio; + continueResize = false; + } + } + + if ( !continueResize ) { + that.position.left = that.prevPosition.left; + that.position.top = that.prevPosition.top; + that.size.width = that.prevSize.width; + that.size.height = that.prevSize.height; + } + }, + + stop: function() { + var that = $( this ).resizable( "instance" ), + o = that.options, + co = that.containerOffset, + cop = that.containerPosition, + ce = that.containerElement, + helper = $( that.helper ), + ho = helper.offset(), + w = helper.outerWidth() - that.sizeDiff.width, + h = helper.outerHeight() - that.sizeDiff.height; + + if ( that._helper && !o.animate && ( /relative/ ).test( ce.css( "position" ) ) ) { + $( this ).css( { + left: ho.left - cop.left - co.left, + width: w, + height: h + } ); + } + + if ( that._helper && !o.animate && ( /static/ ).test( ce.css( "position" ) ) ) { + $( this ).css( { + left: ho.left - cop.left - co.left, + width: w, + height: h + } ); + } + } +} ); + +$.ui.plugin.add( "resizable", "alsoResize", { + + start: function() { + var that = $( this ).resizable( "instance" ), + o = that.options; + + $( o.alsoResize ).each( function() { + var el = $( this ), + elSize = that._calculateAdjustedElementDimensions( el ); + + el.data( "ui-resizable-alsoresize", { + width: elSize.width, height: elSize.height, + left: parseFloat( el.css( "left" ) ), top: parseFloat( el.css( "top" ) ) + } ); + } ); + }, + + resize: function( event, ui ) { + var that = $( this ).resizable( "instance" ), + o = that.options, + os = that.originalSize, + op = that.originalPosition, + delta = { + height: ( that.size.height - os.height ) || 0, + width: ( that.size.width - os.width ) || 0, + top: ( that.position.top - op.top ) || 0, + left: ( that.position.left - op.left ) || 0 + }; + + $( o.alsoResize ).each( function() { + var el = $( this ), start = $( this ).data( "ui-resizable-alsoresize" ), style = {}, + css = el.parents( ui.originalElement[ 0 ] ).length ? + [ "width", "height" ] : + [ "width", "height", "top", "left" ]; + + $.each( css, function( i, prop ) { + var sum = ( start[ prop ] || 0 ) + ( delta[ prop ] || 0 ); + if ( sum && sum >= 0 ) { + style[ prop ] = sum || null; + } + } ); + + el.css( style ); + } ); + }, + + stop: function() { + $( this ).removeData( "ui-resizable-alsoresize" ); + } +} ); + +$.ui.plugin.add( "resizable", "ghost", { + + start: function() { + + var that = $( this ).resizable( "instance" ), cs = that.size; + + that.ghost = that.originalElement.clone(); + that.ghost.css( { + opacity: 0.25, + display: "block", + position: "relative", + height: cs.height, + width: cs.width, + margin: 0, + left: 0, + top: 0 + } ); + + that._addClass( that.ghost, "ui-resizable-ghost" ); + + // DEPRECATED + // TODO: remove after 1.12 + if ( $.uiBackCompat === true && typeof that.options.ghost === "string" ) { + + // Ghost option + that.ghost.addClass( this.options.ghost ); + } + + that.ghost.appendTo( that.helper ); + + }, + + resize: function() { + var that = $( this ).resizable( "instance" ); + if ( that.ghost ) { + that.ghost.css( { + position: "relative", + height: that.size.height, + width: that.size.width + } ); + } + }, + + stop: function() { + var that = $( this ).resizable( "instance" ); + if ( that.ghost && that.helper ) { + that.helper.get( 0 ).removeChild( that.ghost.get( 0 ) ); + } + } + +} ); + +$.ui.plugin.add( "resizable", "grid", { + + resize: function() { + var outerDimensions, + that = $( this ).resizable( "instance" ), + o = that.options, + cs = that.size, + os = that.originalSize, + op = that.originalPosition, + a = that.axis, + grid = typeof o.grid === "number" ? [ o.grid, o.grid ] : o.grid, + gridX = ( grid[ 0 ] || 1 ), + gridY = ( grid[ 1 ] || 1 ), + ox = Math.round( ( cs.width - os.width ) / gridX ) * gridX, + oy = Math.round( ( cs.height - os.height ) / gridY ) * gridY, + newWidth = os.width + ox, + newHeight = os.height + oy, + isMaxWidth = o.maxWidth && ( o.maxWidth < newWidth ), + isMaxHeight = o.maxHeight && ( o.maxHeight < newHeight ), + isMinWidth = o.minWidth && ( o.minWidth > newWidth ), + isMinHeight = o.minHeight && ( o.minHeight > newHeight ); + + o.grid = grid; + + if ( isMinWidth ) { + newWidth += gridX; + } + if ( isMinHeight ) { + newHeight += gridY; + } + if ( isMaxWidth ) { + newWidth -= gridX; + } + if ( isMaxHeight ) { + newHeight -= gridY; + } + + if ( /^(se|s|e)$/.test( a ) ) { + that.size.width = newWidth; + that.size.height = newHeight; + } else if ( /^(ne)$/.test( a ) ) { + that.size.width = newWidth; + that.size.height = newHeight; + that.position.top = op.top - oy; + } else if ( /^(sw)$/.test( a ) ) { + that.size.width = newWidth; + that.size.height = newHeight; + that.position.left = op.left - ox; + } else { + if ( newHeight - gridY <= 0 || newWidth - gridX <= 0 ) { + outerDimensions = that._getPaddingPlusBorderDimensions( this ); + } + + if ( newHeight - gridY > 0 ) { + that.size.height = newHeight; + that.position.top = op.top - oy; + } else { + newHeight = gridY - outerDimensions.height; + that.size.height = newHeight; + that.position.top = op.top + os.height - newHeight; + } + if ( newWidth - gridX > 0 ) { + that.size.width = newWidth; + that.position.left = op.left - ox; + } else { + newWidth = gridX - outerDimensions.width; + that.size.width = newWidth; + that.position.left = op.left + os.width - newWidth; + } + } + } + +} ); + +var widgetsResizable = $.ui.resizable; + + +/*! + * jQuery UI Selectable 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: Selectable +//>>group: Interactions +//>>description: Allows groups of elements to be selected with the mouse. +//>>docs: https://api.jqueryui.com/selectable/ +//>>demos: https://jqueryui.com/selectable/ +//>>css.structure: ../../themes/base/selectable.css + + +var widgetsSelectable = $.widget( "ui.selectable", $.ui.mouse, { + version: "1.14.1", + options: { + appendTo: "body", + autoRefresh: true, + distance: 0, + filter: "*", + tolerance: "touch", + + // Callbacks + selected: null, + selecting: null, + start: null, + stop: null, + unselected: null, + unselecting: null + }, + _create: function() { + var that = this; + + this._addClass( "ui-selectable" ); + + this.dragged = false; + + // Cache selectee children based on filter + this.refresh = function() { + that.elementPos = $( that.element[ 0 ] ).offset(); + that.selectees = $( that.options.filter, that.element[ 0 ] ); + that._addClass( that.selectees, "ui-selectee" ); + that.selectees.each( function() { + var $this = $( this ), + selecteeOffset = $this.offset(), + pos = { + left: selecteeOffset.left - that.elementPos.left, + top: selecteeOffset.top - that.elementPos.top + }; + $.data( this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass( "ui-selected" ), + selecting: $this.hasClass( "ui-selecting" ), + unselecting: $this.hasClass( "ui-unselecting" ) + } ); + } ); + }; + this.refresh(); + + this._mouseInit(); + + this.helper = $( "
          " ); + this._addClass( this.helper, "ui-selectable-helper" ); + }, + + _destroy: function() { + this.selectees.removeData( "selectable-item" ); + this._mouseDestroy(); + }, + + _mouseStart: function( event ) { + var that = this, + options = this.options; + + this.opos = [ event.pageX, event.pageY ]; + this.elementPos = $( this.element[ 0 ] ).offset(); + + if ( this.options.disabled ) { + return; + } + + this.selectees = $( options.filter, this.element[ 0 ] ); + + this._trigger( "start", event ); + + $( options.appendTo ).append( this.helper ); + + // position helper (lasso) + this.helper.css( { + "left": event.pageX, + "top": event.pageY, + "width": 0, + "height": 0 + } ); + + if ( options.autoRefresh ) { + this.refresh(); + } + + this.selectees.filter( ".ui-selected" ).each( function() { + var selectee = $.data( this, "selectable-item" ); + selectee.startselected = true; + if ( !event.metaKey && !event.ctrlKey ) { + that._removeClass( selectee.$element, "ui-selected" ); + selectee.selected = false; + that._addClass( selectee.$element, "ui-unselecting" ); + selectee.unselecting = true; + + // selectable UNSELECTING callback + that._trigger( "unselecting", event, { + unselecting: selectee.element + } ); + } + } ); + + $( event.target ).parents().addBack().each( function() { + var doSelect, + selectee = $.data( this, "selectable-item" ); + if ( selectee ) { + doSelect = ( !event.metaKey && !event.ctrlKey ) || + !selectee.$element.hasClass( "ui-selected" ); + that._removeClass( selectee.$element, doSelect ? "ui-unselecting" : "ui-selected" ) + ._addClass( selectee.$element, doSelect ? "ui-selecting" : "ui-unselecting" ); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + + // selectable (UN)SELECTING callback + if ( doSelect ) { + that._trigger( "selecting", event, { + selecting: selectee.element + } ); + } else { + that._trigger( "unselecting", event, { + unselecting: selectee.element + } ); + } + return false; + } + } ); + + }, + + _mouseDrag: function( event ) { + + this.dragged = true; + + if ( this.options.disabled ) { + return; + } + + var tmp, + that = this, + options = this.options, + x1 = this.opos[ 0 ], + y1 = this.opos[ 1 ], + x2 = event.pageX, + y2 = event.pageY; + + if ( x1 > x2 ) { + tmp = x2; x2 = x1; x1 = tmp; + } + if ( y1 > y2 ) { + tmp = y2; y2 = y1; y1 = tmp; + } + this.helper.css( { left: x1, top: y1, width: x2 - x1, height: y2 - y1 } ); + + this.selectees.each( function() { + var selectee = $.data( this, "selectable-item" ), + hit = false, + offset = {}; + + //prevent helper from being selected if appendTo: selectable + if ( !selectee || selectee.element === that.element[ 0 ] ) { + return; + } + + offset.left = selectee.left + that.elementPos.left; + offset.right = selectee.right + that.elementPos.left; + offset.top = selectee.top + that.elementPos.top; + offset.bottom = selectee.bottom + that.elementPos.top; + + if ( options.tolerance === "touch" ) { + hit = ( !( offset.left > x2 || offset.right < x1 || offset.top > y2 || + offset.bottom < y1 ) ); + } else if ( options.tolerance === "fit" ) { + hit = ( offset.left > x1 && offset.right < x2 && offset.top > y1 && + offset.bottom < y2 ); + } + + if ( hit ) { + + // SELECT + if ( selectee.selected ) { + that._removeClass( selectee.$element, "ui-selected" ); + selectee.selected = false; + } + if ( selectee.unselecting ) { + that._removeClass( selectee.$element, "ui-unselecting" ); + selectee.unselecting = false; + } + if ( !selectee.selecting ) { + that._addClass( selectee.$element, "ui-selecting" ); + selectee.selecting = true; + + // selectable SELECTING callback + that._trigger( "selecting", event, { + selecting: selectee.element + } ); + } + } else { + + // UNSELECT + if ( selectee.selecting ) { + if ( ( event.metaKey || event.ctrlKey ) && selectee.startselected ) { + that._removeClass( selectee.$element, "ui-selecting" ); + selectee.selecting = false; + that._addClass( selectee.$element, "ui-selected" ); + selectee.selected = true; + } else { + that._removeClass( selectee.$element, "ui-selecting" ); + selectee.selecting = false; + if ( selectee.startselected ) { + that._addClass( selectee.$element, "ui-unselecting" ); + selectee.unselecting = true; + } + + // selectable UNSELECTING callback + that._trigger( "unselecting", event, { + unselecting: selectee.element + } ); + } + } + if ( selectee.selected ) { + if ( !event.metaKey && !event.ctrlKey && !selectee.startselected ) { + that._removeClass( selectee.$element, "ui-selected" ); + selectee.selected = false; + + that._addClass( selectee.$element, "ui-unselecting" ); + selectee.unselecting = true; + + // selectable UNSELECTING callback + that._trigger( "unselecting", event, { + unselecting: selectee.element + } ); + } + } + } + } ); + + return false; + }, + + _mouseStop: function( event ) { + var that = this; + + this.dragged = false; + + $( ".ui-unselecting", this.element[ 0 ] ).each( function() { + var selectee = $.data( this, "selectable-item" ); + that._removeClass( selectee.$element, "ui-unselecting" ); + selectee.unselecting = false; + selectee.startselected = false; + that._trigger( "unselected", event, { + unselected: selectee.element + } ); + } ); + $( ".ui-selecting", this.element[ 0 ] ).each( function() { + var selectee = $.data( this, "selectable-item" ); + that._removeClass( selectee.$element, "ui-selecting" ) + ._addClass( selectee.$element, "ui-selected" ); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + that._trigger( "selected", event, { + selected: selectee.element + } ); + } ); + this._trigger( "stop", event ); + + this.helper.remove(); + + return false; + } + +} ); + + +/*! + * jQuery UI Sortable 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: Sortable +//>>group: Interactions +//>>description: Enables items in a list to be sorted using the mouse. +//>>docs: https://api.jqueryui.com/sortable/ +//>>demos: https://jqueryui.com/sortable/ +//>>css.structure: ../../themes/base/sortable.css + + +var widgetsSortable = $.widget( "ui.sortable", $.ui.mouse, { + version: "1.14.1", + widgetEventPrefix: "sort", + ready: false, + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: "auto", + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: "> *", + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000, + + // Callbacks + activate: null, + beforeStop: null, + change: null, + deactivate: null, + out: null, + over: null, + receive: null, + remove: null, + sort: null, + start: null, + stop: null, + update: null + }, + + _isOverAxis: function( x, reference, size ) { + return ( x >= reference ) && ( x < ( reference + size ) ); + }, + + _isFloating: function( item ) { + return ( /left|right/ ).test( item.css( "float" ) ) || + ( /inline|table-cell/ ).test( item.css( "display" ) ); + }, + + _create: function() { + this.containerCache = {}; + this._addClass( "ui-sortable" ); + + //Get the items + this.refresh(); + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + this._setHandleClassName(); + + //We're ready to go + this.ready = true; + + }, + + _setOption: function( key, value ) { + this._super( key, value ); + + if ( key === "handle" ) { + this._setHandleClassName(); + } + }, + + _setHandleClassName: function() { + var that = this; + this._removeClass( this.element.find( ".ui-sortable-handle" ), "ui-sortable-handle" ); + $.each( this.items, function() { + that._addClass( + this.instance.options.handle ? + this.item.find( this.instance.options.handle ) : + this.item, + "ui-sortable-handle" + ); + } ); + }, + + _destroy: function() { + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) { + this.items[ i ].item.removeData( this.widgetName + "-item" ); + } + + return this; + }, + + _mouseCapture: function( event, overrideHandle ) { + var currentItem = null, + validHandle = false, + that = this; + + if ( this.reverting ) { + return false; + } + + if ( this.options.disabled || this.options.type === "static" ) { + return false; + } + + //We have to refresh the items data once first + this._refreshItems( event ); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + $( event.target ).parents().each( function() { + if ( $.data( this, that.widgetName + "-item" ) === that ) { + currentItem = $( this ); + return false; + } + } ); + if ( $.data( event.target, that.widgetName + "-item" ) === that ) { + currentItem = $( event.target ); + } + + if ( !currentItem ) { + return false; + } + if ( this.options.handle && !overrideHandle ) { + $( this.options.handle, currentItem ).find( "*" ).addBack().each( function() { + if ( this === event.target ) { + validHandle = true; + } + } ); + if ( !validHandle ) { + return false; + } + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function( event, overrideHandle, noActivation ) { + + var i, body, + o = this.options; + + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to + // mouseCapture + this.refreshPositions(); + + //Prepare the dragged items parent + this.appendTo = $( o.appendTo !== "parent" ? + o.appendTo : + this.currentItem.parent() ); + + //Create and append the visible helper + this.helper = this._createHelper( event ); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend( this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + + // This is a relative to absolute position minus the actual position calculation - + // only used for relative positioned helper + relative: this._getRelativeOffset() + } ); + + // After we get the helper offset, but before we get the parent offset we can + // change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css( "position", "absolute" ); + this.cssPosition = this.helper.css( "position" ); + + //Adjust the mouse offset relative to the helper if "cursorAt" is supplied + if ( o.cursorAt ) { + this._adjustOffsetFromHelper( o.cursorAt ); + } + + //Cache the former DOM position + this.domPosition = { + prev: this.currentItem.prev()[ 0 ], + parent: this.currentItem.parent()[ 0 ] + }; + + // If the helper is not the original, hide the original so it's not playing any role during + // the drag, won't cause anything bad this way + if ( this.helper[ 0 ] !== this.currentItem[ 0 ] ) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Get the next scrolling parent + this.scrollParent = this.placeholder.scrollParent(); + + $.extend( this.offset, { + parent: this._getParentOffset() + } ); + + //Set a containment if given in the options + if ( o.containment ) { + this._setContainment(); + } + + if ( o.cursor && o.cursor !== "auto" ) { // cursor option + body = this.document.find( "body" ); + + this._storedStylesheet = + $( "" ).appendTo( body ); + } + + // We need to make sure to grab the zIndex before setting the + // opacity, because setting the opacity to anything lower than 1 + // causes the zIndex to change from "auto" to 0. + if ( o.zIndex ) { // zIndex option + if ( this.helper.css( "zIndex" ) ) { + this._storedZIndex = this.helper.css( "zIndex" ); + } + this.helper.css( "zIndex", o.zIndex ); + } + + if ( o.opacity ) { // opacity option + if ( this.helper.css( "opacity" ) ) { + this._storedOpacity = this.helper.css( "opacity" ); + } + this.helper.css( "opacity", o.opacity ); + } + + //Prepare scrolling + if ( this.scrollParent[ 0 ] !== this.document[ 0 ] && + this.scrollParent[ 0 ].tagName !== "HTML" ) { + this.overflowOffset = this.scrollParent.offset(); + } + + //Call callbacks + this._trigger( "start", event, this._uiHash() ); + + //Recache the helper size + if ( !this._preserveHelperProportions ) { + this._cacheHelperProportions(); + } + + //Post "activate" events to possible containers + if ( !noActivation ) { + for ( i = this.containers.length - 1; i >= 0; i-- ) { + this.containers[ i ]._trigger( "activate", event, this._uiHash( this ) ); + } + } + + //Prepare possible droppables + if ( $.ui.ddmanager ) { + $.ui.ddmanager.current = this; + } + + if ( $.ui.ddmanager && !o.dropBehaviour ) { + $.ui.ddmanager.prepareOffsets( this, event ); + } + + this.dragging = true; + + this._addClass( this.helper, "ui-sortable-helper" ); + + //Move the helper, if needed + if ( !this.helper.parent().is( this.appendTo ) ) { + this.helper.detach().appendTo( this.appendTo ); + + //Update position + this.offset.parent = this._getParentOffset(); + } + + //Generate the original position + this.position = this.originalPosition = this._generatePosition( event ); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + this.lastPositionAbs = this.positionAbs = this._convertPositionTo( "absolute" ); + + this._mouseDrag( event ); + + return true; + + }, + + _scroll: function( event ) { + var o = this.options, + scrolled = false; + + if ( this.scrollParent[ 0 ] !== this.document[ 0 ] && + this.scrollParent[ 0 ].tagName !== "HTML" ) { + + if ( ( this.overflowOffset.top + this.scrollParent[ 0 ].offsetHeight ) - + event.pageY < o.scrollSensitivity ) { + this.scrollParent[ 0 ].scrollTop = + scrolled = this.scrollParent[ 0 ].scrollTop + o.scrollSpeed; + } else if ( event.pageY - this.overflowOffset.top < o.scrollSensitivity ) { + this.scrollParent[ 0 ].scrollTop = + scrolled = this.scrollParent[ 0 ].scrollTop - o.scrollSpeed; + } + + if ( ( this.overflowOffset.left + this.scrollParent[ 0 ].offsetWidth ) - + event.pageX < o.scrollSensitivity ) { + this.scrollParent[ 0 ].scrollLeft = scrolled = + this.scrollParent[ 0 ].scrollLeft + o.scrollSpeed; + } else if ( event.pageX - this.overflowOffset.left < o.scrollSensitivity ) { + this.scrollParent[ 0 ].scrollLeft = scrolled = + this.scrollParent[ 0 ].scrollLeft - o.scrollSpeed; + } + + } else { + + if ( event.pageY - this.document.scrollTop() < o.scrollSensitivity ) { + scrolled = this.document.scrollTop( this.document.scrollTop() - o.scrollSpeed ); + } else if ( this.window.height() - ( event.pageY - this.document.scrollTop() ) < + o.scrollSensitivity ) { + scrolled = this.document.scrollTop( this.document.scrollTop() + o.scrollSpeed ); + } + + if ( event.pageX - this.document.scrollLeft() < o.scrollSensitivity ) { + scrolled = this.document.scrollLeft( + this.document.scrollLeft() - o.scrollSpeed + ); + } else if ( this.window.width() - ( event.pageX - this.document.scrollLeft() ) < + o.scrollSensitivity ) { + scrolled = this.document.scrollLeft( + this.document.scrollLeft() + o.scrollSpeed + ); + } + + } + + return scrolled; + }, + + _mouseDrag: function( event ) { + var i, item, itemElement, intersection, + o = this.options; + + //Compute the helpers position + this.position = this._generatePosition( event ); + this.positionAbs = this._convertPositionTo( "absolute" ); + + //Set the helper position + if ( !this.options.axis || this.options.axis !== "y" ) { + this.helper[ 0 ].style.left = this.position.left + "px"; + } + if ( !this.options.axis || this.options.axis !== "x" ) { + this.helper[ 0 ].style.top = this.position.top + "px"; + } + + //Do scrolling + if ( o.scroll ) { + if ( this._scroll( event ) !== false ) { + + //Update item positions used in position checks + this._refreshItemPositions( true ); + + if ( $.ui.ddmanager && !o.dropBehaviour ) { + $.ui.ddmanager.prepareOffsets( this, event ); + } + } + } + + this.dragDirection = { + vertical: this._getDragVerticalDirection(), + horizontal: this._getDragHorizontalDirection() + }; + + //Rearrange + for ( i = this.items.length - 1; i >= 0; i-- ) { + + //Cache variables and intersection, continue if no intersection + item = this.items[ i ]; + itemElement = item.item[ 0 ]; + intersection = this._intersectsWithPointer( item ); + if ( !intersection ) { + continue; + } + + // Only put the placeholder inside the current Container, skip all + // items from other containers. This works because when moving + // an item from one container to another the + // currentContainer is switched before the placeholder is moved. + // + // Without this, moving items in "sub-sortables" can cause + // the placeholder to jitter between the outer and inner container. + if ( item.instance !== this.currentContainer ) { + continue; + } + + // Cannot intersect with itself + // no useless actions that have been done before + // no action if the item moved is the parent of the item checked + if ( itemElement !== this.currentItem[ 0 ] && + this.placeholder[ intersection === 1 ? + "next" : "prev" ]()[ 0 ] !== itemElement && + !$.contains( this.placeholder[ 0 ], itemElement ) && + ( this.options.type === "semi-dynamic" ? + !$.contains( this.element[ 0 ], itemElement ) : + true + ) + ) { + + this.direction = intersection === 1 ? "down" : "up"; + + if ( this.options.tolerance === "pointer" || + this._intersectsWithSides( item ) ) { + this._rearrange( event, item ); + } else { + break; + } + + this._trigger( "change", event, this._uiHash() ); + break; + } + } + + //Post events to containers + this._contactContainers( event ); + + //Interconnect with droppables + if ( $.ui.ddmanager ) { + $.ui.ddmanager.drag( this, event ); + } + + //Call callbacks + this._trigger( "sort", event, this._uiHash() ); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function( event, noPropagation ) { + + if ( !event ) { + return; + } + + //If we are using droppables, inform the manager about the drop + if ( $.ui.ddmanager && !this.options.dropBehaviour ) { + $.ui.ddmanager.drop( this, event ); + } + + if ( this.options.revert ) { + var that = this, + cur = this.placeholder.offset(), + axis = this.options.axis, + animation = {}; + + if ( !axis || axis === "x" ) { + animation.left = cur.left - this.offset.parent.left - this.margins.left + + ( this.offsetParent[ 0 ] === this.document[ 0 ].body ? + 0 : + this.offsetParent[ 0 ].scrollLeft + ); + } + if ( !axis || axis === "y" ) { + animation.top = cur.top - this.offset.parent.top - this.margins.top + + ( this.offsetParent[ 0 ] === this.document[ 0 ].body ? + 0 : + this.offsetParent[ 0 ].scrollTop + ); + } + this.reverting = true; + $( this.helper ).animate( + animation, + parseInt( this.options.revert, 10 ) || 500, + function() { + that._clear( event ); + } + ); + } else { + this._clear( event, noPropagation ); + } + + return false; + + }, + + cancel: function() { + + if ( this.dragging ) { + + this._mouseUp( new $.Event( "mouseup", { target: null } ) ); + + if ( this.options.helper === "original" ) { + this.currentItem.css( this._storedCSS ); + this._removeClass( this.currentItem, "ui-sortable-helper" ); + } else { + this.currentItem.show(); + } + + //Post deactivating events to containers + for ( var i = this.containers.length - 1; i >= 0; i-- ) { + this.containers[ i ]._trigger( "deactivate", null, this._uiHash( this ) ); + if ( this.containers[ i ].containerCache.over ) { + this.containers[ i ]._trigger( "out", null, this._uiHash( this ) ); + this.containers[ i ].containerCache.over = 0; + } + } + + } + + if ( this.placeholder ) { + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, + // it unbinds ALL events from the original node! + if ( this.placeholder[ 0 ].parentNode ) { + this.placeholder[ 0 ].parentNode.removeChild( this.placeholder[ 0 ] ); + } + if ( this.options.helper !== "original" && this.helper && + this.helper[ 0 ].parentNode ) { + this.helper.remove(); + } + + $.extend( this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + } ); + + if ( this.domPosition.prev ) { + $( this.domPosition.prev ).after( this.currentItem ); + } else { + $( this.domPosition.parent ).prepend( this.currentItem ); + } + } + + return this; + + }, + + serialize: function( o ) { + + var items = this._getItemsAsjQuery( o && o.connected ), + str = []; + o = o || {}; + + $( items ).each( function() { + var res = ( $( o.item || this ).attr( o.attribute || "id" ) || "" ) + .match( o.expression || ( /(.+)[\-=_](.+)/ ) ); + if ( res ) { + str.push( + ( o.key || res[ 1 ] + "[]" ) + + "=" + ( o.key && o.expression ? res[ 1 ] : res[ 2 ] ) ); + } + } ); + + if ( !str.length && o.key ) { + str.push( o.key + "=" ); + } + + return str.join( "&" ); + + }, + + toArray: function( o ) { + + var items = this._getItemsAsjQuery( o && o.connected ), + ret = []; + + o = o || {}; + + items.each( function() { + ret.push( $( o.item || this ).attr( o.attribute || "id" ) || "" ); + } ); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function( item ) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height, + l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height, + dyClick = this.offset.click.top, + dxClick = this.offset.click.left, + isOverElementHeight = ( this.options.axis === "x" ) || ( ( y1 + dyClick ) > t && + ( y1 + dyClick ) < b ), + isOverElementWidth = ( this.options.axis === "y" ) || ( ( x1 + dxClick ) > l && + ( x1 + dxClick ) < r ), + isOverElement = isOverElementHeight && isOverElementWidth; + + if ( this.options.tolerance === "pointer" || + this.options.forcePointerForContainers || + ( this.options.tolerance !== "pointer" && + this.helperProportions[ this.floating ? "width" : "height" ] > + item[ this.floating ? "width" : "height" ] ) + ) { + return isOverElement; + } else { + + return ( l < x1 + ( this.helperProportions.width / 2 ) && // Right Half + x2 - ( this.helperProportions.width / 2 ) < r && // Left Half + t < y1 + ( this.helperProportions.height / 2 ) && // Bottom Half + y2 - ( this.helperProportions.height / 2 ) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function( item ) { + var verticalDirection, horizontalDirection, + isOverElementHeight = ( this.options.axis === "x" ) || + this._isOverAxis( + this.positionAbs.top + this.offset.click.top, item.top, item.height ), + isOverElementWidth = ( this.options.axis === "y" ) || + this._isOverAxis( + this.positionAbs.left + this.offset.click.left, item.left, item.width ), + isOverElement = isOverElementHeight && isOverElementWidth; + + if ( !isOverElement ) { + return false; + } + + verticalDirection = this.dragDirection.vertical; + horizontalDirection = this.dragDirection.horizontal; + + return this.floating ? + ( ( horizontalDirection === "right" || verticalDirection === "down" ) ? 2 : 1 ) : + ( verticalDirection && ( verticalDirection === "down" ? 2 : 1 ) ); + + }, + + _intersectsWithSides: function( item ) { + + var isOverBottomHalf = this._isOverAxis( this.positionAbs.top + + this.offset.click.top, item.top + ( item.height / 2 ), item.height ), + isOverRightHalf = this._isOverAxis( this.positionAbs.left + + this.offset.click.left, item.left + ( item.width / 2 ), item.width ), + verticalDirection = this.dragDirection.vertical, + horizontalDirection = this.dragDirection.horizontal; + + if ( this.floating && horizontalDirection ) { + return ( ( horizontalDirection === "right" && isOverRightHalf ) || + ( horizontalDirection === "left" && !isOverRightHalf ) ); + } else { + return verticalDirection && ( ( verticalDirection === "down" && isOverBottomHalf ) || + ( verticalDirection === "up" && !isOverBottomHalf ) ); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta !== 0 && ( delta > 0 ? "down" : "up" ); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta !== 0 && ( delta > 0 ? "right" : "left" ); + }, + + refresh: function( event ) { + this._refreshItems( event ); + this._setHandleClassName(); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor === String ? + [ options.connectWith ] : + options.connectWith; + }, + + _getItemsAsjQuery: function( connected ) { + + var i, j, cur, inst, + items = [], + queries = [], + connectWith = this._connectWith(); + + if ( connectWith && connected ) { + for ( i = connectWith.length - 1; i >= 0; i-- ) { + cur = $( connectWith[ i ], this.document[ 0 ] ); + for ( j = cur.length - 1; j >= 0; j-- ) { + inst = $.data( cur[ j ], this.widgetFullName ); + if ( inst && inst !== this && !inst.options.disabled ) { + queries.push( [ typeof inst.options.items === "function" ? + inst.options.items.call( inst.element ) : + $( inst.options.items, inst.element ) + .not( ".ui-sortable-helper" ) + .not( ".ui-sortable-placeholder" ), inst ] ); + } + } + } + } + + queries.push( [ typeof this.options.items === "function" ? + this.options.items + .call( this.element, null, { options: this.options, item: this.currentItem } ) : + $( this.options.items, this.element ) + .not( ".ui-sortable-helper" ) + .not( ".ui-sortable-placeholder" ), this ] ); + + function addItems() { + items.push( this ); + } + for ( i = queries.length - 1; i >= 0; i-- ) { + queries[ i ][ 0 ].each( addItems ); + } + + return $( items ); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find( ":data(" + this.widgetName + "-item)" ); + + this.items = $.grep( this.items, function( item ) { + for ( var j = 0; j < list.length; j++ ) { + if ( list[ j ] === item.item[ 0 ] ) { + return false; + } + } + return true; + } ); + + }, + + _refreshItems: function( event ) { + + this.items = []; + this.containers = [ this ]; + + var i, j, cur, inst, targetData, _queries, item, queriesLength, + items = this.items, + queries = [ [ typeof this.options.items === "function" ? + this.options.items.call( this.element[ 0 ], event, { item: this.currentItem } ) : + $( this.options.items, this.element ), this ] ], + connectWith = this._connectWith(); + + //Shouldn't be run the first time through due to massive slow-down + if ( connectWith && this.ready ) { + for ( i = connectWith.length - 1; i >= 0; i-- ) { + cur = $( connectWith[ i ], this.document[ 0 ] ); + for ( j = cur.length - 1; j >= 0; j-- ) { + inst = $.data( cur[ j ], this.widgetFullName ); + if ( inst && inst !== this && !inst.options.disabled ) { + queries.push( [ typeof inst.options.items === "function" ? + inst.options.items + .call( inst.element[ 0 ], event, { item: this.currentItem } ) : + $( inst.options.items, inst.element ), inst ] ); + this.containers.push( inst ); + } + } + } + } + + for ( i = queries.length - 1; i >= 0; i-- ) { + targetData = queries[ i ][ 1 ]; + _queries = queries[ i ][ 0 ]; + + for ( j = 0, queriesLength = _queries.length; j < queriesLength; j++ ) { + item = $( _queries[ j ] ); + + // Data for target checking (mouse manager) + item.data( this.widgetName + "-item", targetData ); + + items.push( { + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + } ); + } + } + + }, + + _refreshItemPositions: function( fast ) { + var i, item, t, p; + + for ( i = this.items.length - 1; i >= 0; i-- ) { + item = this.items[ i ]; + + //We ignore calculating positions of all connected containers when we're not over them + if ( this.currentContainer && item.instance !== this.currentContainer && + item.item[ 0 ] !== this.currentItem[ 0 ] ) { + continue; + } + + t = this.options.toleranceElement ? + $( this.options.toleranceElement, item.item ) : + item.item; + + if ( !fast ) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + p = t.offset(); + item.left = p.left; + item.top = p.top; + } + }, + + refreshPositions: function( fast ) { + + // Determine whether items are being displayed horizontally + this.floating = this.items.length ? + this.options.axis === "x" || this._isFloating( this.items[ 0 ].item ) : + false; + + // This has to be redone because due to the item being moved out/into the offsetParent, + // the offsetParent's position will change + if ( this.offsetParent && this.helper ) { + this.offset.parent = this._getParentOffset(); + } + + this._refreshItemPositions( fast ); + + var i, p; + + if ( this.options.custom && this.options.custom.refreshContainers ) { + this.options.custom.refreshContainers.call( this ); + } else { + for ( i = this.containers.length - 1; i >= 0; i-- ) { + p = this.containers[ i ].element.offset(); + this.containers[ i ].containerCache.left = p.left; + this.containers[ i ].containerCache.top = p.top; + this.containers[ i ].containerCache.width = + this.containers[ i ].element.outerWidth(); + this.containers[ i ].containerCache.height = + this.containers[ i ].element.outerHeight(); + } + } + + return this; + }, + + _createPlaceholder: function( that ) { + that = that || this; + var className, nodeName, + o = that.options; + + if ( !o.placeholder || o.placeholder.constructor === String ) { + className = o.placeholder; + nodeName = that.currentItem[ 0 ].nodeName.toLowerCase(); + o.placeholder = { + element: function() { + + var element = $( "<" + nodeName + ">", that.document[ 0 ] ); + + that._addClass( element, "ui-sortable-placeholder", + className || that.currentItem[ 0 ].className ) + ._removeClass( element, "ui-sortable-helper" ); + + if ( nodeName === "tbody" ) { + that._createTrPlaceholder( + that.currentItem.find( "tr" ).eq( 0 ), + $( "", that.document[ 0 ] ).appendTo( element ) + ); + } else if ( nodeName === "tr" ) { + that._createTrPlaceholder( that.currentItem, element ); + } else if ( nodeName === "img" ) { + element.attr( "src", that.currentItem.attr( "src" ) ); + } + + if ( !className ) { + element.css( "visibility", "hidden" ); + } + + return element; + }, + update: function( container, p ) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - + // the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a + // class name is specified + if ( className && !o.forcePlaceholderSize ) { + return; + } + + // If the element doesn't have a actual height or width by itself (without + // styles coming from a stylesheet), it receives the inline height and width + // from the dragged item. Or, if it's a tbody or tr, it's going to have a height + // anyway since we're populating them with s above, but they're unlikely to + // be the correct height on their own if the row heights are dynamic, so we'll + // always assign the height of the dragged item given forcePlaceholderSize + // is true. + if ( !p.height() || ( o.forcePlaceholderSize && + ( nodeName === "tbody" || nodeName === "tr" ) ) ) { + p.height( + that.currentItem.innerHeight() - + parseInt( that.currentItem.css( "paddingTop" ) || 0, 10 ) - + parseInt( that.currentItem.css( "paddingBottom" ) || 0, 10 ) ); + } + if ( !p.width() ) { + p.width( + that.currentItem.innerWidth() - + parseInt( that.currentItem.css( "paddingLeft" ) || 0, 10 ) - + parseInt( that.currentItem.css( "paddingRight" ) || 0, 10 ) ); + } + } + }; + } + + //Create the placeholder + that.placeholder = $( o.placeholder.element.call( that.element, that.currentItem ) ); + + //Append it after the actual current item + that.currentItem.after( that.placeholder ); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update( that, that.placeholder ); + + }, + + _createTrPlaceholder: function( sourceTr, targetTr ) { + var that = this; + + sourceTr.children().each( function() { + $( " ", that.document[ 0 ] ) + .attr( "colspan", $( this ).attr( "colspan" ) || 1 ) + .appendTo( targetTr ); + } ); + }, + + _contactContainers: function( event ) { + var i, j, dist, itemWithLeastDistance, posProperty, sizeProperty, cur, nearBottom, + floating, axis, + innermostContainer = null, + innermostIndex = null; + + // Get innermost container that intersects with item + for ( i = this.containers.length - 1; i >= 0; i-- ) { + + // Never consider a container that's located within the item itself + if ( $.contains( this.currentItem[ 0 ], this.containers[ i ].element[ 0 ] ) ) { + continue; + } + + if ( this._intersectsWith( this.containers[ i ].containerCache ) ) { + + // If we've already found a container and it's more "inner" than this, then continue + if ( innermostContainer && + $.contains( + this.containers[ i ].element[ 0 ], + innermostContainer.element[ 0 ] ) ) { + continue; + } + + innermostContainer = this.containers[ i ]; + innermostIndex = i; + + } else { + + // container doesn't intersect. trigger "out" event if necessary + if ( this.containers[ i ].containerCache.over ) { + this.containers[ i ]._trigger( "out", event, this._uiHash( this ) ); + this.containers[ i ].containerCache.over = 0; + } + } + + } + + // If no intersecting containers found, return + if ( !innermostContainer ) { + return; + } + + // Move the item into the container if it's not there already + if ( this.containers.length === 1 ) { + if ( !this.containers[ innermostIndex ].containerCache.over ) { + this.containers[ innermostIndex ]._trigger( "over", event, this._uiHash( this ) ); + this.containers[ innermostIndex ].containerCache.over = 1; + } + } else { + + // When entering a new container, we will find the item with the least distance and + // append our item near it + dist = 10000; + itemWithLeastDistance = null; + floating = innermostContainer.floating || this._isFloating( this.currentItem ); + posProperty = floating ? "left" : "top"; + sizeProperty = floating ? "width" : "height"; + axis = floating ? "pageX" : "pageY"; + + for ( j = this.items.length - 1; j >= 0; j-- ) { + if ( !$.contains( + this.containers[ innermostIndex ].element[ 0 ], this.items[ j ].item[ 0 ] ) + ) { + continue; + } + if ( this.items[ j ].item[ 0 ] === this.currentItem[ 0 ] ) { + continue; + } + + cur = this.items[ j ].item.offset()[ posProperty ]; + nearBottom = false; + if ( event[ axis ] - cur > this.items[ j ][ sizeProperty ] / 2 ) { + nearBottom = true; + } + + if ( Math.abs( event[ axis ] - cur ) < dist ) { + dist = Math.abs( event[ axis ] - cur ); + itemWithLeastDistance = this.items[ j ]; + this.direction = nearBottom ? "up" : "down"; + } + } + + //Check if dropOnEmpty is enabled + if ( !itemWithLeastDistance && !this.options.dropOnEmpty ) { + return; + } + + if ( this.currentContainer === this.containers[ innermostIndex ] ) { + if ( !this.currentContainer.containerCache.over ) { + this.containers[ innermostIndex ]._trigger( "over", event, this._uiHash() ); + this.currentContainer.containerCache.over = 1; + } + return; + } + + if ( itemWithLeastDistance ) { + this._rearrange( event, itemWithLeastDistance, null, true ); + } else { + this._rearrange( event, null, this.containers[ innermostIndex ].element, true ); + } + this._trigger( "change", event, this._uiHash() ); + this.containers[ innermostIndex ]._trigger( "change", event, this._uiHash( this ) ); + this.currentContainer = this.containers[ innermostIndex ]; + + //Update the placeholder + this.options.placeholder.update( this.currentContainer, this.placeholder ); + + //Update scrollParent + this.scrollParent = this.placeholder.scrollParent(); + + //Update overflowOffset + if ( this.scrollParent[ 0 ] !== this.document[ 0 ] && + this.scrollParent[ 0 ].tagName !== "HTML" ) { + this.overflowOffset = this.scrollParent.offset(); + } + + this.containers[ innermostIndex ]._trigger( "over", event, this._uiHash( this ) ); + this.containers[ innermostIndex ].containerCache.over = 1; + } + + }, + + _createHelper: function( event ) { + + var o = this.options, + helper = typeof o.helper === "function" ? + $( o.helper.apply( this.element[ 0 ], [ event, this.currentItem ] ) ) : + ( o.helper === "clone" ? this.currentItem.clone() : this.currentItem ); + + //Add the helper to the DOM if that didn't happen already + if ( !helper.parents( "body" ).length ) { + this.appendTo[ 0 ].appendChild( helper[ 0 ] ); + } + + if ( helper[ 0 ] === this.currentItem[ 0 ] ) { + this._storedCSS = { + width: this.currentItem[ 0 ].style.width, + height: this.currentItem[ 0 ].style.height, + position: this.currentItem.css( "position" ), + top: this.currentItem.css( "top" ), + left: this.currentItem.css( "left" ) + }; + } + + if ( !helper[ 0 ].style.width || o.forceHelperSize ) { + helper.width( this.currentItem.width() ); + } + if ( !helper[ 0 ].style.height || o.forceHelperSize ) { + helper.height( this.currentItem.height() ); + } + + return helper; + + }, + + _adjustOffsetFromHelper: function( obj ) { + if ( typeof obj === "string" ) { + obj = obj.split( " " ); + } + if ( Array.isArray( obj ) ) { + obj = { left: +obj[ 0 ], top: +obj[ 1 ] || 0 }; + } + if ( "left" in obj ) { + this.offset.click.left = obj.left + this.margins.left; + } + if ( "right" in obj ) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ( "top" in obj ) { + this.offset.click.top = obj.top + this.margins.top; + } + if ( "bottom" in obj ) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the + // following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the + // next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't + // the document, which means that the scroll is included in the initial calculation of the + // offset of the parent, and never recalculated upon drag + if ( this.cssPosition === "absolute" && this.scrollParent[ 0 ] !== this.document[ 0 ] && + $.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + // This needs to be actually done for all browsers, since pageX/pageY includes + // this information. + if ( this.offsetParent[ 0 ] === this.document[ 0 ].body ) { + po = { top: 0, left: 0 }; + } + + return { + top: po.top + ( parseInt( this.offsetParent.css( "borderTopWidth" ), 10 ) || 0 ), + left: po.left + ( parseInt( this.offsetParent.css( "borderLeftWidth" ), 10 ) || 0 ) + }; + + }, + + _getRelativeOffset: function() { + + if ( this.cssPosition === "relative" ) { + var p = this.currentItem.position(); + return { + top: p.top - ( parseInt( this.helper.css( "top" ), 10 ) || 0 ) + + this.scrollParent.scrollTop(), + left: p.left - ( parseInt( this.helper.css( "left" ), 10 ) || 0 ) + + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: ( parseInt( this.currentItem.css( "marginLeft" ), 10 ) || 0 ), + top: ( parseInt( this.currentItem.css( "marginTop" ), 10 ) || 0 ) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var ce, co, over, + o = this.options; + if ( o.containment === "parent" ) { + o.containment = this.helper[ 0 ].parentNode; + } + if ( o.containment === "document" || o.containment === "window" ) { + this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + o.containment === "document" ? + this.document.width() : + this.window.width() - this.helperProportions.width - this.margins.left, + ( o.containment === "document" ? + ( this.document.height() || document.body.parentNode.scrollHeight ) : + this.window.height() || this.document[ 0 ].body.parentNode.scrollHeight + ) - this.helperProportions.height - this.margins.top + ]; + } + + if ( !( /^(document|window|parent)$/ ).test( o.containment ) ) { + ce = $( o.containment )[ 0 ]; + co = $( o.containment ).offset(); + over = ( $( ce ).css( "overflow" ) !== "hidden" ); + + this.containment = [ + co.left + ( parseInt( $( ce ).css( "borderLeftWidth" ), 10 ) || 0 ) + + ( parseInt( $( ce ).css( "paddingLeft" ), 10 ) || 0 ) - this.margins.left, + co.top + ( parseInt( $( ce ).css( "borderTopWidth" ), 10 ) || 0 ) + + ( parseInt( $( ce ).css( "paddingTop" ), 10 ) || 0 ) - this.margins.top, + co.left + ( over ? Math.max( ce.scrollWidth, ce.offsetWidth ) : ce.offsetWidth ) - + ( parseInt( $( ce ).css( "borderLeftWidth" ), 10 ) || 0 ) - + ( parseInt( $( ce ).css( "paddingRight" ), 10 ) || 0 ) - + this.helperProportions.width - this.margins.left, + co.top + ( over ? Math.max( ce.scrollHeight, ce.offsetHeight ) : ce.offsetHeight ) - + ( parseInt( $( ce ).css( "borderTopWidth" ), 10 ) || 0 ) - + ( parseInt( $( ce ).css( "paddingBottom" ), 10 ) || 0 ) - + this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function( d, pos ) { + + if ( !pos ) { + pos = this.position; + } + var mod = d === "absolute" ? 1 : -1, + scroll = this.cssPosition === "absolute" && + !( this.scrollParent[ 0 ] !== this.document[ 0 ] && + $.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) ? + this.offsetParent : + this.scrollParent, + scrollIsRootNode = ( /(html|body)/i ).test( scroll[ 0 ].tagName ); + + return { + top: ( + + // The absolute mouse position + pos.top + + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.top * mod + + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.top * mod - + ( ( this.cssPosition === "fixed" ? + -this.scrollParent.scrollTop() : + ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod ) + ), + left: ( + + // The absolute mouse position + pos.left + + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.left * mod + + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.left * mod - + ( ( this.cssPosition === "fixed" ? + -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : + scroll.scrollLeft() ) * mod ) + ) + }; + + }, + + _generatePosition: function( event ) { + + var top, left, + o = this.options, + pageX = event.pageX, + pageY = event.pageY, + scroll = this.cssPosition === "absolute" && + !( this.scrollParent[ 0 ] !== this.document[ 0 ] && + $.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) ? + this.offsetParent : + this.scrollParent, + scrollIsRootNode = ( /(html|body)/i ).test( scroll[ 0 ].tagName ); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if ( this.cssPosition === "relative" && !( this.scrollParent[ 0 ] !== this.document[ 0 ] && + this.scrollParent[ 0 ] !== this.offsetParent[ 0 ] ) ) { + this.offset.relative = this._getRelativeOffset(); + } + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if ( this.originalPosition ) { //If we are not dragging yet, we won't check for options + + if ( this.containment ) { + if ( event.pageX - this.offset.click.left < this.containment[ 0 ] ) { + pageX = this.containment[ 0 ] + this.offset.click.left; + } + if ( event.pageY - this.offset.click.top < this.containment[ 1 ] ) { + pageY = this.containment[ 1 ] + this.offset.click.top; + } + if ( event.pageX - this.offset.click.left > this.containment[ 2 ] ) { + pageX = this.containment[ 2 ] + this.offset.click.left; + } + if ( event.pageY - this.offset.click.top > this.containment[ 3 ] ) { + pageY = this.containment[ 3 ] + this.offset.click.top; + } + } + + if ( o.grid ) { + top = this.originalPageY + Math.round( ( pageY - this.originalPageY ) / + o.grid[ 1 ] ) * o.grid[ 1 ]; + pageY = this.containment ? + ( ( top - this.offset.click.top >= this.containment[ 1 ] && + top - this.offset.click.top <= this.containment[ 3 ] ) ? + top : + ( ( top - this.offset.click.top >= this.containment[ 1 ] ) ? + top - o.grid[ 1 ] : top + o.grid[ 1 ] ) ) : + top; + + left = this.originalPageX + Math.round( ( pageX - this.originalPageX ) / + o.grid[ 0 ] ) * o.grid[ 0 ]; + pageX = this.containment ? + ( ( left - this.offset.click.left >= this.containment[ 0 ] && + left - this.offset.click.left <= this.containment[ 2 ] ) ? + left : + ( ( left - this.offset.click.left >= this.containment[ 0 ] ) ? + left - o.grid[ 0 ] : left + o.grid[ 0 ] ) ) : + left; + } + + } + + return { + top: ( + + // The absolute mouse position + pageY - + + // Click offset (relative to the element) + this.offset.click.top - + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.top - + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.top + + ( ( this.cssPosition === "fixed" ? + -this.scrollParent.scrollTop() : + ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) ) + ), + left: ( + + // The absolute mouse position + pageX - + + // Click offset (relative to the element) + this.offset.click.left - + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.left - + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.left + + ( ( this.cssPosition === "fixed" ? + -this.scrollParent.scrollLeft() : + scrollIsRootNode ? 0 : scroll.scrollLeft() ) ) + ) + }; + + }, + + _rearrange: function( event, i, a, hardRefresh ) { + + if ( a ) { + a[ 0 ].appendChild( this.placeholder[ 0 ] ); + } else { + i.item[ 0 ].parentNode.insertBefore( this.placeholder[ 0 ], + ( this.direction === "down" ? i.item[ 0 ] : i.item[ 0 ].nextSibling ) ); + } + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, + // if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var counter = this.counter; + + this._delay( function() { + if ( counter === this.counter ) { + + //Precompute after each DOM insertion, NOT on mousemove + this.refreshPositions( !hardRefresh ); + } + } ); + + }, + + _clear: function( event, noPropagation ) { + + this.reverting = false; + + // We delay all events that have to be triggered to after the point where the placeholder + // has been removed and everything else normalized again + var i, + delayedTriggers = []; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets + // reappended (see #4088) + if ( !this._noFinalSort && this.currentItem.parent().length ) { + this.placeholder.before( this.currentItem ); + } + this._noFinalSort = null; + + if ( this.helper[ 0 ] === this.currentItem[ 0 ] ) { + for ( i in this._storedCSS ) { + if ( this._storedCSS[ i ] === "auto" || this._storedCSS[ i ] === "static" ) { + this._storedCSS[ i ] = ""; + } + } + this.currentItem.css( this._storedCSS ); + this._removeClass( this.currentItem, "ui-sortable-helper" ); + } else { + this.currentItem.show(); + } + + if ( this.fromOutside && !noPropagation ) { + delayedTriggers.push( function( event ) { + this._trigger( "receive", event, this._uiHash( this.fromOutside ) ); + } ); + } + if ( ( this.fromOutside || + this.domPosition.prev !== + this.currentItem.prev().not( ".ui-sortable-helper" )[ 0 ] || + this.domPosition.parent !== this.currentItem.parent()[ 0 ] ) && !noPropagation ) { + + // Trigger update callback if the DOM position has changed + delayedTriggers.push( function( event ) { + this._trigger( "update", event, this._uiHash() ); + } ); + } + + // Check if the items Container has Changed and trigger appropriate + // events. + if ( this !== this.currentContainer ) { + if ( !noPropagation ) { + delayedTriggers.push( function( event ) { + this._trigger( "remove", event, this._uiHash() ); + } ); + delayedTriggers.push( ( function( c ) { + return function( event ) { + c._trigger( "receive", event, this._uiHash( this ) ); + }; + } ).call( this, this.currentContainer ) ); + delayedTriggers.push( ( function( c ) { + return function( event ) { + c._trigger( "update", event, this._uiHash( this ) ); + }; + } ).call( this, this.currentContainer ) ); + } + } + + //Post events to containers + function delayEvent( type, instance, container ) { + return function( event ) { + container._trigger( type, event, instance._uiHash( instance ) ); + }; + } + for ( i = this.containers.length - 1; i >= 0; i-- ) { + if ( !noPropagation ) { + delayedTriggers.push( delayEvent( "deactivate", this, this.containers[ i ] ) ); + } + if ( this.containers[ i ].containerCache.over ) { + delayedTriggers.push( delayEvent( "out", this, this.containers[ i ] ) ); + this.containers[ i ].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if ( this._storedStylesheet ) { + this._storedStylesheet.remove(); + this._storedStylesheet = null; + } + if ( this._storedOpacity ) { + this.helper.css( "opacity", this._storedOpacity ); + } + if ( this._storedZIndex ) { + this.helper.css( "zIndex", this._storedZIndex === "auto" ? "" : this._storedZIndex ); + } + + this.dragging = false; + + if ( !noPropagation ) { + this._trigger( "beforeStop", event, this._uiHash() ); + } + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, + // it unbinds ALL events from the original node! + this.placeholder[ 0 ].parentNode.removeChild( this.placeholder[ 0 ] ); + + if ( !this.cancelHelperRemoval ) { + if ( this.helper[ 0 ] !== this.currentItem[ 0 ] ) { + this.helper.remove(); + } + this.helper = null; + } + + if ( !noPropagation ) { + for ( i = 0; i < delayedTriggers.length; i++ ) { + + // Trigger all delayed events + delayedTriggers[ i ].call( this, event ); + } + this._trigger( "stop", event, this._uiHash() ); + } + + this.fromOutside = false; + return !this.cancelHelperRemoval; + + }, + + _trigger: function() { + if ( $.Widget.prototype._trigger.apply( this, arguments ) === false ) { + this.cancel(); + } + }, + + _uiHash: function( _inst ) { + var inst = _inst || this; + return { + helper: inst.helper, + placeholder: inst.placeholder || $( [] ), + position: inst.position, + originalPosition: inst.originalPosition, + offset: inst.positionAbs, + item: inst.currentItem, + sender: _inst ? _inst.element : null + }; + } + +} ); + + +/*! + * jQuery UI Accordion 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: Accordion +//>>group: Widgets +/* eslint-disable max-len */ +//>>description: Displays collapsible content panels for presenting information in a limited amount of space. +/* eslint-enable max-len */ +//>>docs: https://api.jqueryui.com/accordion/ +//>>demos: https://jqueryui.com/accordion/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/accordion.css +//>>css.theme: ../../themes/base/theme.css + + +var widgetsAccordion = $.widget( "ui.accordion", { + version: "1.14.1", + options: { + active: 0, + animate: {}, + classes: { + "ui-accordion-header": "ui-corner-top", + "ui-accordion-header-collapsed": "ui-corner-all", + "ui-accordion-content": "ui-corner-bottom" + }, + collapsible: false, + event: "click", + header: function( elem ) { + return elem + .find( "> li > :first-child" ) + .add( + elem.find( "> :not(li)" ) + + // Support: jQuery <3.5 only + // We could use `.even()` but that's unavailable in older jQuery. + .filter( function( i ) { + return i % 2 === 0; + } ) + ); + }, + heightStyle: "auto", + icons: { + activeHeader: "ui-icon-triangle-1-s", + header: "ui-icon-triangle-1-e" + }, + + // Callbacks + activate: null, + beforeActivate: null + }, + + hideProps: { + borderTopWidth: "hide", + borderBottomWidth: "hide", + paddingTop: "hide", + paddingBottom: "hide", + height: "hide" + }, + + showProps: { + borderTopWidth: "show", + borderBottomWidth: "show", + paddingTop: "show", + paddingBottom: "show", + height: "show" + }, + + _create: function() { + var options = this.options; + + this.prevShow = this.prevHide = $(); + this._addClass( "ui-accordion", "ui-widget ui-helper-reset" ); + this.element.attr( "role", "tablist" ); + + // Don't allow collapsible: false and active: false / null + if ( !options.collapsible && ( options.active === false || options.active == null ) ) { + options.active = 0; + } + + this._processPanels(); + + // handle negative values + if ( options.active < 0 ) { + options.active += this.headers.length; + } + this._refresh(); + }, + + _getCreateEventData: function() { + return { + header: this.active, + panel: !this.active.length ? $() : this.active.next() + }; + }, + + _createIcons: function() { + var icon, children, + icons = this.options.icons; + + if ( icons ) { + icon = $( "" ); + this._addClass( icon, "ui-accordion-header-icon", "ui-icon " + icons.header ); + icon.prependTo( this.headers ); + children = this.active.children( ".ui-accordion-header-icon" ); + this._removeClass( children, icons.header ) + ._addClass( children, null, icons.activeHeader ) + ._addClass( this.headers, "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this._removeClass( this.headers, "ui-accordion-icons" ); + this.headers.children( ".ui-accordion-header-icon" ).remove(); + }, + + _destroy: function() { + var contents; + + // Clean up main element + this.element.removeAttr( "role" ); + + // Clean up headers + this.headers + .removeAttr( "role aria-expanded aria-selected aria-controls tabIndex" ) + .removeUniqueId(); + + this._destroyIcons(); + + // Clean up content panels + contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role aria-hidden aria-labelledby" ) + .removeUniqueId(); + + if ( this.options.heightStyle !== "content" ) { + contents.css( "height", "" ); + } + }, + + _setOption: function( key, value ) { + if ( key === "active" ) { + + // _activate() will handle invalid values and update this.options + this._activate( value ); + return; + } + + if ( key === "event" ) { + if ( this.options.event ) { + this._off( this.headers, this.options.event ); + } + this._setupEvents( value ); + } + + this._super( key, value ); + + // Setting collapsible: false while collapsed; open first panel + if ( key === "collapsible" && !value && this.options.active === false ) { + this._activate( 0 ); + } + + if ( key === "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + }, + + _setOptionDisabled: function( value ) { + this._super( value ); + + this.element.attr( "aria-disabled", value ); + this._toggleClass( null, "ui-state-disabled", !!value ); + }, + + _keydown: function( event ) { + if ( event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._eventHandler( event ); + break; + case keyCode.HOME: + toFocus = this.headers[ 0 ]; + break; + case keyCode.END: + toFocus = this.headers[ length - 1 ]; + break; + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + $( toFocus ).trigger( "focus" ); + event.preventDefault(); + } + }, + + _panelKeyDown: function( event ) { + if ( event.keyCode === $.ui.keyCode.UP && event.ctrlKey ) { + $( event.currentTarget ).prev().trigger( "focus" ); + } + }, + + refresh: function() { + var options = this.options; + this._processPanels(); + + // Was collapsed or no panel + if ( ( options.active === false && options.collapsible === true ) || + !this.headers.length ) { + options.active = false; + this.active = $(); + + // active false only when collapsible is true + } else if ( options.active === false ) { + this._activate( 0 ); + + // was active, but active panel is gone + } else if ( this.active.length && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) { + + // all remaining panel are disabled + if ( this.headers.length === this.headers.find( ".ui-state-disabled" ).length ) { + options.active = false; + this.active = $(); + + // activate previous panel + } else { + this._activate( Math.max( 0, options.active - 1 ) ); + } + + // was active, active panel still exists + } else { + + // make sure active index is correct + options.active = this.headers.index( this.active ); + } + + this._destroyIcons(); + + this._refresh(); + }, + + _processPanels: function() { + var prevHeaders = this.headers, + prevPanels = this.panels; + + if ( typeof this.options.header === "function" ) { + this.headers = this.options.header( this.element ); + } else { + this.headers = this.element.find( this.options.header ); + } + this._addClass( this.headers, "ui-accordion-header ui-accordion-header-collapsed", + "ui-state-default" ); + + this.panels = this.headers.next().filter( ":not(.ui-accordion-content-active)" ).hide(); + this._addClass( this.panels, "ui-accordion-content", "ui-helper-reset ui-widget-content" ); + + // Avoid memory leaks (#10056) + if ( prevPanels ) { + this._off( prevHeaders.not( this.headers ) ); + this._off( prevPanels.not( this.panels ) ); + } + }, + + _refresh: function() { + var maxHeight, + options = this.options, + heightStyle = options.heightStyle, + parent = this.element.parent(); + + this.active = this._findActive( options.active ); + this._addClass( this.active, "ui-accordion-header-active", "ui-state-active" ) + ._removeClass( this.active, "ui-accordion-header-collapsed" ); + this._addClass( this.active.next(), "ui-accordion-content-active" ); + this.active.next().show(); + + this.headers + .attr( "role", "tab" ) + .each( function() { + var header = $( this ), + headerId = header.uniqueId().attr( "id" ), + panel = header.next(), + panelId = panel.uniqueId().attr( "id" ); + header.attr( "aria-controls", panelId ); + panel.attr( "aria-labelledby", headerId ); + } ) + .next() + .attr( "role", "tabpanel" ); + + this.headers + .not( this.active ) + .attr( { + "aria-selected": "false", + "aria-expanded": "false", + tabIndex: -1 + } ) + .next() + .attr( { + "aria-hidden": "true" + } ) + .hide(); + + // Make sure at least one header is in the tab order + if ( !this.active.length ) { + this.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + this.active.attr( { + "aria-selected": "true", + "aria-expanded": "true", + tabIndex: 0 + } ) + .next() + .attr( { + "aria-hidden": "false" + } ); + } + + this._createIcons(); + + this._setupEvents( options.event ); + + if ( heightStyle === "fill" ) { + maxHeight = parent.height(); + this.element.siblings( ":visible" ).each( function() { + var elem = $( this ), + position = elem.css( "position" ); + + if ( position === "absolute" || position === "fixed" ) { + return; + } + maxHeight -= elem.outerHeight( true ); + } ); + + this.headers.each( function() { + maxHeight -= $( this ).outerHeight( true ); + } ); + + this.headers.next() + .each( function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + } ) + .css( "overflow", "auto" ); + } else if ( heightStyle === "auto" ) { + maxHeight = 0; + this.headers.next() + .each( function() { + var isVisible = $( this ).is( ":visible" ); + if ( !isVisible ) { + $( this ).show(); + } + maxHeight = Math.max( maxHeight, $( this ).css( "height", "" ).height() ); + if ( !isVisible ) { + $( this ).hide(); + } + } ) + .height( maxHeight ); + } + }, + + _activate: function( index ) { + var active = this._findActive( index )[ 0 ]; + + // Trying to activate the already active panel + if ( active === this.active[ 0 ] ) { + return; + } + + // Trying to collapse, simulate a click on the currently active header + active = active || this.active[ 0 ]; + + this._eventHandler( { + target: active, + currentTarget: active, + preventDefault: $.noop + } ); + }, + + _findActive: function( selector ) { + return typeof selector === "number" ? this.headers.eq( selector ) : $(); + }, + + _setupEvents: function( event ) { + var events = { + keydown: "_keydown" + }; + if ( event ) { + $.each( event.split( " " ), function( index, eventName ) { + events[ eventName ] = "_eventHandler"; + } ); + } + + this._off( this.headers.add( this.headers.next() ) ); + this._on( this.headers, events ); + this._on( this.headers.next(), { keydown: "_panelKeyDown" } ); + this._hoverable( this.headers ); + this._focusable( this.headers ); + }, + + _eventHandler: function( event ) { + var activeChildren, clickedChildren, + options = this.options, + active = this.active, + clicked = $( event.currentTarget ), + clickedIsActive = clicked[ 0 ] === active[ 0 ], + collapsing = clickedIsActive && options.collapsible, + toShow = collapsing ? $() : clicked.next(), + toHide = active.next(), + eventData = { + oldHeader: active, + oldPanel: toHide, + newHeader: collapsing ? $() : clicked, + newPanel: toShow + }; + + event.preventDefault(); + + if ( + + // click on active header, but not collapsible + ( clickedIsActive && !options.collapsible ) || + + // allow canceling activation + ( this._trigger( "beforeActivate", event, eventData ) === false ) ) { + return; + } + + options.active = collapsing ? false : this.headers.index( clicked ); + + // When the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $() : clicked; + this._toggle( eventData ); + + // Switch classes + // corner classes on the previously active header stay after the animation + this._removeClass( active, "ui-accordion-header-active", "ui-state-active" ); + if ( options.icons ) { + activeChildren = active.children( ".ui-accordion-header-icon" ); + this._removeClass( activeChildren, null, options.icons.activeHeader ) + ._addClass( activeChildren, null, options.icons.header ); + } + + if ( !clickedIsActive ) { + this._removeClass( clicked, "ui-accordion-header-collapsed" ) + ._addClass( clicked, "ui-accordion-header-active", "ui-state-active" ); + if ( options.icons ) { + clickedChildren = clicked.children( ".ui-accordion-header-icon" ); + this._removeClass( clickedChildren, null, options.icons.header ) + ._addClass( clickedChildren, null, options.icons.activeHeader ); + } + + this._addClass( clicked.next(), "ui-accordion-content-active" ); + } + }, + + _toggle: function( data ) { + var toShow = data.newPanel, + toHide = this.prevShow.length ? this.prevShow : data.oldPanel; + + // Handle activating a panel during the animation for another activation + this.prevShow.add( this.prevHide ).stop( true, true ); + this.prevShow = toShow; + this.prevHide = toHide; + + if ( this.options.animate ) { + this._animate( toShow, toHide, data ); + } else { + toHide.hide(); + toShow.show(); + this._toggleComplete( data ); + } + + toHide.attr( { + "aria-hidden": "true" + } ); + toHide.prev().attr( { + "aria-selected": "false", + "aria-expanded": "false" + } ); + + // if we're switching panels, remove the old header from the tab order + // if we're opening from collapsed state, remove the previous header from the tab order + // if we're collapsing, then keep the collapsing header in the tab order + if ( toShow.length && toHide.length ) { + toHide.prev().attr( { + "tabIndex": -1, + "aria-expanded": "false" + } ); + } else if ( toShow.length ) { + this.headers.filter( function() { + return parseInt( $( this ).attr( "tabIndex" ), 10 ) === 0; + } ) + .attr( "tabIndex", -1 ); + } + + toShow + .attr( "aria-hidden", "false" ) + .prev() + .attr( { + "aria-selected": "true", + "aria-expanded": "true", + tabIndex: 0 + } ); + }, + + _animate: function( toShow, toHide, data ) { + var total, easing, duration, + that = this, + adjust = 0, + boxSizing = toShow.css( "box-sizing" ), + down = toShow.length && + ( !toHide.length || ( toShow.index() < toHide.index() ) ), + animate = this.options.animate || {}, + options = down && animate.down || animate, + complete = function() { + that._toggleComplete( data ); + }; + + if ( typeof options === "number" ) { + duration = options; + } + if ( typeof options === "string" ) { + easing = options; + } + + // fall back from options to animation in case of partial down settings + easing = easing || options.easing || animate.easing; + duration = duration || options.duration || animate.duration; + + if ( !toHide.length ) { + return toShow.animate( this.showProps, duration, easing, complete ); + } + if ( !toShow.length ) { + return toHide.animate( this.hideProps, duration, easing, complete ); + } + + total = toShow.show().outerHeight(); + toHide.animate( this.hideProps, { + duration: duration, + easing: easing, + step: function( now, fx ) { + fx.now = Math.round( now ); + } + } ); + toShow + .hide() + .animate( this.showProps, { + duration: duration, + easing: easing, + complete: complete, + step: function( now, fx ) { + fx.now = Math.round( now ); + if ( fx.prop !== "height" ) { + if ( boxSizing === "content-box" ) { + adjust += fx.now; + } + } else if ( that.options.heightStyle !== "content" ) { + fx.now = Math.round( total - toHide.outerHeight() - adjust ); + adjust = 0; + } + } + } ); + }, + + _toggleComplete: function( data ) { + var toHide = data.oldPanel, + prev = toHide.prev(); + + this._removeClass( toHide, "ui-accordion-content-active" ); + this._removeClass( prev, "ui-accordion-header-active" ) + ._addClass( prev, "ui-accordion-header-collapsed" ); + + this._trigger( "activate", null, data ); + } +} ); + + +/*! + * jQuery UI Menu 1.14.1 + * https://jqueryui.com + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license. + * https://jquery.org/license + */ + +//>>label: Menu +//>>group: Widgets +//>>description: Creates nestable menus. +//>>docs: https://api.jqueryui.com/menu/ +//>>demos: https://jqueryui.com/menu/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/menu.css +//>>css.theme: ../../themes/base/theme.css + + +var widgetsMenu = $.widget( "ui.menu", { + version: "1.14.1", + defaultElement: "